| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Foxo6
|
ENSMUSG00000052135.8 | Foxo6 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Foxo6 | chr4_120252045_120253258 | 34698 | 0.164021 | -0.73 | 2.9e-10 | Click! |
| Foxo6 | chr4_120269608_120269766 | 17662 | 0.198966 | -0.72 | 4.7e-10 | Click! |
| Foxo6 | chr4_120253332_120253634 | 33866 | 0.165890 | -0.72 | 7.1e-10 | Click! |
| Foxo6 | chr4_120269390_120269541 | 17884 | 0.198579 | -0.71 | 1.2e-09 | Click! |
| Foxo6 | chr4_120242723_120243628 | 44174 | 0.142489 | -0.70 | 3.3e-09 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr14_48475621_48476075 | 6.06 |
Tmem260 |
transmembrane protein 260 |
3526 |
0.2 |
| chr4_119036598_119036749 | 5.87 |
Gm12866 |
predicted gene 12866 |
32438 |
0.08 |
| chr6_143068200_143068506 | 4.49 |
C2cd5 |
C2 calcium-dependent domain containing 5 |
1268 |
0.45 |
| chr14_70707892_70708242 | 4.17 |
Xpo7 |
exportin 7 |
32 |
0.97 |
| chr5_135115423_135115665 | 3.94 |
Gm43500 |
predicted gene 43500 |
7749 |
0.1 |
| chr4_130295074_130295364 | 3.70 |
Fabp3 |
fatty acid binding protein 3, muscle and heart |
13376 |
0.13 |
| chr9_48362196_48362510 | 3.61 |
Nxpe4 |
neurexophilin and PC-esterase domain family, member 4 |
312 |
0.89 |
| chr18_23710155_23710339 | 3.59 |
Gm15972 |
predicted gene 15972 |
42058 |
0.12 |
| chr7_66113642_66113961 | 3.58 |
Chsy1 |
chondroitin sulfate synthase 1 |
4286 |
0.13 |
| chr10_30750253_30750413 | 3.47 |
Gm48335 |
predicted gene, 48335 |
6371 |
0.16 |
| chr13_45849210_45849500 | 3.45 |
Atxn1 |
ataxin 1 |
22933 |
0.23 |
| chr2_84052835_84052990 | 3.41 |
Gm13692 |
predicted gene 13692 |
18299 |
0.15 |
| chr1_129990849_129991148 | 3.34 |
Gm37278 |
predicted gene, 37278 |
47836 |
0.15 |
| chr7_120865040_120865504 | 3.33 |
Gm15774 |
predicted gene 15774 |
10026 |
0.13 |
| chr6_37748257_37748408 | 3.31 |
Atp6v0c-ps2 |
ATPase, H+ transporting, lysosomal V0 subunit C, pseudogene 2 |
57754 |
0.12 |
| chr15_100391062_100391248 | 3.28 |
Slc11a2 |
solute carrier family 11 (proton-coupled divalent metal ion transporters), member 2 |
12088 |
0.1 |
| chr13_63564531_63566515 | 3.26 |
Ptch1 |
patched 1 |
212 |
0.91 |
| chr7_14438248_14438399 | 3.15 |
Sult2a8 |
sulfotransferase family 2A, dehydroepiandrosterone (DHEA)-preferring, member 8 |
186 |
0.94 |
| chr4_146168082_146168501 | 3.14 |
Zfp600 |
zinc finger protein 600 |
6382 |
0.14 |
| chr11_77372346_77372497 | 3.09 |
Ssh2 |
slingshot protein phosphatase 2 |
19016 |
0.17 |
| chr10_83014028_83014325 | 3.04 |
Gm10773 |
predicted gene 10773 |
17519 |
0.17 |
| chr9_43225254_43225470 | 3.02 |
Oaf |
out at first homolog |
270 |
0.89 |
| chr1_77282399_77282552 | 3.01 |
Epha4 |
Eph receptor A4 |
95132 |
0.08 |
| chr18_65250204_65250466 | 2.99 |
Mir122 |
microRNA 122 |
1474 |
0.34 |
| chr4_101176121_101176511 | 2.99 |
Jak1 |
Janus kinase 1 |
9109 |
0.15 |
| chr18_69946685_69946957 | 2.98 |
Ccdc68 |
coiled-coil domain containing 68 |
21245 |
0.15 |
| chr17_28446269_28446422 | 2.97 |
Gm22146 |
predicted gene, 22146 |
155 |
0.91 |
| chr1_40175905_40176060 | 2.91 |
Il1r1 |
interleukin 1 receptor, type I |
49098 |
0.12 |
| chr16_91716739_91716893 | 2.86 |
Cryzl1 |
crystallin, zeta (quinone reductase)-like 1 |
653 |
0.6 |
| chr12_102787968_102788326 | 2.76 |
Gm47042 |
predicted gene, 47042 |
23435 |
0.08 |
| chr11_120631517_120631724 | 2.75 |
Mafg |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein G (avian) |
823 |
0.28 |
| chr2_104081769_104081934 | 2.74 |
Cd59b |
CD59b antigen |
10785 |
0.11 |
| chr5_22348847_22349031 | 2.69 |
Reln |
reelin |
4237 |
0.17 |
| chr2_26024451_26024631 | 2.68 |
Ubac1 |
ubiquitin associated domain containing 1 |
2794 |
0.19 |
| chr11_103158624_103159304 | 2.66 |
Fmnl1 |
formin-like 1 |
12143 |
0.11 |
| chr9_123986169_123986497 | 2.65 |
Ccr1l1 |
chemokine (C-C motif) receptor 1-like 1 |
7925 |
0.17 |
| chr1_193205520_193205671 | 2.65 |
Lamb3 |
laminin, beta 3 |
2104 |
0.16 |
| chr5_96988795_96988946 | 2.58 |
Gm9484 |
predicted gene 9484 |
8494 |
0.13 |
| chr7_73595024_73595834 | 2.55 |
Gm44734 |
predicted gene 44734 |
13519 |
0.1 |
| chr18_60648333_60648813 | 2.55 |
Synpo |
synaptopodin |
254 |
0.92 |
| chr1_149960824_149961040 | 2.53 |
Pla2g4a |
phospholipase A2, group IVA (cytosolic, calcium-dependent) |
323 |
0.91 |
| chr18_50133862_50134181 | 2.52 |
Cd63-ps |
CD63 antigen, pseudogene |
705 |
0.67 |
| chr19_4884110_4884271 | 2.51 |
Zdhhc24 |
zinc finger, DHHC domain containing 24 |
4423 |
0.09 |
| chr1_67116639_67117125 | 2.47 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
6144 |
0.25 |
| chr6_120579566_120580923 | 2.46 |
Gm44124 |
predicted gene, 44124 |
68 |
0.96 |
| chr4_142076018_142076233 | 2.46 |
Tmem51os1 |
Tmem51 opposite strand 1 |
7847 |
0.14 |
| chr16_10850443_10850829 | 2.45 |
Rmi2 |
RecQ mediated genome instability 2 |
15568 |
0.1 |
| chr2_104111511_104111671 | 2.43 |
A930018P22Rik |
RIKEN cDNA A930018P22 gene |
11178 |
0.12 |
| chr19_55565985_55566160 | 2.40 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
175748 |
0.03 |
| chr8_94966621_94966796 | 2.38 |
Gm10286 |
predicted gene 10286 |
3046 |
0.16 |
| chr16_58637548_58637721 | 2.37 |
Ftdc2 |
ferritin domain containing 2 |
1105 |
0.41 |
| chr2_65822418_65822569 | 2.36 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
23274 |
0.19 |
| chr4_127288993_127289759 | 2.36 |
Gm22221 |
predicted gene, 22221 |
4543 |
0.15 |
| chr9_110670862_110671013 | 2.36 |
Ccdc12 |
coiled-coil domain containing 12 |
4012 |
0.12 |
| chr4_15213205_15213456 | 2.33 |
Tmem64 |
transmembrane protein 64 |
52501 |
0.13 |
| chr17_63979339_63979498 | 2.33 |
Fer |
fer (fms/fps related) protein kinase |
41446 |
0.2 |
| chr12_55060194_55060577 | 2.33 |
2700097O09Rik |
RIKEN cDNA 2700097O09 gene |
6284 |
0.11 |
| chr11_107469708_107471023 | 2.32 |
Pitpnc1 |
phosphatidylinositol transfer protein, cytoplasmic 1 |
334 |
0.82 |
| chr2_68796050_68796462 | 2.30 |
Gm13612 |
predicted gene 13612 |
34761 |
0.14 |
| chr6_82072895_82073274 | 2.27 |
Gm15864 |
predicted gene 15864 |
20503 |
0.16 |
| chr4_98318734_98319169 | 2.23 |
0610025J13Rik |
RIKEN cDNA 0610025J13 gene |
2447 |
0.26 |
| chr11_116057350_116057520 | 2.22 |
Unk |
unkempt family zinc finger |
1537 |
0.24 |
| chr16_32563013_32563416 | 2.17 |
Gm34680 |
predicted gene, 34680 |
11472 |
0.14 |
| chr6_5509305_5509636 | 2.17 |
Pdk4 |
pyruvate dehydrogenase kinase, isoenzyme 4 |
13161 |
0.28 |
| chr11_85107327_85107485 | 2.16 |
Rpl13-ps1 |
ribosomal protein L13, pseudogene 1 |
4387 |
0.16 |
| chr8_109864802_109865078 | 2.15 |
Ap1g1 |
adaptor protein complex AP-1, gamma 1 subunit |
1832 |
0.22 |
| chr8_3256601_3256763 | 2.15 |
Gm16180 |
predicted gene 16180 |
3022 |
0.26 |
| chr4_115737400_115738211 | 2.15 |
Efcab14 |
EF-hand calcium binding domain 14 |
25 |
0.97 |
| chr9_108096046_108096232 | 2.11 |
Apeh |
acylpeptide hydrolase |
1533 |
0.17 |
| chr12_53820000_53820350 | 2.11 |
1700060O08Rik |
RIKEN cDNA 1700060O08 gene |
259217 |
0.02 |
| chr12_80083512_80083718 | 2.11 |
Gm36660 |
predicted gene, 36660 |
2181 |
0.23 |
| chr2_172933682_172934412 | 2.11 |
Bmp7 |
bone morphogenetic protein 7 |
6045 |
0.2 |
| chr6_34155309_34155694 | 2.11 |
Gm13856 |
predicted gene 13856 |
3572 |
0.22 |
| chr19_31781133_31781545 | 2.10 |
Prkg1 |
protein kinase, cGMP-dependent, type I |
16306 |
0.26 |
| chr3_108098837_108098988 | 2.10 |
Gnat2 |
guanine nucleotide binding protein, alpha transducing 2 |
1669 |
0.2 |
| chr3_122047989_122048843 | 2.10 |
Abca4 |
ATP-binding cassette, sub-family A (ABC1), member 4 |
1840 |
0.33 |
| chr6_5291230_5291963 | 2.07 |
Pon2 |
paraoxonase 2 |
2528 |
0.26 |
| chr14_47522434_47522734 | 2.06 |
Fbxo34 |
F-box protein 34 |
3495 |
0.15 |
| chr4_134751606_134751882 | 2.05 |
Ldlrap1 |
low density lipoprotein receptor adaptor protein 1 |
894 |
0.61 |
| chr3_155055322_155055517 | 2.05 |
Tnni3k |
TNNI3 interacting kinase |
12 |
0.98 |
| chr14_122511754_122511908 | 2.04 |
Gm18143 |
predicted gene, 18143 |
1998 |
0.22 |
| chr12_3866694_3867113 | 2.02 |
Dnmt3a |
DNA methyltransferase 3A |
712 |
0.65 |
| chr18_56978164_56978384 | 2.01 |
C330018D20Rik |
RIKEN cDNA C330018D20 gene |
2906 |
0.3 |
| chr11_69062573_69063351 | 2.01 |
9330160F10Rik |
RIKEN cDNA 9330160F10 gene |
2479 |
0.1 |
| chr16_17753157_17753381 | 2.01 |
Klhl22 |
kelch-like 22 |
6349 |
0.09 |
| chr15_80250611_80250938 | 1.96 |
Mief1 |
mitochondrial elongation factor 1 |
3143 |
0.14 |
| chr8_19735430_19735613 | 1.96 |
4930467E23Rik |
RIKEN cDNA 4930467E23 gene |
5945 |
0.18 |
| chr6_5287440_5287910 | 1.94 |
Pon2 |
paraoxonase 2 |
1393 |
0.4 |
| chr8_20620783_20620977 | 1.93 |
Gm21119 |
predicted gene, 21119 |
5961 |
0.2 |
| chr1_85838028_85838331 | 1.93 |
Cab39 |
calcium binding protein 39 |
4901 |
0.17 |
| chr8_20833861_20834050 | 1.93 |
Gm20946 |
predicted gene, 20946 |
5602 |
0.15 |
| chr3_137529888_137530557 | 1.91 |
Gm4861 |
predicted gene 4861 |
22400 |
0.2 |
| chr7_26139542_26139713 | 1.91 |
Cyp2b26-ps |
cytochrome P450, family 2, subfamily b, polypeptide 26, pseudogene |
8965 |
0.15 |
| chr18_69614138_69614719 | 1.91 |
Tcf4 |
transcription factor 4 |
1984 |
0.45 |
| chrX_11935397_11935739 | 1.90 |
Gm14491 |
predicted gene 14491 |
22279 |
0.2 |
| chr5_120005810_120006020 | 1.90 |
Gm38554 |
predicted gene, 38554 |
46672 |
0.13 |
| chr5_75358882_75359196 | 1.89 |
Gm22084 |
predicted gene, 22084 |
13106 |
0.18 |
| chr10_39169764_39170498 | 1.89 |
D030034A15Rik |
RIKEN cDNA D030034A15 gene |
3121 |
0.19 |
| chr2_152817573_152818379 | 1.89 |
Bcl2l1 |
BCL2-like 1 |
10559 |
0.12 |
| chr1_180216923_180217234 | 1.88 |
Gm37336 |
predicted gene, 37336 |
4677 |
0.16 |
| chr8_19906123_19906274 | 1.88 |
Gm31371 |
predicted gene, 31371 |
2806 |
0.28 |
| chr17_58924909_58925074 | 1.88 |
Pdzph1 |
PDZ and pleckstrin homology domains 1 |
31496 |
0.19 |
| chr4_118526862_118527114 | 1.86 |
2610528J11Rik |
RIKEN cDNA 2610528J11 gene |
11 |
0.96 |
| chr3_127791863_127792067 | 1.86 |
Tifa |
TRAF-interacting protein with forkhead-associated domain |
1161 |
0.34 |
| chr19_5884001_5884302 | 1.86 |
Slc25a45 |
solute carrier family 25, member 45 |
5495 |
0.08 |
| chr8_20040963_20041142 | 1.85 |
Gm20778 |
predicted gene, 20778 |
5944 |
0.19 |
| chr16_21781286_21781437 | 1.83 |
Ehhadh |
enoyl-Coenzyme A, hydratase/3-hydroxyacyl Coenzyme A dehydrogenase |
6446 |
0.13 |
| chr11_53294582_53294807 | 1.83 |
Hspa4 |
heat shock protein 4 |
5717 |
0.17 |
| chr6_31588196_31588373 | 1.81 |
Gm6117 |
predicted gene 6117 |
13317 |
0.17 |
| chr6_37617523_37617974 | 1.81 |
Ybx1-ps2 |
Y box protein 1, pseudogene 2 |
69447 |
0.1 |
| chr18_40110818_40111000 | 1.80 |
Gm50395 |
predicted gene, 50395 |
1176 |
0.58 |
| chr9_64472786_64473083 | 1.79 |
Megf11 |
multiple EGF-like-domains 11 |
28402 |
0.2 |
| chr9_119087968_119088457 | 1.79 |
Plcd1 |
phospholipase C, delta 1 |
49 |
0.96 |
| chr10_125785483_125786054 | 1.79 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
180400 |
0.03 |
| chr6_129235522_129235889 | 1.79 |
2310001H17Rik |
RIKEN cDNA 2310001H17 gene |
1722 |
0.24 |
| chr7_26055182_26055442 | 1.77 |
Cyp2b13 |
cytochrome P450, family 2, subfamily b, polypeptide 13 |
6185 |
0.14 |
| chr16_92698271_92698641 | 1.76 |
Runx1 |
runt related transcription factor 1 |
1128 |
0.6 |
| chr1_134078161_134079036 | 1.75 |
Btg2 |
BTG anti-proliferation factor 2 |
522 |
0.7 |
| chr1_73046888_73047083 | 1.75 |
1700027A15Rik |
RIKEN cDNA 1700027A15 gene |
22416 |
0.2 |
| chr4_6452560_6452756 | 1.72 |
Nsmaf |
neutral sphingomyelinase (N-SMase) activation associated factor |
921 |
0.61 |
| chr6_38623489_38623665 | 1.71 |
Klrg2 |
killer cell lectin-like receptor subfamily G, member 2 |
13656 |
0.17 |
| chr10_84597067_84597218 | 1.71 |
Tcp11l2 |
t-complex 11 (mouse) like 2 |
2489 |
0.2 |
| chr9_64018248_64018912 | 1.70 |
Smad6 |
SMAD family member 6 |
1593 |
0.32 |
| chrX_103493565_103494070 | 1.68 |
Jpx |
Jpx transcript, Xist activator (non-protein coding) |
22 |
0.94 |
| chr9_22123242_22123487 | 1.68 |
6530413G14Rik |
RIKEN cDNA 6530413G14 gene |
5692 |
0.07 |
| chr4_10964913_10965223 | 1.67 |
Rps11-ps3 |
ribosomal protein S11, pseudogene 3 |
18460 |
0.16 |
| chr13_109665894_109666372 | 1.66 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
20023 |
0.29 |
| chr18_46404986_46405434 | 1.66 |
Gm4107 |
predicted gene 4107 |
21833 |
0.13 |
| chr5_76990916_76991084 | 1.66 |
Srp72 |
signal recognition particle 72 |
2993 |
0.16 |
| chr13_68889914_68890340 | 1.65 |
Gm7979 |
predicted gene 7979 |
33594 |
0.18 |
| chr4_105641775_105641926 | 1.65 |
Gm12726 |
predicted gene 12726 |
63510 |
0.14 |
| chr4_154443031_154443239 | 1.65 |
Prdm16 |
PR domain containing 16 |
85630 |
0.07 |
| chr1_170609925_170610258 | 1.64 |
Nos1ap |
nitric oxide synthase 1 (neuronal) adaptor protein |
20230 |
0.16 |
| chr12_91384738_91384923 | 1.63 |
Tshr |
thyroid stimulating hormone receptor |
264 |
0.65 |
| chr10_80114596_80114882 | 1.63 |
Stk11 |
serine/threonine kinase 11 |
1064 |
0.3 |
| chr1_43247602_43248038 | 1.63 |
Gm29610 |
predicted gene 29610 |
22863 |
0.16 |
| chr7_26019859_26020010 | 1.63 |
Cyp2b27-ps |
cytochrome P450, family 2, subfamily b, polypeptide 27, pseudogene |
8972 |
0.13 |
| chr19_46542875_46543028 | 1.62 |
Arl3 |
ADP-ribosylation factor-like 3 |
138 |
0.95 |
| chr1_86268675_86268882 | 1.61 |
Armc9 |
armadillo repeat containing 9 |
24212 |
0.09 |
| chr9_46205146_46205297 | 1.61 |
Sik3 |
SIK family kinase 3 |
14350 |
0.1 |
| chr12_110024246_110024718 | 1.61 |
Gm34667 |
predicted gene, 34667 |
609 |
0.65 |
| chr2_122241953_122242115 | 1.60 |
Sord |
sorbitol dehydrogenase |
7285 |
0.11 |
| chr1_69542704_69542927 | 1.59 |
Gm29114 |
predicted gene 29114 |
28883 |
0.17 |
| chr3_137969141_137969487 | 1.59 |
Dapp1 |
dual adaptor for phosphotyrosine and 3-phosphoinositides 1 |
12216 |
0.12 |
| chr15_83448172_83448323 | 1.58 |
Pacsin2 |
protein kinase C and casein kinase substrate in neurons 2 |
15423 |
0.15 |
| chr3_94932620_94933158 | 1.58 |
Selenbp1 |
selenium binding protein 1 |
167 |
0.9 |
| chr14_46704583_46704734 | 1.58 |
D330046F09Rik |
RIKEN cDNA D330046F09 gene |
30883 |
0.09 |
| chr11_85832197_85833021 | 1.57 |
Tbx2 |
T-box 2 |
58 |
0.84 |
| chr5_149266736_149266887 | 1.57 |
Alox5ap |
arachidonate 5-lipoxygenase activating protein |
1464 |
0.24 |
| chr16_32461837_32462117 | 1.56 |
Pcyt1a |
phosphate cytidylyltransferase 1, choline, alpha isoform |
963 |
0.42 |
| chr7_126924057_126924208 | 1.56 |
Tmem219 |
transmembrane protein 219 |
1215 |
0.19 |
| chr7_120918533_120918787 | 1.55 |
Polr3e |
polymerase (RNA) III (DNA directed) polypeptide E |
876 |
0.48 |
| chr3_18429033_18429189 | 1.54 |
Gm30667 |
predicted gene, 30667 |
32143 |
0.18 |
| chr1_133348248_133348399 | 1.54 |
Ren1 |
renin 1 structural |
2187 |
0.21 |
| chr19_5727451_5728139 | 1.54 |
Gm16538 |
predicted gene 16538 |
589 |
0.4 |
| chr9_97145459_97145610 | 1.53 |
Rpl7a-ps10 |
ribosomal protein L7A, pseudogene 10 |
33645 |
0.12 |
| chr4_120665266_120665476 | 1.53 |
Cited4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
1201 |
0.41 |
| chr11_69094659_69095279 | 1.53 |
Per1 |
period circadian clock 1 |
248 |
0.79 |
| chr3_52452381_52452532 | 1.53 |
Gm38098 |
predicted gene, 38098 |
27048 |
0.19 |
| chr12_24706721_24707100 | 1.52 |
Rrm2 |
ribonucleotide reductase M2 |
1331 |
0.35 |
| chr1_193510501_193510734 | 1.52 |
Mir205hg |
Mir205 host gene |
443 |
0.79 |
| chr2_27215711_27215862 | 1.51 |
Sardh |
sarcosine dehydrogenase |
154 |
0.94 |
| chr2_125355707_125356036 | 1.51 |
Gm14003 |
predicted gene 14003 |
71893 |
0.09 |
| chr6_124492807_124493221 | 1.50 |
C1rl |
complement component 1, r subcomponent-like |
99 |
0.92 |
| chr19_10016296_10016459 | 1.50 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
1333 |
0.3 |
| chr17_84689339_84689718 | 1.50 |
Abcg8 |
ATP binding cassette subfamily G member 8 |
6397 |
0.15 |
| chr18_24102564_24102822 | 1.50 |
Ino80c |
INO80 complex subunit C |
12220 |
0.18 |
| chr7_26169116_26169364 | 1.49 |
Cyp2b9 |
cytochrome P450, family 2, subfamily b, polypeptide 9 |
4171 |
0.18 |
| chr11_64839766_64839932 | 1.48 |
Gm12292 |
predicted gene 12292 |
3904 |
0.32 |
| chr19_38191474_38191796 | 1.48 |
Fra10ac1 |
FRA10AC1 homolog (human) |
32503 |
0.13 |
| chr1_180245885_180246051 | 1.48 |
Psen2 |
presenilin 2 |
18 |
0.97 |
| chr19_21882102_21882590 | 1.48 |
Gm50130 |
predicted gene, 50130 |
48590 |
0.12 |
| chr5_118149835_118149986 | 1.48 |
Gm26411 |
predicted gene, 26411 |
1016 |
0.46 |
| chr13_99019515_99019689 | 1.47 |
A930014D07Rik |
RIKEN cDNA A930014D07 gene |
12503 |
0.12 |
| chr4_107899249_107899588 | 1.47 |
Czib |
CXXC motif containing zinc binding protein |
6048 |
0.13 |
| chr4_147399557_147400377 | 1.47 |
Gm8178 |
predicted gene 8178 |
21038 |
0.12 |
| chr3_159839922_159840851 | 1.47 |
Wls |
wntless WNT ligand secretion mediator |
476 |
0.86 |
| chr4_9747534_9747849 | 1.46 |
4930412C18Rik |
RIKEN cDNA 4930412C18 gene |
22894 |
0.19 |
| chr15_78261282_78261433 | 1.46 |
Ncf4 |
neutrophil cytosolic factor 4 |
479 |
0.73 |
| chr8_123948814_123949697 | 1.45 |
Nup133 |
nucleoporin 133 |
0 |
0.67 |
| chr8_115830109_115830289 | 1.45 |
Maf |
avian musculoaponeurotic fibrosarcoma oncogene homolog |
122405 |
0.06 |
| chr11_88559439_88559590 | 1.45 |
Msi2 |
musashi RNA-binding protein 2 |
30633 |
0.2 |
| chr13_5592488_5592779 | 1.43 |
Gm35330 |
predicted gene, 35330 |
21505 |
0.26 |
| chr7_125758410_125758561 | 1.43 |
D430042O09Rik |
RIKEN cDNA D430042O09 gene |
27770 |
0.19 |
| chr3_146596973_146597140 | 1.43 |
Uox |
urate oxidase |
21 |
0.88 |
| chr9_65196135_65196618 | 1.42 |
Gm25313 |
predicted gene, 25313 |
311 |
0.76 |
| chr1_90504528_90505067 | 1.42 |
Gm35048 |
predicted gene, 35048 |
15699 |
0.22 |
| chr2_73047352_73047542 | 1.42 |
Sp3os |
trans-acting transcription factor 3, opposite strand |
60206 |
0.08 |
| chr11_94290140_94290302 | 1.42 |
Luc7l3 |
LUC7-like 3 (S. cerevisiae) |
3002 |
0.2 |
| chr11_94589450_94589734 | 1.41 |
Acsf2 |
acyl-CoA synthetase family member 2 |
12177 |
0.11 |
| chr19_53965032_53965401 | 1.41 |
Gm50273 |
predicted gene, 50273 |
2447 |
0.22 |
| chr4_48428166_48428317 | 1.41 |
Tex10 |
testis expressed gene 10 |
31062 |
0.17 |
| chr8_104022784_104023000 | 1.41 |
Gm8748 |
predicted gene 8748 |
48257 |
0.12 |
| chr11_90517895_90518046 | 1.41 |
Gm11511 |
predicted gene 11511 |
654 |
0.72 |
| chr15_8443314_8443465 | 1.41 |
Nipbl |
NIPBL cohesin loading factor |
1074 |
0.5 |
| chr1_58963808_58963963 | 1.40 |
Trak2 |
trafficking protein, kinesin binding 2 |
9544 |
0.15 |
| chr1_90963124_90963376 | 1.40 |
Rab17 |
RAB17, member RAS oncogene family |
4367 |
0.16 |
| chr13_97778107_97778371 | 1.40 |
Gm47577 |
predicted gene, 47577 |
12325 |
0.14 |
| chr6_142538576_142538902 | 1.40 |
Ldhb |
lactate dehydrogenase B |
30782 |
0.15 |
| chr6_35169404_35169555 | 1.39 |
Nup205 |
nucleoporin 205 |
7942 |
0.21 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.5 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.7 | 2.9 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.5 | 1.5 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.5 | 1.4 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.4 | 2.1 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.4 | 1.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.4 | 1.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.3 | 0.7 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.3 | 1.0 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.3 | 1.3 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.3 | 1.9 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.3 | 1.2 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.3 | 1.7 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.3 | 1.4 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.3 | 1.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.3 | 0.8 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 0.7 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.2 | 1.0 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.2 | 1.2 | GO:0070627 | ferrous iron import(GO:0070627) |
| 0.2 | 0.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 0.7 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.2 | 0.7 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 | 0.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.2 | 0.6 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 1.0 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.2 | 0.6 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.2 | 0.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.2 | 0.6 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.2 | 0.6 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.2 | 0.6 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.2 | 1.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.2 | 2.0 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.2 | 0.9 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.2 | 0.5 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.2 | 0.7 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 | 0.5 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.2 | 0.7 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.2 | 0.7 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.2 | 0.5 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.2 | 1.5 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.2 | 0.5 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.2 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.2 | 1.0 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.2 | 0.9 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.2 | 0.5 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.2 | 0.5 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.2 | 0.8 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.1 | 1.6 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 | 0.4 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.7 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 1.3 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.1 | 0.9 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 | 1.0 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.4 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.1 | 0.7 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.6 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.4 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.1 | 0.5 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.1 | 0.5 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.1 | 0.4 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.4 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.1 | 0.6 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.1 | 0.4 | GO:0051794 | regulation of catagen(GO:0051794) |
| 0.1 | 0.4 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 0.8 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 | 0.4 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 | 0.6 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.3 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 | 0.2 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.1 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 1.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.4 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.1 | 1.0 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 0.8 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 1.0 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.1 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.4 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.1 | 1.0 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 0.8 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.3 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 | 0.7 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.1 | 0.3 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.1 | 0.4 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.1 | 0.1 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.1 | 0.4 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.3 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.5 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 | 0.2 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 | 0.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 0.4 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.1 | 0.3 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 1.0 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.1 | 0.3 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 1.5 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.1 | 0.6 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.1 | 0.9 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.1 | 0.3 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.1 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.1 | 0.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.1 | 1.4 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.1 | 0.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 4.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.1 | 1.0 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.1 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.4 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.1 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.1 | 1.0 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.1 | 0.3 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 0.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 2.5 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.1 | 0.5 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 0.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.2 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
| 0.1 | 0.2 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.1 | 0.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.4 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.3 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 0.1 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 | 0.2 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.3 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.1 | 0.5 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.2 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.1 | 0.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.1 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 3.0 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.1 | 0.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 0.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.5 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.1 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) |
| 0.1 | 0.3 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.3 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.1 | 0.2 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
| 0.1 | 0.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.1 | 0.3 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 1.3 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 | 0.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.4 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.1 | 1.2 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 | 0.2 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
| 0.1 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 0.2 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.1 | 0.5 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.1 | 0.8 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.1 | 0.1 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
| 0.1 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 1.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.1 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.3 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.2 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.1 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.7 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.5 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.1 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.1 | 0.4 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 | 0.3 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.1 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.1 | GO:0052330 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.1 | 0.8 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.1 | 0.2 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.1 | 0.1 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.1 | 0.3 | GO:0000237 | leptotene(GO:0000237) |
| 0.1 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.2 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 | 0.8 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 0.2 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.3 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.0 | 0.4 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.0 | 0.4 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.2 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.3 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.0 | 0.0 | GO:0060677 | ureteric bud elongation(GO:0060677) |
| 0.0 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.0 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.0 | 0.2 | GO:0007418 | ventral midline development(GO:0007418) |
| 0.0 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.1 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.0 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.3 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.0 | 0.1 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.0 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 0.1 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.0 | 1.5 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.1 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.7 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.5 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 | 0.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.0 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.0 | 0.6 | GO:0001945 | lymph vessel development(GO:0001945) |
| 0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.3 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.1 | GO:1900164 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.0 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 3.7 | GO:0098792 | xenophagy(GO:0098792) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 1.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.0 | 0.0 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.0 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.2 | GO:0014889 | muscle atrophy(GO:0014889) |
| 0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.0 | 0.1 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.0 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.0 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.0 | 0.2 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.1 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 | 0.4 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.8 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.2 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.1 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.1 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.0 | 0.0 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.0 | 0.2 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 | 0.1 | GO:1905049 | regulation of metalloendopeptidase activity(GO:1904683) negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.2 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.4 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 1.2 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.0 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.0 | 0.1 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.0 | 0.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.6 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
| 0.0 | 0.1 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.4 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 | 0.5 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.0 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.5 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
| 0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.0 | 0.3 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.8 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.1 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.4 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.0 | 0.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.0 | 0.1 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.3 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.0 | GO:0038091 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
| 0.0 | 0.1 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.4 | GO:0008207 | C21-steroid hormone metabolic process(GO:0008207) |
| 0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.0 | 0.0 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.3 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.2 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.0 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.0 | 0.9 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.0 | 0.2 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.4 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.0 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.8 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.1 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.0 | 0.1 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
| 0.0 | 0.7 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.3 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.1 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
| 0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.0 | 0.1 | GO:0097286 | iron ion import(GO:0097286) |
| 0.0 | 0.1 | GO:0046016 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.7 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.5 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.2 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.0 | GO:0072679 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
| 0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.2 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.2 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 1.0 | GO:0003281 | ventricular septum development(GO:0003281) |
| 0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 | 0.7 | GO:0042398 | cellular modified amino acid biosynthetic process(GO:0042398) |
| 0.0 | 0.0 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.2 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.0 | 0.4 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.0 | 0.4 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.0 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.0 | 0.1 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.3 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.0 | 0.2 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.0 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.0 | GO:0009265 | 2'-deoxyribonucleotide biosynthetic process(GO:0009265) deoxyribose phosphate biosynthetic process(GO:0046385) |
| 0.0 | 0.2 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
| 0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.0 | GO:0046629 | gamma-delta T cell activation(GO:0046629) |
| 0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.0 | 0.1 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 0.0 | 0.0 | GO:0072319 | clathrin coat disassembly(GO:0072318) vesicle uncoating(GO:0072319) |
| 0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.0 | 2.1 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
| 0.0 | 0.0 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.0 | 0.1 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.3 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.1 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.1 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
| 0.0 | 0.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.2 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.0 | 0.0 | GO:0036257 | multivesicular body organization(GO:0036257) multivesicular body assembly(GO:0036258) |
| 0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.0 | GO:0060440 | trachea formation(GO:0060440) regulation of Golgi inheritance(GO:0090170) positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.4 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.0 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
| 0.0 | 0.0 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.5 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.0 | 0.2 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 0.0 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.1 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.1 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.0 | GO:0097709 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
| 0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.1 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.0 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.0 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.0 | 0.1 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.1 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.0 | 0.2 | GO:0046033 | AMP metabolic process(GO:0046033) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.1 | GO:0009147 | CTP biosynthetic process(GO:0006241) pyrimidine nucleoside triphosphate metabolic process(GO:0009147) pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 0.0 | 0.0 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.0 | 0.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.0 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.0 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.0 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.0 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.0 | 0.0 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.0 | 0.0 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.2 | GO:0043149 | contractile actin filament bundle assembly(GO:0030038) stress fiber assembly(GO:0043149) |
| 0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:1902116 | negative regulation of organelle assembly(GO:1902116) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.4 | GO:0043297 | apical junction assembly(GO:0043297) |
| 0.0 | 0.0 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.0 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.1 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.0 | 0.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.5 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.0 | 0.3 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0036515 | dopaminergic neuron axon guidance(GO:0036514) serotonergic neuron axon guidance(GO:0036515) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.0 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.3 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.0 | 0.0 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.0 | 0.0 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 0.0 | 0.0 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.0 | 0.2 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.1 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.0 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
| 0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 | 0.0 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.0 | 0.2 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.0 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 | 0.0 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
| 0.0 | 0.0 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.6 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.0 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.0 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.1 | GO:0018126 | protein hydroxylation(GO:0018126) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.0 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 | 0.0 | GO:0002434 | immune complex clearance(GO:0002434) |
| 0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.1 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.0 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.0 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.1 | GO:0042181 | ketone biosynthetic process(GO:0042181) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 2.1 | GO:0000377 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.0 | 0.4 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.1 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.0 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.0 | 0.1 | GO:0006739 | NADP metabolic process(GO:0006739) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
| 0.0 | 0.0 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 | 0.1 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.0 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.1 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.1 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.1 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.1 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.0 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.0 | 0.0 | GO:0071466 | cellular response to xenobiotic stimulus(GO:0071466) |
| 0.0 | 0.1 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.0 | 0.0 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.0 | 0.1 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) |
| 0.0 | 0.0 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.0 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.1 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.0 | 0.2 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0042311 | vasodilation(GO:0042311) |
| 0.0 | 0.0 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.0 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.0 | 0.0 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.0 | 0.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.4 | GO:0044042 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.0 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.0 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.2 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.0 | 0.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.0 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.0 | 0.0 | GO:0032799 | low-density lipoprotein receptor particle metabolic process(GO:0032799) |
| 0.0 | 0.1 | GO:0001659 | temperature homeostasis(GO:0001659) |
| 0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.0 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.1 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
| 0.0 | 0.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.0 | 0.1 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.0 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.0 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 0.1 | GO:0051608 | histamine transport(GO:0051608) |
| 0.0 | 0.0 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
| 0.0 | 0.0 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.0 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.1 | GO:0060039 | pericardium development(GO:0060039) |
| 0.0 | 0.1 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.0 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.1 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.0 | 0.1 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.1 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.2 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.0 | 0.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.1 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.0 | 0.1 | GO:0043302 | positive regulation of leukocyte degranulation(GO:0043302) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 3.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.3 | 1.3 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.2 | 0.7 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.2 | 1.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.9 | GO:0000805 | X chromosome(GO:0000805) |
| 0.2 | 0.7 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.6 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 1.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 3.2 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 0.4 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.4 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.9 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 1.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.3 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.4 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.1 | 0.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 1.0 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 1.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.7 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.1 | 1.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 4.2 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 1.2 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 4.0 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.1 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.5 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 0.1 | 0.7 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.1 | 0.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.4 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.9 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 4.0 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.5 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.2 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.1 | 2.1 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 0.3 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.2 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 1.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 0.5 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.1 | 0.4 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.8 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.7 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.5 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.9 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.2 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 1.2 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.0 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.2 | GO:0035363 | histone locus body(GO:0035363) |
| 0.0 | 0.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.8 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.2 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 1.4 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 1.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.5 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.3 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.7 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.3 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.7 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.4 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.3 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 1.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.0 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.3 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 1.4 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 1.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.7 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.5 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.0 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 1.3 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.2 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.0 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.1 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.7 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.0 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.2 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.9 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.2 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 2.1 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.5 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.4 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.0 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.1 | GO:0042581 | specific granule(GO:0042581) |
| 0.0 | 0.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 1.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.7 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 0.9 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.4 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.0 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 1.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.6 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.8 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.0 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 0.2 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.2 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.1 | GO:0046930 | pore complex(GO:0046930) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.1 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.7 | 2.2 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.7 | 3.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.6 | 2.4 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.4 | 1.3 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.4 | 2.0 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.4 | 1.9 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.4 | 0.8 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.4 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.3 | 1.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.3 | 2.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.3 | 1.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.3 | 1.3 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.3 | 1.8 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.3 | 1.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.2 | 0.7 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.2 | 0.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.2 | 1.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 0.6 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.2 | 1.8 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.2 | 1.7 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.2 | 1.7 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.2 | 1.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.2 | 0.7 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.7 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.2 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.2 | 1.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 0.5 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.2 | 2.0 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.2 | 0.5 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.2 | 1.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.4 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.4 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 1.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.4 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.1 | 0.7 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 0.7 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.5 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 0.4 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.1 | 0.6 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.3 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
| 0.1 | 0.4 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.4 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.1 | 2.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.4 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.6 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 0.9 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 0.4 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 0.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 1.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 1.2 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.3 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.4 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 1.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.1 | 1.5 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.6 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.1 | 1.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.1 | GO:0052827 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
| 0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.3 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 1.2 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 1.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.6 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.1 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.6 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 1.0 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.5 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.1 | 0.3 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.3 | GO:0016530 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 0.3 | GO:0034845 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.2 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.1 | 0.5 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.1 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 2.1 | GO:0008748 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.1 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 2.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.5 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.1 | 0.1 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
| 0.1 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 1.0 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.3 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.1 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.1 | 0.2 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.5 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.1 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.1 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.4 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.7 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.4 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.4 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 2.5 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.5 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.7 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.4 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.1 | GO:0046428 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.8 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 1.4 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.7 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.8 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 1.6 | GO:0018727 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
| 0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.6 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 1.4 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.3 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.0 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 1.3 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.9 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 0.8 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.3 | GO:0018855 | succinate-CoA ligase activity(GO:0004774) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.0 | 1.1 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.3 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.0 | 0.1 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
| 0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.5 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.2 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.7 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 1.2 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 1.3 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.3 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
| 0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.0 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.2 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.3 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.1 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.4 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 2.2 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.7 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.0 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 0.3 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.0 | 0.1 | GO:0032138 | DNA insertion or deletion binding(GO:0032135) single base insertion or deletion binding(GO:0032138) |
| 0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 0.6 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0034811 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.2 | GO:0004950 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.0 | 0.2 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 1.3 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.0 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.0 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
| 0.0 | 0.1 | GO:0018450 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.0 | 0.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 1.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.0 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.0 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.0 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.6 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.4 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.0 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.0 | 0.0 | GO:0033558 | protein deacetylase activity(GO:0033558) |
| 0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 2.1 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.0 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.0 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.3 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.2 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 0.8 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.0 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.4 | GO:0016419 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.0 | 0.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.0 | 0.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.0 | 0.7 | GO:0004497 | monooxygenase activity(GO:0004497) |
| 0.0 | 0.0 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.2 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.0 | 0.8 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.0 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.4 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.0 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.0 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.0 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.0 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.0 | 0.9 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.4 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.4 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.1 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.0 | 0.3 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.1 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.1 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.1 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.6 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.1 | 1.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 0.7 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 1.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 2.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 0.9 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 2.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 1.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 2.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 1.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 1.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 1.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 2.4 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 1.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 2.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.6 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 1.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 1.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.5 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 1.1 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 1.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.7 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.5 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 1.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 0.7 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.6 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 1.1 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.6 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.6 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 1.3 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.2 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 2.3 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.2 | 2.3 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 2.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.1 | 0.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 0.2 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
| 0.1 | 2.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 1.5 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 0.8 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 0.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 2.9 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 1.9 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.1 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 0.2 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 0.6 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 1.7 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.0 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.1 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 0.4 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 0.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 0.4 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.6 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.8 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.8 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.9 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 1.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.9 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 2.5 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.6 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 1.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.9 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.3 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.0 | 0.6 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.8 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 1.1 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 1.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.7 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.6 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 1.1 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.1 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.3 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.6 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 1.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.2 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.3 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 1.3 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.2 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.2 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
| 0.0 | 0.2 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.4 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.1 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
| 0.0 | 0.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.3 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.3 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.0 | REACTOME DNA REPLICATION | Genes involved in DNA Replication |
| 0.0 | 0.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.0 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.2 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.0 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.2 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.6 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 0.1 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.2 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.2 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |