| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Creb1
|
ENSMUSG00000025958.8 | Creb1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Creb1 | chr1_64532608_64533440 | 130 | 0.968590 | 0.74 | 1.5e-10 | Click! |
| Creb1 | chr1_64532128_64532528 | 317 | 0.909716 | 0.72 | 7.8e-10 | Click! |
| Creb1 | chr1_64522773_64522924 | 9797 | 0.216278 | -0.35 | 9.5e-03 | Click! |
| Creb1 | chr1_64520053_64520204 | 12517 | 0.209817 | -0.31 | 2.2e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_185362566_185363206 | 15.43 |
4930532G15Rik |
RIKEN cDNA 4930532G15 gene |
21 |
0.66 |
| chr12_4907401_4907932 | 13.80 |
Ubxn2a |
UBX domain protein 2A |
39 |
0.97 |
| chr8_123948814_123949697 | 13.34 |
Nup133 |
nucleoporin 133 |
0 |
0.67 |
| chr3_84814173_84814697 | 11.60 |
Fbxw7 |
F-box and WD-40 domain protein 7 |
833 |
0.72 |
| chr12_33429347_33430190 | 8.22 |
Twistnb |
twist basic helix-loop-helix transcription factor 1 neighbor |
133 |
0.95 |
| chr17_14978672_14979463 | 7.57 |
9030025P20Rik |
RIKEN cDNA 9030025P20 gene |
160 |
0.64 |
| chr17_15010042_15010833 | 7.48 |
Gm3435 |
predicted gene 3435 |
102 |
0.7 |
| chr6_28215268_28215862 | 7.41 |
6530409C15Rik |
RIKEN cDNA 6530409C15 gene |
10 |
0.94 |
| chr17_15041419_15041766 | 7.07 |
Ermard |
ER membrane associated RNA degradation |
23 |
0.38 |
| chr13_46727889_46728218 | 6.90 |
Nup153 |
nucleoporin 153 |
113 |
0.96 |
| chr3_96905206_96905674 | 6.85 |
Gpr89 |
G protein-coupled receptor 89 |
94 |
0.91 |
| chr1_143702764_143703306 | 6.81 |
Cdc73 |
cell division cycle 73, Paf1/RNA polymerase II complex component |
142 |
0.95 |
| chr6_91440817_91441099 | 6.53 |
1810044D09Rik |
RIKEN cDNA 1810044D09 gene |
29 |
0.5 |
| chr9_121709940_121710409 | 6.46 |
Ss18l2 |
SS18, nBAF chromatin remodeling complex subunit like 2 |
155 |
0.91 |
| chr8_40511611_40511902 | 6.39 |
Cnot7 |
CCR4-NOT transcription complex, subunit 7 |
2 |
0.5 |
| chr9_100545364_100546003 | 6.24 |
Nck1 |
non-catalytic region of tyrosine kinase adaptor protein 1 |
48 |
0.97 |
| chr1_180851033_180851465 | 6.07 |
Sde2 |
SDE2 telomere maintenance homolog (S. pombe) |
122 |
0.92 |
| chr8_60983187_60983493 | 6.03 |
Clcn3 |
chloride channel, voltage-sensitive 3 |
40 |
0.56 |
| chr8_40510955_40511528 | 5.98 |
Cnot7 |
CCR4-NOT transcription complex, subunit 7 |
63 |
0.9 |
| chr10_94688556_94688771 | 5.91 |
Cep83 |
centrosomal protein 83 |
7 |
0.56 |
| chr17_71598699_71598910 | 5.76 |
Trmt61b |
tRNA methyltransferase 61B |
49 |
0.95 |
| chr4_103114799_103115198 | 5.71 |
Mier1 |
MEIR1 treanscription regulator |
42 |
0.88 |
| chr7_118532929_118533139 | 5.61 |
Coq7 |
demethyl-Q 7 |
263 |
0.9 |
| chr8_106011390_106011600 | 5.54 |
Dus2 |
dihydrouridine synthase 2 |
12 |
0.84 |
| chr18_31910664_31910837 | 5.40 |
Sft2d3 |
SFT2 domain containing 3 |
1074 |
0.42 |
| chr2_129296702_129297029 | 5.39 |
Ckap2l |
cytoskeleton associated protein 2-like |
347 |
0.56 |
| chr12_17348325_17348718 | 5.37 |
Nol10 |
nucleolar protein 10 |
63 |
0.61 |
| chr12_3235672_3235863 | 5.32 |
Rab10os |
RAB10, member RAS oncogene family, opposite strand |
24 |
0.97 |
| chr5_108312697_108312889 | 5.31 |
Gm43081 |
predicted gene 43081 |
44 |
0.64 |
| chr1_134454955_134455620 | 5.29 |
Gm37935 |
predicted gene, 37935 |
186 |
0.56 |
| chr10_77622145_77622862 | 5.25 |
Ube2g2 |
ubiquitin-conjugating enzyme E2G 2 |
125 |
0.91 |
| chr2_119605771_119605947 | 5.24 |
Oip5os1 |
Opa interacting protein 5, opposite strand 1 |
11556 |
0.1 |
| chr8_72492560_72492758 | 5.24 |
Slc35e1 |
solute carrier family 35, member E1 |
45 |
0.76 |
| chr6_131292968_131293354 | 5.09 |
Magohb |
mago homolog B, exon junction complex core component |
10 |
0.93 |
| chr18_3383150_3383320 | 5.08 |
Cul2 |
cullin 2 |
3 |
0.98 |
| chr7_63938917_63939336 | 5.06 |
Klf13 |
Kruppel-like factor 13 |
211 |
0.91 |
| chr1_43933762_43934020 | 5.04 |
Tpp2 |
tripeptidyl peptidase II |
116 |
0.95 |
| chr12_87471895_87472100 | 5.03 |
Snw1 |
SNW domain containing 1 |
272 |
0.76 |
| chr18_9957690_9958213 | 5.03 |
Thoc1 |
THO complex 1 |
45 |
0.97 |
| chr10_116581671_116582164 | 4.99 |
5330438D12Rik |
RIKEN cDNA 5330438D12 gene |
341 |
0.52 |
| chr1_132382021_132382305 | 4.97 |
Gm15849 |
predicted gene 15849 |
1034 |
0.42 |
| chr2_120731161_120731381 | 4.97 |
Cdan1 |
congenital dyserythropoietic anemia, type I (human) |
219 |
0.93 |
| chr5_48372221_48372411 | 4.88 |
5730480H06Rik |
RIKEN cDNA 5730480H06 gene |
13 |
0.98 |
| chr11_96034780_96035007 | 4.87 |
Snf8 |
SNF8, ESCRT-II complex subunit, homolog (S. cerevisiae) |
8 |
0.94 |
| chr2_144270815_144271049 | 4.85 |
Mgme1 |
mitochondrial genome maintenance exonuclease 1 |
9 |
0.5 |
| chr11_59202374_59202603 | 4.84 |
Mrpl55 |
mitochondrial ribosomal protein L55 |
1 |
0.58 |
| chr12_116280390_116281270 | 4.73 |
Esyt2 |
extended synaptotagmin-like protein 2 |
366 |
0.61 |
| chr17_3557402_3557579 | 4.73 |
Tfb1m |
transcription factor B1, mitochondrial |
244 |
0.59 |
| chr3_101603784_101604527 | 4.71 |
Atp1a1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
529 |
0.76 |
| chr8_94986824_94987051 | 4.66 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
1369 |
0.31 |
| chr3_100685044_100685332 | 4.61 |
Man1a2 |
mannosidase, alpha, class 1A, member 2 |
63 |
0.96 |
| chr7_16313509_16314466 | 4.59 |
Bbc3 |
BCL2 binding component 3 |
470 |
0.71 |
| chr9_122950925_122951118 | 4.56 |
1110059G10Rik |
RIKEN cDNA 1110059G10 gene |
21 |
0.49 |
| chr13_108214137_108214479 | 4.56 |
Elovl7 |
ELOVL family member 7, elongation of long chain fatty acids (yeast) |
96 |
0.96 |
| chr8_70522463_70523590 | 4.55 |
Kxd1 |
KxDL motif containing 1 |
64 |
0.93 |
| chr8_105900179_105900535 | 4.55 |
Pskh1 |
protein serine kinase H1 |
84 |
0.92 |
| chr8_111027361_111027911 | 4.53 |
Ddx19b |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 19b |
128 |
0.92 |
| chr5_139484391_139484788 | 4.51 |
Zfand2a |
zinc finger, AN1-type domain 2A |
40 |
0.97 |
| chr19_10949238_10949429 | 4.51 |
Ccdc86 |
coiled-coil domain containing 86 |
67 |
0.95 |
| chr12_8208024_8208479 | 4.47 |
Ldah |
lipid droplet associated hydrolase |
58 |
0.95 |
| chr17_46645515_46646560 | 4.46 |
Klc4 |
kinesin light chain 4 |
15 |
0.7 |
| chr5_65335315_65336004 | 4.45 |
Rfc1 |
replication factor C (activator 1) 1 |
11 |
0.96 |
| chr5_74531662_74531841 | 4.44 |
Scfd2 |
Sec1 family domain containing 2 |
1 |
0.98 |
| chrX_56597885_56598283 | 4.43 |
Mmgt1 |
membrane magnesium transporter 1 |
15 |
0.97 |
| chr15_81400022_81400232 | 4.43 |
Xpnpep3 |
X-prolyl aminopeptidase 3, mitochondrial |
11 |
0.52 |
| chr8_79711585_79712295 | 4.42 |
Anapc10 |
anaphase promoting complex subunit 10 |
89 |
0.65 |
| chr1_91459004_91459242 | 4.42 |
Per2 |
period circadian clock 2 |
201 |
0.9 |
| chr3_10439292_10440192 | 4.40 |
Snx16 |
sorting nexin 16 |
345 |
0.89 |
| chr2_119288277_119288891 | 4.40 |
Vps18 |
VPS18 CORVET/HOPS core subunit |
156 |
0.91 |
| chr7_55962372_55962565 | 4.37 |
Nipa2 |
non imprinted in Prader-Willi/Angelman syndrome 2 homolog (human) |
0 |
0.53 |
| chr4_141723058_141723709 | 4.36 |
Ddi2 |
DNA-damage inducible protein 2 |
36 |
0.96 |
| chr10_54038943_54039113 | 4.36 |
Gm47917 |
predicted gene, 47917 |
24783 |
0.18 |
| chr5_113735793_113736072 | 4.35 |
Ficd |
FIC domain containing |
129 |
0.93 |
| chr7_132930808_132931261 | 4.33 |
1500002F19Rik |
RIKEN cDNA 1500002F19 gene |
69 |
0.55 |
| chr4_11191450_11191649 | 4.32 |
Ccne2 |
cyclin E2 |
160 |
0.93 |
| chr11_80873165_80873425 | 4.27 |
Spaca3 |
sperm acrosome associated 3 |
14923 |
0.18 |
| chr11_17257464_17257839 | 4.24 |
C1d |
C1D nuclear receptor co-repressor |
37 |
0.98 |
| chr13_38634550_38635412 | 4.21 |
Gm47400 |
predicted gene, 47400 |
10 |
0.55 |
| chr2_119047293_119047608 | 4.20 |
Knl1 |
kinetochore scaffold 1 |
300 |
0.85 |
| chr6_35133372_35133548 | 4.18 |
Cnot4 |
CCR4-NOT transcription complex, subunit 4 |
165 |
0.96 |
| chrX_159532796_159533370 | 4.16 |
Bclaf3 |
Bclaf1 and Thrap3 family member 3 |
364 |
0.88 |
| chr5_107438056_107438634 | 4.16 |
Btbd8 |
BTB (POZ) domain containing 8 |
348 |
0.78 |
| chr16_58670696_58670958 | 4.15 |
Cpox |
coproporphyrinogen oxidase |
499 |
0.71 |
| chr5_24164866_24165071 | 4.13 |
Nupl2 |
nucleoporin like 2 |
5 |
0.97 |
| chr3_158036557_158036745 | 4.10 |
Lrrc40 |
leucine rich repeat containing 40 |
11 |
0.43 |
| chrX_36795488_36795678 | 4.06 |
Slc25a5 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 5 |
68 |
0.96 |
| chr15_65787151_65787615 | 4.05 |
Efr3a |
EFR3 homolog A |
335 |
0.91 |
| chr8_105635968_105636474 | 4.05 |
Ctcf |
CCCTC-binding factor |
347 |
0.62 |
| chr17_25273855_25274122 | 4.00 |
Ube2i |
ubiquitin-conjugating enzyme E2I |
74 |
0.93 |
| chr12_118301013_118301849 | 3.99 |
Sp4 |
trans-acting transcription factor 4 |
9 |
0.99 |
| chrX_13281576_13282101 | 3.96 |
Ddx3x |
DEAD/H (Asp-Glu-Ala-Asp/His) box polypeptide 3, X-linked |
806 |
0.53 |
| chr10_62449616_62449832 | 3.95 |
Supv3l1 |
suppressor of var1, 3-like 1 (S. cerevisiae) |
14 |
0.76 |
| chrX_134307917_134308276 | 3.94 |
Cenpi |
centromere protein I |
12 |
0.97 |
| chr1_37430006_37430228 | 3.93 |
Coa5 |
cytochrome C oxidase assembly factor 5 |
14 |
0.5 |
| chr16_22009170_22009536 | 3.89 |
Senp2 |
SUMO/sentrin specific peptidase 2 |
131 |
0.95 |
| chr3_145118687_145118995 | 3.88 |
Odf2l |
outer dense fiber of sperm tails 2-like |
133 |
0.97 |
| chr19_44135816_44135979 | 3.88 |
Cwf19l1 |
CWF19-like 1, cell cycle control (S. pombe) |
21 |
0.96 |
| chr7_118533277_118533466 | 3.88 |
Coq7 |
demethyl-Q 7 |
15 |
0.97 |
| chr19_55098940_55099840 | 3.86 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
61 |
0.57 |
| chr12_85824837_85825296 | 3.84 |
Ttll5 |
tubulin tyrosine ligase-like family, member 5 |
9 |
0.91 |
| chr13_73603864_73604073 | 3.83 |
Clptm1l |
CLPTM1-like |
38 |
0.97 |
| chr2_120609238_120609778 | 3.82 |
Lrrc57 |
leucine rich repeat containing 57 |
0 |
0.56 |
| chr5_99979050_99979580 | 3.81 |
Gm17092 |
predicted gene 17092 |
254 |
0.61 |
| chr18_10181301_10182002 | 3.77 |
Rock1 |
Rho-associated coiled-coil containing protein kinase 1 |
141 |
0.94 |
| chr4_14826328_14826702 | 3.77 |
Otud6b |
OTU domain containing 6B |
72 |
0.97 |
| chr15_58888458_58889145 | 3.77 |
Rnf139 |
ring finger protein 139 |
428 |
0.48 |
| chr7_35554990_35556314 | 3.75 |
B230322F03Rik |
RIKEN cDNA B230322F03 gene |
285 |
0.62 |
| chr5_108629602_108630383 | 3.74 |
Tmem175 |
transmembrane protein 175 |
10 |
0.75 |
| chr5_22550217_22550558 | 3.74 |
Orc5 |
origin recognition complex, subunit 5 |
12 |
0.51 |
| chr7_110844227_110844605 | 3.74 |
Rnf141 |
ring finger protein 141 |
14 |
0.97 |
| chr10_13868870_13869056 | 3.70 |
Aig1 |
androgen-induced 1 |
6 |
0.96 |
| chr19_29251015_29252343 | 3.69 |
Jak2 |
Janus kinase 2 |
149 |
0.96 |
| chr12_73286641_73287386 | 3.67 |
Slc38a6 |
solute carrier family 38, member 6 |
47 |
0.81 |
| chr11_97280607_97280872 | 3.66 |
Npepps |
aminopeptidase puromycin sensitive |
101 |
0.88 |
| chr11_101315611_101316025 | 3.63 |
Psme3 |
proteaseome (prosome, macropain) activator subunit 3 (PA28 gamma, Ki) |
395 |
0.61 |
| chr7_17056040_17057017 | 3.62 |
Hif3a |
hypoxia inducible factor 3, alpha subunit |
151 |
0.91 |
| chr12_56345658_56346032 | 3.62 |
Mbip |
MAP3K12 binding inhibitory protein 1 |
10 |
0.98 |
| chr3_129878387_129878691 | 3.61 |
Pla2g12a |
phospholipase A2, group XIIA |
67 |
0.96 |
| chr10_120979509_120979778 | 3.61 |
Lemd3 |
LEM domain containing 3 |
311 |
0.85 |
| chr19_4624981_4625748 | 3.58 |
Rce1 |
Ras converting CAAX endopeptidase 1 |
6 |
0.91 |
| chr5_96989015_96989192 | 3.56 |
Gm9484 |
predicted gene 9484 |
8261 |
0.13 |
| chr4_59002756_59003229 | 3.56 |
Dnajc25 |
DnaJ heat shock protein family (Hsp40) member C25 |
180 |
0.54 |
| chr14_8080107_8080416 | 3.55 |
Rpp14 |
ribonuclease P 14 subunit |
106 |
0.97 |
| chr18_67610774_67611094 | 3.52 |
Spire1 |
spire type actin nucleation factor 1 |
144 |
0.95 |
| chr7_123377816_123378116 | 3.52 |
Lcmt1 |
leucine carboxyl methyltransferase 1 |
16 |
0.97 |
| chr14_87415761_87416078 | 3.47 |
Tdrd3 |
tudor domain containing 3 |
720 |
0.67 |
| chr5_3543627_3543901 | 3.46 |
Fam133b |
family with sequence similarity 133, member B |
69 |
0.75 |
| chr18_80933341_80934251 | 3.46 |
Atp9b |
ATPase, class II, type 9B |
187 |
0.93 |
| chr6_72347602_72347888 | 3.44 |
0610030E20Rik |
RIKEN cDNA 0610030E20 gene |
378 |
0.59 |
| chr1_161969333_161969576 | 3.44 |
Pigc |
phosphatidylinositol glycan anchor biosynthesis, class C |
152 |
0.51 |
| chr16_50432298_50432480 | 3.44 |
Bbx |
bobby sox HMG box containing |
0 |
0.99 |
| chr11_93995509_93996192 | 3.44 |
Spag9 |
sperm associated antigen 9 |
241 |
0.91 |
| chr9_100546009_100546352 | 3.44 |
Nck1 |
non-catalytic region of tyrosine kinase adaptor protein 1 |
46 |
0.97 |
| chr8_22653302_22653542 | 3.43 |
Polb |
polymerase (DNA directed), beta |
4 |
0.97 |
| chr14_59597802_59598342 | 3.43 |
Cdadc1 |
cytidine and dCMP deaminase domain containing 1 |
113 |
0.96 |
| chr7_35056532_35056858 | 3.42 |
Cebpg |
CCAAT/enhancer binding protein (C/EBP), gamma |
122 |
0.85 |
| chr5_144100522_144100984 | 3.41 |
Lmtk2 |
lemur tyrosine kinase 2 |
317 |
0.85 |
| chr5_129715279_129715593 | 3.40 |
Mrps17 |
mitochondrial ribosomal protein S17 |
61 |
0.95 |
| chr2_37422261_37422843 | 3.40 |
Rc3h2 |
ring finger and CCCH-type zinc finger domains 2 |
317 |
0.83 |
| chr17_26138894_26139425 | 3.39 |
Axin1 |
axin 1 |
209 |
0.85 |
| chr11_83964030_83964505 | 3.39 |
Synrg |
synergin, gamma |
161 |
0.95 |
| chr10_122096764_122097910 | 3.38 |
Rxylt1 |
ribitol xylosyltransferase 1 |
34 |
0.97 |
| chr16_76372898_76373534 | 3.38 |
Nrip1 |
nuclear receptor interacting protein 1 |
167 |
0.95 |
| chr15_9140259_9140542 | 3.37 |
Skp2 |
S-phase kinase-associated protein 2 (p45) |
35 |
0.65 |
| chr5_106696516_106696984 | 3.36 |
Zfp644 |
zinc finger protein 644 |
55 |
0.67 |
| chr15_10470473_10471119 | 3.34 |
Dnajc21 |
DnaJ heat shock protein family (Hsp40) member C21 |
280 |
0.89 |
| chr13_73603602_73603835 | 3.32 |
Clptm1l |
CLPTM1-like |
288 |
0.9 |
| chr3_153724547_153725057 | 3.32 |
St6galnac3 |
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 3 |
311 |
0.87 |
| chr13_51651355_51651798 | 3.32 |
Secisbp2 |
SECIS binding protein 2 |
121 |
0.95 |
| chr9_64178981_64179377 | 3.31 |
Snapc5 |
small nuclear RNA activating complex, polypeptide 5 |
95 |
0.89 |
| chr6_25809116_25809407 | 3.30 |
Pot1a |
protection of telomeres 1A |
15 |
0.99 |
| chr3_19628406_19629045 | 3.29 |
1700064H15Rik |
RIKEN cDNA 1700064H15 gene |
48 |
0.97 |
| chr11_6476088_6476273 | 3.29 |
Purb |
purine rich element binding protein B |
263 |
0.7 |
| chr8_36249195_36249944 | 3.28 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
53 |
0.98 |
| chr1_150392415_150392953 | 3.28 |
Odr4 |
odr4 GPCR localization factor homolog |
35 |
0.65 |
| chr9_35210939_35211298 | 3.27 |
Srpr |
signal recognition particle receptor ('docking protein') |
37 |
0.51 |
| chr11_52396338_52396521 | 3.24 |
9530068E07Rik |
RIKEN cDNA 9530068E07 gene |
1 |
0.97 |
| chr4_148448704_148449271 | 3.23 |
Mtor |
mechanistic target of rapamycin kinase |
362 |
0.81 |
| chr5_76139953_76140446 | 3.22 |
Srd5a3 |
steroid 5 alpha-reductase 3 |
72 |
0.97 |
| chr2_144556128_144556308 | 3.22 |
Sec23b |
SEC23 homolog B, COPII coat complex component |
11 |
0.96 |
| chr2_60880792_60881813 | 3.22 |
Rbms1 |
RNA binding motif, single stranded interacting protein 1 |
136 |
0.98 |
| chr5_90366495_90366990 | 3.22 |
Gm9958 |
predicted gene 9958 |
122 |
0.56 |
| chr15_36173669_36174199 | 3.21 |
Polr2k |
polymerase (RNA) II (DNA directed) polypeptide K |
76 |
0.94 |
| chr1_87755659_87756078 | 3.21 |
Atg16l1 |
autophagy related 16-like 1 (S. cerevisiae) |
2 |
0.97 |
| chr12_40037886_40038404 | 3.19 |
Arl4aos |
ADP-ribosylation factor-like 4A, opposite strand |
46 |
0.59 |
| chr11_53350270_53350813 | 3.19 |
Aff4 |
AF4/FMR2 family, member 4 |
292 |
0.84 |
| chr16_50431996_50432270 | 3.19 |
Bbx |
bobby sox HMG box containing |
176 |
0.97 |
| chr1_36067771_36068474 | 3.18 |
Hs6st1 |
heparan sulfate 6-O-sulfotransferase 1 |
278 |
0.88 |
| chr11_11684707_11686418 | 3.16 |
Gm11999 |
predicted gene 11999 |
162 |
0.73 |
| chr18_44828099_44828778 | 3.16 |
Ythdc2 |
YTH domain containing 2 |
692 |
0.64 |
| chr18_68299638_68300062 | 3.15 |
Fam210a |
family with sequence similarity 210, member A |
352 |
0.6 |
| chr3_19311256_19311929 | 3.14 |
Pde7a |
phosphodiesterase 7A |
270 |
0.94 |
| chr7_3629780_3630130 | 3.14 |
Tfpt |
TCF3 (E2A) fusion partner |
26 |
0.48 |
| chr6_115601669_115602278 | 3.14 |
Mkrn2 |
makorin, ring finger protein, 2 |
12 |
0.96 |
| chr11_43681649_43682033 | 3.14 |
Pwwp2a |
PWWP domain containing 2A |
157 |
0.95 |
| chr1_58972977_58974247 | 3.13 |
Stradb |
STE20-related kinase adaptor beta |
90 |
0.63 |
| chr11_94987880_94988057 | 3.12 |
Ppp1r9b |
protein phosphatase 1, regulatory subunit 9B |
3067 |
0.14 |
| chr15_85811025_85811500 | 3.12 |
Cdpf1 |
cysteine rich, DPF motif domain containing 1 |
172 |
0.93 |
| chr16_56075244_56076135 | 3.11 |
Senp7 |
SUMO1/sentrin specific peptidase 7 |
209 |
0.9 |
| chr9_80066905_80067169 | 3.11 |
Senp6 |
SUMO/sentrin specific peptidase 6 |
62 |
0.97 |
| chr5_76905127_76905707 | 3.09 |
Aasdh |
aminoadipate-semialdehyde dehydrogenase |
10 |
0.97 |
| chr17_47593260_47593617 | 3.09 |
Ccnd3 |
cyclin D3 |
2 |
0.96 |
| chr2_24934550_24935930 | 3.09 |
Arrdc1 |
arrestin domain containing 1 |
12 |
0.94 |
| chr5_29735522_29736024 | 3.08 |
Dnajb6 |
DnaJ heat shock protein family (Hsp40) member B6 |
85 |
0.61 |
| chr3_88502907_88503431 | 3.08 |
Lmna |
lamin A |
138 |
0.9 |
| chr4_135817367_135817518 | 3.08 |
Myom3 |
myomesin family, member 3 |
16798 |
0.12 |
| chr10_116950277_116950812 | 3.06 |
4933412E12Rik |
RIKEN cDNA 4933412E12 gene |
23 |
0.56 |
| chr4_7580664_7580815 | 3.05 |
8430436N08Rik |
RIKEN cDNA 8430436N08 gene |
20051 |
0.28 |
| chr4_103114576_103114749 | 3.03 |
Mier1 |
MEIR1 treanscription regulator |
100 |
0.5 |
| chr4_86575812_86576188 | 3.03 |
Rraga |
Ras-related GTP binding A |
332 |
0.83 |
| chr12_52503984_52504723 | 3.02 |
Arhgap5 |
Rho GTPase activating protein 5 |
11 |
0.98 |
| chr7_30664735_30665126 | 3.01 |
Haus5 |
HAUS augmin-like complex, subunit 5 |
3 |
0.48 |
| chr9_20652259_20652604 | 3.00 |
Pin1 |
protein (peptidyl-prolyl cis/trans isomerase) NIMA-interacting 1 |
336 |
0.8 |
| chr10_62920506_62920722 | 2.99 |
Slc25a16 |
solute carrier family 25 (mitochondrial carrier, Graves disease autoantigen), member 16 |
19 |
0.95 |
| chr16_13437112_13437498 | 2.99 |
Mir193b |
microRNA 193b |
12218 |
0.13 |
| chr5_20881436_20881842 | 2.98 |
Phtf2 |
putative homeodomain transcription factor 2 |
406 |
0.57 |
| chr4_32615602_32615798 | 2.98 |
Casp8ap2 |
caspase 8 associated protein 2 |
222 |
0.9 |
| chr12_72760597_72761228 | 2.97 |
Ppm1a |
protein phosphatase 1A, magnesium dependent, alpha isoform |
111 |
0.97 |
| chr8_84937343_84937534 | 2.97 |
Mast1 |
microtubule associated serine/threonine kinase 1 |
79 |
0.91 |
| chrX_163908760_163909214 | 2.96 |
Ap1s2 |
adaptor-related protein complex 1, sigma 2 subunit |
30 |
0.98 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.1 | 9.3 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 2.9 | 8.8 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 2.8 | 8.5 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 2.0 | 12.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 1.8 | 7.4 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 1.8 | 18.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 1.8 | 5.4 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 1.7 | 5.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 1.6 | 4.9 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 1.5 | 4.6 | GO:1903416 | response to glycoside(GO:1903416) |
| 1.4 | 4.3 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 1.4 | 4.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 1.3 | 4.0 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 1.3 | 6.5 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 1.3 | 3.8 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 1.3 | 3.8 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 1.2 | 3.7 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 1.2 | 3.6 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 1.2 | 4.7 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 1.1 | 8.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 1.1 | 3.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 1.1 | 2.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 1.1 | 3.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 1.1 | 2.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 1.1 | 9.5 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 1.0 | 3.1 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 1.0 | 3.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 1.0 | 4.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 1.0 | 5.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 1.0 | 3.0 | GO:0045472 | response to ether(GO:0045472) |
| 1.0 | 4.0 | GO:0048478 | replication fork protection(GO:0048478) |
| 1.0 | 3.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 1.0 | 3.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 1.0 | 3.9 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.9 | 2.8 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.9 | 2.8 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.9 | 1.9 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.9 | 2.8 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.9 | 9.3 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.9 | 9.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.9 | 2.8 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.9 | 1.8 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.9 | 3.4 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.9 | 4.3 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.8 | 3.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.8 | 6.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.8 | 4.9 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.8 | 2.4 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.8 | 2.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.8 | 1.6 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.8 | 2.4 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.8 | 6.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.8 | 2.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.8 | 3.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.8 | 2.3 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.8 | 3.8 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.7 | 3.7 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.7 | 3.7 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.7 | 2.2 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.7 | 2.9 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.7 | 2.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.7 | 2.7 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.7 | 1.4 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.7 | 1.3 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.6 | 2.6 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.6 | 1.9 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.6 | 3.9 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.6 | 2.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.6 | 1.9 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.6 | 3.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.6 | 1.8 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
| 0.6 | 4.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.6 | 1.8 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.6 | 1.8 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.6 | 1.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.6 | 4.8 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.6 | 1.8 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.6 | 2.4 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.6 | 0.6 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.6 | 1.8 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.6 | 2.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.6 | 1.8 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.6 | 1.7 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.6 | 1.7 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
| 0.6 | 2.9 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.6 | 2.3 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.6 | 3.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.6 | 7.3 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.6 | 3.9 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.5 | 5.5 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.5 | 1.6 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.5 | 4.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.5 | 2.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.5 | 0.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.5 | 2.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.5 | 2.6 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.5 | 4.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.5 | 2.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.5 | 2.5 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.5 | 2.0 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.5 | 2.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.5 | 3.0 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.5 | 3.0 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.5 | 1.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.5 | 1.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.5 | 1.5 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.5 | 1.5 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.5 | 1.4 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.5 | 1.4 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.5 | 1.9 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 2.4 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.5 | 0.5 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.5 | 0.9 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.5 | 2.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.5 | 1.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.5 | 0.9 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.5 | 1.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.4 | 6.7 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.4 | 2.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.4 | 2.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.4 | 1.8 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.4 | 2.7 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.4 | 1.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.4 | 1.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.4 | 2.2 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.4 | 2.6 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
| 0.4 | 0.9 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.4 | 1.7 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.4 | 7.3 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.4 | 1.7 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.4 | 5.6 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.4 | 2.1 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
| 0.4 | 2.5 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.4 | 1.7 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.4 | 0.8 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.4 | 0.8 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.4 | 1.3 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.4 | 2.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.4 | 1.2 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.4 | 2.9 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.4 | 2.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.4 | 2.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.4 | 2.0 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.4 | 6.8 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.4 | 1.2 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.4 | 6.7 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.4 | 1.6 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.4 | 4.7 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.4 | 1.6 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.4 | 3.9 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.4 | 3.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.4 | 1.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.4 | 1.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.4 | 3.4 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.4 | 3.0 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.4 | 1.5 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.4 | 1.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.4 | 4.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.4 | 4.1 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.4 | 1.9 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.4 | 1.5 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.4 | 2.2 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.4 | 0.4 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.4 | 1.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.4 | 0.7 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.4 | 1.4 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.4 | 1.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.3 | 1.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.3 | 3.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.3 | 2.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.3 | 0.3 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
| 0.3 | 2.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.3 | 1.0 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.3 | 0.7 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.3 | 1.0 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.3 | 1.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.3 | 2.3 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.3 | 1.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.3 | 0.7 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.3 | 0.3 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.3 | 1.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.3 | 1.3 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.3 | 1.6 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.3 | 1.6 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.3 | 2.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 | 0.9 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.3 | 0.9 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.3 | 1.5 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.3 | 4.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.3 | 0.9 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.3 | 3.4 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.3 | 2.4 | GO:1903867 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.3 | 1.5 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.3 | 0.6 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.3 | 0.6 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.3 | 0.9 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.3 | 0.9 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.3 | 8.9 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.3 | 1.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.3 | 1.8 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.3 | 0.9 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.3 | 1.2 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.3 | 0.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.3 | 0.6 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.3 | 1.7 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.3 | 0.3 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
| 0.3 | 0.9 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.3 | 0.9 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.3 | 0.9 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.3 | 0.6 | GO:0090148 | membrane fission(GO:0090148) |
| 0.3 | 2.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.3 | 10.7 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.3 | 1.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.3 | 0.6 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.3 | 3.3 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.3 | 2.5 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.3 | 1.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.3 | 10.2 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.3 | 0.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.3 | 0.3 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.3 | 4.9 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.3 | 0.3 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.3 | 0.8 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.3 | 3.8 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.3 | 1.1 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
| 0.3 | 5.9 | GO:0051452 | intracellular pH reduction(GO:0051452) |
| 0.3 | 1.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.3 | 1.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.3 | 1.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.3 | 2.6 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.3 | 0.3 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.3 | 1.6 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
| 0.3 | 1.8 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
| 0.3 | 0.8 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.3 | 5.1 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.3 | 0.5 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.3 | 0.3 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.3 | 1.8 | GO:0060613 | fat pad development(GO:0060613) |
| 0.3 | 0.5 | GO:2000142 | regulation of DNA-templated transcription, initiation(GO:2000142) |
| 0.3 | 3.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.2 | 0.7 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.2 | 0.7 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.2 | 1.7 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.2 | 1.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.2 | 2.5 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 | 0.7 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.2 | 0.7 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.2 | 0.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.2 | 1.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.2 | 1.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.2 | 1.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.2 | 0.7 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.2 | 1.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.2 | 11.3 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.2 | 1.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.2 | 0.7 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.2 | 0.9 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 0.2 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 | 1.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.2 | 0.9 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.2 | 2.3 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.2 | 2.3 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.2 | 0.9 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
| 0.2 | 1.8 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.2 | 1.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.2 | 1.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.2 | 0.7 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 | 0.7 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.2 | 1.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 1.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.2 | 1.8 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.2 | 0.9 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.2 | 0.4 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.2 | 0.7 | GO:0030242 | pexophagy(GO:0030242) |
| 0.2 | 0.9 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.2 | 1.5 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.2 | 0.4 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 1.3 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.2 | 1.3 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.2 | 0.6 | GO:0015817 | histidine transport(GO:0015817) |
| 0.2 | 0.6 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) G1 DNA damage checkpoint(GO:0044783) |
| 0.2 | 1.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 | 0.4 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 | 0.9 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.2 | 0.4 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.2 | 0.6 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.2 | 0.8 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.2 | 2.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.2 | 2.1 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.2 | 0.8 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.2 | GO:0097460 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) |
| 0.2 | 0.6 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.2 | 1.5 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.2 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.2 | 0.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.2 | 1.6 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.2 | 0.6 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 3.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.2 | 1.2 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.2 | 1.0 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 2.6 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.2 | 8.2 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.2 | 0.8 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.2 | 2.2 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.2 | 12.7 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.2 | 1.0 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 | 1.0 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.2 | 1.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.2 | 0.6 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.2 | 3.4 | GO:0097205 | renal filtration(GO:0097205) |
| 0.2 | 1.0 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.2 | 2.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.2 | 0.8 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.2 | 1.6 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.2 | 1.3 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.2 | 2.5 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.2 | 2.3 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.2 | 6.5 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.2 | 0.4 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
| 0.2 | 0.6 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.2 | 1.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.2 | 1.3 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.2 | 2.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.2 | 1.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.2 | 0.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.2 | 0.9 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 | 3.5 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.2 | 0.6 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.2 | 8.5 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.2 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.2 | 0.4 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.2 | 0.7 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.2 | 0.5 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.2 | 0.7 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 0.4 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.2 | 1.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.2 | 0.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.2 | 3.0 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.2 | 0.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 1.8 | GO:0042026 | protein refolding(GO:0042026) |
| 0.2 | 5.1 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.2 | 0.4 | GO:0030578 | PML body organization(GO:0030578) |
| 0.2 | 0.5 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.2 | 5.8 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.2 | 0.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.2 | 0.3 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.2 | 0.5 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 | 0.3 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.2 | 3.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.2 | 0.3 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.2 | 1.8 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.2 | 1.7 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.2 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.5 | GO:0007619 | courtship behavior(GO:0007619) |
| 0.2 | 0.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 1.9 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.2 | 0.2 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.2 | 0.8 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.2 | 0.5 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.2 | 0.8 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.2 | 0.6 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.2 | 0.6 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.2 | 0.5 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 | 0.5 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.2 | 0.6 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.2 | 0.5 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
| 0.2 | 0.3 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.2 | 3.2 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.2 | 1.2 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.2 | 0.5 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 1.2 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.1 | 0.4 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 0.9 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.1 | 3.9 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.1 | 1.0 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 1.9 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.1 | 1.9 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.1 | 1.3 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 | 0.4 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 2.8 | GO:0070897 | DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.1 | 0.4 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.1 | 0.9 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.1 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.1 | 1.7 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.1 | 0.3 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 1.4 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.1 | 0.6 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 | 2.7 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.4 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.4 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.1 | 0.8 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.1 | 0.7 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.6 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.1 | 1.0 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.1 | 0.7 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.4 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.1 | 2.6 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 0.3 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.3 | GO:1903276 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
| 0.1 | 1.6 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.4 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 0.4 | GO:1900164 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.4 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 | 2.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.1 | 0.9 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.1 | 0.4 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.1 | 0.5 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.1 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 1.4 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.1 | 3.9 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.4 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.8 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
| 0.1 | 0.5 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.4 | GO:0042023 | DNA endoreduplication(GO:0042023) |
| 0.1 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 2.7 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 2.6 | GO:0006998 | nuclear envelope organization(GO:0006998) |
| 0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.1 | 0.5 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.1 | 0.4 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.1 | 0.2 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 1.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 3.9 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.1 | 0.5 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.5 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.4 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.2 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.1 | 0.6 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.1 | 0.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 2.0 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 0.5 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 0.5 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.1 | 0.2 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
| 0.1 | 2.4 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.1 | 0.3 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.2 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 0.2 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
| 0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 1.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 0.8 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
| 0.1 | 0.8 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.1 | 0.6 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.1 | 1.9 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.1 | 3.1 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.1 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.4 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 | 0.4 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 1.9 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.1 | 16.1 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.1 | 0.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 | 0.6 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 0.5 | GO:0036233 | glycine import(GO:0036233) |
| 0.1 | 1.7 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 0.3 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.1 | 0.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 0.8 | GO:0034033 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.1 | 0.4 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.8 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 0.5 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.3 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.1 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.6 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.1 | 0.7 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.1 | 0.7 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 0.5 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.4 | GO:0045851 | pH reduction(GO:0045851) |
| 0.1 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.6 | GO:0043486 | histone exchange(GO:0043486) |
| 0.1 | 0.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.3 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
| 0.1 | 0.4 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.1 | 0.5 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.1 | 0.4 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.1 | 0.3 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.4 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.1 | 0.8 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 1.0 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.1 | 1.8 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.1 | 0.3 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.1 | 0.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.2 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.9 | GO:0048524 | positive regulation of viral process(GO:0048524) |
| 0.1 | 0.5 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.1 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.1 | 0.2 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
| 0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.3 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.2 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.1 | 0.7 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.1 | GO:0060435 | bronchiole development(GO:0060435) |
| 0.1 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 2.4 | GO:0001895 | retina homeostasis(GO:0001895) |
| 0.1 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.2 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.1 | 0.4 | GO:0006734 | NADH metabolic process(GO:0006734) |
| 0.1 | 0.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.2 | GO:1904358 | positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
| 0.1 | 0.6 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.7 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.1 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.1 | 1.5 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.1 | 0.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.1 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.1 | 0.8 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.1 | 0.6 | GO:0001553 | luteinization(GO:0001553) |
| 0.1 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.6 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 0.6 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 2.3 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 | 0.3 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 0.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.1 | 0.4 | GO:0036336 | dendritic cell migration(GO:0036336) |
| 0.1 | 0.3 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 1.5 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.1 | 0.3 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 | 0.5 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.1 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 0.4 | GO:1904353 | regulation of telomere capping(GO:1904353) |
| 0.1 | 0.2 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.5 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.1 | 0.9 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.1 | 1.2 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 0.3 | GO:0051198 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.1 | 0.8 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.1 | 0.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.1 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 | 0.7 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
| 0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 2.1 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.1 | 0.1 | GO:1905063 | regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 | 0.2 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 0.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.1 | 0.5 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
| 0.1 | 0.4 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.1 | 0.6 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.3 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.5 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) |
| 0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.9 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.6 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.2 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.0 | 0.9 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 | 0.4 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.0 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.1 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
| 0.0 | 0.6 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.0 | 0.3 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.0 | 0.3 | GO:0046755 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.3 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.4 | GO:0048520 | positive regulation of behavior(GO:0048520) |
| 0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.0 | 0.6 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.2 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.1 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.4 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.6 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.0 | 0.0 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.9 | GO:0060323 | head morphogenesis(GO:0060323) |
| 0.0 | 0.2 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.8 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.2 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.0 | 1.2 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.3 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.4 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 1.1 | GO:0001541 | ovarian follicle development(GO:0001541) |
| 0.0 | 0.2 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.7 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.4 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.4 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.0 | 0.1 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.0 | 0.2 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.0 | 0.3 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.0 | 0.1 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.3 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.0 | 0.1 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 1.7 | GO:0010950 | positive regulation of endopeptidase activity(GO:0010950) |
| 0.0 | 0.0 | GO:1901142 | insulin metabolic process(GO:1901142) |
| 0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.2 | GO:0032402 | melanosome transport(GO:0032402) |
| 0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.1 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
| 0.0 | 0.3 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.0 | 0.6 | GO:2000278 | regulation of DNA biosynthetic process(GO:2000278) |
| 0.0 | 0.2 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.0 | 0.2 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.4 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.0 | 0.5 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.1 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 | 0.3 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 3.6 | GO:0006281 | DNA repair(GO:0006281) |
| 0.0 | 0.2 | GO:0032366 | intracellular lipid transport(GO:0032365) intracellular sterol transport(GO:0032366) |
| 0.0 | 0.0 | GO:1901028 | regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901028) |
| 0.0 | 0.2 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 3.5 | GO:0060271 | cilium morphogenesis(GO:0060271) |
| 0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.4 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.0 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.1 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.8 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.0 | 0.2 | GO:0034644 | cellular response to UV(GO:0034644) |
| 0.0 | 0.8 | GO:0006260 | DNA replication(GO:0006260) |
| 0.0 | 0.0 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 | 0.2 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.0 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.0 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.1 | GO:1904752 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
| 0.0 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.3 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
| 0.0 | 0.0 | GO:0021938 | ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.0 | 0.2 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.0 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.0 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.0 | GO:0001810 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.4 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.0 | 0.2 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.1 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
| 0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.0 | 0.2 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.1 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:0006278 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.0 | 0.2 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.0 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.1 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.0 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.0 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 | 0.1 | GO:1902686 | positive regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902110) mitochondrial outer membrane permeabilization involved in programmed cell death(GO:1902686) |
| 0.0 | 0.2 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.0 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.0 | 0.0 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.0 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.0 | 0.0 | GO:0090224 | regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.0 | 0.0 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.1 | GO:0097531 | mast cell chemotaxis(GO:0002551) mast cell migration(GO:0097531) |
| 0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.0 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.0 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.0 | 0.0 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.0 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 | 0.3 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.0 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.0 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.0 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.2 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
| 0.0 | 0.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.0 | GO:0044533 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.0 | 0.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.0 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 0.6 | GO:0006626 | protein targeting to mitochondrion(GO:0006626) |
| 0.0 | 0.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.1 | GO:0032006 | regulation of TOR signaling(GO:0032006) |
| 0.0 | 0.0 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
| 0.0 | 0.2 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 7.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 2.0 | 8.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 1.5 | 6.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 1.3 | 5.3 | GO:0097452 | GAIT complex(GO:0097452) |
| 1.3 | 8.8 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 1.2 | 5.0 | GO:0030891 | VCB complex(GO:0030891) |
| 1.2 | 4.7 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 1.1 | 10.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 1.1 | 4.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 1.0 | 6.2 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 1.0 | 3.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 1.0 | 15.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 1.0 | 3.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 1.0 | 3.9 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.9 | 4.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.8 | 2.5 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.8 | 10.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.8 | 5.3 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.7 | 2.9 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.7 | 9.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.7 | 6.9 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.7 | 5.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.7 | 23.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.7 | 7.5 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.7 | 1.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.7 | 3.3 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.6 | 3.9 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.6 | 5.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.6 | 2.5 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.6 | 2.5 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.6 | 4.0 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.6 | 1.7 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.6 | 8.9 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.5 | 2.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.5 | 3.8 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.5 | 3.8 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.5 | 1.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.5 | 2.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.5 | 2.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.5 | 5.0 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.5 | 1.5 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.5 | 5.5 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.5 | 1.5 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.5 | 3.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.5 | 1.4 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.5 | 4.8 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.5 | 3.8 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.5 | 1.9 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.5 | 0.9 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.5 | 2.8 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.5 | 3.3 | GO:0070187 | telosome(GO:0070187) |
| 0.5 | 1.8 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.4 | 3.9 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.4 | 1.7 | GO:0000938 | GARP complex(GO:0000938) |
| 0.4 | 21.3 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.4 | 1.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.4 | 8.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.4 | 3.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.4 | 2.0 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.4 | 2.8 | GO:0032009 | early phagosome(GO:0032009) |
| 0.4 | 1.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.4 | 3.6 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.4 | 1.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.4 | 0.8 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.4 | 1.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.4 | 1.9 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.4 | 2.3 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.4 | 4.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.4 | 3.0 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.4 | 1.9 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.4 | 2.9 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.4 | 4.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.4 | 1.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.4 | 1.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.3 | 2.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 3.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.3 | 1.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.3 | 2.6 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 2.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 7.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.3 | 1.9 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.3 | 0.9 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.3 | 1.2 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.3 | 1.5 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.3 | 6.6 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.3 | 2.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.3 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 4.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.3 | 8.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.3 | 3.0 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.3 | 2.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.3 | 1.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.3 | 0.8 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.3 | 8.9 | GO:0016592 | mediator complex(GO:0016592) |
| 0.3 | 1.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.3 | 2.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.3 | 0.5 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.3 | 1.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.3 | 3.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.3 | 1.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.2 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.2 | 1.5 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.2 | 1.5 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.2 | 0.7 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 1.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.2 | 1.9 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.2 | 2.1 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.2 | 2.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.2 | 0.7 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 1.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.2 | 0.7 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.2 | 2.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.2 | 1.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.2 | 11.3 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.2 | 1.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.2 | 1.7 | GO:0071437 | invadopodium(GO:0071437) |
| 0.2 | 5.8 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.2 | 2.1 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.2 | 13.0 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.2 | 0.6 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 2.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.2 | 4.4 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
| 0.2 | 1.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.2 | 1.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.2 | 3.0 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 1.8 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.2 | 2.0 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.2 | 1.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.2 | 0.6 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.2 | 0.4 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.2 | 0.6 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.2 | 2.3 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.2 | 1.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 0.9 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 2.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.2 | 0.6 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 4.3 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.2 | 8.3 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.2 | 1.7 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 7.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.2 | 0.9 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.2 | 6.9 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.2 | 1.4 | GO:0042581 | specific granule(GO:0042581) |
| 0.2 | 4.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.2 | 0.8 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 7.7 | GO:0016605 | PML body(GO:0016605) |
| 0.2 | 1.2 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.2 | 0.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 1.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 2.8 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.2 | 0.8 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.2 | 8.0 | GO:0000776 | kinetochore(GO:0000776) |
| 0.2 | 8.5 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.2 | 1.8 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.2 | 9.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.2 | 4.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.2 | 0.5 | GO:1990923 | PET complex(GO:1990923) |
| 0.2 | 3.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.2 | 0.9 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.2 | 0.3 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 7.0 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| 0.1 | 0.6 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.1 | 1.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 1.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.7 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.7 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 1.6 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 3.8 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.8 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 6.1 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 6.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 1.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.8 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 9.5 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.1 | 1.2 | GO:0036452 | ESCRT complex(GO:0036452) |
| 0.1 | 0.7 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 3.5 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.4 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.6 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 1.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 0.8 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.1 | 6.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 1.2 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.1 | 1.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 2.9 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 5.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 1.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 1.8 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 4.0 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 1.5 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
| 0.1 | 0.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.3 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 1.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 4.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 1.5 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 1.3 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.1 | 0.3 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 4.1 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 1.1 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.8 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 4.2 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.1 | 0.8 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.1 | 0.3 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.4 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 3.1 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 2.2 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.1 | 8.3 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 1.3 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.5 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 3.9 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 1.0 | GO:1902555 | endoribonuclease complex(GO:1902555) |
| 0.1 | 0.5 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.8 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.1 | 0.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.4 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 0.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 2.1 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 19.4 | GO:0005813 | centrosome(GO:0005813) |
| 0.1 | 0.9 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 1.8 | GO:0098687 | chromosomal region(GO:0098687) |
| 0.1 | 87.0 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.1 | 0.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 3.6 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.1 | 1.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 1.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 5.8 | GO:0044431 | Golgi apparatus part(GO:0044431) |
| 0.1 | 2.6 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.1 | 0.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.1 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.7 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.4 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 1.3 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.2 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.0 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.0 | 0.7 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.0 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 18.9 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.0 | 0.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 4.4 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 14.6 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.0 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.1 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.8 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.0 | 0.0 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.6 | 10.7 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 2.9 | 11.7 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 1.6 | 4.8 | GO:0043398 | HLH domain binding(GO:0043398) |
| 1.6 | 4.8 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 1.6 | 1.6 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 1.6 | 20.4 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 1.4 | 4.3 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 1.4 | 4.3 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 1.2 | 3.7 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 1.2 | 17.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 1.2 | 3.6 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 1.2 | 8.3 | GO:0043731 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 1.2 | 4.6 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 1.0 | 3.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 1.0 | 5.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 1.0 | 3.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.9 | 2.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.9 | 10.7 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.9 | 2.6 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.9 | 5.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.8 | 2.5 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.8 | 9.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.8 | 2.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.8 | 3.9 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.8 | 7.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.8 | 3.0 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.8 | 3.8 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.7 | 6.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.7 | 11.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.7 | 2.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.7 | 2.9 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.7 | 2.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.7 | 4.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.7 | 1.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.7 | 0.7 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.7 | 2.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.7 | 7.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.7 | 1.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.7 | 0.7 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.6 | 3.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.6 | 5.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.6 | 1.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.6 | 2.5 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.6 | 0.6 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.6 | 3.8 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.6 | 1.8 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.6 | 5.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.6 | 2.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.6 | 4.5 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.6 | 1.7 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.6 | 3.9 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.6 | 5.0 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.6 | 2.2 | GO:0032564 | dATP binding(GO:0032564) |
| 0.6 | 3.9 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.5 | 1.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.5 | 2.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.5 | 1.5 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.5 | 1.5 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.5 | 1.5 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.5 | 3.8 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.5 | 1.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.5 | 1.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.5 | 3.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.5 | 2.8 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.5 | 1.4 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.5 | 1.9 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.5 | 0.9 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.5 | 3.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.5 | 2.3 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.5 | 8.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.4 | 2.7 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.4 | 0.9 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.4 | 1.3 | GO:0019002 | GMP binding(GO:0019002) |
| 0.4 | 1.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.4 | 3.5 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.4 | 3.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.4 | 1.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.4 | 1.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.4 | 1.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.4 | 2.5 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.4 | 2.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.4 | 1.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.4 | 2.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.4 | 1.6 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.4 | 3.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.4 | 4.8 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.4 | 3.6 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.4 | 1.2 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.4 | 5.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.4 | 5.6 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.4 | 3.7 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.4 | 2.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.4 | 0.4 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.4 | 1.1 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.4 | 1.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.4 | 1.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.3 | 1.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.3 | 3.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.3 | 2.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.3 | 2.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.3 | 2.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.3 | 1.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.3 | 11.6 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.3 | 1.0 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.3 | 2.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.3 | 0.7 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.3 | 1.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.3 | 0.7 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.3 | 1.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.3 | 1.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.3 | 1.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.3 | 3.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.3 | 0.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.3 | 3.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.3 | 1.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.3 | 1.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.3 | 1.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.3 | 1.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.3 | 2.7 | GO:0034943 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.3 | 2.0 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.3 | 3.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.3 | 0.6 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.3 | 1.7 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.3 | 2.7 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.3 | 0.5 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.3 | 1.3 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.3 | 0.8 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.3 | 1.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.3 | 1.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.3 | 1.0 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.3 | 2.6 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.3 | 1.5 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.3 | 3.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.3 | 0.8 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.3 | 1.5 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.3 | 1.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.3 | 1.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.3 | 1.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.2 | 0.7 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.2 | 2.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.2 | 3.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 1.7 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 8.5 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.2 | 0.9 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.2 | 3.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.2 | 0.7 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.2 | 1.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.2 | 0.7 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.2 | 1.4 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.2 | 13.2 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.2 | 0.7 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.2 | 0.9 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.2 | 1.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.2 | 3.0 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.2 | 1.3 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.2 | 0.9 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.2 | 1.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 1.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.2 | 1.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.2 | 1.9 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.2 | 0.8 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.2 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 2.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 1.7 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.2 | 6.2 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.2 | 0.8 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.2 | 1.0 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.2 | 2.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.2 | 0.8 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.2 | 1.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.2 | 1.5 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.2 | 0.6 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.2 | 0.6 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.2 | 1.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.2 | 1.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 0.7 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.2 | 0.7 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.2 | 0.7 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.2 | 2.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.2 | 7.2 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.2 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.2 | 8.1 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.2 | 0.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.2 | 7.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.2 | 3.8 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.2 | 0.7 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.2 | 0.9 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 0.5 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.2 | 5.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.2 | 1.6 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.2 | 0.9 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.2 | 0.5 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.2 | 0.5 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.2 | 3.9 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.2 | 2.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.2 | 2.3 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.2 | 1.7 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 3.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.2 | 12.8 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.2 | 3.8 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.2 | 0.5 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.2 | 0.6 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.2 | 0.5 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.2 | 3.9 | GO:0052712 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.2 | 0.5 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.2 | 2.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.2 | 1.8 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.2 | 2.5 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.2 | 0.8 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.2 | 3.6 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.2 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.2 | 5.0 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.2 | 3.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.2 | 0.2 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.2 | 4.7 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.2 | 2.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 3.6 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 1.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 6.9 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 7.6 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.1 | 0.6 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 1.0 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.1 | 1.8 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 1.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.5 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.1 | 2.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.4 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.1 | 0.4 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 3.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 1.3 | GO:0016208 | AMP binding(GO:0016208) |
| 0.1 | 0.4 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.1 | 0.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 1.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 1.7 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.5 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.4 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 1.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.6 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 1.1 | GO:0034582 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.1 | 0.7 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.1 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.8 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.7 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 2.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 1.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 4.7 | GO:0002039 | p53 binding(GO:0002039) |
| 0.1 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 2.4 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.1 | 0.2 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.1 | 0.5 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 0.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 6.6 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.1 | 0.8 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 15.3 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
| 0.1 | 2.9 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.1 | 1.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.1 | 0.7 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 1.6 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 2.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.5 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.5 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.1 | 3.2 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.7 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.5 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.3 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 2.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.1 | 3.2 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.1 | 1.0 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 1.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.1 | 2.3 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.3 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.1 | 0.2 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.1 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.4 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.5 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.0 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.1 | 0.3 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 1.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 1.2 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.4 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.3 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.1 | 6.9 | GO:0018169 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
| 0.1 | 0.6 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 5.8 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.1 | 0.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 1.1 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
| 0.1 | 1.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 0.2 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.1 | 1.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 0.8 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 10.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 1.2 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 3.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 0.6 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 3.3 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.1 | 0.2 | GO:0034845 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.1 | 3.4 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.1 | 0.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 4.3 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 0.2 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.1 | 0.7 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 2.1 | GO:0034930 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
| 0.1 | 2.4 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 1.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 1.0 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 1.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.4 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.0 | 5.9 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 1.5 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.2 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.4 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 2.3 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.3 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.0 | 0.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.1 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 0.8 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 6.6 | GO:0003723 | RNA binding(GO:0003723) |
| 0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 2.9 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.3 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 1.0 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 0.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.5 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.6 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.4 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 1.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.0 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.3 | GO:0034885 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.0 | 0.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 1.9 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 21.8 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
| 0.0 | 0.3 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 3.5 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.2 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.3 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
| 0.0 | 1.5 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.1 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.0 | 0.5 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.6 | GO:0015145 | monosaccharide transmembrane transporter activity(GO:0015145) |
| 0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.6 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) tRNA guanylyltransferase activity(GO:0008193) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.1 | GO:0035258 | steroid hormone receptor binding(GO:0035258) |
| 0.0 | 0.5 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.0 | 0.5 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.4 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 3.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 1.8 | GO:0016616 | oxidoreductase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0016616) |
| 0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.4 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 1.1 | GO:0016874 | ligase activity(GO:0016874) |
| 0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.4 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.1 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
| 0.0 | 0.0 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.0 | GO:0046977 | TAP binding(GO:0046977) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.0 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 0.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 0.0 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.2 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.0 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.2 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
| 0.0 | 0.1 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 15.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.7 | 15.8 | PID MYC PATHWAY | C-MYC pathway |
| 0.6 | 7.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.5 | 3.5 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.5 | 4.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.5 | 3.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.5 | 4.7 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.4 | 6.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.4 | 8.8 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.3 | 1.0 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.3 | 3.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.3 | 3.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.3 | 0.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.3 | 11.1 | PID FOXO PATHWAY | FoxO family signaling |
| 0.2 | 5.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.2 | 3.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.2 | 2.6 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.2 | 10.6 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.2 | 9.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.2 | 10.9 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.2 | 2.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.2 | 0.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.2 | 4.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.2 | 8.5 | PID P73PATHWAY | p73 transcription factor network |
| 0.2 | 2.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.2 | 1.7 | PID ATR PATHWAY | ATR signaling pathway |
| 0.2 | 5.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.2 | 1.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 3.9 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 1.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.8 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 2.1 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 11.3 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 2.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 2.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 2.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 1.0 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 0.5 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 2.6 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 0.9 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 0.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 2.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 1.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 1.8 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 1.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 0.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 1.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 0.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 1.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 2.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 1.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 0.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.1 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 1.5 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.9 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 1.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.9 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.7 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 1.0 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.2 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 1.3 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 29.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 1.0 | 16.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.8 | 10.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.8 | 4.7 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.7 | 5.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.6 | 3.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.6 | 13.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.6 | 7.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.6 | 6.8 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.6 | 1.7 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.6 | 8.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.5 | 6.0 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.5 | 7.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.5 | 6.4 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.4 | 4.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.4 | 1.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.4 | 3.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.4 | 7.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.4 | 3.8 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.4 | 1.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.4 | 8.0 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.4 | 10.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.4 | 5.3 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.4 | 3.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.4 | 2.8 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.3 | 3.8 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.3 | 4.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.3 | 1.7 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.3 | 3.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.3 | 4.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.3 | 6.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.3 | 1.9 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.3 | 5.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.3 | 4.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.3 | 6.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.3 | 2.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.3 | 5.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.3 | 1.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.3 | 2.6 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.3 | 0.3 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.3 | 2.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.3 | 0.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.3 | 4.1 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.3 | 1.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.3 | 8.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.3 | 2.9 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.3 | 3.6 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.2 | 6.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.2 | 7.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.2 | 9.6 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.2 | 2.8 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.2 | 2.8 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.2 | 4.6 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.2 | 2.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 3.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.2 | 1.5 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.2 | 0.9 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.2 | 2.2 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.2 | 2.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.2 | 4.1 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.2 | 3.9 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 15.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.2 | 8.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.2 | 1.0 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.2 | 2.8 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.2 | 1.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.2 | 19.7 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.2 | 0.8 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.1 | 1.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 6.4 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 1.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 1.6 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
| 0.1 | 1.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 2.7 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.5 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 3.2 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 0.5 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 3.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 1.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.0 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 1.6 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 4.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 3.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 4.1 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.1 | 5.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 1.0 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 0.7 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 6.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 1.7 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 0.8 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 0.6 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 2.0 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
| 0.1 | 0.4 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 2.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 0.5 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 0.9 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 10.0 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 0.3 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.1 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.6 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 0.2 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 2.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 0.2 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
| 0.1 | 1.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 0.9 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.6 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 0.7 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.4 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 2.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 0.1 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.1 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 0.1 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 0.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 1.4 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 0.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 1.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 1.1 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.1 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 0.8 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 0.1 | 0.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 1.0 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.1 | 1.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.8 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.2 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.4 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.5 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.2 | REACTOME METABOLISM OF RNA | Genes involved in Metabolism of RNA |
| 0.0 | 0.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.1 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.0 | 0.3 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.2 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.6 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.2 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
| 0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.0 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.3 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.0 | REACTOME PI3K CASCADE | Genes involved in PI3K Cascade |
| 0.0 | 0.1 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
| 0.0 | 0.4 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.3 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |