| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Cpeb1
|
ENSMUSG00000025586.10 | Cpeb1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Cpeb1 | chr7_81372375_81372746 | 75 | 0.967592 | 0.67 | 2.4e-08 | Click! |
| Cpeb1 | chr7_81454347_81455042 | 19 | 0.946498 | 0.52 | 5.0e-05 | Click! |
| Cpeb1 | chr7_81357081_81357232 | 1161 | 0.438306 | -0.42 | 1.3e-03 | Click! |
| Cpeb1 | chr7_81455424_81455614 | 54 | 0.833386 | 0.29 | 2.9e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr18_23037418_23037876 | 19.37 |
Nol4 |
nucleolar protein 4 |
1009 |
0.7 |
| chr12_45562730_45563119 | 11.96 |
Gm48517 |
predicted gene, 48517 |
10363 |
0.27 |
| chr13_83743743_83743894 | 11.91 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
4955 |
0.14 |
| chr13_83742358_83742568 | 11.22 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
3600 |
0.15 |
| chr3_10685256_10685662 | 9.28 |
Gm37831 |
predicted gene, 37831 |
39143 |
0.17 |
| chr16_77537354_77537608 | 9.06 |
Gm36963 |
predicted gene, 36963 |
2401 |
0.2 |
| chr13_84064676_84065083 | 8.61 |
Gm17750 |
predicted gene, 17750 |
107 |
0.97 |
| chr5_7655324_7655475 | 8.30 |
Gm8802 |
predicted gene 8802 |
201709 |
0.02 |
| chr3_34232049_34232222 | 8.29 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
35271 |
0.16 |
| chr14_118230432_118230634 | 8.04 |
Gm4675 |
predicted gene 4675 |
5699 |
0.14 |
| chr2_141954926_141955125 | 8.01 |
Fau-ps1 |
Finkel-Biskis-Reilly murine sarcoma virus (FBR-MuSV) ubiquitously expressed (fox derived), pseudogene 1 |
116236 |
0.07 |
| chr15_53145899_53146294 | 7.76 |
Ext1 |
exostosin glycosyltransferase 1 |
38228 |
0.23 |
| chr8_71727942_71728505 | 7.70 |
Fcho1 |
FCH domain only 1 |
2507 |
0.15 |
| chr1_96346717_96347057 | 7.64 |
Gm37076 |
predicted gene, 37076 |
33645 |
0.18 |
| chr7_79535266_79535447 | 7.63 |
Gm35040 |
predicted gene, 35040 |
687 |
0.49 |
| chr9_10269473_10269801 | 7.58 |
Gm24496 |
predicted gene, 24496 |
20950 |
0.22 |
| chr3_34411859_34412208 | 7.55 |
Gm34599 |
predicted gene, 34599 |
4462 |
0.22 |
| chr2_48539427_48539578 | 7.48 |
Gm13481 |
predicted gene 13481 |
82257 |
0.1 |
| chr3_134629851_134630075 | 7.23 |
Gm26820 |
predicted gene, 26820 |
802 |
0.76 |
| chr12_70108160_70108442 | 7.14 |
Nin |
ninein |
3270 |
0.2 |
| chr13_83749525_83749738 | 6.97 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
10768 |
0.12 |
| chr3_156559909_156560264 | 6.94 |
4930570G19Rik |
RIKEN cDNA 4930570G19 gene |
1496 |
0.36 |
| chr3_16431647_16431999 | 6.91 |
Ythdf3 |
YTH N6-methyladenosine RNA binding protein 3 |
248587 |
0.02 |
| chr15_66240081_66240411 | 6.87 |
Kcnq3 |
potassium voltage-gated channel, subfamily Q, member 3 |
45805 |
0.14 |
| chr7_61939801_61940302 | 6.73 |
Mir344-2 |
microRNA 344-2 |
55 |
0.95 |
| chr16_24509582_24509735 | 6.69 |
Morf4l1-ps1 |
mortality factor 4 like 1, pseudogene 1 |
19736 |
0.22 |
| chrX_110811168_110811444 | 6.69 |
Gm44593 |
predicted gene 44593 |
1018 |
0.58 |
| chr2_106716251_106716402 | 6.65 |
Mpped2 |
metallophosphoesterase domain containing 2 |
14164 |
0.23 |
| chr11_66694776_66694950 | 6.64 |
Gm12297 |
predicted gene 12297 |
131256 |
0.05 |
| chr4_82690701_82691000 | 6.60 |
Gm11269 |
predicted gene 11269 |
1955 |
0.35 |
| chr5_9910569_9910720 | 6.57 |
Gm42832 |
predicted gene 42832 |
58030 |
0.14 |
| chr4_23602035_23602253 | 6.54 |
Gm25978 |
predicted gene, 25978 |
24601 |
0.22 |
| chr2_71517791_71517985 | 6.53 |
Metap1d |
methionyl aminopeptidase type 1D (mitochondrial) |
2476 |
0.2 |
| chr19_36534720_36535517 | 6.50 |
Hectd2 |
HECT domain E3 ubiquitin protein ligase 2 |
19521 |
0.2 |
| chr9_16014090_16014288 | 6.46 |
Fat3 |
FAT atypical cadherin 3 |
7439 |
0.3 |
| chr4_12263404_12263560 | 6.42 |
Gm11846 |
predicted gene 11846 |
7917 |
0.21 |
| chr3_17790108_17790687 | 6.39 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
440 |
0.82 |
| chr13_84758337_84758535 | 6.37 |
Gm26913 |
predicted gene, 26913 |
67495 |
0.14 |
| chrX_152198430_152198581 | 6.34 |
Iqsec2 |
IQ motif and Sec7 domain 2 |
19541 |
0.17 |
| chr8_29544323_29544526 | 6.34 |
Nudc-ps1 |
nuclear distribution gene C homolog (Aspergillus), pseudogene 1 |
257443 |
0.02 |
| chr4_32432624_32432775 | 6.32 |
Bach2 |
BTB and CNC homology, basic leucine zipper transcription factor 2 |
15264 |
0.25 |
| chr13_85068402_85068695 | 6.25 |
Gm47745 |
predicted gene, 47745 |
25787 |
0.17 |
| chr3_62458622_62458788 | 6.22 |
Dhx36 |
DEAH (Asp-Glu-Ala-His) box polypeptide 36 |
13882 |
0.24 |
| chr2_22029338_22029851 | 6.04 |
Gm13337 |
predicted gene 13337 |
38232 |
0.22 |
| chr11_107777459_107777610 | 6.04 |
Gm11650 |
predicted gene 11650 |
16332 |
0.16 |
| chr13_51778976_51779261 | 6.02 |
Sema4d |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4D |
2007 |
0.34 |
| chr12_7028540_7028691 | 5.98 |
Gm46311 |
predicted gene, 46311 |
61655 |
0.16 |
| chr11_24286671_24286960 | 5.96 |
Gm12065 |
predicted gene 12065 |
84191 |
0.08 |
| chr11_80623402_80623553 | 5.95 |
C030013C21Rik |
RIKEN cDNA C030013C21 gene |
114371 |
0.05 |
| chr15_18819029_18819205 | 5.94 |
Cdh10 |
cadherin 10 |
140 |
0.75 |
| chr5_70842284_70842796 | 5.89 |
Gabrg1 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 1 |
77 |
0.99 |
| chr17_65742516_65742902 | 5.89 |
Rab31 |
RAB31, member RAS oncogene family |
29931 |
0.15 |
| chr6_8956269_8957017 | 5.88 |
Nxph1 |
neurexophilin 1 |
6967 |
0.32 |
| chr7_49922872_49923348 | 5.88 |
Slc6a5 |
solute carrier family 6 (neurotransmitter transporter, glycine), member 5 |
11410 |
0.25 |
| chr12_72235750_72235907 | 5.84 |
Rtn1 |
reticulon 1 |
89 |
0.98 |
| chr8_20261423_20261959 | 5.83 |
6820431F20Rik |
RIKEN cDNA 6820431F20 gene |
21575 |
0.21 |
| chr19_18889230_18889551 | 5.79 |
Trpm6 |
transient receptor potential cation channel, subfamily M, member 6 |
48753 |
0.16 |
| chr6_144251849_144252061 | 5.76 |
Sox5 |
SRY (sex determining region Y)-box 5 |
42387 |
0.21 |
| chr2_114872337_114872488 | 5.76 |
Gm13974 |
predicted gene 13974 |
18319 |
0.24 |
| chr10_100127919_100128115 | 5.72 |
Gm22918 |
predicted gene, 22918 |
11484 |
0.14 |
| chr16_56057278_56057429 | 5.70 |
Senp7 |
SUMO1/sentrin specific peptidase 7 |
9015 |
0.11 |
| chr4_116016940_116018214 | 5.69 |
Faah |
fatty acid amide hydrolase |
98 |
0.95 |
| chr10_25023823_25024169 | 5.69 |
Gm47715 |
predicted gene, 47715 |
23976 |
0.15 |
| chr2_62808909_62809197 | 5.67 |
Gm13569 |
predicted gene 13569 |
134 |
0.97 |
| chr5_92698263_92699271 | 5.66 |
Shroom3 |
shroom family member 3 |
15142 |
0.16 |
| chr14_79851831_79851982 | 5.64 |
Gm6999 |
predicted gene 6999 |
15194 |
0.16 |
| chr18_31317015_31317210 | 5.63 |
Rit2 |
Ras-like without CAAX 2 |
1 |
0.98 |
| chr8_31895464_31895660 | 5.61 |
Nrg1 |
neuregulin 1 |
8976 |
0.25 |
| chr4_97377971_97378179 | 5.59 |
Gm12696 |
predicted gene 12696 |
144257 |
0.05 |
| chr2_114805556_114805724 | 5.52 |
Gm13974 |
predicted gene 13974 |
48453 |
0.16 |
| chr14_59737148_59737645 | 5.50 |
Gm19716 |
predicted gene, 19716 |
94848 |
0.07 |
| chr13_58971668_58972019 | 5.47 |
Ntrk2 |
neurotrophic tyrosine kinase, receptor, type 2 |
100108 |
0.06 |
| chr1_12577055_12577225 | 5.45 |
Gm2383 |
predicted gene 2383 |
11563 |
0.24 |
| chr5_3941325_3941616 | 5.43 |
Akap9 |
A kinase (PRKA) anchor protein (yotiao) 9 |
9820 |
0.18 |
| chr4_23173209_23173360 | 5.43 |
Gm11884 |
predicted gene 11884 |
87500 |
0.1 |
| chr11_118792990_118793180 | 5.42 |
Gm11750 |
predicted gene 11750 |
1713 |
0.38 |
| chr2_162413526_162413677 | 5.42 |
Ptprtos |
protein tyrosine phosphatase, receptor type T, opposite strand |
22788 |
0.27 |
| chr6_73645490_73645641 | 5.42 |
Gm31747 |
predicted gene, 31747 |
36892 |
0.2 |
| chr1_25229305_25229684 | 5.41 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
394 |
0.81 |
| chr3_17797861_17798083 | 5.41 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
2228 |
0.25 |
| chr10_89257304_89257504 | 5.41 |
Ano4 |
anoctamin 4 |
104 |
0.98 |
| chr5_111595440_111595747 | 5.35 |
Gm42489 |
predicted gene 42489 |
1977 |
0.36 |
| chr7_31127074_31128340 | 5.34 |
Scn1b |
sodium channel, voltage-gated, type I, beta |
704 |
0.47 |
| chr5_16024676_16024946 | 5.31 |
Cacna2d1 |
calcium channel, voltage-dependent, alpha2/delta subunit 1 |
903 |
0.62 |
| chr1_56345109_56345287 | 5.31 |
Gm28900 |
predicted gene 28900 |
106209 |
0.08 |
| chr5_20227973_20228279 | 5.31 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
60 |
0.98 |
| chr8_109352648_109352876 | 5.27 |
Gm1943 |
predicted gene 1943 |
11898 |
0.24 |
| chr9_91386867_91387031 | 5.26 |
Zic4 |
zinc finger protein of the cerebellum 4 |
4539 |
0.14 |
| chr16_77235959_77236165 | 5.26 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
255 |
0.94 |
| chr4_97281231_97281423 | 5.25 |
Gm12696 |
predicted gene 12696 |
241005 |
0.02 |
| chr1_42691558_42691883 | 5.24 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
1373 |
0.31 |
| chr18_15391349_15391512 | 5.24 |
Aqp4 |
aquaporin 4 |
8572 |
0.2 |
| chr5_99273822_99274019 | 5.22 |
Gm35394 |
predicted gene, 35394 |
175 |
0.96 |
| chr8_7946302_7946523 | 5.22 |
Gm45160 |
predicted gene 45160 |
38956 |
0.19 |
| chr9_41377483_41377907 | 5.22 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
1134 |
0.48 |
| chr5_71095239_71095609 | 5.20 |
Gabra2 |
gamma-aminobutyric acid (GABA) A receptor, subunit alpha 2 |
224 |
0.97 |
| chr5_133365953_133366104 | 5.20 |
Gm42625 |
predicted gene 42625 |
77314 |
0.11 |
| chr15_102789205_102789501 | 5.19 |
Gm49473 |
predicted gene, 49473 |
6018 |
0.16 |
| chr1_129208294_129208780 | 5.18 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
64765 |
0.13 |
| chr4_32326160_32326311 | 5.14 |
Bach2it1 |
BTB and CNC homology 2, intronic transcript 1 |
74474 |
0.1 |
| chr3_67557401_67557820 | 5.14 |
Gm35299 |
predicted gene, 35299 |
4185 |
0.15 |
| chr2_136713076_136713349 | 5.09 |
Snap25 |
synaptosomal-associated protein 25 |
241 |
0.93 |
| chr12_53623939_53624105 | 5.08 |
1700030L22Rik |
RIKEN cDNA 1700030L22 gene |
314176 |
0.01 |
| chr9_40346679_40346871 | 5.04 |
Gramd1b |
GRAM domain containing 1B |
485 |
0.69 |
| chr4_12088754_12089077 | 5.04 |
Rbm12b2 |
RNA binding motif protein 12 B2 |
524 |
0.56 |
| chr3_48846282_48846527 | 5.01 |
Gm37190 |
predicted gene, 37190 |
85455 |
0.1 |
| chr18_55190877_55191196 | 5.00 |
Gm22597 |
predicted gene, 22597 |
11196 |
0.23 |
| chr4_22095654_22096002 | 5.00 |
Gm11880 |
predicted gene 11880 |
21704 |
0.23 |
| chr3_5755164_5755385 | 4.97 |
Gm8797 |
predicted pseudogene 8797 |
4468 |
0.32 |
| chr13_107246926_107247235 | 4.96 |
Gm2726 |
predicted gene 2726 |
33111 |
0.2 |
| chr5_43672866_43673108 | 4.93 |
Cc2d2a |
coiled-coil and C2 domain containing 2A |
698 |
0.67 |
| chr11_41532088_41532404 | 4.92 |
Hspd1-ps3 |
heat shock protein 1 (chaperonin), pseudogene 3 |
33509 |
0.2 |
| chr6_15789581_15789781 | 4.91 |
Gm43924 |
predicted gene, 43924 |
21642 |
0.21 |
| chr7_88261931_88262082 | 4.91 |
Ctsc |
cathepsin C |
16079 |
0.22 |
| chr3_17616549_17616970 | 4.89 |
Gm38154 |
predicted gene, 38154 |
53929 |
0.16 |
| chr13_34096148_34096452 | 4.89 |
Gm47065 |
predicted gene, 47065 |
7273 |
0.1 |
| chr15_88408673_88408889 | 4.88 |
4930445N06Rik |
RIKEN cDNA 4930445N06 gene |
93149 |
0.08 |
| chr6_36858333_36858503 | 4.87 |
Ptn |
pleiotrophin |
48198 |
0.16 |
| chr5_20068672_20068823 | 4.87 |
Gm23570 |
predicted gene, 23570 |
23868 |
0.22 |
| chr19_20923632_20923852 | 4.86 |
Gm32750 |
predicted gene, 32750 |
1350 |
0.52 |
| chr10_94906172_94906405 | 4.84 |
Plxnc1 |
plexin C1 |
16369 |
0.18 |
| chr1_38849080_38849231 | 4.84 |
Lonrf2 |
LON peptidase N-terminal domain and ring finger 2 |
12444 |
0.16 |
| chr6_140946687_140946847 | 4.84 |
Gm30524 |
predicted gene, 30524 |
8842 |
0.26 |
| chr13_83884765_83885152 | 4.83 |
2810049E08Rik |
RIKEN cDNA 2810049E08 gene |
6250 |
0.23 |
| chr13_83739197_83739995 | 4.82 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
733 |
0.33 |
| chr12_46635053_46635249 | 4.80 |
Gm48535 |
predicted gene, 48535 |
30558 |
0.15 |
| chr15_74162477_74162748 | 4.80 |
Gm15387 |
predicted gene 15387 |
68279 |
0.11 |
| chr13_15714658_15715471 | 4.79 |
Gm48408 |
predicted gene, 48408 |
55056 |
0.11 |
| chr9_41918609_41918944 | 4.79 |
Gm40513 |
predicted gene, 40513 |
28172 |
0.14 |
| chr6_18446901_18447365 | 4.78 |
Gm26233 |
predicted gene, 26233 |
2207 |
0.27 |
| chr6_81661085_81661448 | 4.78 |
Gm26264 |
predicted gene, 26264 |
22955 |
0.21 |
| chr3_29541386_29541537 | 4.76 |
Egfem1 |
EGF-like and EMI domain containing 1 |
27555 |
0.23 |
| chr4_25409420_25409571 | 4.74 |
Gm11894 |
predicted gene 11894 |
9854 |
0.22 |
| chr4_88372716_88372867 | 4.74 |
Focad |
focadhesin |
27424 |
0.17 |
| chr12_14927661_14927858 | 4.74 |
Gm9202 |
predicted gene 9202 |
2348 |
0.36 |
| chr11_19555052_19555235 | 4.73 |
Gm12027 |
predicted gene 12027 |
72918 |
0.11 |
| chr12_117172470_117172817 | 4.72 |
Gm10421 |
predicted gene 10421 |
20992 |
0.25 |
| chr6_75602565_75602923 | 4.72 |
4933439N06Rik |
RIKEN cDNA 4933439N06 gene |
29286 |
0.25 |
| chr10_65125058_65125244 | 4.72 |
Gm28881 |
predicted gene 28881 |
4784 |
0.37 |
| chr2_7530815_7530966 | 4.71 |
Gm28641 |
predicted gene 28641 |
951 |
0.65 |
| chr12_65382458_65382659 | 4.71 |
Gm26015 |
predicted gene, 26015 |
23412 |
0.22 |
| chr13_69260577_69260855 | 4.70 |
Gm4812 |
predicted gene 4812 |
84939 |
0.08 |
| chr9_91387807_91387958 | 4.69 |
Zic4 |
zinc finger protein of the cerebellum 4 |
5472 |
0.13 |
| chr13_84059070_84059621 | 4.67 |
Gm17750 |
predicted gene, 17750 |
5427 |
0.24 |
| chr5_150906717_150907027 | 4.67 |
Gm43298 |
predicted gene 43298 |
24230 |
0.17 |
| chr13_83727942_83728228 | 4.67 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
21 |
0.96 |
| chr10_87489292_87489542 | 4.66 |
Ascl1 |
achaete-scute family bHLH transcription factor 1 |
4243 |
0.23 |
| chr11_117462616_117462767 | 4.66 |
Gm34418 |
predicted gene, 34418 |
19906 |
0.13 |
| chr5_147155422_147155776 | 4.64 |
Gsx1 |
GS homeobox 1 |
33097 |
0.12 |
| chr9_81863521_81864338 | 4.62 |
Mei4 |
meiotic double-stranded break formation protein 4 |
220 |
0.95 |
| chr9_41586209_41586579 | 4.62 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
1375 |
0.27 |
| chr2_79059440_79059602 | 4.62 |
Gm14469 |
predicted gene 14469 |
20787 |
0.2 |
| chr10_20723138_20723443 | 4.62 |
Pde7b |
phosphodiesterase 7B |
1406 |
0.48 |
| chr13_84804703_84804898 | 4.61 |
Gm26913 |
predicted gene, 26913 |
113859 |
0.07 |
| chr7_69579565_69579742 | 4.57 |
Gm44535 |
predicted gene 44535 |
55 |
0.98 |
| chr16_94235829_94236007 | 4.57 |
Gm6363 |
predicted gene 6363 |
7429 |
0.14 |
| chr4_148327377_148327851 | 4.57 |
Gm13206 |
predicted gene 13206 |
20761 |
0.14 |
| chr7_82396135_82396286 | 4.56 |
Adamtsl3 |
ADAMTS-like 3 |
12264 |
0.23 |
| chr3_4796668_4797120 | 4.56 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
664 |
0.77 |
| chr16_63806140_63806298 | 4.54 |
Epha3 |
Eph receptor A3 |
57194 |
0.14 |
| chr13_26656976_26657325 | 4.53 |
Gm47883 |
predicted gene, 47883 |
23543 |
0.23 |
| chr3_34638120_34638287 | 4.53 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
29 |
0.77 |
| chr7_49870383_49870534 | 4.52 |
Slc6a5 |
solute carrier family 6 (neurotransmitter transporter, glycine), member 5 |
39688 |
0.16 |
| chr6_110205910_110206254 | 4.51 |
Gm19039 |
predicted gene, 19039 |
171972 |
0.04 |
| chr11_25704688_25704839 | 4.49 |
Gm23514 |
predicted gene, 23514 |
19623 |
0.26 |
| chr3_14578086_14578447 | 4.49 |
E2f5 |
E2F transcription factor 5 |
375 |
0.81 |
| chr4_123013505_123013880 | 4.48 |
Trit1 |
tRNA isopentenyltransferase 1 |
2905 |
0.2 |
| chr8_55104196_55104391 | 4.47 |
Gm8734 |
predicted gene 8734 |
22578 |
0.16 |
| chr17_90390617_90390804 | 4.46 |
Nrxn1 |
neurexin I |
41350 |
0.18 |
| chr2_158846450_158846601 | 4.46 |
Dhx35 |
DEAH (Asp-Glu-Ala-His) box polypeptide 35 |
4104 |
0.28 |
| chr4_66523825_66524140 | 4.46 |
Gm25480 |
predicted gene, 25480 |
20079 |
0.27 |
| chr9_37143982_37144618 | 4.46 |
Pknox2 |
Pbx/knotted 1 homeobox 2 |
1360 |
0.32 |
| chr18_14202777_14203149 | 4.46 |
8430422H06Rik |
RIKEN cDNA 8430422H06 gene |
29346 |
0.22 |
| chr16_40907986_40908143 | 4.44 |
Gm26381 |
predicted gene, 26381 |
309681 |
0.01 |
| chr2_124176756_124177153 | 4.44 |
Sema6d |
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6D |
33949 |
0.18 |
| chr16_77787854_77788233 | 4.44 |
Gm17333 |
predicted gene, 17333 |
58561 |
0.11 |
| chr16_12901634_12901795 | 4.43 |
4930414F18Rik |
RIKEN cDNA 4930414F18 gene |
44221 |
0.15 |
| chr7_90886789_90887161 | 4.41 |
Gm45159 |
predicted gene 45159 |
97 |
0.92 |
| chr2_22620546_22620977 | 4.41 |
Gad2 |
glutamic acid decarboxylase 2 |
1444 |
0.31 |
| chr3_5347552_5347820 | 4.40 |
Zfhx4 |
zinc finger homeodomain 4 |
106014 |
0.07 |
| chr15_91050498_91050649 | 4.39 |
Kif21a |
kinesin family member 21A |
625 |
0.74 |
| chr11_65928209_65928360 | 4.38 |
Dnah9 |
dynein, axonemal, heavy chain 9 |
326 |
0.94 |
| chr7_54836612_54836763 | 4.38 |
Luzp2 |
leucine zipper protein 2 |
1072 |
0.57 |
| chr16_49194228_49194379 | 4.37 |
1700026J12Rik |
RIKEN cDNA 1700026J12 gene |
61469 |
0.13 |
| chr18_25538070_25538572 | 4.37 |
Celf4 |
CUGBP, Elav-like family member 4 |
37082 |
0.19 |
| chr5_112225580_112225794 | 4.32 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
2954 |
0.16 |
| chr3_101343856_101344007 | 4.32 |
Gm43467 |
predicted gene 43467 |
33085 |
0.11 |
| chr6_101199323_101199474 | 4.31 |
Pdzrn3 |
PDZ domain containing RING finger 3 |
198 |
0.85 |
| chr8_12486572_12486996 | 4.31 |
4933439N14Rik |
RIKEN cDNA 4933439N14 gene |
16115 |
0.15 |
| chr1_177150558_177150803 | 4.30 |
Gm38146 |
predicted gene, 38146 |
15227 |
0.16 |
| chr12_99011646_99011852 | 4.30 |
Gm47109 |
predicted gene, 47109 |
18740 |
0.16 |
| chr3_128798099_128798250 | 4.29 |
Gm4410 |
predicted gene 4410 |
41662 |
0.19 |
| chr15_43477056_43477333 | 4.29 |
Emc2 |
ER membrane protein complex subunit 2 |
35 |
0.66 |
| chr11_109903301_109903462 | 4.29 |
Gm11697 |
predicted gene 11697 |
32935 |
0.16 |
| chr3_29726662_29726842 | 4.29 |
Gm37557 |
predicted gene, 37557 |
44532 |
0.17 |
| chr14_12346789_12346985 | 4.29 |
Fezf2 |
Fez family zinc finger 2 |
928 |
0.45 |
| chr3_10331737_10331888 | 4.29 |
Impa1 |
inositol (myo)-1(or 4)-monophosphatase 1 |
373 |
0.74 |
| chr7_142387340_142388526 | 4.28 |
Ctsd |
cathepsin D |
76 |
0.94 |
| chr3_57919887_57920056 | 4.27 |
Gm24531 |
predicted gene, 24531 |
2216 |
0.26 |
| chr6_22794880_22795138 | 4.27 |
Gm25942 |
predicted gene, 25942 |
5191 |
0.17 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.2 | 9.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 1.8 | 5.3 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 1.7 | 5.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 1.6 | 6.3 | GO:0007412 | axon target recognition(GO:0007412) |
| 1.4 | 6.8 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 1.3 | 6.3 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 1.1 | 4.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 1.0 | 5.2 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 1.0 | 2.9 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.9 | 2.8 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.9 | 2.7 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.9 | 2.6 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
| 0.8 | 2.5 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.8 | 3.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.8 | 4.0 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.8 | 4.6 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.8 | 16.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.8 | 2.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.7 | 2.9 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.7 | 1.4 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.7 | 2.7 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.7 | 2.7 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.7 | 2.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.6 | 1.3 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.6 | 1.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.6 | 2.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.6 | 1.8 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
| 0.6 | 6.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.6 | 2.4 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.6 | 2.4 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.6 | 1.2 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.6 | 1.8 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.6 | 1.2 | GO:0061055 | myotome development(GO:0061055) |
| 0.6 | 6.4 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.6 | 1.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.6 | 2.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.6 | 2.8 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.6 | 4.5 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.5 | 1.6 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.5 | 1.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.5 | 1.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.5 | 3.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.5 | 2.7 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.5 | 2.7 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.5 | 1.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.5 | 2.6 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.5 | 6.3 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.5 | 1.6 | GO:0030070 | insulin processing(GO:0030070) |
| 0.5 | 2.1 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.5 | 1.5 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.5 | 8.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.5 | 0.5 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
| 0.5 | 1.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.5 | 1.0 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.5 | 1.9 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.5 | 2.9 | GO:0035989 | tendon development(GO:0035989) |
| 0.5 | 1.4 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.5 | 1.4 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.5 | 1.9 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.5 | 1.4 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.5 | 2.8 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.5 | 0.9 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.5 | 4.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.5 | 0.9 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.5 | 1.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.5 | 5.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.4 | 1.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.4 | 1.3 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.4 | 1.8 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.4 | 1.3 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.4 | 2.2 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.4 | 0.4 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.4 | 2.6 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.4 | 1.7 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.4 | 1.3 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.4 | 3.0 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.4 | 2.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.4 | 2.1 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.4 | 1.3 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.4 | 1.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.4 | 6.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.4 | 1.2 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.4 | 0.4 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.4 | 2.8 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.4 | 0.8 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.4 | 1.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.4 | 0.8 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.4 | 1.5 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.4 | 1.9 | GO:0036233 | glycine import(GO:0036233) |
| 0.4 | 0.8 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.4 | 0.8 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.4 | 1.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.4 | 3.0 | GO:0060013 | righting reflex(GO:0060013) |
| 0.4 | 0.4 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.4 | 1.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.4 | 2.1 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.4 | 1.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.4 | 4.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.4 | 1.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.3 | 1.4 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.3 | 1.7 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.3 | 2.7 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.3 | 1.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.3 | 0.3 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.3 | 1.7 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.3 | 1.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.3 | 2.0 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.3 | 0.7 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.3 | 1.3 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.3 | 1.9 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.3 | 1.0 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.3 | 1.3 | GO:0014028 | notochord formation(GO:0014028) |
| 0.3 | 0.3 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.3 | 3.5 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.3 | 1.3 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.3 | 1.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.3 | 0.6 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.3 | 0.9 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.3 | 0.9 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
| 0.3 | 3.0 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.3 | 1.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.3 | 0.9 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.3 | 0.9 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.3 | 6.0 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.3 | 1.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 | 1.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.3 | 1.4 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.3 | 1.4 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.3 | 3.3 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.3 | 0.3 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.3 | 3.6 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.3 | 0.5 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.3 | 0.8 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.3 | 0.5 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.3 | 0.8 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.3 | 1.3 | GO:0021544 | subpallium development(GO:0021544) |
| 0.3 | 1.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.3 | 0.8 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.3 | 0.5 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.3 | 0.8 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.3 | 0.5 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.3 | 3.0 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.3 | 2.0 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.3 | 0.5 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.3 | 4.0 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 | 0.5 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.2 | 3.0 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.2 | 0.7 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 1.7 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.2 | 0.7 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.2 | 0.5 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.2 | 0.2 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.2 | 1.2 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 0.2 | 0.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 | 0.7 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 0.9 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.2 | 0.9 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.2 | 0.5 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.2 | 4.5 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.2 | 0.7 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.2 | 0.7 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.2 | 2.0 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.2 | 1.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.2 | 1.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 | 0.7 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.2 | 1.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.2 | 1.1 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.2 | 0.4 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.2 | 1.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.2 | 1.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.2 | 3.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 2.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.2 | 0.6 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.2 | 1.5 | GO:0072112 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.2 | 0.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 0.6 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.2 | 0.4 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.2 | 3.8 | GO:0048841 | regulation of axon extension involved in axon guidance(GO:0048841) |
| 0.2 | 1.0 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.2 | 0.4 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.2 | 0.8 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.2 | 0.4 | GO:0003011 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
| 0.2 | 1.0 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.2 | 1.0 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.2 | 0.6 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.2 | 0.6 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 | 0.6 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 0.4 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.2 | 3.0 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 | 0.6 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.2 | 0.6 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.2 | 0.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.2 | 3.5 | GO:0003407 | neural retina development(GO:0003407) |
| 0.2 | 0.4 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.2 | 1.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.2 | 0.4 | GO:0043366 | beta selection(GO:0043366) |
| 0.2 | 0.6 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.2 | 0.6 | GO:0046959 | habituation(GO:0046959) |
| 0.2 | 1.0 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.2 | 0.7 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.2 | 1.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.2 | 0.9 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 0.9 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.2 | 0.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.2 | 0.9 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 | 0.7 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.2 | 1.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.2 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.2 | 1.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.2 | 0.7 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.2 | 1.4 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.2 | 0.5 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.2 | 1.4 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.2 | 0.7 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.2 | 0.3 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.2 | 1.4 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.2 | 0.7 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.2 | 0.2 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 0.3 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.2 | 0.3 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.2 | 0.7 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 | 2.0 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.2 | 1.7 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.2 | 0.3 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.2 | 0.5 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.2 | 0.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 0.5 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.2 | 0.3 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.2 | 0.5 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.2 | 0.3 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.2 | 0.5 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.2 | 0.3 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
| 0.2 | 0.8 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.2 | 0.5 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.2 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.2 | 0.3 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.2 | 1.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.2 | 0.5 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.2 | 0.5 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.2 | 0.5 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 0.2 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.2 | 0.3 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.9 | GO:0097066 | response to thyroid hormone(GO:0097066) |
| 0.1 | 0.7 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.6 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.1 | 0.4 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.7 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.1 | 0.6 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.1 | 0.7 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.1 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 | 1.3 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
| 0.1 | 0.4 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 | 2.2 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
| 0.1 | 0.6 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.6 | GO:0022030 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
| 0.1 | 3.2 | GO:0021766 | hippocampus development(GO:0021766) |
| 0.1 | 0.8 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 3.0 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.9 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.1 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.8 | GO:0036005 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.1 | 1.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.1 | 4.2 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 0.1 | 1.1 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.1 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.1 | 0.4 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.1 | 0.3 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.4 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 | 0.3 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.5 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.1 | 0.3 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.1 | 0.4 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.1 | 0.6 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.1 | 0.1 | GO:0072179 | metanephric tubule formation(GO:0072174) nephric duct formation(GO:0072179) |
| 0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.1 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 | 0.4 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.1 | 2.1 | GO:0050771 | negative regulation of axonogenesis(GO:0050771) |
| 0.1 | 0.6 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.1 | 0.1 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.1 | 0.5 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.1 | 9.2 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.1 | 0.1 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.1 | 0.5 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.1 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
| 0.1 | 0.5 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.1 | 0.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 0.5 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.1 | 0.3 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.1 | 0.5 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.1 | 0.5 | GO:2000018 | regulation of male gonad development(GO:2000018) |
| 0.1 | 0.1 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
| 0.1 | 2.3 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.1 | 0.8 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 1.0 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 0.9 | GO:0097286 | iron ion import(GO:0097286) |
| 0.1 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.1 | 0.3 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.3 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.4 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.1 | 0.1 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.1 | 0.2 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.1 | 1.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.3 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.1 | 0.3 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.6 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
| 0.1 | 0.3 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.9 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 | 1.4 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.1 | 0.4 | GO:0060278 | regulation of ovulation(GO:0060278) |
| 0.1 | 0.5 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.1 | 0.6 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.1 | 0.6 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.3 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.1 | 0.3 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.1 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.1 | 1.2 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.1 | 0.3 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 2.2 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.5 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.1 | 0.4 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.1 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 1.3 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.3 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 0.2 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.1 | 0.9 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.4 | GO:0086070 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
| 0.1 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.1 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 | 1.1 | GO:0001964 | startle response(GO:0001964) |
| 0.1 | 0.1 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.6 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 | 0.5 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.1 | 0.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 | 0.9 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 | 0.1 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) |
| 0.1 | 0.3 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.1 | GO:0033084 | immature T cell proliferation in thymus(GO:0033080) regulation of immature T cell proliferation in thymus(GO:0033084) |
| 0.1 | 0.3 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 0.3 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.3 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.2 | GO:0001757 | somite specification(GO:0001757) |
| 0.1 | 0.3 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.1 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.1 | 0.4 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.1 | 0.3 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.5 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.1 | 0.4 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.1 | 0.6 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.1 | 0.2 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
| 0.1 | 0.5 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.1 | 0.4 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.1 | 0.2 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.2 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.1 | 0.2 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 1.6 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.1 | 0.2 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
| 0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.3 | GO:0042977 | activation of JAK2 kinase activity(GO:0042977) |
| 0.1 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.4 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.1 | 0.2 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 0.1 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
| 0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.7 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
| 0.1 | 0.7 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 1.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 0.1 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.1 | 0.1 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
| 0.1 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 0.3 | GO:0036376 | sodium ion export from cell(GO:0036376) |
| 0.1 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 0.7 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 0.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 | 0.3 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.1 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.4 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.1 | 0.5 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 | 0.2 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.1 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.1 | 0.1 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) negative regulation of gastrulation(GO:2000542) |
| 0.1 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.1 | 0.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.3 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.1 | 0.3 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 | 1.0 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.1 | 0.1 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.1 | 0.5 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 | 0.3 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.1 | 1.4 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
| 0.1 | 0.4 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.1 | 0.3 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.1 | 1.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.1 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
| 0.1 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 0.1 | GO:0046881 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.1 | 0.2 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 | 1.1 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.1 | 0.2 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 0.5 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.6 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
| 0.1 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 | 0.3 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.1 | 0.1 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.1 | GO:0060631 | regulation of meiosis I(GO:0060631) |
| 0.1 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.1 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.8 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.1 | 0.4 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.6 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.2 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.1 | 0.3 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 0.2 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.1 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.1 | 0.6 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.1 | 0.2 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.1 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.1 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.1 | 0.9 | GO:0007616 | long-term memory(GO:0007616) |
| 0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.1 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.1 | 0.1 | GO:2000136 | regulation of cell proliferation involved in heart morphogenesis(GO:2000136) |
| 0.1 | 0.2 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.1 | 0.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.4 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 | 0.3 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.1 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.1 | 0.9 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 | 0.1 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.1 | 1.5 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.1 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.2 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
| 0.1 | 0.2 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 1.1 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0051135 | regulation of NK T cell activation(GO:0051133) positive regulation of NK T cell activation(GO:0051135) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 | 0.1 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 | 0.2 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
| 0.0 | 0.1 | GO:0060618 | nipple development(GO:0060618) |
| 0.0 | 1.2 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.0 | 0.1 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.0 | 0.2 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 2.5 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 1.2 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.0 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
| 0.0 | 0.3 | GO:0006929 | substrate-dependent cell migration(GO:0006929) |
| 0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.0 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.0 | 0.6 | GO:0051966 | regulation of synaptic transmission, glutamatergic(GO:0051966) |
| 0.0 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.0 | 0.1 | GO:0090193 | positive regulation of glomerulus development(GO:0090193) |
| 0.0 | 0.9 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.0 | 0.2 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.0 | 0.4 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.0 | GO:0048382 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) mesendoderm development(GO:0048382) |
| 0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.0 | 0.4 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.5 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.0 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 0.0 | 0.1 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.3 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.6 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
| 0.0 | 0.5 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.2 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.8 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.0 | 0.7 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.4 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.1 | GO:0032490 | detection of molecule of bacterial origin(GO:0032490) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.1 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.7 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.0 | 0.4 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.1 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.0 | 1.9 | GO:0007269 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
| 0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
| 0.0 | 0.1 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
| 0.0 | 0.2 | GO:0002591 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
| 0.0 | 0.5 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.0 | 0.1 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.7 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 1.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.8 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.7 | GO:0042058 | regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.7 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
| 0.0 | 0.2 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.0 | GO:0014044 | Schwann cell development(GO:0014044) |
| 0.0 | 0.0 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.6 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 0.1 | GO:0090267 | positive regulation of spindle checkpoint(GO:0090232) positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.0 | 0.2 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.1 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.1 | GO:0036445 | neuronal stem cell division(GO:0036445) neuroblast division(GO:0055057) |
| 0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.0 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.3 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.0 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.2 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.2 | GO:0010829 | negative regulation of glucose transport(GO:0010829) |
| 0.0 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
| 0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.0 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.0 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.7 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.0 | 0.1 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.0 | 0.0 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
| 0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.0 | 0.1 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.2 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.0 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.0 | 0.1 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.0 | GO:0052042 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.0 | 0.0 | GO:0060004 | reflex(GO:0060004) |
| 0.0 | 0.0 | GO:0043084 | penile erection(GO:0043084) |
| 0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.0 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.0 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
| 0.0 | 1.3 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.2 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
| 0.0 | 0.0 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.0 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
| 0.0 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.0 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.1 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.0 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.0 | 0.0 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.2 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.0 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.0 | GO:0046070 | dGTP metabolic process(GO:0046070) |
| 0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.0 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.0 | 0.0 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.0 | GO:0071502 | sensory perception of touch(GO:0050975) cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.1 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.0 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.1 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.0 | 0.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.0 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.0 | 0.0 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.0 | 0.1 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 8.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 1.2 | 4.8 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 1.0 | 2.9 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.9 | 2.7 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.8 | 2.5 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.8 | 2.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.8 | 4.7 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.8 | 2.3 | GO:1990393 | 3M complex(GO:1990393) |
| 0.7 | 4.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.7 | 4.8 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.7 | 3.3 | GO:0071547 | piP-body(GO:0071547) |
| 0.6 | 1.9 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.6 | 7.0 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.6 | 10.7 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.6 | 2.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.6 | 5.7 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.6 | 1.7 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.5 | 4.2 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.5 | 1.8 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.4 | 1.7 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.4 | 1.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.4 | 1.3 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.4 | 4.7 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.4 | 1.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.4 | 1.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.4 | 1.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.3 | 1.0 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.3 | 1.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.3 | 1.0 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.3 | 1.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.3 | 1.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.3 | 2.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.3 | 4.1 | GO:0036038 | MKS complex(GO:0036038) |
| 0.3 | 2.2 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.3 | 1.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.3 | 1.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.3 | 0.3 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.3 | 2.0 | GO:0070187 | telosome(GO:0070187) |
| 0.3 | 2.6 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.3 | 0.8 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.3 | 1.9 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.3 | 0.8 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.3 | 1.9 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.3 | 0.8 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.3 | 0.8 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.3 | 6.5 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.2 | 1.0 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.2 | 7.2 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.2 | 1.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.2 | 2.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.2 | 1.2 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.2 | 2.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.2 | 1.8 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 3.7 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.2 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.2 | 1.6 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 3.1 | GO:0000800 | lateral element(GO:0000800) |
| 0.2 | 1.3 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.2 | 0.7 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.2 | 1.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.2 | 1.0 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.2 | 2.5 | GO:0031045 | dense core granule(GO:0031045) |
| 0.2 | 0.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 2.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.2 | 0.7 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.2 | 1.9 | GO:0060091 | kinocilium(GO:0060091) |
| 0.2 | 0.5 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.2 | 0.5 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.2 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 1.3 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.2 | 0.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.2 | 1.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.2 | 1.3 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.2 | 0.5 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.2 | 2.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.2 | 0.5 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.2 | 0.5 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.2 | 0.6 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 4.1 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.2 | 0.9 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.2 | 1.4 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.2 | 2.9 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.1 | 0.6 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.1 | 1.8 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 4.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 1.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 1.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.7 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 6.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.1 | 1.0 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 2.0 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 0.2 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 1.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.6 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 1.0 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 2.2 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 0.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 0.9 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.4 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.8 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 0.5 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 7.0 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.1 | 2.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.1 | 0.5 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 4.2 | GO:0030426 | growth cone(GO:0030426) |
| 0.1 | 0.8 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 2.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 0.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 12.7 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.1 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 7.5 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.3 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 1.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.1 | 0.5 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 10.2 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.1 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 2.9 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 2.9 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 1.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.8 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.6 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.1 | 0.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 0.7 | GO:0043205 | fibril(GO:0043205) |
| 0.1 | 3.1 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.1 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.5 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.4 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 10.7 | GO:0030424 | axon(GO:0030424) |
| 0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.4 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 1.8 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.2 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 1.4 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.6 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 1.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 1.2 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.6 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.3 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.7 | 8.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 2.0 | 6.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 1.8 | 5.5 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 1.8 | 5.4 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 1.0 | 3.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 1.0 | 2.9 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.9 | 2.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.9 | 4.3 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.8 | 3.3 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.7 | 5.7 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.7 | 2.7 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.6 | 5.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.6 | 3.8 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.6 | 10.6 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.6 | 2.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.6 | 5.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.6 | 1.7 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.6 | 2.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.6 | 2.8 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.6 | 2.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.5 | 1.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.5 | 4.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.5 | 2.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.5 | 2.1 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
| 0.5 | 2.0 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.5 | 2.0 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.5 | 2.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.5 | 4.6 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.5 | 2.7 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.4 | 1.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.4 | 1.6 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.4 | 1.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.4 | 6.6 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.4 | 1.5 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.4 | 0.7 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.4 | 0.7 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.4 | 2.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.4 | 1.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.4 | 6.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.4 | 1.4 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.3 | 1.7 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.3 | 1.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.3 | 1.6 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.3 | 1.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.3 | 6.5 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.3 | 1.0 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.3 | 0.9 | GO:0016917 | GABA receptor activity(GO:0016917) |
| 0.3 | 1.3 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.3 | 2.5 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.3 | 1.9 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.3 | 1.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.3 | 0.9 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.3 | 1.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.3 | 0.9 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.3 | 5.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.3 | 1.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.3 | 2.0 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.3 | 1.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.3 | 0.6 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.3 | 1.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.3 | 1.7 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.3 | 1.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.3 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.3 | 2.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.3 | 0.8 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.3 | 1.8 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.2 | 1.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.2 | 2.2 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.2 | 0.5 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.2 | 3.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.2 | 2.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.2 | 0.9 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 1.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.2 | 1.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.2 | 0.6 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.2 | 1.9 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 0.6 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.2 | 1.0 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 0.6 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.2 | 1.4 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.2 | 1.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.2 | 3.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.2 | 1.5 | GO:0052872 | tocotrienol omega-hydroxylase activity(GO:0052872) |
| 0.2 | 0.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 0.4 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.2 | 0.8 | GO:0009374 | biotin binding(GO:0009374) |
| 0.2 | 4.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.2 | 0.6 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.2 | 0.9 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 0.5 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.2 | 0.5 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.2 | 2.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.2 | 0.5 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.2 | 0.5 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.2 | 0.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 2.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.2 | 0.5 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.2 | 1.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.2 | 0.3 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.2 | 0.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.2 | 1.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.2 | 1.2 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.2 | 1.8 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.2 | 2.1 | GO:0031005 | filamin binding(GO:0031005) |
| 0.2 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 0.5 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.2 | 4.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.2 | 0.6 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.2 | 1.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.5 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.2 | 0.9 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 1.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.3 | GO:0015250 | water channel activity(GO:0015250) |
| 0.1 | 0.6 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.7 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.1 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 4.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 1.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 0.1 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
| 0.1 | 1.6 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 3.9 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 0.7 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 1.1 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.9 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.3 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.8 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 4.5 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.1 | 0.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.7 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.5 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.1 | 0.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.5 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.1 | 1.3 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.5 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 1.3 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.1 | 0.8 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.1 | 0.4 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
| 0.1 | 0.6 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 1.8 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.9 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 2.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.7 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 1.0 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 1.4 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.1 | 4.1 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 0.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 0.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 2.5 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.1 | 2.3 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.1 | 0.8 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.1 | 0.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.7 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.6 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 1.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.1 | 0.6 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.6 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 1.9 | GO:0004118 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 1.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.8 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.4 | GO:0043820 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.1 | 0.9 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.9 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.1 | 0.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.2 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.1 | 0.3 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.1 | 1.0 | GO:0015665 | alcohol transmembrane transporter activity(GO:0015665) |
| 0.1 | 0.8 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.4 | GO:0031420 | alkali metal ion binding(GO:0031420) |
| 0.1 | 0.2 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.1 | 0.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.3 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.1 | 0.7 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.1 | 1.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.6 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.1 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 1.4 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 0.4 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.4 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 1.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.7 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 0.2 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.1 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.6 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
| 0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.1 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.9 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 1.2 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 1.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 0.6 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.0 | 1.3 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.5 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.0 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.9 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.3 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.9 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.0 | 0.2 | GO:0052688 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.8 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.4 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.3 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.2 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.6 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 1.2 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 2.3 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.0 | 0.8 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.9 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.5 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.7 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.2 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.0 | 0.2 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 2.0 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0015172 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
| 0.0 | 0.0 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
| 0.0 | 0.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.4 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 1.2 | GO:0034930 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
| 0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 0.6 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.0 | 0.3 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.2 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.0 | 0.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.2 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.0 | 0.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.8 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.1 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0018586 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.0 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.4 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.0 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.1 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.0 | 0.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.0 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.4 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.0 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 0.7 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.4 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.3 | 1.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.2 | 6.5 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.2 | 7.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.2 | 1.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.2 | 4.1 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.2 | 2.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 2.7 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 3.0 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 7.1 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 6.9 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 0.9 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 4.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.8 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.5 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 4.3 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 2.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 1.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 2.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 1.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 4.5 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 0.3 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 0.8 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.9 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.1 | 0.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 0.4 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 0.4 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 1.5 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 1.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 5.1 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.5 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.3 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 11.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.9 | 10.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.4 | 7.8 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.3 | 4.7 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.3 | 6.8 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.3 | 1.7 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.3 | 4.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.3 | 3.8 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.3 | 2.6 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.3 | 3.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.2 | 5.2 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 2.4 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.2 | 3.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.2 | 1.6 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.2 | 1.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.2 | 2.7 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.2 | 0.2 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.2 | 0.4 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.2 | 1.9 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.2 | 3.7 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.2 | 2.7 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.2 | 0.9 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.2 | 0.9 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.2 | 2.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.2 | 1.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.2 | 1.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 1.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.2 | 8.7 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.2 | 0.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.2 | 1.4 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.2 | 1.9 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.2 | 2.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.2 | 1.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.2 | 1.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 2.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 0.7 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.1 | 0.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 3.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 2.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 2.4 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.1 | 1.3 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.1 | 2.9 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 2.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 1.9 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 5.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 2.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 3.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 0.7 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
| 0.1 | 1.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 0.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 1.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 1.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 3.9 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.1 | 0.5 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.1 | 0.9 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 0.8 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 0.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 0.1 | REACTOME GABA RECEPTOR ACTIVATION | Genes involved in GABA receptor activation |
| 0.1 | 0.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 1.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.3 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 1.3 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.1 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 0.0 | 0.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.2 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.0 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |