| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hnf1b
|
ENSMUSG00000020679.5 | Hnf1b |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Hnf1b | chr11_83850510_83850886 | 157 | 0.912912 | 0.85 | 2.4e-16 | Click! |
| Hnf1b | chr11_83852874_83853122 | 38 | 0.966988 | 0.81 | 4.9e-14 | Click! |
| Hnf1b | chr11_83852648_83852819 | 227 | 0.904559 | 0.81 | 1.2e-13 | Click! |
| Hnf1b | chr11_83885322_83885481 | 32441 | 0.117744 | 0.80 | 2.2e-13 | Click! |
| Hnf1b | chr11_83852004_83852325 | 78 | 0.959214 | 0.77 | 4.9e-12 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr8_20817574_20818579 | 247.83 |
Gm20946 |
predicted gene, 20946 |
10277 |
0.15 |
| chr12_24686000_24686681 | 213.67 |
Cys1 |
cystin 1 |
4527 |
0.16 |
| chr8_33987076_33987405 | 213.07 |
Gm45817 |
predicted gene 45817 |
40 |
0.96 |
| chr8_20024336_20025030 | 206.86 |
Gm45754 |
predicted gene 45754 |
5272 |
0.19 |
| chr8_19719087_19719899 | 201.29 |
Gm7760 |
predicted gene 7760 |
7788 |
0.16 |
| chr10_80975511_80975708 | 147.93 |
Gm3828 |
predicted gene 3828 |
20899 |
0.08 |
| chr17_84156966_84157484 | 145.77 |
Gm19696 |
predicted gene, 19696 |
785 |
0.6 |
| chr17_83999191_83999431 | 142.12 |
8430430B14Rik |
RIKEN cDNA 8430430B14 gene |
757 |
0.52 |
| chr19_43767999_43768210 | 140.04 |
Cutc |
cutC copper transporter |
3231 |
0.18 |
| chr2_119566179_119566455 | 134.27 |
Chp1 |
calcineurin-like EF hand protein 1 |
288 |
0.85 |
| chr18_6989325_6989534 | 126.13 |
Mkx |
mohawk homeobox |
3559 |
0.23 |
| chr14_120271077_120271397 | 118.14 |
Mbnl2 |
muscleblind like splicing factor 2 |
4432 |
0.3 |
| chr12_80930232_80930519 | 114.70 |
1700052I22Rik |
RIKEN cDNA 1700052I22 gene |
5926 |
0.14 |
| chr10_79814385_79814560 | 109.09 |
Palm |
paralemmin |
190 |
0.84 |
| chr6_116286832_116287192 | 108.10 |
Zfand4 |
zinc finger, AN1-type domain 4 |
459 |
0.75 |
| chr1_136966812_136967021 | 106.99 |
Nr5a2 |
nuclear receptor subfamily 5, group A, member 2 |
6468 |
0.23 |
| chr1_130822276_130822511 | 106.65 |
Gm15848 |
predicted gene 15848 |
1689 |
0.24 |
| chr5_66052662_66053184 | 105.20 |
Rbm47 |
RNA binding motif protein 47 |
1629 |
0.27 |
| chr1_151157958_151158754 | 103.69 |
C730036E19Rik |
RIKEN cDNA C730036E19 gene |
20322 |
0.1 |
| chr17_31152594_31152769 | 101.41 |
Gm15318 |
predicted gene 15318 |
71 |
0.95 |
| chr3_108476837_108477244 | 101.29 |
5330417C22Rik |
RIKEN cDNA 5330417C22 gene |
6959 |
0.1 |
| chr12_59095476_59095647 | 101.07 |
Mia2 |
MIA SH3 domain ER export factor 2 |
238 |
0.83 |
| chr13_97300330_97300499 | 100.84 |
C430039J16Rik |
RIKEN cDNA C430039J16 gene |
17231 |
0.18 |
| chr13_4279342_4279679 | 97.60 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
77 |
0.97 |
| chr10_115263315_115263511 | 97.56 |
Gm8942 |
predicted gene 8942 |
6565 |
0.17 |
| chr1_172895002_172895185 | 97.52 |
Apcs |
serum amyloid P-component |
52 |
0.97 |
| chr1_88109131_88109476 | 95.47 |
Ugt1a6b |
UDP glucuronosyltransferase 1 family, polypeptide A6B |
2441 |
0.1 |
| chr7_118628011_118628267 | 95.00 |
Tmc5 |
transmembrane channel-like gene family 5 |
5597 |
0.17 |
| chr13_16292023_16292187 | 92.27 |
Gm48491 |
predicted gene, 48491 |
14267 |
0.21 |
| chr15_79690079_79691459 | 92.11 |
Gtpbp1 |
GTP binding protein 1 |
76 |
0.92 |
| chr10_115809220_115809545 | 91.64 |
Tspan8 |
tetraspanin 8 |
7450 |
0.27 |
| chr12_52446576_52446857 | 91.41 |
Gm47431 |
predicted gene, 47431 |
1409 |
0.46 |
| chr13_73680502_73680703 | 90.76 |
Slc6a18 |
solute carrier family 6 (neurotransmitter transporter), member 18 |
2579 |
0.21 |
| chr12_108710988_108711167 | 90.58 |
Degs2 |
delta(4)-desaturase, sphingolipid 2 |
8762 |
0.11 |
| chr3_121852211_121852459 | 90.13 |
Gm42593 |
predicted gene 42593 |
10507 |
0.15 |
| chr10_108067694_108067845 | 89.82 |
Gm47999 |
predicted gene, 47999 |
74663 |
0.1 |
| chr10_84886211_84886658 | 89.18 |
Ric8b |
RIC8 guanine nucleotide exchange factor B |
31182 |
0.17 |
| chr16_93368089_93368271 | 88.89 |
1810044K17Rik |
RIKEN cDNA 1810044K17 gene |
59 |
0.95 |
| chr5_66080858_66081152 | 88.43 |
Rbm47 |
RNA binding motif protein 47 |
5 |
0.96 |
| chr4_63172040_63172221 | 87.91 |
Kif12 |
kinesin family member 12 |
1 |
0.98 |
| chr9_63201505_63201702 | 87.73 |
Skor1 |
SKI family transcriptional corepressor 1 |
52642 |
0.12 |
| chr13_4233586_4233793 | 87.16 |
Akr1c19 |
aldo-keto reductase family 1, member C19 |
51 |
0.97 |
| chr15_79285406_79285956 | 86.99 |
Baiap2l2 |
BAI1-associated protein 2-like 2 |
144 |
0.91 |
| chr9_71663389_71664022 | 86.58 |
Cgnl1 |
cingulin-like 1 |
15355 |
0.21 |
| chr12_30943684_30943877 | 86.29 |
Sh3yl1 |
Sh3 domain YSC-like 1 |
31593 |
0.13 |
| chr3_89113073_89113337 | 86.28 |
Gm29704 |
predicted gene, 29704 |
3519 |
0.09 |
| chr1_59212186_59212347 | 86.22 |
Als2 |
alsin Rho guanine nucleotide exchange factor |
6860 |
0.17 |
| chr4_45453233_45453615 | 85.38 |
Shb |
src homology 2 domain-containing transforming protein B |
29378 |
0.12 |
| chr8_110792686_110792996 | 84.93 |
Il34 |
interleukin 34 |
1953 |
0.23 |
| chr7_70869109_70869264 | 84.79 |
Gm42397 |
predicted gene, 42397 |
1727 |
0.44 |
| chr19_4820548_4820699 | 84.59 |
Ccs |
copper chaperone for superoxide dismutase |
5386 |
0.08 |
| chr8_4837818_4838009 | 84.41 |
Gm44961 |
predicted gene 44961 |
16683 |
0.13 |
| chr11_50354825_50355149 | 84.31 |
Cby3 |
chibby family member 3 |
525 |
0.66 |
| chr16_36545491_36545642 | 83.38 |
Casr |
calcium-sensing receptor |
16040 |
0.11 |
| chr3_98044876_98045059 | 82.95 |
Gm42819 |
predicted gene 42819 |
14280 |
0.18 |
| chr19_55700934_55701097 | 82.52 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
40805 |
0.21 |
| chr14_73253542_73253713 | 81.85 |
Rb1 |
RB transcriptional corepressor 1 |
10694 |
0.17 |
| chr5_100567324_100567596 | 81.75 |
Plac8 |
placenta-specific 8 |
4037 |
0.16 |
| chr5_140034121_140034770 | 81.52 |
Gm43702 |
predicted gene 43702 |
2269 |
0.28 |
| chr13_70866959_70867347 | 81.45 |
8030423J24Rik |
RIKEN cDNA 8030423J24 gene |
15795 |
0.19 |
| chr14_12073815_12074036 | 81.19 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
17235 |
0.23 |
| chr19_42689878_42690041 | 81.05 |
Gm25216 |
predicted gene, 25216 |
9943 |
0.19 |
| chr18_37928346_37928846 | 80.82 |
Diaph1 |
diaphanous related formin 1 |
6785 |
0.09 |
| chr3_121530937_121531224 | 80.59 |
A530020G20Rik |
RIKEN cDNA A530020G20 gene |
539 |
0.67 |
| chr15_81897987_81898172 | 80.51 |
Aco2 |
aconitase 2, mitochondrial |
2773 |
0.13 |
| chr7_110088063_110088458 | 80.14 |
Zfp143 |
zinc finger protein 143 |
3369 |
0.16 |
| chr7_70501939_70502090 | 80.14 |
Gm7656 |
predicted gene 7656 |
11166 |
0.15 |
| chr4_123990693_123991181 | 79.98 |
Gm12902 |
predicted gene 12902 |
64703 |
0.08 |
| chr16_55532716_55533041 | 79.85 |
Mir5118 |
microRNA 5118 |
38147 |
0.19 |
| chr10_43441343_43441584 | 79.50 |
Gm3699 |
predicted gene 3699 |
15038 |
0.13 |
| chr17_74599040_74599233 | 79.16 |
Birc6 |
baculoviral IAP repeat-containing 6 |
1015 |
0.55 |
| chr11_115911824_115912039 | 78.89 |
Smim6 |
small integral membrane protein 6 |
86 |
0.93 |
| chr12_31256586_31256763 | 78.84 |
Gm32899 |
predicted gene, 32899 |
2183 |
0.18 |
| chr9_66769338_66769700 | 78.52 |
Car12 |
carbonic anhydrase 12 |
21809 |
0.12 |
| chr4_117136303_117136464 | 78.50 |
Plk3 |
polo like kinase 3 |
2420 |
0.1 |
| chr6_88049109_88049327 | 77.99 |
Rab7 |
RAB7, member RAS oncogene family |
3948 |
0.14 |
| chr11_57986265_57986424 | 77.70 |
Gm12249 |
predicted gene 12249 |
13210 |
0.15 |
| chr12_111817099_111817250 | 77.43 |
Zfyve21 |
zinc finger, FYVE domain containing 21 |
918 |
0.42 |
| chr6_17503828_17504004 | 77.24 |
Met |
met proto-oncogene |
12675 |
0.23 |
| chr7_35372700_35372880 | 77.06 |
Rhpn2 |
rhophilin, Rho GTPase binding protein 2 |
6492 |
0.14 |
| chr10_107941600_107941772 | 76.64 |
Gm29685 |
predicted gene, 29685 |
4959 |
0.28 |
| chr4_118240396_118240604 | 76.34 |
Ptprf |
protein tyrosine phosphatase, receptor type, F |
4055 |
0.2 |
| chr2_163547032_163547209 | 76.31 |
Hnf4a |
hepatic nuclear factor 4, alpha |
67 |
0.96 |
| chr4_141161724_141161914 | 75.53 |
Fbxo42 |
F-box protein 42 |
13897 |
0.11 |
| chr17_55903813_55903973 | 75.48 |
Zfp959 |
zinc finger protein 959 |
11425 |
0.1 |
| chr14_57089155_57089477 | 75.25 |
Gjb2 |
gap junction protein, beta 2 |
15386 |
0.14 |
| chr9_85377041_85377205 | 75.23 |
Gm48832 |
predicted gene, 48832 |
29058 |
0.13 |
| chr18_39828001_39828152 | 74.66 |
Pabpc2 |
poly(A) binding protein, cytoplasmic 2 |
54579 |
0.14 |
| chr5_64624277_64624487 | 74.44 |
Gm42565 |
predicted gene 42565 |
11458 |
0.12 |
| chr17_85043384_85043762 | 74.27 |
Slc3a1 |
solute carrier family 3, member 1 |
15197 |
0.17 |
| chr1_168708243_168708421 | 74.24 |
1700063I16Rik |
RIKEN cDNA 1700063I16 gene |
32450 |
0.25 |
| chr12_80103423_80104027 | 74.23 |
Zfp36l1 |
zinc finger protein 36, C3H type-like 1 |
9269 |
0.12 |
| chr2_9918820_9919008 | 74.04 |
Taf3 |
TATA-box binding protein associated factor 3 |
80 |
0.96 |
| chr11_24569735_24569998 | 73.78 |
Gm22787 |
predicted gene, 22787 |
15808 |
0.2 |
| chr17_57233114_57233482 | 73.52 |
C3 |
complement component 3 |
5162 |
0.12 |
| chr8_117334497_117335149 | 72.61 |
Cmip |
c-Maf inducing protein |
14347 |
0.24 |
| chr2_125615804_125616138 | 72.57 |
Cep152 |
centrosomal protein 152 |
9142 |
0.22 |
| chr19_43767654_43767827 | 72.56 |
Cutc |
cutC copper transporter |
2867 |
0.19 |
| chr14_25451921_25452103 | 72.32 |
Zmiz1os1 |
Zmiz1 opposite strand 1 |
5786 |
0.14 |
| chr14_79515207_79515376 | 72.10 |
Elf1 |
E74-like factor 1 |
383 |
0.84 |
| chr12_79561049_79561200 | 72.00 |
Rad51b |
RAD51 paralog B |
233771 |
0.02 |
| chr14_50991091_50991249 | 71.58 |
Gm49038 |
predicted gene, 49038 |
5905 |
0.08 |
| chr7_140913111_140913389 | 71.26 |
BC024386 |
cDNA sequence BC023486 |
7167 |
0.06 |
| chr8_25252569_25252996 | 71.18 |
Tacc1 |
transforming, acidic coiled-coil containing protein 1 |
3787 |
0.24 |
| chr9_109895636_109895978 | 71.11 |
Mir7089 |
microRNA 7089 |
6164 |
0.12 |
| chr5_138089120_138089321 | 71.02 |
Zkscan1 |
zinc finger with KRAB and SCAN domains 1 |
3420 |
0.11 |
| chr10_17651111_17651283 | 70.97 |
Gm47771 |
predicted gene, 47771 |
7316 |
0.25 |
| chr8_76912739_76912935 | 70.82 |
Nr3c2 |
nuclear receptor subfamily 3, group C, member 2 |
4565 |
0.24 |
| chr9_122815347_122815499 | 70.72 |
Tcaim |
T cell activation inhibitor, mitochondrial |
9820 |
0.12 |
| chr19_47053545_47053710 | 70.13 |
Gm50319 |
predicted gene, 50319 |
1621 |
0.21 |
| chr10_17408326_17408492 | 70.04 |
Gm47760 |
predicted gene, 47760 |
75532 |
0.09 |
| chr1_133309702_133309900 | 69.87 |
Golt1a |
golgi transport 1A |
1 |
0.5 |
| chr9_47321173_47321428 | 69.57 |
Gm31816 |
predicted gene, 31816 |
41450 |
0.18 |
| chr11_24146026_24146328 | 69.37 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
3798 |
0.19 |
| chr5_103981281_103981446 | 68.89 |
Hsd17b13 |
hydroxysteroid (17-beta) dehydrogenase 13 |
3953 |
0.16 |
| chr1_140415769_140416105 | 68.33 |
Kcnt2 |
potassium channel, subfamily T, member 2 |
26999 |
0.25 |
| chr10_99902739_99902899 | 68.30 |
Gm47579 |
predicted gene, 47579 |
36799 |
0.16 |
| chr9_61812393_61812659 | 68.25 |
Gm19208 |
predicted gene, 19208 |
39178 |
0.16 |
| chr10_69928456_69928792 | 68.13 |
Ank3 |
ankyrin 3, epithelial |
2491 |
0.42 |
| chr16_90412490_90412680 | 68.08 |
Hunk |
hormonally upregulated Neu-associated kinase |
12041 |
0.18 |
| chr6_138351080_138351249 | 67.95 |
Lmo3 |
LIM domain only 3 |
70288 |
0.11 |
| chr8_47652310_47652730 | 67.80 |
Gm8623 |
predicted gene 8623 |
19756 |
0.1 |
| chr17_48418119_48418309 | 67.74 |
Gm49893 |
predicted gene, 49893 |
934 |
0.42 |
| chr7_109191268_109192295 | 67.70 |
Lmo1 |
LIM domain only 1 |
16574 |
0.17 |
| chr13_24879758_24879991 | 67.64 |
D130043K22Rik |
RIKEN cDNA D130043K22 gene |
651 |
0.62 |
| chr13_114680541_114680791 | 67.58 |
4930544M13Rik |
RIKEN cDNA 4930544M13 gene |
73429 |
0.09 |
| chr11_77772304_77772596 | 67.56 |
Myo18a |
myosin XVIIIA |
299 |
0.87 |
| chr18_55042412_55042585 | 67.51 |
Gm4221 |
predicted gene 4221 |
15087 |
0.18 |
| chr2_146577252_146577409 | 67.43 |
4933406D12Rik |
RIKEN cDNA 4933406D12 gene |
34399 |
0.2 |
| chr1_20618019_20618176 | 67.17 |
Pkhd1 |
polycystic kidney and hepatic disease 1 |
33 |
0.98 |
| chr10_75429110_75429286 | 66.77 |
Upb1 |
ureidopropionase, beta |
1017 |
0.5 |
| chr19_10014816_10015132 | 66.60 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
42 |
0.96 |
| chr1_165348850_165349001 | 66.57 |
Dcaf6 |
DDB1 and CUL4 associated factor 6 |
3073 |
0.21 |
| chr12_76272882_76273056 | 66.49 |
Gm47526 |
predicted gene, 47526 |
4747 |
0.13 |
| chr9_14233753_14234098 | 66.16 |
Gm47565 |
predicted gene, 47565 |
17014 |
0.14 |
| chr19_31868623_31868825 | 66.15 |
A1cf |
APOBEC1 complementation factor |
40 |
0.98 |
| chr4_154294526_154294739 | 66.03 |
Arhgef16 |
Rho guanine nucleotide exchange factor (GEF) 16 |
5260 |
0.18 |
| chr6_38335385_38335568 | 66.02 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
18797 |
0.12 |
| chr15_10834317_10834685 | 65.94 |
Gm19276 |
predicted gene, 19276 |
19674 |
0.2 |
| chr1_73630448_73630632 | 65.94 |
C530043A13Rik |
RIKEN cDNA C530043A13 gene |
100750 |
0.06 |
| chr11_121085252_121085439 | 65.83 |
Sectm1a |
secreted and transmembrane 1A |
4125 |
0.1 |
| chr6_129510243_129510423 | 65.82 |
Tmem52b |
transmembrane protein 52B |
2222 |
0.14 |
| chr11_108251302_108251514 | 65.73 |
Gm11655 |
predicted gene 11655 |
69558 |
0.1 |
| chr16_88631538_88631715 | 65.52 |
2310079G19Rik |
RIKEN cDNA 2310079G19 gene |
3960 |
0.12 |
| chr5_134913846_134914156 | 65.45 |
Cldn13 |
claudin 13 |
1525 |
0.2 |
| chr17_43113681_43113832 | 65.33 |
E130008D07Rik |
RIKEN cDNA E130008D07 gene |
44440 |
0.18 |
| chr6_72961689_72961879 | 65.15 |
Tmsb10 |
thymosin, beta 10 |
3036 |
0.2 |
| chr14_29996026_29996395 | 65.11 |
Il17rb |
interleukin 17 receptor B |
2249 |
0.18 |
| chr1_64787464_64787940 | 65.00 |
Plekhm3 |
pleckstrin homology domain containing, family M, member 3 |
49062 |
0.1 |
| chr6_116286399_116286591 | 64.96 |
Zfand4 |
zinc finger, AN1-type domain 4 |
58 |
0.96 |
| chr19_5816056_5816257 | 64.93 |
Gm27702 |
predicted gene, 27702 |
8551 |
0.07 |
| chr7_101083858_101084024 | 64.84 |
Fchsd2 |
FCH and double SH3 domains 2 |
8922 |
0.16 |
| chr7_65337972_65338245 | 64.78 |
Tjp1 |
tight junction protein 1 |
4689 |
0.24 |
| chr7_89434277_89434601 | 64.61 |
AI314278 |
expressed sequence AI314278 |
8100 |
0.16 |
| chr19_4033370_4033521 | 64.58 |
Gstp1 |
glutathione S-transferase, pi 1 |
2548 |
0.09 |
| chr5_105758216_105758376 | 64.55 |
Lrrc8d |
leucine rich repeat containing 8D |
26066 |
0.16 |
| chr11_109705801_109705979 | 64.40 |
Fam20a |
family with sequence similarity 20, member A |
16366 |
0.17 |
| chr7_103865311_103865713 | 64.39 |
Hbb-y |
hemoglobin Y, beta-like embryonic chain |
12296 |
0.06 |
| chr4_57282767_57282979 | 64.34 |
Gm12536 |
predicted gene 12536 |
17223 |
0.18 |
| chr2_173977680_173977839 | 64.28 |
Atp5k-ps2 |
ATP synthase, H+ transporting, mitochondrial F1F0 complex, subunit E, pseudogene 2 |
6932 |
0.22 |
| chr15_99382954_99383108 | 64.28 |
Tmbim6 |
transmembrane BAX inhibitor motif containing 6 |
9851 |
0.09 |
| chr6_143152229_143152730 | 64.21 |
Gm31108 |
predicted gene, 31108 |
1452 |
0.33 |
| chr14_76805295_76805664 | 64.18 |
Gm30246 |
predicted gene, 30246 |
24652 |
0.16 |
| chr2_147968629_147969002 | 64.05 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
7370 |
0.24 |
| chr1_51720415_51720582 | 64.04 |
Gm28055 |
predicted gene 28055 |
22598 |
0.19 |
| chr12_84042265_84042557 | 64.02 |
Acot4 |
acyl-CoA thioesterase 4 |
138 |
0.9 |
| chr2_90565279_90565551 | 63.96 |
Ptprj |
protein tyrosine phosphatase, receptor type, J |
15232 |
0.21 |
| chr8_126736428_126737199 | 63.95 |
Gm45805 |
predicted gene 45805 |
21521 |
0.23 |
| chr14_63093722_63093873 | 63.81 |
Gm17941 |
predicted gene, 17941 |
1541 |
0.28 |
| chr10_69165965_69166116 | 63.63 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
14606 |
0.16 |
| chr16_30053031_30053512 | 63.54 |
Hes1 |
hes family bHLH transcription factor 1 |
11113 |
0.15 |
| chr8_20372500_20373383 | 63.52 |
Gm7807 |
predicted gene 7807 |
8140 |
0.18 |
| chr19_43986489_43986681 | 63.48 |
Cpn1 |
carboxypeptidase N, polypeptide 1 |
29 |
0.97 |
| chr11_116098784_116098935 | 63.41 |
Trim47 |
tripartite motif-containing 47 |
8224 |
0.1 |
| chr15_55265835_55266054 | 63.40 |
Gm26296 |
predicted gene, 26296 |
3341 |
0.29 |
| chr15_38640886_38641047 | 63.34 |
1100001I12Rik |
RIKEN cDNA 1100001I12 gene |
18873 |
0.14 |
| chr15_83455127_83455285 | 63.33 |
Pacsin2 |
protein kinase C and casein kinase substrate in neurons 2 |
9346 |
0.15 |
| chr2_27626687_27626870 | 63.26 |
Rxra |
retinoid X receptor alpha |
49662 |
0.13 |
| chr2_29035787_29036046 | 63.19 |
Cfap77 |
cilia and flagella associated protein 77 |
3444 |
0.21 |
| chr11_110010816_110011149 | 63.18 |
Abca8b |
ATP-binding cassette, sub-family A (ABC1), member 8b |
15137 |
0.2 |
| chr19_38372467_38373000 | 63.18 |
Gm50155 |
predicted gene, 50155 |
12781 |
0.14 |
| chr13_104641151_104641346 | 62.95 |
2610204G07Rik |
RIKEN cDNA 2610204G07 gene |
43683 |
0.19 |
| chr10_118629771_118629922 | 62.95 |
Ifngas1 |
Ifng antisense RNA 1 |
73321 |
0.08 |
| chr2_156951420_156951582 | 62.79 |
Ndrg3 |
N-myc downstream regulated gene 3 |
1892 |
0.21 |
| chr8_125930402_125930585 | 62.71 |
Map3k21 |
mitogen-activated protein kinase kinase kinase 21 |
20043 |
0.17 |
| chr9_103090078_103090422 | 62.69 |
Gm47468 |
predicted gene, 47468 |
4713 |
0.18 |
| chr1_42496135_42496293 | 62.56 |
Gm37047 |
predicted gene, 37047 |
4401 |
0.3 |
| chr14_25452158_25452322 | 62.36 |
Zmiz1os1 |
Zmiz1 opposite strand 1 |
5558 |
0.14 |
| chr18_70437586_70437747 | 62.34 |
Gm45879 |
predicted gene 45879 |
3810 |
0.22 |
| chr1_125676771_125677048 | 62.31 |
Gpr39 |
G protein-coupled receptor 39 |
86 |
0.98 |
| chr8_127441166_127441496 | 62.30 |
Pard3 |
par-3 family cell polarity regulator |
6415 |
0.32 |
| chr13_65011168_65011341 | 62.28 |
Gm6888 |
predicted gene 6888 |
12320 |
0.13 |
| chr1_164471753_164471905 | 62.22 |
Gm32391 |
predicted gene, 32391 |
9387 |
0.14 |
| chr14_117674551_117674852 | 62.21 |
Mir6239 |
microRNA 6239 |
279146 |
0.01 |
| chr14_30341917_30342068 | 62.11 |
Cacna1d |
calcium channel, voltage-dependent, L type, alpha 1D subunit |
10972 |
0.18 |
| chr16_72830512_72830669 | 62.00 |
Robo1 |
roundabout guidance receptor 1 |
145759 |
0.05 |
| chr5_36558050_36558217 | 61.94 |
Tbc1d14 |
TBC1 domain family, member 14 |
5923 |
0.17 |
| chr6_137570946_137571138 | 61.91 |
Eps8 |
epidermal growth factor receptor pathway substrate 8 |
25 |
0.98 |
| chr10_3978461_3978645 | 61.81 |
Mthfd1l |
methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 1-like |
5409 |
0.17 |
| chr5_57782194_57782347 | 61.79 |
Gm42481 |
predicted gene 42481 |
3397 |
0.17 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 64.2 | 192.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 33.7 | 101.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 33.0 | 66.0 | GO:0035483 | gastric emptying(GO:0035483) |
| 32.6 | 97.9 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 32.4 | 97.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 32.0 | 96.1 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 32.0 | 128.0 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 29.9 | 119.8 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 26.7 | 106.7 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 26.0 | 51.9 | GO:0008228 | opsonization(GO:0008228) |
| 25.6 | 76.8 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 24.6 | 73.7 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 24.6 | 73.7 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 23.9 | 71.7 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
| 23.0 | 69.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 22.2 | 110.8 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 21.3 | 106.4 | GO:1904970 | brush border assembly(GO:1904970) |
| 20.9 | 41.9 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 20.4 | 40.8 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 20.0 | 60.1 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 19.3 | 57.8 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 18.5 | 55.4 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 18.0 | 53.9 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 17.9 | 107.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 17.8 | 53.5 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 17.8 | 106.8 | GO:0015871 | choline transport(GO:0015871) |
| 17.5 | 70.0 | GO:0072039 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 17.4 | 87.2 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 17.2 | 86.0 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 16.9 | 67.7 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 16.7 | 67.0 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 16.6 | 49.8 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 16.1 | 64.4 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 15.1 | 45.2 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 14.9 | 29.8 | GO:0001705 | ectoderm formation(GO:0001705) |
| 14.7 | 58.6 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 14.4 | 72.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 14.3 | 57.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 14.0 | 41.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 13.9 | 69.5 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 13.7 | 27.4 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
| 13.6 | 40.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 13.1 | 39.2 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 13.1 | 39.2 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 12.9 | 103.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 12.9 | 51.5 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 12.7 | 63.3 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 12.3 | 98.6 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 12.2 | 24.4 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 12.1 | 60.7 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 12.1 | 36.4 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 12.1 | 36.3 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 12.0 | 48.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 12.0 | 48.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 12.0 | 71.9 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 11.6 | 46.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 11.5 | 23.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 11.2 | 11.2 | GO:0061724 | lipophagy(GO:0061724) |
| 11.2 | 33.5 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 11.0 | 43.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 10.9 | 10.9 | GO:1901656 | glycoside transport(GO:1901656) |
| 10.8 | 32.4 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 10.8 | 53.8 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 10.5 | 10.5 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 10.5 | 31.6 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 10.0 | 30.1 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 10.0 | 20.0 | GO:0006868 | glutamine transport(GO:0006868) |
| 9.7 | 19.5 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 9.6 | 28.9 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 9.5 | 28.4 | GO:0032439 | endosome localization(GO:0032439) |
| 9.3 | 18.6 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 9.3 | 83.7 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 9.3 | 9.3 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 9.2 | 27.7 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 9.2 | 36.6 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 9.2 | 73.2 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
| 9.0 | 18.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) positive regulation of gap junction assembly(GO:1903598) |
| 9.0 | 45.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 8.8 | 35.2 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 8.7 | 8.7 | GO:0003134 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 8.6 | 43.0 | GO:0046618 | drug export(GO:0046618) |
| 8.6 | 8.6 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 8.5 | 34.2 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 8.5 | 67.8 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 8.4 | 16.8 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 8.4 | 33.5 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 8.3 | 33.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 8.2 | 24.7 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 8.2 | 24.6 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 8.1 | 40.4 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 8.0 | 32.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 8.0 | 23.9 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 7.9 | 39.6 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 7.9 | 23.7 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 7.9 | 31.5 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 7.8 | 31.2 | GO:0019532 | oxalate transport(GO:0019532) |
| 7.7 | 23.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 7.7 | 69.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 7.7 | 77.0 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 7.6 | 15.2 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 7.6 | 7.6 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 7.5 | 30.2 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 7.5 | 22.6 | GO:0097503 | sialylation(GO:0097503) |
| 7.5 | 7.5 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 7.4 | 29.5 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 7.2 | 28.8 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 7.2 | 223.1 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 7.1 | 7.1 | GO:0010039 | response to iron ion(GO:0010039) |
| 7.1 | 42.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 7.1 | 14.2 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
| 7.0 | 27.8 | GO:0003383 | apical constriction(GO:0003383) |
| 6.9 | 20.7 | GO:0060596 | mammary placode formation(GO:0060596) |
| 6.8 | 27.3 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 6.8 | 20.4 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 6.8 | 20.4 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 6.7 | 20.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 6.7 | 93.6 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 6.6 | 46.4 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 6.6 | 59.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 6.6 | 85.4 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 6.5 | 32.6 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 6.5 | 19.5 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 6.5 | 26.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 6.5 | 32.4 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 6.4 | 19.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 6.4 | 63.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 6.4 | 95.9 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 6.4 | 25.5 | GO:0072611 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
| 6.4 | 6.4 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
| 6.3 | 19.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 6.3 | 19.0 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 6.3 | 19.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 6.3 | 44.2 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) |
| 6.3 | 18.9 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 6.3 | 12.6 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
| 6.3 | 12.6 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 6.2 | 18.6 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 6.2 | 24.8 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 6.1 | 24.6 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 6.1 | 24.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 6.1 | 18.4 | GO:0070836 | caveola assembly(GO:0070836) |
| 6.1 | 12.2 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
| 6.1 | 85.5 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 6.1 | 24.4 | GO:0009597 | detection of virus(GO:0009597) |
| 6.0 | 18.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 6.0 | 24.1 | GO:0006116 | NADH oxidation(GO:0006116) |
| 6.0 | 23.9 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 6.0 | 11.9 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 6.0 | 17.9 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 5.9 | 47.2 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 5.9 | 29.5 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 5.9 | 29.4 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 5.9 | 17.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 5.9 | 23.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 5.9 | 17.6 | GO:0006562 | proline catabolic process(GO:0006562) |
| 5.8 | 17.5 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 5.8 | 29.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 5.8 | 23.3 | GO:0021590 | cerebellum maturation(GO:0021590) |
| 5.8 | 64.1 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 5.7 | 17.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 5.7 | 22.6 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 5.6 | 90.4 | GO:0051180 | vitamin transport(GO:0051180) |
| 5.6 | 28.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 5.6 | 16.8 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 5.6 | 44.6 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 5.5 | 16.6 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 5.5 | 16.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 5.5 | 81.8 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 5.4 | 43.5 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 5.4 | 43.5 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 5.4 | 16.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 5.4 | 26.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 5.3 | 10.7 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 5.3 | 16.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 5.3 | 21.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 5.3 | 15.9 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 5.3 | 63.4 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 5.3 | 5.3 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 5.3 | 10.5 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
| 5.3 | 15.8 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 5.2 | 10.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 5.2 | 5.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 5.2 | 114.9 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 5.2 | 31.3 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 5.2 | 15.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 5.2 | 20.7 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 5.2 | 36.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 5.1 | 5.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 5.1 | 25.7 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 5.1 | 15.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 5.1 | 35.6 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 5.0 | 25.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 5.0 | 90.4 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 4.9 | 19.8 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 4.9 | 14.8 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 4.9 | 9.8 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 4.9 | 9.8 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 4.9 | 29.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 4.9 | 24.4 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 4.9 | 9.7 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
| 4.8 | 9.7 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 4.8 | 53.0 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 4.8 | 4.8 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 4.8 | 19.0 | GO:0051639 | actin filament network formation(GO:0051639) |
| 4.7 | 9.5 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 4.7 | 14.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 4.7 | 70.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 4.7 | 51.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 4.7 | 18.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 4.7 | 18.7 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 4.6 | 69.7 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 4.6 | 27.7 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 4.6 | 36.8 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 4.6 | 27.4 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 4.5 | 22.7 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 4.5 | 40.7 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 4.5 | 31.5 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 4.5 | 117.0 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 4.5 | 40.5 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 4.5 | 4.5 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 4.5 | 13.4 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 4.4 | 4.4 | GO:1900238 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 4.4 | 13.3 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 4.4 | 13.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 4.4 | 39.9 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) |
| 4.4 | 30.9 | GO:0046415 | urate metabolic process(GO:0046415) |
| 4.4 | 57.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 4.3 | 12.9 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 4.3 | 25.7 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 4.3 | 25.6 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 4.3 | 4.3 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 4.3 | 17.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 4.3 | 51.1 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 4.2 | 17.0 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 4.2 | 21.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 4.2 | 21.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 4.2 | 21.1 | GO:1904752 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 4.2 | 12.6 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 4.2 | 4.2 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 4.2 | 16.8 | GO:0032328 | alanine transport(GO:0032328) |
| 4.2 | 16.8 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 4.2 | 12.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 4.2 | 16.6 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 4.1 | 8.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 4.1 | 86.5 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 4.1 | 4.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 4.1 | 8.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 4.1 | 16.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 4.0 | 4.0 | GO:1901071 | glucosamine-containing compound metabolic process(GO:1901071) |
| 4.0 | 12.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 4.0 | 12.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 4.0 | 15.9 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 3.9 | 11.8 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 3.9 | 7.8 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 3.9 | 23.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 3.9 | 35.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 3.9 | 3.9 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 3.9 | 3.9 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 3.9 | 27.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 3.9 | 7.8 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 3.9 | 15.5 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 3.9 | 15.5 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 3.9 | 7.7 | GO:0002432 | granuloma formation(GO:0002432) |
| 3.9 | 15.4 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 3.8 | 11.5 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 3.8 | 23.0 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 3.8 | 7.7 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 3.8 | 26.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 3.8 | 3.8 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 3.8 | 45.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 3.8 | 30.4 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 3.8 | 26.5 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 3.8 | 7.5 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 3.8 | 22.5 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 3.8 | 11.3 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 3.7 | 7.5 | GO:0007567 | parturition(GO:0007567) |
| 3.7 | 11.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 3.7 | 14.9 | GO:0035627 | ceramide transport(GO:0035627) |
| 3.7 | 3.7 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 3.7 | 11.1 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 3.7 | 33.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 3.7 | 11.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 3.7 | 29.5 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
| 3.7 | 18.3 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 3.7 | 14.6 | GO:0042493 | response to drug(GO:0042493) |
| 3.6 | 7.3 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 3.6 | 14.5 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 3.6 | 28.9 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 3.6 | 25.2 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 3.6 | 3.6 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 3.6 | 10.7 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 3.6 | 14.3 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 3.6 | 25.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 3.5 | 7.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 3.5 | 14.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 3.5 | 17.5 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 3.5 | 10.5 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 3.5 | 7.0 | GO:0042737 | drug catabolic process(GO:0042737) |
| 3.5 | 7.0 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 3.5 | 13.9 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 3.5 | 17.3 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 3.4 | 55.2 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 3.4 | 3.4 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 3.4 | 37.9 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 3.4 | 27.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 3.4 | 175.0 | GO:0035725 | sodium ion transmembrane transport(GO:0035725) |
| 3.4 | 10.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 3.4 | 6.8 | GO:0006573 | valine metabolic process(GO:0006573) |
| 3.4 | 23.9 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 3.4 | 6.8 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 3.4 | 3.4 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 3.4 | 10.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 3.4 | 13.5 | GO:0007619 | courtship behavior(GO:0007619) |
| 3.4 | 87.8 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 3.4 | 3.4 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 3.4 | 10.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 3.4 | 10.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 3.3 | 30.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 3.3 | 16.7 | GO:0006865 | amino acid transport(GO:0006865) |
| 3.3 | 10.0 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 3.3 | 16.6 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 3.3 | 6.6 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 3.3 | 26.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 3.3 | 6.6 | GO:0042938 | dipeptide transport(GO:0042938) |
| 3.3 | 6.6 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
| 3.3 | 39.2 | GO:0006968 | cellular defense response(GO:0006968) |
| 3.3 | 16.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 3.2 | 12.9 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 3.2 | 16.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 3.2 | 6.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 3.2 | 19.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 3.2 | 12.8 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 3.2 | 9.6 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 3.2 | 15.9 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 3.2 | 9.5 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 3.2 | 15.8 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 3.2 | 15.8 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 3.1 | 6.3 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 3.1 | 31.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 3.1 | 56.4 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 3.1 | 6.2 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 3.1 | 9.3 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 3.1 | 6.2 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 3.1 | 6.2 | GO:0031947 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 3.1 | 3.1 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 3.1 | 3.1 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 3.1 | 6.2 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 3.1 | 18.4 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 3.1 | 21.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 3.1 | 9.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 3.0 | 9.1 | GO:0030242 | pexophagy(GO:0030242) |
| 3.0 | 3.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 3.0 | 3.0 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
| 3.0 | 9.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 3.0 | 15.1 | GO:0015671 | oxygen transport(GO:0015671) |
| 3.0 | 3.0 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
| 3.0 | 18.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 3.0 | 6.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 3.0 | 18.0 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 3.0 | 9.0 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 3.0 | 6.0 | GO:0070920 | regulation of production of small RNA involved in gene silencing by RNA(GO:0070920) |
| 3.0 | 26.9 | GO:0051014 | actin filament severing(GO:0051014) |
| 3.0 | 3.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 3.0 | 3.0 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 2.9 | 2.9 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
| 2.9 | 5.9 | GO:0014002 | astrocyte development(GO:0014002) |
| 2.9 | 17.6 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 2.9 | 11.7 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 2.9 | 23.3 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 2.9 | 17.4 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 2.9 | 8.7 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 2.9 | 11.6 | GO:0016264 | gap junction assembly(GO:0016264) |
| 2.9 | 52.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 2.9 | 8.7 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 2.9 | 5.8 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 2.9 | 2.9 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 2.9 | 14.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 2.9 | 2.9 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 2.9 | 8.6 | GO:0000087 | mitotic M phase(GO:0000087) |
| 2.9 | 8.6 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 2.8 | 8.5 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 2.8 | 2.8 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 2.8 | 5.6 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 2.8 | 16.9 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 2.8 | 2.8 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
| 2.8 | 14.0 | GO:0006477 | protein sulfation(GO:0006477) |
| 2.8 | 2.8 | GO:0036394 | amylase secretion(GO:0036394) |
| 2.8 | 16.7 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 2.8 | 13.9 | GO:0015669 | gas transport(GO:0015669) |
| 2.8 | 11.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 2.8 | 5.5 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 2.8 | 5.5 | GO:0035989 | tendon development(GO:0035989) |
| 2.8 | 35.8 | GO:0045116 | protein neddylation(GO:0045116) |
| 2.7 | 5.5 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 2.7 | 5.5 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 2.7 | 21.8 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 2.7 | 8.2 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 2.7 | 86.9 | GO:0051058 | negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 2.7 | 13.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 2.7 | 8.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 2.7 | 8.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 2.7 | 5.4 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 2.7 | 8.0 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 2.7 | 8.0 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 2.7 | 5.3 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 2.7 | 21.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 2.7 | 5.3 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 2.7 | 5.3 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
| 2.7 | 13.3 | GO:0060056 | mammary gland involution(GO:0060056) |
| 2.6 | 2.6 | GO:0051182 | coenzyme transport(GO:0051182) |
| 2.6 | 5.3 | GO:0048254 | snoRNA localization(GO:0048254) |
| 2.6 | 7.9 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 2.6 | 36.9 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 2.6 | 21.1 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 2.6 | 5.3 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
| 2.6 | 36.6 | GO:0046460 | neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 2.6 | 7.8 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 2.6 | 10.4 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 2.6 | 10.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 2.6 | 26.1 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 2.6 | 2.6 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 2.6 | 10.4 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 2.6 | 10.4 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 2.6 | 31.0 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 2.6 | 180.3 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 2.6 | 12.9 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 2.6 | 12.8 | GO:0015879 | carnitine transport(GO:0015879) |
| 2.6 | 15.4 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 2.6 | 2.6 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 2.6 | 7.7 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 2.6 | 7.7 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 2.6 | 2.6 | GO:1904396 | regulation of neuromuscular junction development(GO:1904396) |
| 2.5 | 7.6 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 2.5 | 7.6 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 2.5 | 2.5 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 2.5 | 2.5 | GO:0015747 | urate transport(GO:0015747) |
| 2.5 | 7.6 | GO:0032898 | neurotrophin production(GO:0032898) |
| 2.5 | 10.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 2.5 | 7.6 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 2.5 | 12.7 | GO:0080009 | mRNA methylation(GO:0080009) |
| 2.5 | 20.2 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 2.5 | 5.1 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 2.5 | 25.2 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
| 2.5 | 15.1 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 2.5 | 22.6 | GO:0009648 | photoperiodism(GO:0009648) |
| 2.5 | 7.5 | GO:0072553 | terminal button organization(GO:0072553) |
| 2.5 | 19.9 | GO:0007097 | nuclear migration(GO:0007097) |
| 2.5 | 14.9 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
| 2.5 | 5.0 | GO:0032507 | maintenance of protein location in cell(GO:0032507) |
| 2.5 | 7.4 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 2.5 | 14.8 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 2.5 | 39.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 2.5 | 12.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 2.4 | 2.4 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 2.4 | 14.7 | GO:0060068 | vagina development(GO:0060068) |
| 2.4 | 14.6 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 2.4 | 7.3 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 2.4 | 19.5 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 2.4 | 17.0 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) |
| 2.4 | 7.3 | GO:0051775 | response to redox state(GO:0051775) |
| 2.4 | 9.7 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 2.4 | 7.3 | GO:0030857 | negative regulation of epithelial cell differentiation(GO:0030857) |
| 2.4 | 7.3 | GO:0071440 | histone H3-K14 acetylation(GO:0044154) regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 2.4 | 7.2 | GO:0048069 | eye pigmentation(GO:0048069) |
| 2.4 | 4.8 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 2.4 | 2.4 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
| 2.4 | 4.8 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
| 2.4 | 19.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 2.4 | 7.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 2.4 | 4.8 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 2.4 | 7.2 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 2.4 | 4.8 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 2.4 | 4.8 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 2.4 | 2.4 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 2.4 | 4.7 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 2.4 | 96.9 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 2.4 | 7.1 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 2.4 | 2.4 | GO:0010594 | regulation of endothelial cell migration(GO:0010594) |
| 2.4 | 2.4 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 2.4 | 23.5 | GO:0036035 | osteoclast development(GO:0036035) |
| 2.3 | 4.7 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
| 2.3 | 16.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 2.3 | 4.7 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 2.3 | 11.7 | GO:0001765 | membrane raft assembly(GO:0001765) |
| 2.3 | 2.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 2.3 | 9.3 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 2.3 | 9.3 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 2.3 | 7.0 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 2.3 | 6.9 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 2.3 | 9.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 2.3 | 4.6 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 2.3 | 11.5 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 2.3 | 13.8 | GO:0051013 | microtubule severing(GO:0051013) |
| 2.3 | 6.9 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 2.3 | 13.8 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 2.3 | 4.6 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 2.3 | 6.9 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 2.3 | 4.6 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 2.3 | 6.8 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 2.3 | 4.6 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 2.3 | 6.8 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 2.3 | 4.6 | GO:0019627 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 2.3 | 2.3 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 2.3 | 68.0 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 2.3 | 20.4 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 2.3 | 6.8 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 2.3 | 6.8 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 2.3 | 22.5 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 2.3 | 6.8 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 2.2 | 6.7 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 2.2 | 13.5 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 2.2 | 8.9 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 2.2 | 22.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 2.2 | 4.5 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 2.2 | 44.5 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
| 2.2 | 4.4 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 2.2 | 20.0 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 2.2 | 11.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 2.2 | 8.9 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 2.2 | 2.2 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 2.2 | 2.2 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 2.2 | 13.3 | GO:0050892 | intestinal absorption(GO:0050892) |
| 2.2 | 8.9 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 2.2 | 13.3 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 2.2 | 17.7 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
| 2.2 | 6.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 2.2 | 17.6 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 2.2 | 4.4 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 2.2 | 26.3 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
| 2.2 | 59.0 | GO:0019915 | lipid storage(GO:0019915) |
| 2.2 | 4.4 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 2.2 | 13.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 2.2 | 2.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 2.2 | 4.4 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 2.2 | 6.5 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 2.2 | 15.2 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 2.2 | 26.1 | GO:0006828 | manganese ion transport(GO:0006828) |
| 2.2 | 6.5 | GO:0060214 | endocardium formation(GO:0060214) |
| 2.2 | 8.6 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 2.2 | 2.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 2.2 | 4.3 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
| 2.2 | 2.2 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 2.1 | 2.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 2.1 | 2.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 2.1 | 6.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 2.1 | 32.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 2.1 | 4.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 2.1 | 8.5 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 2.1 | 4.2 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 2.1 | 12.7 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 2.1 | 52.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 2.1 | 6.3 | GO:0046836 | glycolipid transport(GO:0046836) |
| 2.1 | 10.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 2.1 | 2.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 2.1 | 12.6 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 2.1 | 18.8 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 2.1 | 35.6 | GO:0010107 | potassium ion import(GO:0010107) |
| 2.1 | 18.8 | GO:0019985 | translesion synthesis(GO:0019985) |
| 2.1 | 20.9 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 2.1 | 25.0 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 2.1 | 2.1 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
| 2.1 | 20.8 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 2.1 | 2.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 2.1 | 4.2 | GO:1901890 | positive regulation of focal adhesion assembly(GO:0051894) positive regulation of cell junction assembly(GO:1901890) |
| 2.1 | 10.4 | GO:0060613 | fat pad development(GO:0060613) |
| 2.1 | 12.5 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 2.1 | 6.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 2.1 | 8.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 2.1 | 10.4 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 2.1 | 2.1 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 2.1 | 2.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) neural plate regionalization(GO:0060897) |
| 2.1 | 10.3 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 2.1 | 10.3 | GO:0061042 | vascular wound healing(GO:0061042) |
| 2.0 | 4.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 2.0 | 4.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 2.0 | 12.3 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 2.0 | 14.3 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 2.0 | 4.1 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 2.0 | 14.3 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 2.0 | 14.3 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 2.0 | 6.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 2.0 | 83.4 | GO:0051056 | regulation of small GTPase mediated signal transduction(GO:0051056) |
| 2.0 | 10.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 2.0 | 2.0 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 2.0 | 4.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 2.0 | 4.0 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 2.0 | 14.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 2.0 | 12.1 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 2.0 | 10.0 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 2.0 | 4.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 2.0 | 8.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 2.0 | 2.0 | GO:0070206 | protein trimerization(GO:0070206) |
| 2.0 | 2.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 2.0 | 6.0 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 2.0 | 19.9 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 2.0 | 45.6 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) |
| 2.0 | 17.8 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 2.0 | 9.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 2.0 | 5.9 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 2.0 | 5.9 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 2.0 | 2.0 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 2.0 | 2.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 2.0 | 2.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 2.0 | 2.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 2.0 | 15.7 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 2.0 | 58.5 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 2.0 | 2.0 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 1.9 | 11.7 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 1.9 | 7.8 | GO:0000187 | activation of MAPK activity(GO:0000187) |
| 1.9 | 3.9 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 1.9 | 7.8 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 1.9 | 11.6 | GO:0002934 | desmosome organization(GO:0002934) |
| 1.9 | 3.9 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 1.9 | 5.8 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 1.9 | 5.8 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 1.9 | 1.9 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 1.9 | 1.9 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 1.9 | 1.9 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 1.9 | 15.4 | GO:0006790 | sulfur compound metabolic process(GO:0006790) |
| 1.9 | 21.1 | GO:0009303 | rRNA transcription(GO:0009303) |
| 1.9 | 40.2 | GO:0051591 | response to cAMP(GO:0051591) |
| 1.9 | 3.8 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 1.9 | 5.7 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 1.9 | 5.7 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 1.9 | 1.9 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 1.9 | 7.6 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 1.9 | 91.2 | GO:0031929 | TOR signaling(GO:0031929) |
| 1.9 | 15.2 | GO:0009650 | UV protection(GO:0009650) |
| 1.9 | 17.0 | GO:0007614 | short-term memory(GO:0007614) |
| 1.9 | 5.6 | GO:0030449 | regulation of complement activation(GO:0030449) |
| 1.9 | 9.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 1.9 | 1.9 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 1.9 | 9.4 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 1.9 | 7.5 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 1.9 | 1.9 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
| 1.9 | 5.6 | GO:0050955 | thermoception(GO:0050955) |
| 1.9 | 33.6 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 1.9 | 7.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 1.9 | 3.7 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 1.9 | 9.3 | GO:0097264 | self proteolysis(GO:0097264) |
| 1.9 | 5.6 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 1.9 | 1.9 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 1.9 | 3.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 1.9 | 31.5 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 1.9 | 9.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 1.8 | 7.4 | GO:0070431 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 1.8 | 7.4 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 1.8 | 7.4 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 1.8 | 5.5 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
| 1.8 | 1.8 | GO:0071466 | cellular response to xenobiotic stimulus(GO:0071466) |
| 1.8 | 5.5 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 1.8 | 3.7 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.8 | 7.3 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
| 1.8 | 5.5 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 1.8 | 11.0 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
| 1.8 | 5.5 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 1.8 | 7.3 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 1.8 | 23.8 | GO:0006465 | signal peptide processing(GO:0006465) |
| 1.8 | 5.5 | GO:0070417 | cellular response to cold(GO:0070417) |
| 1.8 | 5.5 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
| 1.8 | 9.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 1.8 | 3.6 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 1.8 | 5.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 1.8 | 14.5 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 1.8 | 10.8 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 1.8 | 1.8 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 1.8 | 3.6 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 1.8 | 9.0 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 1.8 | 7.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 1.8 | 10.8 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 1.8 | 9.0 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 1.8 | 7.2 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 1.8 | 5.4 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 1.8 | 1.8 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 1.8 | 8.9 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 1.8 | 8.9 | GO:0046697 | decidualization(GO:0046697) |
| 1.8 | 3.6 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
| 1.8 | 16.1 | GO:0070166 | enamel mineralization(GO:0070166) |
| 1.8 | 3.6 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 1.8 | 7.1 | GO:0030033 | microvillus assembly(GO:0030033) |
| 1.8 | 1.8 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
| 1.8 | 19.5 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 1.8 | 3.5 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 1.8 | 7.1 | GO:0016556 | mRNA modification(GO:0016556) |
| 1.8 | 3.5 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 1.8 | 17.7 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 1.8 | 19.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 1.8 | 3.5 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 1.8 | 1.8 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
| 1.8 | 1.8 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 1.8 | 3.5 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 1.7 | 3.5 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 1.7 | 1.7 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
| 1.7 | 10.5 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 1.7 | 5.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 1.7 | 1.7 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 1.7 | 3.5 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 1.7 | 19.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 1.7 | 3.5 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 1.7 | 3.5 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 1.7 | 3.4 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 1.7 | 5.2 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 1.7 | 13.8 | GO:0010388 | cullin deneddylation(GO:0010388) |
| 1.7 | 12.0 | GO:0006706 | steroid catabolic process(GO:0006706) |
| 1.7 | 17.1 | GO:0042312 | regulation of vasodilation(GO:0042312) |
| 1.7 | 1.7 | GO:0050904 | diapedesis(GO:0050904) |
| 1.7 | 6.8 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 1.7 | 3.4 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 1.7 | 35.8 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 1.7 | 8.5 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 1.7 | 15.3 | GO:0006721 | terpenoid metabolic process(GO:0006721) |
| 1.7 | 6.8 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 1.7 | 6.7 | GO:0043471 | regulation of carbohydrate catabolic process(GO:0043470) regulation of cellular carbohydrate catabolic process(GO:0043471) |
| 1.7 | 1.7 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 1.7 | 6.7 | GO:0032060 | bleb assembly(GO:0032060) |
| 1.7 | 13.4 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
| 1.7 | 16.7 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 1.7 | 1.7 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 1.7 | 34.9 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 1.7 | 5.0 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 1.7 | 19.9 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 1.7 | 3.3 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
| 1.7 | 1.7 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 1.7 | 1.7 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 1.7 | 5.0 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 1.7 | 1.7 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 1.6 | 3.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 1.6 | 1.6 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 1.6 | 9.9 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 1.6 | 54.3 | GO:0006284 | base-excision repair(GO:0006284) |
| 1.6 | 18.1 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 1.6 | 4.9 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 1.6 | 8.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 1.6 | 24.6 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 1.6 | 23.0 | GO:0001952 | regulation of cell-matrix adhesion(GO:0001952) |
| 1.6 | 6.6 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 1.6 | 22.9 | GO:0046889 | positive regulation of lipid biosynthetic process(GO:0046889) |
| 1.6 | 6.5 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 1.6 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 1.6 | 3.3 | GO:0032800 | receptor biosynthetic process(GO:0032800) |
| 1.6 | 1.6 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 1.6 | 4.9 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 1.6 | 4.9 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 1.6 | 14.5 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 1.6 | 21.0 | GO:0010470 | regulation of gastrulation(GO:0010470) |
| 1.6 | 22.6 | GO:0043068 | positive regulation of programmed cell death(GO:0043068) |
| 1.6 | 11.3 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 1.6 | 11.3 | GO:1904357 | negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 1.6 | 8.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
| 1.6 | 33.8 | GO:0007031 | peroxisome organization(GO:0007031) |
| 1.6 | 12.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 1.6 | 4.8 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 1.6 | 1.6 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
| 1.6 | 3.2 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 1.6 | 3.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 1.6 | 6.4 | GO:0070842 | aggresome assembly(GO:0070842) |
| 1.6 | 1.6 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 1.6 | 8.0 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 1.6 | 1.6 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 1.6 | 17.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 1.6 | 4.8 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 1.6 | 33.2 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 1.6 | 4.7 | GO:0007525 | somatic muscle development(GO:0007525) |
| 1.6 | 7.9 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 1.6 | 9.4 | GO:0015074 | DNA integration(GO:0015074) |
| 1.6 | 7.9 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 1.6 | 14.1 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 1.6 | 1.6 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 1.6 | 11.0 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 1.6 | 1.6 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 1.6 | 6.3 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 1.6 | 3.1 | GO:0002674 | negative regulation of acute inflammatory response(GO:0002674) |
| 1.6 | 1.6 | GO:2000738 | positive regulation of stem cell differentiation(GO:2000738) |
| 1.6 | 1.6 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 1.6 | 6.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 1.6 | 4.7 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 1.6 | 18.7 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
| 1.6 | 3.1 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 1.6 | 1.6 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 1.6 | 4.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 1.5 | 1.5 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 1.5 | 12.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 1.5 | 4.6 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) |
| 1.5 | 29.4 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 1.5 | 4.6 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 1.5 | 1.5 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 1.5 | 1.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 1.5 | 3.1 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
| 1.5 | 77.0 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 1.5 | 6.2 | GO:0000237 | leptotene(GO:0000237) |
| 1.5 | 1.5 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 1.5 | 27.5 | GO:0043297 | apical junction assembly(GO:0043297) |
| 1.5 | 3.1 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 1.5 | 7.6 | GO:0007343 | egg activation(GO:0007343) |
| 1.5 | 10.6 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 1.5 | 16.7 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 1.5 | 1.5 | GO:0030431 | sleep(GO:0030431) |
| 1.5 | 25.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 1.5 | 3.0 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 1.5 | 4.5 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 1.5 | 1.5 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 1.5 | 18.0 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
| 1.5 | 10.5 | GO:0030575 | nuclear body organization(GO:0030575) |
| 1.5 | 30.0 | GO:0048661 | positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 1.5 | 14.9 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 1.5 | 3.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 1.5 | 13.4 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 1.5 | 73.0 | GO:0043433 | negative regulation of sequence-specific DNA binding transcription factor activity(GO:0043433) |
| 1.5 | 13.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 1.5 | 8.9 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 1.5 | 1.5 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
| 1.5 | 3.0 | GO:0030220 | platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 1.5 | 1.5 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 1.5 | 8.9 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 1.5 | 1.5 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 1.5 | 10.3 | GO:0071549 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
| 1.5 | 93.9 | GO:0051028 | mRNA transport(GO:0051028) |
| 1.5 | 7.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 1.5 | 130.2 | GO:0007596 | blood coagulation(GO:0007596) |
| 1.5 | 1.5 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 1.5 | 7.3 | GO:0034063 | stress granule assembly(GO:0034063) |
| 1.5 | 30.7 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 1.5 | 4.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 1.5 | 32.1 | GO:0015914 | phospholipid transport(GO:0015914) |
| 1.5 | 23.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 1.5 | 32.0 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 1.4 | 5.8 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 1.4 | 2.9 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 1.4 | 7.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
| 1.4 | 11.6 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
| 1.4 | 10.1 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
| 1.4 | 10.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 1.4 | 1.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 1.4 | 1.4 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 1.4 | 24.4 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
| 1.4 | 4.3 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 1.4 | 4.3 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 1.4 | 1.4 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 1.4 | 8.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 1.4 | 5.7 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 1.4 | 1.4 | GO:0032944 | regulation of mononuclear cell proliferation(GO:0032944) |
| 1.4 | 8.5 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 1.4 | 1.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 1.4 | 5.6 | GO:0006907 | pinocytosis(GO:0006907) |
| 1.4 | 1.4 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 1.4 | 7.0 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 1.4 | 21.0 | GO:0031124 | mRNA 3'-end processing(GO:0031124) |
| 1.4 | 7.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 1.4 | 9.8 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 1.4 | 2.8 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
| 1.4 | 8.3 | GO:0071385 | cellular response to glucocorticoid stimulus(GO:0071385) |
| 1.4 | 9.7 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 1.4 | 4.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 1.4 | 9.6 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 1.4 | 11.0 | GO:0034030 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 1.4 | 4.1 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 1.4 | 4.1 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 1.4 | 2.7 | GO:0001757 | somite specification(GO:0001757) |
| 1.4 | 4.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 1.4 | 1.4 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 1.3 | 1.3 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 1.3 | 4.0 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 1.3 | 2.7 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 1.3 | 6.7 | GO:0032049 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 1.3 | 5.4 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 1.3 | 1.3 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 1.3 | 2.7 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
| 1.3 | 4.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 1.3 | 29.4 | GO:0007569 | cell aging(GO:0007569) |
| 1.3 | 2.7 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 1.3 | 2.7 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
| 1.3 | 1.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 1.3 | 1.3 | GO:1901317 | regulation of sperm motility(GO:1901317) |
| 1.3 | 4.0 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 1.3 | 1.3 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 1.3 | 2.7 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 1.3 | 2.7 | GO:0034982 | protein processing involved in protein targeting to mitochondrion(GO:0006627) mitochondrial protein processing(GO:0034982) |
| 1.3 | 5.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 1.3 | 2.7 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 1.3 | 1.3 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 1.3 | 1.3 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 1.3 | 2.6 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 1.3 | 9.2 | GO:0090090 | negative regulation of canonical Wnt signaling pathway(GO:0090090) |
| 1.3 | 3.9 | GO:0003159 | morphogenesis of an endothelium(GO:0003159) |
| 1.3 | 2.6 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 1.3 | 1.3 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 1.3 | 46.8 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 1.3 | 18.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 1.3 | 5.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 1.3 | 3.9 | GO:0010225 | response to UV-C(GO:0010225) |
| 1.3 | 3.9 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 1.3 | 1.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 1.3 | 3.9 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 1.3 | 1.3 | GO:0099518 | vesicle cytoskeletal trafficking(GO:0099518) |
| 1.3 | 1.3 | GO:0048143 | astrocyte activation(GO:0048143) |
| 1.3 | 3.8 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 1.3 | 7.7 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 1.3 | 1.3 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 1.3 | 3.8 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
| 1.3 | 5.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 1.3 | 2.5 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 1.3 | 3.8 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 1.3 | 2.5 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 1.3 | 11.4 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 1.3 | 1.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 1.3 | 20.2 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 1.3 | 3.8 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 1.2 | 29.9 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 1.2 | 15.0 | GO:0071539 | protein localization to centrosome(GO:0071539) protein localization to microtubule cytoskeleton(GO:0072698) |
| 1.2 | 143.0 | GO:0007018 | microtubule-based movement(GO:0007018) |
| 1.2 | 5.0 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
| 1.2 | 23.6 | GO:0006953 | acute-phase response(GO:0006953) |
| 1.2 | 4.9 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 1.2 | 3.7 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 1.2 | 2.5 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 1.2 | 4.9 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 1.2 | 3.7 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 1.2 | 2.5 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 1.2 | 2.5 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 1.2 | 9.8 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 1.2 | 52.7 | GO:0001824 | blastocyst development(GO:0001824) |
| 1.2 | 33.1 | GO:1901998 | toxin transport(GO:1901998) |
| 1.2 | 3.7 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 1.2 | 3.7 | GO:0000012 | single strand break repair(GO:0000012) |
| 1.2 | 3.7 | GO:0051225 | spindle assembly(GO:0051225) |
| 1.2 | 4.9 | GO:0098781 | ncRNA transcription(GO:0098781) |
| 1.2 | 8.5 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 1.2 | 1.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 1.2 | 29.2 | GO:0007566 | embryo implantation(GO:0007566) |
| 1.2 | 3.6 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 1.2 | 3.6 | GO:0001842 | neural fold formation(GO:0001842) |
| 1.2 | 6.0 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 1.2 | 1.2 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 1.2 | 6.0 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 1.2 | 1.2 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 1.2 | 6.0 | GO:0010712 | regulation of collagen metabolic process(GO:0010712) |
| 1.2 | 9.6 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
| 1.2 | 3.6 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 1.2 | 9.6 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 1.2 | 2.4 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 1.2 | 10.7 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 1.2 | 1.2 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 1.2 | 10.7 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
| 1.2 | 2.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 1.2 | 2.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 1.2 | 1.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 1.2 | 4.7 | GO:0051026 | chiasma assembly(GO:0051026) |
| 1.2 | 1.2 | GO:0061180 | mammary gland epithelium development(GO:0061180) |
| 1.2 | 2.4 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 1.2 | 9.4 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 1.2 | 15.3 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 1.2 | 1.2 | GO:0046471 | cardiolipin metabolic process(GO:0032048) phosphatidylglycerol metabolic process(GO:0046471) |
| 1.2 | 2.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 1.2 | 1.2 | GO:1902309 | regulation of peptidyl-serine dephosphorylation(GO:1902308) negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 1.2 | 9.4 | GO:0043248 | proteasome assembly(GO:0043248) |
| 1.2 | 9.4 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 1.2 | 3.5 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 1.2 | 13.9 | GO:0034340 | response to type I interferon(GO:0034340) |
| 1.2 | 1.2 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 1.2 | 5.8 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 1.2 | 2.3 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 1.2 | 1.2 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 1.2 | 1.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 1.2 | 4.6 | GO:0002719 | negative regulation of cytokine production involved in immune response(GO:0002719) |
| 1.2 | 5.8 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 1.2 | 12.7 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 1.2 | 64.5 | GO:0006814 | sodium ion transport(GO:0006814) |
| 1.2 | 1.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 1.2 | 4.6 | GO:0006862 | nucleotide transport(GO:0006862) |
| 1.1 | 5.7 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 1.1 | 10.3 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
| 1.1 | 3.4 | GO:0042304 | regulation of fatty acid biosynthetic process(GO:0042304) |
| 1.1 | 35.3 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 1.1 | 4.6 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
| 1.1 | 1.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 1.1 | 10.2 | GO:0044344 | cellular response to fibroblast growth factor stimulus(GO:0044344) |
| 1.1 | 6.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 1.1 | 2.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 1.1 | 1.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 1.1 | 1.1 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 1.1 | 3.4 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 1.1 | 4.5 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 1.1 | 2.3 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
| 1.1 | 3.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 1.1 | 2.2 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 1.1 | 2.2 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 1.1 | 3.4 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 1.1 | 5.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 1.1 | 1.1 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.1 | 4.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 1.1 | 3.3 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 1.1 | 7.8 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 1.1 | 2.2 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 1.1 | 7.8 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 1.1 | 4.4 | GO:0031639 | plasminogen activation(GO:0031639) |
| 1.1 | 6.6 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 1.1 | 2.2 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 1.1 | 3.3 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 1.1 | 21.0 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 1.1 | 2.2 | GO:0006734 | NADH metabolic process(GO:0006734) |
| 1.1 | 4.4 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 1.1 | 1.1 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 1.1 | 6.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 1.1 | 3.3 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 1.1 | 61.5 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 1.1 | 8.8 | GO:0032098 | regulation of appetite(GO:0032098) |
| 1.1 | 1.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 1.1 | 2.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 1.1 | 6.6 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 1.1 | 7.6 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 1.1 | 1.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 1.1 | 8.7 | GO:0044804 | nucleophagy(GO:0044804) |
| 1.1 | 1.1 | GO:0046189 | phenol-containing compound biosynthetic process(GO:0046189) |
| 1.1 | 1.1 | GO:0045931 | positive regulation of mitotic cell cycle(GO:0045931) |
| 1.1 | 1.1 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
| 1.1 | 1.1 | GO:0034238 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 1.1 | 2.2 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 1.1 | 2.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 1.1 | 1.1 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
| 1.1 | 5.4 | GO:0002775 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
| 1.1 | 21.6 | GO:0008285 | negative regulation of cell proliferation(GO:0008285) |
| 1.1 | 10.8 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 1.1 | 18.3 | GO:0042542 | response to hydrogen peroxide(GO:0042542) |
| 1.1 | 1.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 1.1 | 10.7 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 1.1 | 3.2 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 1.1 | 23.5 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 1.1 | 1.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 1.1 | 56.5 | GO:0006665 | sphingolipid metabolic process(GO:0006665) |
| 1.1 | 3.2 | GO:0014029 | neural crest formation(GO:0014029) |
| 1.1 | 2.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 1.1 | 2.1 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 1.1 | 3.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 1.1 | 3.2 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 1.1 | 10.6 | GO:0031398 | positive regulation of protein ubiquitination(GO:0031398) |
| 1.1 | 6.3 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 1.1 | 2.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 1.1 | 9.5 | GO:0003416 | endochondral bone growth(GO:0003416) bone growth(GO:0098868) |
| 1.1 | 9.5 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 1.1 | 3.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 1.0 | 2.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 1.0 | 1.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 1.0 | 5.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 1.0 | 1.0 | GO:2000054 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 1.0 | 1.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 1.0 | 12.6 | GO:0072528 | pyrimidine nucleotide biosynthetic process(GO:0006221) pyrimidine-containing compound biosynthetic process(GO:0072528) |
| 1.0 | 2.1 | GO:0046006 | regulation of activated T cell proliferation(GO:0046006) |
| 1.0 | 2.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 1.0 | 5.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 1.0 | 7.3 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
| 1.0 | 1.0 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
| 1.0 | 4.2 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 1.0 | 5.2 | GO:0002585 | positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
| 1.0 | 9.4 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 1.0 | 2.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 1.0 | 1.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 1.0 | 9.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 1.0 | 2.1 | GO:0060049 | regulation of protein glycosylation(GO:0060049) |
| 1.0 | 12.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 1.0 | 5.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 1.0 | 2.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 1.0 | 3.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 1.0 | 2.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 1.0 | 5.1 | GO:0045056 | transcytosis(GO:0045056) |
| 1.0 | 7.2 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 1.0 | 21.5 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 1.0 | 1.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 1.0 | 1.0 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 1.0 | 4.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 1.0 | 4.1 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 1.0 | 1.0 | GO:0007413 | axonal fasciculation(GO:0007413) |
| 1.0 | 4.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 1.0 | 5.1 | GO:0032881 | regulation of polysaccharide metabolic process(GO:0032881) regulation of glycogen metabolic process(GO:0070873) |
| 1.0 | 2.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 1.0 | 2.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
| 1.0 | 2.0 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 1.0 | 1.0 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 1.0 | 2.0 | GO:0015893 | drug transport(GO:0015893) |
| 1.0 | 2.0 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 1.0 | 1.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 1.0 | 10.1 | GO:0050832 | defense response to fungus(GO:0050832) |
| 1.0 | 1.0 | GO:0010165 | response to X-ray(GO:0010165) |
| 1.0 | 1.0 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 1.0 | 12.1 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 1.0 | 6.0 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 1.0 | 1.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 1.0 | 2.0 | GO:0046549 | retinal cone cell development(GO:0046549) |
| 1.0 | 29.0 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 1.0 | 4.0 | GO:0071709 | membrane assembly(GO:0071709) |
| 1.0 | 1.0 | GO:0043954 | cellular component maintenance(GO:0043954) |
| 1.0 | 1.0 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 1.0 | 17.9 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
| 1.0 | 4.0 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 1.0 | 1.0 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 1.0 | 3.0 | GO:0007616 | long-term memory(GO:0007616) |
| 1.0 | 1.0 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 1.0 | 22.7 | GO:0007129 | synapsis(GO:0007129) |
| 1.0 | 14.7 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
| 1.0 | 2.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 1.0 | 9.8 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
| 1.0 | 4.9 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 1.0 | 11.7 | GO:0032418 | lysosome localization(GO:0032418) |
| 1.0 | 2.9 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 1.0 | 5.8 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
| 1.0 | 4.8 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 1.0 | 3.8 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 1.0 | 1.0 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 1.0 | 1.9 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) |
| 1.0 | 1.0 | GO:0032963 | collagen metabolic process(GO:0032963) |
| 0.9 | 1.9 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
| 0.9 | 3.8 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.9 | 23.7 | GO:0009267 | cellular response to starvation(GO:0009267) |
| 0.9 | 0.9 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.9 | 0.9 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
| 0.9 | 9.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.9 | 5.7 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.9 | 1.9 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
| 0.9 | 11.2 | GO:0070670 | response to interleukin-4(GO:0070670) |
| 0.9 | 1.9 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.9 | 0.9 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.9 | 7.5 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.9 | 4.7 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
| 0.9 | 0.9 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.9 | 0.9 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.9 | 55.9 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
| 0.9 | 0.9 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.9 | 2.8 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.9 | 1.8 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.9 | 8.3 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.9 | 2.7 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
| 0.9 | 3.6 | GO:0042088 | T-helper 1 type immune response(GO:0042088) |
| 0.9 | 6.4 | GO:0043154 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0043154) |
| 0.9 | 3.6 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.9 | 16.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.9 | 1.8 | GO:0045346 | MHC class II biosynthetic process(GO:0045342) regulation of MHC class II biosynthetic process(GO:0045346) negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.9 | 24.5 | GO:0048017 | inositol lipid-mediated signaling(GO:0048017) |
| 0.9 | 5.4 | GO:0006260 | DNA replication(GO:0006260) |
| 0.9 | 3.6 | GO:0010799 | regulation of peptidyl-threonine phosphorylation(GO:0010799) |
| 0.9 | 2.7 | GO:0045104 | intermediate filament cytoskeleton organization(GO:0045104) |
| 0.9 | 3.6 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.9 | 6.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.9 | 0.9 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.9 | 3.6 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
| 0.9 | 1.8 | GO:0051231 | spindle elongation(GO:0051231) |
| 0.9 | 6.3 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.9 | 0.9 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.9 | 5.4 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.9 | 0.9 | GO:1902652 | cholesterol metabolic process(GO:0008203) secondary alcohol metabolic process(GO:1902652) |
| 0.9 | 0.9 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.9 | 0.9 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.9 | 1.8 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.9 | 0.9 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
| 0.9 | 18.6 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.9 | 2.7 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.9 | 13.3 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.9 | 6.2 | GO:0032873 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.9 | 3.5 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.9 | 3.5 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.9 | 7.0 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
| 0.9 | 1.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.9 | 1.7 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.9 | 3.5 | GO:0043467 | regulation of generation of precursor metabolites and energy(GO:0043467) |
| 0.9 | 13.0 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.9 | 4.3 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.9 | 4.3 | GO:0042060 | wound healing(GO:0042060) |
| 0.9 | 1.7 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.9 | 2.6 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.9 | 9.5 | GO:1903317 | regulation of protein maturation(GO:1903317) |
| 0.9 | 0.9 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.9 | 5.2 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.9 | 0.9 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.9 | 2.6 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
| 0.9 | 7.7 | GO:0006094 | gluconeogenesis(GO:0006094) |
| 0.9 | 1.7 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.9 | 0.9 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.9 | 6.8 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.9 | 2.6 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.9 | 8.5 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 0.8 | 0.8 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.8 | 6.8 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.8 | 11.9 | GO:0045667 | regulation of osteoblast differentiation(GO:0045667) |
| 0.8 | 5.1 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.8 | 0.8 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.8 | 0.8 | GO:0043473 | pigmentation(GO:0043473) |
| 0.8 | 23.6 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
| 0.8 | 82.4 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.8 | 0.8 | GO:0044062 | regulation of excretion(GO:0044062) |
| 0.8 | 2.5 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.8 | 10.9 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.8 | 6.7 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.8 | 5.0 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.8 | 2.5 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.8 | 7.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.8 | 7.5 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.8 | 1.7 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.8 | 0.8 | GO:0019371 | cyclooxygenase pathway(GO:0019371) maintenance of blood-brain barrier(GO:0035633) |
| 0.8 | 0.8 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.8 | 14.1 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.8 | 5.8 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.8 | 3.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.8 | 9.9 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
| 0.8 | 8.3 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
| 0.8 | 4.1 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.8 | 25.6 | GO:0034612 | response to tumor necrosis factor(GO:0034612) |
| 0.8 | 5.8 | GO:0006415 | translational termination(GO:0006415) |
| 0.8 | 7.4 | GO:0051321 | meiotic cell cycle(GO:0051321) |
| 0.8 | 3.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.8 | 14.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.8 | 9.9 | GO:0009994 | oocyte differentiation(GO:0009994) |
| 0.8 | 2.5 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
| 0.8 | 13.1 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.8 | 1.6 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.8 | 1.6 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.8 | 2.4 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.8 | 0.8 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.8 | 92.9 | GO:0006631 | fatty acid metabolic process(GO:0006631) |
| 0.8 | 12.2 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.8 | 0.8 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.8 | 1.6 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.8 | 0.8 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.8 | 5.7 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.8 | 0.8 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.8 | 0.8 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.8 | 2.4 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.8 | 1.6 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.8 | 20.2 | GO:0070372 | regulation of ERK1 and ERK2 cascade(GO:0070372) |
| 0.8 | 0.8 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
| 0.8 | 0.8 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.8 | 2.4 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
| 0.8 | 6.5 | GO:0045930 | negative regulation of mitotic cell cycle(GO:0045930) |
| 0.8 | 0.8 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.8 | 3.2 | GO:0033144 | negative regulation of intracellular steroid hormone receptor signaling pathway(GO:0033144) |
| 0.8 | 0.8 | GO:0048659 | smooth muscle cell proliferation(GO:0048659) |
| 0.8 | 1.6 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.8 | 2.4 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.8 | 1.6 | GO:0060760 | positive regulation of response to cytokine stimulus(GO:0060760) |
| 0.8 | 12.8 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.8 | 0.8 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.8 | 0.8 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.8 | 11.2 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.8 | 0.8 | GO:0022403 | cell cycle phase(GO:0022403) |
| 0.8 | 2.4 | GO:0042424 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.8 | 1.6 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.8 | 3.9 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.8 | 1.6 | GO:1900117 | regulation of execution phase of apoptosis(GO:1900117) |
| 0.8 | 53.3 | GO:0006457 | protein folding(GO:0006457) |
| 0.8 | 3.9 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.8 | 7.0 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.8 | 2.3 | GO:0071168 | protein localization to chromatin(GO:0071168) |
| 0.8 | 3.1 | GO:0044273 | sulfur compound catabolic process(GO:0044273) |
| 0.8 | 1.6 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.8 | 4.7 | GO:0045860 | positive regulation of protein kinase activity(GO:0045860) |
| 0.8 | 10.1 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.8 | 10.9 | GO:0046849 | bone remodeling(GO:0046849) |
| 0.8 | 0.8 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.8 | 7.7 | GO:0030500 | regulation of bone mineralization(GO:0030500) |
| 0.8 | 3.9 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
| 0.8 | 4.6 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
| 0.8 | 10.0 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.8 | 5.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.8 | 0.8 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.8 | 0.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.8 | 22.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.8 | 6.9 | GO:0048854 | brain morphogenesis(GO:0048854) |
| 0.8 | 1.5 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.8 | 0.8 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.8 | 4.6 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.8 | 20.5 | GO:0006869 | lipid transport(GO:0006869) |
| 0.8 | 3.0 | GO:0031214 | biomineral tissue development(GO:0031214) |
| 0.8 | 0.8 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.8 | 0.8 | GO:0046885 | regulation of hormone biosynthetic process(GO:0046885) |
| 0.8 | 1.5 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.8 | 23.4 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
| 0.8 | 140.2 | GO:0006397 | mRNA processing(GO:0006397) |
| 0.8 | 1.5 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.8 | 0.8 | GO:0071711 | basement membrane organization(GO:0071711) |
| 0.7 | 15.0 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.7 | 3.0 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.7 | 7.5 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.7 | 0.7 | GO:0001553 | luteinization(GO:0001553) |
| 0.7 | 6.7 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
| 0.7 | 0.7 | GO:0023058 | adaptation of signaling pathway(GO:0023058) |
| 0.7 | 3.0 | GO:0032400 | melanosome localization(GO:0032400) |
| 0.7 | 1.5 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.7 | 1.5 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.7 | 1.5 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.7 | 4.4 | GO:0008630 | intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.7 | 6.6 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.7 | 0.7 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.7 | 2.9 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.7 | 0.7 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.7 | 5.1 | GO:0031100 | organ regeneration(GO:0031100) |
| 0.7 | 0.7 | GO:0018198 | peptidyl-cysteine modification(GO:0018198) |
| 0.7 | 8.8 | GO:1904029 | regulation of cyclin-dependent protein kinase activity(GO:1904029) |
| 0.7 | 4.4 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.7 | 8.7 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.7 | 0.7 | GO:0003163 | sinoatrial node development(GO:0003163) cardiac pacemaker cell differentiation(GO:0060920) |
| 0.7 | 0.7 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.7 | 20.9 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.7 | 0.7 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.7 | 0.7 | GO:0035967 | cellular response to topologically incorrect protein(GO:0035967) |
| 0.7 | 8.6 | GO:2000045 | regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
| 0.7 | 56.8 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
| 0.7 | 1.4 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.7 | 0.7 | GO:0098751 | bone cell development(GO:0098751) |
| 0.7 | 2.1 | GO:0060065 | uterus development(GO:0060065) |
| 0.7 | 9.3 | GO:1901617 | organic hydroxy compound biosynthetic process(GO:1901617) |
| 0.7 | 0.7 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.7 | 1.4 | GO:2000136 | regulation of cell proliferation involved in heart morphogenesis(GO:2000136) |
| 0.7 | 24.2 | GO:0008360 | regulation of cell shape(GO:0008360) |
| 0.7 | 2.1 | GO:0033687 | osteoblast proliferation(GO:0033687) |
| 0.7 | 36.9 | GO:0035304 | regulation of protein dephosphorylation(GO:0035304) |
| 0.7 | 4.3 | GO:0043410 | positive regulation of MAPK cascade(GO:0043410) |
| 0.7 | 1.4 | GO:0055094 | response to lipoprotein particle(GO:0055094) |
| 0.7 | 2.1 | GO:0009712 | catecholamine metabolic process(GO:0006584) catechol-containing compound metabolic process(GO:0009712) |
| 0.7 | 0.7 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.7 | 0.7 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.7 | 1.4 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.7 | 9.1 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
| 0.7 | 1.4 | GO:0016045 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.7 | 4.9 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.7 | 1.4 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.7 | 36.0 | GO:0019882 | antigen processing and presentation(GO:0019882) |
| 0.7 | 2.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.7 | 4.8 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.7 | 2.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.7 | 1.4 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.7 | 1.4 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.7 | 2.1 | GO:0032275 | luteinizing hormone secretion(GO:0032275) |
| 0.7 | 0.7 | GO:0051602 | response to electrical stimulus(GO:0051602) |
| 0.7 | 1.4 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.7 | 0.7 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.7 | 4.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.7 | 31.3 | GO:0016042 | lipid catabolic process(GO:0016042) |
| 0.7 | 1.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.7 | 2.0 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.7 | 16.3 | GO:0051291 | protein heterooligomerization(GO:0051291) |
| 0.7 | 4.1 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.7 | 1.4 | GO:0061430 | bone trabecula morphogenesis(GO:0061430) |
| 0.7 | 3.4 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.7 | 3.4 | GO:0051897 | positive regulation of protein kinase B signaling(GO:0051897) |
| 0.7 | 1.3 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.7 | 1.3 | GO:0060563 | neuroepithelial cell differentiation(GO:0060563) |
| 0.7 | 1.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.7 | 3.4 | GO:0038179 | neurotrophin signaling pathway(GO:0038179) |
| 0.7 | 0.7 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.7 | 4.7 | GO:0002286 | T cell activation involved in immune response(GO:0002286) |
| 0.7 | 0.7 | GO:0030320 | cellular anion homeostasis(GO:0030002) cellular monovalent inorganic anion homeostasis(GO:0030320) |
| 0.7 | 1.3 | GO:2000677 | regulation of transcription regulatory region DNA binding(GO:2000677) |
| 0.7 | 0.7 | GO:0070170 | regulation of tooth mineralization(GO:0070170) |
| 0.7 | 2.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.7 | 2.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.7 | 25.8 | GO:0043434 | response to peptide hormone(GO:0043434) |
| 0.7 | 2.0 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
| 0.7 | 0.7 | GO:0021794 | thalamus development(GO:0021794) |
| 0.7 | 3.9 | GO:0007043 | cell-cell junction assembly(GO:0007043) |
| 0.7 | 0.7 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.7 | 0.7 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.7 | 1.3 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.6 | 0.6 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.6 | 0.6 | GO:0051154 | negative regulation of striated muscle cell differentiation(GO:0051154) |
| 0.6 | 1.3 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.6 | 2.6 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.6 | 3.2 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.6 | 71.3 | GO:0007264 | small GTPase mediated signal transduction(GO:0007264) |
| 0.6 | 0.6 | GO:0033628 | regulation of cell adhesion mediated by integrin(GO:0033628) |
| 0.6 | 5.1 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.6 | 1.3 | GO:0060996 | dendritic spine development(GO:0060996) |
| 0.6 | 9.5 | GO:0009165 | nucleotide biosynthetic process(GO:0009165) |
| 0.6 | 10.1 | GO:0042098 | T cell proliferation(GO:0042098) |
| 0.6 | 0.6 | GO:0015740 | C4-dicarboxylate transport(GO:0015740) aspartate transport(GO:0015810) malate-aspartate shuttle(GO:0043490) |
| 0.6 | 0.6 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.6 | 3.1 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.6 | 3.1 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.6 | 0.6 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.6 | 0.6 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.6 | 0.6 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.6 | 5.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.6 | 1.9 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.6 | 0.6 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.6 | 0.6 | GO:0006534 | cysteine metabolic process(GO:0006534) |
| 0.6 | 1.9 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
| 0.6 | 0.6 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.6 | 11.7 | GO:0051607 | defense response to virus(GO:0051607) |
| 0.6 | 1.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.6 | 0.6 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.6 | 3.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.6 | 0.6 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.6 | 5.5 | GO:0050709 | negative regulation of protein secretion(GO:0050709) |
| 0.6 | 7.9 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.6 | 1.8 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.6 | 3.0 | GO:0051923 | sulfation(GO:0051923) |
| 0.6 | 3.0 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.6 | 0.6 | GO:0048008 | platelet-derived growth factor receptor signaling pathway(GO:0048008) |
| 0.6 | 5.4 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.6 | 3.6 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.6 | 2.4 | GO:0015807 | L-amino acid transport(GO:0015807) |
| 0.6 | 1.2 | GO:0048260 | positive regulation of receptor-mediated endocytosis(GO:0048260) |
| 0.6 | 1.2 | GO:0035878 | nail development(GO:0035878) |
| 0.6 | 1.8 | GO:0022406 | membrane docking(GO:0022406) |
| 0.6 | 3.0 | GO:1903555 | regulation of tumor necrosis factor superfamily cytokine production(GO:1903555) |
| 0.6 | 1.8 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.6 | 3.0 | GO:0018212 | peptidyl-tyrosine modification(GO:0018212) |
| 0.6 | 4.7 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
| 0.6 | 4.7 | GO:0009145 | purine nucleoside triphosphate biosynthetic process(GO:0009145) |
| 0.6 | 0.6 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.6 | 1.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.6 | 4.1 | GO:0032608 | interferon-beta production(GO:0032608) |
| 0.6 | 4.1 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.6 | 1.2 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.6 | 0.6 | GO:1902591 | single-organism membrane budding(GO:1902591) |
| 0.6 | 1.2 | GO:0031279 | regulation of cyclase activity(GO:0031279) |
| 0.6 | 1.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.6 | 0.6 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.6 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.6 | 2.9 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.6 | 6.4 | GO:0051289 | protein homotetramerization(GO:0051289) |
| 0.6 | 8.7 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.6 | 0.6 | GO:0016202 | regulation of striated muscle tissue development(GO:0016202) regulation of muscle tissue development(GO:1901861) |
| 0.6 | 5.2 | GO:0007588 | excretion(GO:0007588) |
| 0.6 | 14.5 | GO:0048545 | response to steroid hormone(GO:0048545) |
| 0.6 | 3.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.6 | 9.8 | GO:0001666 | response to hypoxia(GO:0001666) |
| 0.6 | 1.7 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
| 0.6 | 0.6 | GO:0038061 | NIK/NF-kappaB signaling(GO:0038061) |
| 0.6 | 1.2 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
| 0.6 | 0.6 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.6 | 1.1 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.6 | 2.9 | GO:1903429 | regulation of cell maturation(GO:1903429) |
| 0.6 | 0.6 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.6 | 5.1 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.6 | 1.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.6 | 1.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.6 | 1.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.6 | 2.8 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.6 | 1.1 | GO:0009219 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide metabolic process(GO:0009219) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) deoxyribonucleotide catabolic process(GO:0009264) deoxyribose phosphate catabolic process(GO:0046386) |
| 0.6 | 1.7 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.6 | 1.7 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.6 | 2.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.6 | 1.7 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.6 | 1.1 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.6 | 1.1 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.6 | 5.6 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.6 | 1.1 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.6 | 0.6 | GO:0001659 | temperature homeostasis(GO:0001659) |
| 0.6 | 0.6 | GO:0010632 | regulation of epithelial cell migration(GO:0010632) |
| 0.6 | 0.6 | GO:0051193 | regulation of cofactor metabolic process(GO:0051193) |
| 0.6 | 0.6 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.6 | 0.6 | GO:0060021 | palate development(GO:0060021) |
| 0.6 | 6.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.5 | 1.6 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
| 0.5 | 1.6 | GO:0008207 | C21-steroid hormone metabolic process(GO:0008207) |
| 0.5 | 0.5 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
| 0.5 | 0.5 | GO:0010559 | regulation of glycoprotein biosynthetic process(GO:0010559) |
| 0.5 | 7.7 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.5 | 2.2 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.5 | 11.4 | GO:0008643 | carbohydrate transport(GO:0008643) |
| 0.5 | 1.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.5 | 2.7 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.5 | 0.5 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.5 | 1.1 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.5 | 0.5 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.5 | 0.5 | GO:0033047 | regulation of mitotic sister chromatid segregation(GO:0033047) |
| 0.5 | 50.2 | GO:0007067 | mitotic nuclear division(GO:0007067) |
| 0.5 | 1.1 | GO:0036503 | ERAD pathway(GO:0036503) |
| 0.5 | 2.6 | GO:0043535 | regulation of blood vessel endothelial cell migration(GO:0043535) |
| 0.5 | 1.6 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.5 | 2.6 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
| 0.5 | 1.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.5 | 1.6 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.5 | 4.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.5 | 2.1 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
| 0.5 | 29.2 | GO:0044255 | cellular lipid metabolic process(GO:0044255) |
| 0.5 | 2.1 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.5 | 3.6 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.5 | 0.5 | GO:0060022 | hard palate development(GO:0060022) |
| 0.5 | 2.6 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.5 | 0.5 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
| 0.5 | 6.2 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.5 | 74.5 | GO:0055114 | oxidation-reduction process(GO:0055114) |
| 0.5 | 3.1 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
| 0.5 | 0.5 | GO:0003279 | cardiac septum development(GO:0003279) |
| 0.5 | 0.5 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.5 | 4.6 | GO:0051099 | positive regulation of binding(GO:0051099) |
| 0.5 | 0.5 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.5 | 0.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.5 | 12.6 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 0.5 | 2.5 | GO:0048771 | tissue remodeling(GO:0048771) |
| 0.5 | 92.3 | GO:0005975 | carbohydrate metabolic process(GO:0005975) |
| 0.5 | 1.5 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.5 | 1.0 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.5 | 0.5 | GO:0002718 | regulation of cytokine production involved in immune response(GO:0002718) |
| 0.5 | 8.0 | GO:0016567 | protein ubiquitination(GO:0016567) |
| 0.5 | 0.5 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.5 | 2.0 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.5 | 1.0 | GO:0009629 | response to gravity(GO:0009629) |
| 0.5 | 2.5 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.5 | 0.5 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.5 | 3.4 | GO:0048144 | fibroblast proliferation(GO:0048144) |
| 0.5 | 1.5 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.5 | 0.5 | GO:0030224 | monocyte differentiation(GO:0030224) |
| 0.5 | 2.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.5 | 4.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.5 | 1.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.5 | 0.5 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.5 | 0.5 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.5 | 5.2 | GO:0031109 | microtubule polymerization or depolymerization(GO:0031109) |
| 0.5 | 9.0 | GO:0006906 | vesicle fusion(GO:0006906) |
| 0.5 | 3.3 | GO:0006575 | cellular modified amino acid metabolic process(GO:0006575) |
| 0.5 | 0.5 | GO:0002673 | regulation of acute inflammatory response(GO:0002673) |
| 0.5 | 2.3 | GO:0045444 | fat cell differentiation(GO:0045444) |
| 0.5 | 0.5 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.5 | 1.4 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.5 | 1.9 | GO:2001243 | negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
| 0.5 | 0.9 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.5 | 0.9 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.5 | 0.5 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.5 | 12.4 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.5 | 9.6 | GO:0051301 | cell division(GO:0051301) |
| 0.5 | 0.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.5 | 3.6 | GO:1900373 | positive regulation of cyclic nucleotide biosynthetic process(GO:0030804) positive regulation of nucleotide biosynthetic process(GO:0030810) positive regulation of cAMP biosynthetic process(GO:0030819) positive regulation of purine nucleotide biosynthetic process(GO:1900373) |
| 0.4 | 1.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.4 | 0.9 | GO:0042476 | odontogenesis(GO:0042476) |
| 0.4 | 0.4 | GO:0000959 | mitochondrial RNA metabolic process(GO:0000959) |
| 0.4 | 2.2 | GO:0007631 | feeding behavior(GO:0007631) |
| 0.4 | 0.9 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.4 | 2.2 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.4 | 0.4 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.4 | 10.6 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.4 | 0.9 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.4 | 0.9 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.4 | 17.0 | GO:0007601 | visual perception(GO:0007601) |
| 0.4 | 5.2 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.4 | 20.8 | GO:0006281 | DNA repair(GO:0006281) |
| 0.4 | 0.4 | GO:0060964 | regulation of gene silencing by miRNA(GO:0060964) |
| 0.4 | 0.9 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.4 | 1.3 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.4 | 0.4 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.4 | 0.9 | GO:0051452 | intracellular pH reduction(GO:0051452) |
| 0.4 | 0.8 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
| 0.4 | 3.8 | GO:2000107 | negative regulation of lymphocyte apoptotic process(GO:0070229) negative regulation of leukocyte apoptotic process(GO:2000107) |
| 0.4 | 0.4 | GO:0021586 | pons maturation(GO:0021586) |
| 0.4 | 0.8 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.4 | 2.5 | GO:0002011 | morphogenesis of an epithelial sheet(GO:0002011) |
| 0.4 | 0.4 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) |
| 0.4 | 0.4 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.4 | 44.0 | GO:0006897 | endocytosis(GO:0006897) |
| 0.4 | 0.8 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.4 | 0.8 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.4 | 10.0 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.4 | 4.2 | GO:0048747 | muscle fiber development(GO:0048747) |
| 0.4 | 1.7 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.4 | 1.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.4 | 0.8 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.4 | 2.9 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.4 | 2.9 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.4 | 0.4 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.4 | 0.4 | GO:0015886 | heme transport(GO:0015886) |
| 0.4 | 4.5 | GO:0060976 | coronary vasculature development(GO:0060976) |
| 0.4 | 2.4 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.4 | 0.4 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.4 | 9.3 | GO:0032526 | response to retinoic acid(GO:0032526) |
| 0.4 | 0.8 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.4 | 1.6 | GO:2000648 | positive regulation of stem cell proliferation(GO:2000648) |
| 0.4 | 0.8 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.4 | 0.8 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.4 | 0.4 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.4 | 0.8 | GO:0044346 | fibroblast apoptotic process(GO:0044346) |
| 0.4 | 0.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.4 | 2.8 | GO:0042440 | pigment metabolic process(GO:0042440) |
| 0.4 | 0.4 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
| 0.4 | 2.4 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.4 | 1.6 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.4 | 4.8 | GO:0010629 | negative regulation of gene expression(GO:0010629) |
| 0.4 | 1.6 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.4 | 0.8 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.4 | 1.2 | GO:0051881 | regulation of mitochondrial membrane potential(GO:0051881) |
| 0.4 | 1.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.4 | 0.4 | GO:0048709 | oligodendrocyte differentiation(GO:0048709) |
| 0.4 | 1.2 | GO:0042246 | tissue regeneration(GO:0042246) |
| 0.4 | 7.4 | GO:0051170 | nuclear import(GO:0051170) |
| 0.4 | 34.6 | GO:0032259 | methylation(GO:0032259) |
| 0.4 | 2.3 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.4 | 5.0 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.4 | 0.4 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.4 | 1.9 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.4 | 1.2 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.4 | 0.4 | GO:0002689 | negative regulation of leukocyte chemotaxis(GO:0002689) |
| 0.4 | 1.1 | GO:0032870 | cellular response to hormone stimulus(GO:0032870) |
| 0.4 | 1.1 | GO:0043200 | response to amino acid(GO:0043200) |
| 0.4 | 3.0 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.4 | 0.4 | GO:0015840 | urea transport(GO:0015840) |
| 0.4 | 0.4 | GO:0002070 | epithelial cell maturation(GO:0002070) |
| 0.4 | 10.2 | GO:0008154 | actin polymerization or depolymerization(GO:0008154) |
| 0.4 | 0.8 | GO:0098876 | vesicle-mediated transport to the plasma membrane(GO:0098876) |
| 0.4 | 0.8 | GO:0048536 | spleen development(GO:0048536) |
| 0.4 | 0.8 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.4 | 0.4 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.4 | 0.4 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.4 | 0.7 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.4 | 0.7 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.4 | 0.4 | GO:0010812 | negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.4 | 0.4 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.4 | 0.4 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.4 | 0.4 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.4 | 0.4 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.4 | 0.7 | GO:0035303 | regulation of dephosphorylation(GO:0035303) |
| 0.4 | 1.1 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.4 | 1.1 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
| 0.4 | 2.6 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.4 | 21.8 | GO:0016337 | single organismal cell-cell adhesion(GO:0016337) |
| 0.4 | 0.4 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.4 | 2.9 | GO:0071560 | cellular response to transforming growth factor beta stimulus(GO:0071560) |
| 0.4 | 0.4 | GO:0001923 | B-1 B cell differentiation(GO:0001923) B-1a B cell differentiation(GO:0002337) |
| 0.4 | 0.7 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.4 | 1.1 | GO:0001756 | somitogenesis(GO:0001756) |
| 0.4 | 0.7 | GO:0042755 | eating behavior(GO:0042755) |
| 0.4 | 0.4 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.4 | 0.4 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
| 0.4 | 0.7 | GO:0051353 | positive regulation of oxidoreductase activity(GO:0051353) |
| 0.4 | 3.5 | GO:0072331 | signal transduction by p53 class mediator(GO:0072331) |
| 0.4 | 7.4 | GO:0031047 | gene silencing by RNA(GO:0031047) |
| 0.4 | 0.4 | GO:0030801 | positive regulation of cyclic nucleotide metabolic process(GO:0030801) |
| 0.4 | 0.7 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.3 | 0.7 | GO:0030316 | osteoclast differentiation(GO:0030316) |
| 0.3 | 1.7 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.3 | 1.4 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
| 0.3 | 1.4 | GO:0009615 | response to virus(GO:0009615) |
| 0.3 | 3.5 | GO:0006520 | cellular amino acid metabolic process(GO:0006520) |
| 0.3 | 0.7 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.3 | 0.3 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.3 | 5.5 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.3 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.3 | 3.1 | GO:0006638 | neutral lipid metabolic process(GO:0006638) |
| 0.3 | 1.7 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.3 | 0.7 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.3 | 1.4 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.3 | 1.7 | GO:0072348 | sulfur compound transport(GO:0072348) |
| 0.3 | 1.0 | GO:0046777 | protein autophosphorylation(GO:0046777) |
| 0.3 | 1.3 | GO:0002068 | glandular epithelial cell development(GO:0002068) |
| 0.3 | 0.3 | GO:0044786 | cell cycle DNA replication(GO:0044786) |
| 0.3 | 44.5 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.3 | 0.3 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.3 | 2.0 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.3 | 1.3 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
| 0.3 | 0.7 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.3 | 0.7 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.3 | 1.3 | GO:1901652 | response to peptide(GO:1901652) |
| 0.3 | 1.0 | GO:0007162 | negative regulation of cell adhesion(GO:0007162) |
| 0.3 | 0.7 | GO:0031641 | regulation of myelination(GO:0031641) |
| 0.3 | 0.3 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.3 | 0.3 | GO:0010634 | positive regulation of epithelial cell migration(GO:0010634) |
| 0.3 | 0.7 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.3 | 0.3 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.3 | 0.3 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.3 | 0.6 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.3 | 1.9 | GO:0045766 | positive regulation of angiogenesis(GO:0045766) |
| 0.3 | 0.3 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
| 0.3 | 3.9 | GO:0071241 | cellular response to inorganic substance(GO:0071241) |
| 0.3 | 0.6 | GO:0007602 | phototransduction(GO:0007602) |
| 0.3 | 0.3 | GO:0001101 | response to acid chemical(GO:0001101) |
| 0.3 | 1.0 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.3 | 0.3 | GO:0032753 | positive regulation of interleukin-4 production(GO:0032753) |
| 0.3 | 0.6 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.3 | 0.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.3 | 0.3 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
| 0.3 | 0.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.3 | 0.6 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
| 0.3 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.3 | 0.3 | GO:0008589 | regulation of smoothened signaling pathway(GO:0008589) |
| 0.3 | 0.6 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
| 0.3 | 0.3 | GO:0072576 | liver morphogenesis(GO:0072576) |
| 0.3 | 4.0 | GO:0044772 | mitotic cell cycle phase transition(GO:0044772) |
| 0.3 | 0.3 | GO:0003205 | cardiac chamber development(GO:0003205) |
| 0.3 | 1.8 | GO:0051168 | nuclear export(GO:0051168) |
| 0.3 | 0.3 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.3 | 0.9 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.3 | 3.0 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.3 | 4.3 | GO:0010810 | regulation of cell-substrate adhesion(GO:0010810) |
| 0.3 | 0.9 | GO:0045598 | regulation of fat cell differentiation(GO:0045598) |
| 0.3 | 1.5 | GO:0033363 | secretory granule organization(GO:0033363) |
| 0.3 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.3 | 4.8 | GO:0030317 | sperm motility(GO:0030317) |
| 0.3 | 0.9 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.3 | 13.2 | GO:0016568 | chromatin modification(GO:0016568) |
| 0.3 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.3 | 5.4 | GO:0000423 | macromitophagy(GO:0000423) mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
| 0.3 | 1.2 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
| 0.3 | 0.6 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.3 | 1.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.3 | 3.2 | GO:1905144 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.3 | 15.3 | GO:0030036 | actin cytoskeleton organization(GO:0030036) |
| 0.3 | 1.8 | GO:0016071 | mRNA metabolic process(GO:0016071) |
| 0.3 | 134.9 | GO:0006508 | proteolysis(GO:0006508) |
| 0.3 | 8.4 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.3 | 2.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.3 | 2.9 | GO:0042177 | negative regulation of protein catabolic process(GO:0042177) |
| 0.3 | 0.6 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.3 | 0.3 | GO:0043584 | nose development(GO:0043584) |
| 0.3 | 1.1 | GO:0060674 | placenta blood vessel development(GO:0060674) |
| 0.3 | 1.4 | GO:0007188 | adenylate cyclase-modulating G-protein coupled receptor signaling pathway(GO:0007188) |
| 0.3 | 0.3 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.3 | 0.3 | GO:0060026 | convergent extension(GO:0060026) |
| 0.3 | 0.3 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.3 | 3.1 | GO:0071897 | DNA biosynthetic process(GO:0071897) |
| 0.3 | 1.1 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
| 0.3 | 2.2 | GO:0017148 | negative regulation of translation(GO:0017148) |
| 0.3 | 0.5 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
| 0.3 | 0.3 | GO:0014911 | positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.3 | 0.8 | GO:0006448 | regulation of translational elongation(GO:0006448) |
| 0.3 | 1.4 | GO:0070542 | response to fatty acid(GO:0070542) |
| 0.3 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.3 | 0.3 | GO:0031503 | protein complex localization(GO:0031503) |
| 0.3 | 2.2 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.3 | 1.9 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.3 | 0.3 | GO:0032479 | regulation of type I interferon production(GO:0032479) |
| 0.3 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.3 | 0.3 | GO:0090501 | RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.3 | 0.3 | GO:0034103 | regulation of tissue remodeling(GO:0034103) |
| 0.3 | 5.3 | GO:0031424 | keratinization(GO:0031424) |
| 0.3 | 13.7 | GO:0007519 | skeletal muscle tissue development(GO:0007519) |
| 0.3 | 0.5 | GO:0070265 | necrotic cell death(GO:0070265) |
| 0.3 | 0.3 | GO:0090594 | wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
| 0.3 | 0.5 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.3 | 0.5 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.3 | 10.2 | GO:0007605 | sensory perception of sound(GO:0007605) |
| 0.2 | 0.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.2 | 0.2 | GO:0016446 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.2 | 0.2 | GO:0010823 | negative regulation of mitochondrion organization(GO:0010823) |
| 0.2 | 0.7 | GO:0032273 | positive regulation of protein polymerization(GO:0032273) |
| 0.2 | 4.1 | GO:0001701 | in utero embryonic development(GO:0001701) |
| 0.2 | 0.2 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.2 | 0.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.2 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 0.2 | GO:1903312 | negative regulation of mRNA metabolic process(GO:1903312) |
| 0.2 | 7.1 | GO:0006914 | autophagy(GO:0006914) |
| 0.2 | 6.8 | GO:0006364 | rRNA processing(GO:0006364) |
| 0.2 | 0.9 | GO:0090130 | tissue migration(GO:0090130) |
| 0.2 | 31.6 | GO:0043043 | peptide biosynthetic process(GO:0043043) |
| 0.2 | 0.2 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.2 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.2 | 6.6 | GO:0002244 | hematopoietic progenitor cell differentiation(GO:0002244) |
| 0.2 | 0.5 | GO:0051403 | stress-activated MAPK cascade(GO:0051403) |
| 0.2 | 1.8 | GO:0014013 | regulation of gliogenesis(GO:0014013) |
| 0.2 | 0.9 | GO:0001837 | epithelial to mesenchymal transition(GO:0001837) |
| 0.2 | 0.4 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.2 | 1.8 | GO:0016073 | snRNA metabolic process(GO:0016073) |
| 0.2 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 1.1 | GO:0048814 | regulation of dendrite morphogenesis(GO:0048814) |
| 0.2 | 7.5 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
| 0.2 | 0.2 | GO:1903524 | positive regulation of blood circulation(GO:1903524) |
| 0.2 | 1.1 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.2 | 0.4 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.2 | 0.2 | GO:0046822 | regulation of nucleocytoplasmic transport(GO:0046822) |
| 0.2 | 0.2 | GO:0048708 | astrocyte differentiation(GO:0048708) |
| 0.2 | 2.8 | GO:0008610 | lipid biosynthetic process(GO:0008610) |
| 0.2 | 0.8 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
| 0.2 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.2 | 0.8 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.2 | 2.0 | GO:0097191 | extrinsic apoptotic signaling pathway(GO:0097191) |
| 0.2 | 0.2 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.2 | 0.4 | GO:0060512 | prostate gland morphogenesis(GO:0060512) |
| 0.2 | 0.2 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.2 | 0.2 | GO:0042634 | regulation of hair cycle(GO:0042634) |
| 0.2 | 8.8 | GO:0016311 | dephosphorylation(GO:0016311) |
| 0.2 | 0.4 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 0.2 | 0.2 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.2 | 0.4 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.2 | 0.6 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.2 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.2 | 0.4 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.2 | 0.2 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
| 0.2 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 | 0.2 | GO:0045638 | negative regulation of myeloid cell differentiation(GO:0045638) |
| 0.2 | 0.2 | GO:0006401 | RNA catabolic process(GO:0006401) |
| 0.2 | 0.5 | GO:0030098 | lymphocyte differentiation(GO:0030098) |
| 0.2 | 0.2 | GO:0043276 | anoikis(GO:0043276) |
| 0.2 | 0.2 | GO:0071774 | response to fibroblast growth factor(GO:0071774) |
| 0.2 | 0.5 | GO:0015992 | proton transport(GO:0015992) |
| 0.2 | 0.2 | GO:0002335 | mature B cell differentiation(GO:0002335) |
| 0.2 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.2 | 0.8 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.2 | 0.2 | GO:0032094 | response to food(GO:0032094) |
| 0.2 | 2.3 | GO:0007034 | vacuolar transport(GO:0007034) |
| 0.2 | 4.8 | GO:0034660 | ncRNA metabolic process(GO:0034660) |
| 0.2 | 0.2 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.2 | 0.9 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.2 | 0.2 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.1 | 0.1 | GO:0015874 | norepinephrine transport(GO:0015874) |
| 0.1 | 0.3 | GO:0008347 | glial cell migration(GO:0008347) |
| 0.1 | 0.1 | GO:0030705 | cytoskeleton-dependent intracellular transport(GO:0030705) |
| 0.1 | 5.0 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.1 | 0.1 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.1 | 3.3 | GO:0072594 | establishment of protein localization to organelle(GO:0072594) |
| 0.1 | 0.3 | GO:0051668 | localization within membrane(GO:0051668) |
| 0.1 | 104.1 | GO:0006355 | regulation of transcription, DNA-templated(GO:0006355) |
| 0.1 | 0.1 | GO:1901068 | guanosine-containing compound metabolic process(GO:1901068) |
| 0.1 | 0.4 | GO:0009988 | cell-cell recognition(GO:0009988) |
| 0.1 | 0.1 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.1 | 0.3 | GO:0046034 | purine ribonucleoside monophosphate metabolic process(GO:0009167) ATP metabolic process(GO:0046034) |
| 0.1 | 0.1 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.1 | 0.3 | GO:0006959 | humoral immune response(GO:0006959) |
| 0.1 | 0.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 | 0.1 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.1 | 0.4 | GO:0007613 | memory(GO:0007613) |
| 0.1 | 0.1 | GO:0050777 | negative regulation of immune response(GO:0050777) |
| 0.1 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.1 | 0.1 | GO:0001708 | cell fate specification(GO:0001708) |
| 0.1 | 0.1 | GO:0033674 | positive regulation of kinase activity(GO:0033674) |
| 0.1 | 0.3 | GO:0042633 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.1 | 0.5 | GO:0006979 | response to oxidative stress(GO:0006979) |
| 0.1 | 0.1 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.1 | 116.1 | GO:0007606 | sensory perception of chemical stimulus(GO:0007606) |
| 0.1 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.1 | GO:0042107 | cytokine metabolic process(GO:0042107) |
| 0.1 | 0.4 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.1 | 0.3 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.1 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.1 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.1 | 0.1 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
| 0.1 | 0.1 | GO:0009120 | deoxyribonucleoside metabolic process(GO:0009120) |
| 0.1 | 0.1 | GO:0048525 | negative regulation of viral process(GO:0048525) |
| 0.1 | 0.4 | GO:0051216 | cartilage development(GO:0051216) |
| 0.1 | 0.1 | GO:0016125 | sterol metabolic process(GO:0016125) |
| 0.1 | 1.1 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.1 | 0.2 | GO:0055088 | lipid homeostasis(GO:0055088) |
| 0.1 | 0.2 | GO:0042113 | B cell activation(GO:0042113) |
| 0.1 | 0.2 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.1 | 2.3 | GO:0008544 | epidermis development(GO:0008544) |
| 0.1 | 0.1 | GO:0015849 | organic acid transport(GO:0015849) |
| 0.1 | 0.1 | GO:0015837 | amine transport(GO:0015837) |
| 0.1 | 0.1 | GO:0003014 | renal system process(GO:0003014) |
| 0.1 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.1 | 0.1 | GO:0042461 | photoreceptor cell development(GO:0042461) |
| 0.1 | 0.1 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.1 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 0.1 | GO:0006091 | generation of precursor metabolites and energy(GO:0006091) |
| 0.1 | 0.5 | GO:0070482 | response to oxygen levels(GO:0070482) |
| 0.1 | 0.2 | GO:0008306 | associative learning(GO:0008306) |
| 0.1 | 0.1 | GO:0007422 | peripheral nervous system development(GO:0007422) |
| 0.1 | 0.1 | GO:0035587 | purinergic receptor signaling pathway(GO:0035587) |
| 0.1 | 0.2 | GO:0046683 | response to organophosphorus(GO:0046683) |
| 0.1 | 0.2 | GO:0010737 | protein kinase A signaling(GO:0010737) regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 0.1 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
| 0.1 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 | 0.1 | GO:0030879 | mammary gland development(GO:0030879) |
| 0.1 | 0.3 | GO:0014823 | response to activity(GO:0014823) |
| 0.0 | 4.2 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.7 | GO:0008284 | positive regulation of cell proliferation(GO:0008284) |
| 0.0 | 0.0 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.0 | GO:0009268 | response to pH(GO:0009268) |
| 0.0 | 0.1 | GO:0009725 | response to hormone(GO:0009725) |
| 0.0 | 0.0 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.0 | GO:0030278 | regulation of ossification(GO:0030278) |
| 0.0 | 0.0 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.0 | 0.0 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
| 0.0 | 0.0 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 | 0.0 | GO:0061515 | myeloid cell development(GO:0061515) |
| 0.0 | 0.1 | GO:0007369 | gastrulation(GO:0007369) |
| 0.0 | 0.0 | GO:0009620 | response to fungus(GO:0009620) |
| 0.0 | 0.1 | GO:0001964 | startle response(GO:0001964) |
| 0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.0 | 0.0 | GO:1903900 | regulation of viral life cycle(GO:1903900) |
| 0.0 | 0.0 | GO:0042454 | ribonucleoside catabolic process(GO:0042454) |
| 0.0 | 0.0 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.0 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.2 | GO:0006366 | transcription from RNA polymerase II promoter(GO:0006366) |
| 0.0 | 0.3 | GO:0006629 | lipid metabolic process(GO:0006629) |
| 0.0 | 0.0 | GO:0021532 | neural tube patterning(GO:0021532) |
| 0.0 | 0.0 | GO:0019751 | polyol metabolic process(GO:0019751) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 17.1 | 68.5 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 15.0 | 44.9 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 14.1 | 99.0 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 14.1 | 98.9 | GO:0045180 | basal cortex(GO:0045180) |
| 13.4 | 134.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 13.0 | 39.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 12.9 | 102.8 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 11.4 | 45.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 10.4 | 41.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 9.9 | 29.7 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 9.4 | 84.8 | GO:0071439 | clathrin complex(GO:0071439) |
| 9.2 | 36.7 | GO:0030689 | Noc complex(GO:0030689) |
| 8.9 | 26.6 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 8.7 | 52.5 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 8.6 | 34.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 8.0 | 64.4 | GO:0045179 | apical cortex(GO:0045179) |
| 7.9 | 23.8 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 7.9 | 47.5 | GO:0002177 | manchette(GO:0002177) |
| 7.7 | 23.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 7.6 | 473.3 | GO:0031526 | brush border membrane(GO:0031526) |
| 7.5 | 52.5 | GO:0005688 | U6 snRNP(GO:0005688) |
| 7.4 | 66.6 | GO:0042627 | chylomicron(GO:0042627) |
| 7.3 | 43.7 | GO:0005915 | zonula adherens(GO:0005915) |
| 7.2 | 36.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 7.0 | 424.0 | GO:0005903 | brush border(GO:0005903) |
| 6.9 | 34.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 6.9 | 48.0 | GO:0031528 | microvillus membrane(GO:0031528) |
| 6.4 | 96.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 6.2 | 18.7 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 6.2 | 24.7 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 6.1 | 141.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 6.1 | 30.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 6.0 | 126.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 5.9 | 23.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 5.8 | 17.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 5.7 | 17.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 5.7 | 67.9 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 5.7 | 33.9 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 5.6 | 22.6 | GO:0097255 | R2TP complex(GO:0097255) |
| 5.3 | 15.8 | GO:1990357 | terminal web(GO:1990357) |
| 5.2 | 20.7 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 5.1 | 15.4 | GO:0008091 | spectrin(GO:0008091) |
| 5.0 | 25.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 5.0 | 74.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 4.6 | 13.9 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 4.6 | 27.3 | GO:0070847 | core mediator complex(GO:0070847) |
| 4.5 | 31.8 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 4.5 | 13.4 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 4.4 | 17.7 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 4.4 | 17.7 | GO:0098536 | deuterosome(GO:0098536) |
| 4.4 | 30.9 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 4.4 | 13.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 4.4 | 17.4 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 4.3 | 43.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 4.2 | 25.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 4.2 | 4.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 4.2 | 4.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 4.2 | 16.6 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 4.1 | 16.6 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 4.1 | 16.4 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 4.1 | 20.4 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 4.1 | 32.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 4.0 | 20.0 | GO:0005638 | lamin filament(GO:0005638) |
| 4.0 | 8.0 | GO:0070938 | contractile ring(GO:0070938) |
| 4.0 | 7.9 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 3.9 | 15.8 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 3.9 | 11.8 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 3.9 | 42.9 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 3.8 | 65.0 | GO:0043034 | costamere(GO:0043034) |
| 3.8 | 3.8 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 3.8 | 15.1 | GO:0030478 | actin cap(GO:0030478) |
| 3.7 | 37.0 | GO:0031143 | pseudopodium(GO:0031143) |
| 3.7 | 18.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 3.5 | 10.6 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 3.5 | 7.0 | GO:0071437 | invadopodium(GO:0071437) |
| 3.5 | 59.3 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 3.4 | 99.1 | GO:0016235 | aggresome(GO:0016235) |
| 3.4 | 10.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 3.4 | 20.3 | GO:0005796 | Golgi lumen(GO:0005796) |
| 3.3 | 10.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 3.3 | 710.0 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 3.3 | 26.5 | GO:0031988 | membrane-bounded vesicle(GO:0031988) |
| 3.3 | 9.9 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 3.3 | 39.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 3.3 | 6.6 | GO:0005579 | membrane attack complex(GO:0005579) |
| 3.2 | 9.6 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 3.2 | 25.7 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 3.2 | 9.6 | GO:0005745 | m-AAA complex(GO:0005745) |
| 3.2 | 25.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 3.2 | 28.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 3.2 | 157.8 | GO:0005871 | kinesin complex(GO:0005871) |
| 3.1 | 18.8 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 3.1 | 6.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 3.1 | 9.4 | GO:0005955 | calcineurin complex(GO:0005955) |
| 3.1 | 9.3 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 3.1 | 40.0 | GO:0071565 | nBAF complex(GO:0071565) |
| 3.1 | 9.2 | GO:0097452 | GAIT complex(GO:0097452) |
| 3.1 | 45.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 3.0 | 51.6 | GO:0000242 | pericentriolar material(GO:0000242) |
| 3.0 | 257.8 | GO:0072562 | blood microparticle(GO:0072562) |
| 3.0 | 45.1 | GO:0031941 | filamentous actin(GO:0031941) |
| 3.0 | 21.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 3.0 | 9.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 3.0 | 128.6 | GO:0032587 | ruffle membrane(GO:0032587) |
| 3.0 | 11.9 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 3.0 | 8.9 | GO:0042825 | TAP complex(GO:0042825) |
| 3.0 | 8.9 | GO:0036064 | ciliary basal body(GO:0036064) |
| 3.0 | 68.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 2.9 | 63.2 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 2.9 | 5.7 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 2.8 | 16.7 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 2.8 | 113.6 | GO:0042641 | actomyosin(GO:0042641) |
| 2.8 | 27.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 2.7 | 5.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 2.7 | 8.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 2.7 | 8.1 | GO:1990923 | PET complex(GO:1990923) |
| 2.7 | 357.6 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 2.7 | 5.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 2.7 | 16.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 2.7 | 45.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 2.7 | 8.0 | GO:0000811 | GINS complex(GO:0000811) |
| 2.7 | 23.9 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 2.6 | 13.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 2.6 | 202.5 | GO:0043296 | apical junction complex(GO:0043296) |
| 2.6 | 21.0 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 2.6 | 2.6 | GO:0043293 | apoptosome(GO:0043293) |
| 2.6 | 5.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 2.5 | 17.7 | GO:0043218 | compact myelin(GO:0043218) |
| 2.4 | 9.8 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 2.4 | 9.7 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 2.4 | 4.8 | GO:0001650 | fibrillar center(GO:0001650) |
| 2.4 | 7.2 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 2.4 | 40.8 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 2.4 | 123.8 | GO:0005811 | lipid particle(GO:0005811) |
| 2.4 | 7.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 2.4 | 4.8 | GO:0005683 | U7 snRNP(GO:0005683) |
| 2.4 | 7.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 2.4 | 7.1 | GO:0097433 | dense body(GO:0097433) |
| 2.4 | 4.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 2.4 | 14.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 2.4 | 2.4 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 2.3 | 27.8 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 2.3 | 76.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 2.3 | 39.1 | GO:0005614 | interstitial matrix(GO:0005614) |
| 2.3 | 34.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 2.3 | 49.6 | GO:0070069 | cytochrome complex(GO:0070069) |
| 2.3 | 40.6 | GO:0005922 | connexon complex(GO:0005922) |
| 2.2 | 2.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 2.2 | 22.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 2.2 | 2.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 2.2 | 6.6 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 2.2 | 24.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 2.2 | 6.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 2.2 | 15.4 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 2.2 | 6.6 | GO:0016342 | catenin complex(GO:0016342) |
| 2.2 | 2.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 2.2 | 2.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 2.2 | 6.5 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 2.2 | 4.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 2.2 | 10.8 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 2.1 | 27.9 | GO:0038201 | TOR complex(GO:0038201) |
| 2.1 | 4.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 2.1 | 6.4 | GO:0000235 | astral microtubule(GO:0000235) |
| 2.1 | 163.6 | GO:0005604 | basement membrane(GO:0005604) |
| 2.1 | 264.5 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 2.1 | 12.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 2.1 | 444.8 | GO:0005925 | focal adhesion(GO:0005925) |
| 2.1 | 8.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 2.1 | 6.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 2.1 | 10.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 2.1 | 92.4 | GO:0005770 | late endosome(GO:0005770) |
| 2.0 | 4.1 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 2.0 | 2.0 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 2.0 | 6.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 2.0 | 4.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 2.0 | 592.5 | GO:0005667 | transcription factor complex(GO:0005667) |
| 2.0 | 16.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 2.0 | 12.0 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 2.0 | 10.0 | GO:0042382 | paraspeckles(GO:0042382) |
| 2.0 | 21.8 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 2.0 | 19.6 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 1.9 | 180.6 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 1.9 | 79.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 1.9 | 7.8 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 1.9 | 1.9 | GO:0097413 | Lewy body(GO:0097413) |
| 1.9 | 1.9 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 1.9 | 11.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 1.9 | 7.6 | GO:0005883 | neurofilament(GO:0005883) |
| 1.9 | 16.7 | GO:0070852 | cell body fiber(GO:0070852) |
| 1.8 | 11.0 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 1.8 | 1.8 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 1.8 | 3.6 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 1.8 | 7.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 1.8 | 5.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 1.8 | 3155.2 | GO:0070062 | extracellular exosome(GO:0070062) |
| 1.8 | 5.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 1.8 | 17.7 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 1.8 | 49.5 | GO:0032040 | small-subunit processome(GO:0032040) |
| 1.8 | 19.4 | GO:0035102 | PRC1 complex(GO:0035102) |
| 1.8 | 8.8 | GO:0045178 | basal part of cell(GO:0045178) |
| 1.7 | 10.5 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 1.7 | 13.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 1.7 | 20.5 | GO:0033202 | DNA helicase complex(GO:0033202) |
| 1.7 | 5.1 | GO:0071547 | piP-body(GO:0071547) |
| 1.7 | 11.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 1.7 | 13.3 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 1.7 | 271.4 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 1.7 | 14.9 | GO:0070161 | anchoring junction(GO:0070161) |
| 1.6 | 4.9 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 1.6 | 8.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 1.6 | 144.9 | GO:0005769 | early endosome(GO:0005769) |
| 1.6 | 11.4 | GO:0010369 | chromocenter(GO:0010369) |
| 1.6 | 9.7 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 1.6 | 1.6 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 1.6 | 9.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 1.6 | 4.7 | GO:0043196 | varicosity(GO:0043196) |
| 1.6 | 3.2 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 1.6 | 25.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 1.6 | 4.7 | GO:0046930 | pore complex(GO:0046930) |
| 1.6 | 32.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 1.5 | 41.7 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 1.5 | 13.9 | GO:0033391 | chromatoid body(GO:0033391) |
| 1.5 | 46.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 1.5 | 60.8 | GO:0016363 | nuclear matrix(GO:0016363) |
| 1.5 | 4.5 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 1.5 | 6.0 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 1.5 | 9.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 1.5 | 92.5 | GO:0005938 | cell cortex(GO:0005938) |
| 1.5 | 4.5 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 1.5 | 1.5 | GO:0031523 | Myb complex(GO:0031523) |
| 1.5 | 1.5 | GO:0002141 | stereocilia ankle link(GO:0002141) USH2 complex(GO:1990696) |
| 1.5 | 2.9 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 1.5 | 4.4 | GO:0035861 | site of double-strand break(GO:0035861) |
| 1.5 | 32.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 1.5 | 5.9 | GO:0016600 | flotillin complex(GO:0016600) |
| 1.4 | 8.7 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 1.4 | 13.0 | GO:0030057 | desmosome(GO:0030057) |
| 1.4 | 21.6 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 1.4 | 1.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 1.4 | 67.8 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 1.4 | 4.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 1.4 | 51.5 | GO:0005643 | nuclear pore(GO:0005643) |
| 1.4 | 1.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 1.4 | 6.9 | GO:0090544 | BAF-type complex(GO:0090544) |
| 1.4 | 63.3 | GO:0016605 | PML body(GO:0016605) |
| 1.4 | 1.4 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 1.4 | 2.7 | GO:1990777 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
| 1.4 | 5.5 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
| 1.3 | 10.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 1.3 | 24.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 1.3 | 13.3 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 1.3 | 13.3 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 1.3 | 11.8 | GO:0032797 | SMN complex(GO:0032797) |
| 1.3 | 11.7 | GO:0015629 | actin cytoskeleton(GO:0015629) |
| 1.3 | 5.2 | GO:0061702 | inflammasome complex(GO:0061702) |
| 1.3 | 23.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 1.3 | 20.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 1.3 | 31.0 | GO:0055037 | recycling endosome(GO:0055037) |
| 1.3 | 1.3 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 1.3 | 2.6 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 1.3 | 341.7 | GO:0005730 | nucleolus(GO:0005730) |
| 1.3 | 1.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 1.3 | 8.9 | GO:0031430 | M band(GO:0031430) |
| 1.3 | 8.9 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 1.3 | 25.4 | GO:0031970 | organelle envelope lumen(GO:0031970) |
| 1.3 | 16.5 | GO:0005884 | actin filament(GO:0005884) |
| 1.3 | 1.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 1.3 | 7.5 | GO:0034709 | methylosome(GO:0034709) |
| 1.3 | 2.5 | GO:0001739 | sex chromatin(GO:0001739) |
| 1.2 | 12.4 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 1.2 | 3.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 1.2 | 3.7 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 1.2 | 4.9 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 1.2 | 3.7 | GO:0001652 | granular component(GO:0001652) |
| 1.2 | 4.9 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 1.2 | 9.8 | GO:0000346 | transcription export complex(GO:0000346) |
| 1.2 | 2.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 1.2 | 29.4 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 1.2 | 11.0 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 1.2 | 4.9 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 1.2 | 196.3 | GO:0000785 | chromatin(GO:0000785) |
| 1.2 | 13.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 1.2 | 9.7 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 1.2 | 1245.0 | GO:0005654 | nucleoplasm(GO:0005654) |
| 1.2 | 1.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 1.2 | 6.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 1.2 | 4.7 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 1.2 | 2.3 | GO:0042555 | MCM complex(GO:0042555) |
| 1.2 | 8.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 1.2 | 9.3 | GO:0045171 | intercellular bridge(GO:0045171) |
| 1.2 | 4.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 1.2 | 4.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 1.2 | 6.9 | GO:0034464 | BBSome(GO:0034464) |
| 1.1 | 3.4 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 1.1 | 2.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 1.1 | 27.1 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 1.1 | 2.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 1.1 | 7.8 | GO:0030894 | replisome(GO:0030894) |
| 1.1 | 5.6 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 1.1 | 3.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 1.1 | 3.3 | GO:0036156 | inner dynein arm(GO:0036156) |
| 1.1 | 4.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 1.1 | 7.6 | GO:0005911 | cell-cell junction(GO:0005911) |
| 1.1 | 6.5 | GO:0005902 | microvillus(GO:0005902) |
| 1.1 | 3.2 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 1.1 | 47.6 | GO:0043005 | neuron projection(GO:0043005) |
| 1.0 | 5.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 1.0 | 4.1 | GO:0001520 | outer dense fiber(GO:0001520) |
| 1.0 | 5.2 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 1.0 | 42.3 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 1.0 | 9.2 | GO:0031082 | BLOC complex(GO:0031082) |
| 1.0 | 34.8 | GO:0000139 | Golgi membrane(GO:0000139) |
| 1.0 | 1.0 | GO:0044292 | dendrite terminus(GO:0044292) |
| 1.0 | 8.1 | GO:0005876 | spindle microtubule(GO:0005876) |
| 1.0 | 30.3 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 1.0 | 32.2 | GO:0031975 | organelle envelope(GO:0031967) envelope(GO:0031975) |
| 1.0 | 10.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 1.0 | 6.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 1.0 | 4.0 | GO:0005874 | microtubule(GO:0005874) |
| 1.0 | 3.0 | GO:0005581 | collagen trimer(GO:0005581) |
| 1.0 | 7.9 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 1.0 | 585.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 1.0 | 216.5 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 1.0 | 234.6 | GO:0005794 | Golgi apparatus(GO:0005794) |
| 1.0 | 1.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 1.0 | 122.7 | GO:0009986 | cell surface(GO:0009986) |
| 1.0 | 9.7 | GO:0030496 | midbody(GO:0030496) |
| 1.0 | 23.0 | GO:0043197 | dendritic spine(GO:0043197) |
| 1.0 | 303.7 | GO:0031410 | cytoplasmic vesicle(GO:0031410) |
| 0.9 | 0.9 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.9 | 2.8 | GO:0031417 | NatC complex(GO:0031417) |
| 0.9 | 6.5 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.9 | 5.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.9 | 2.7 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.9 | 6.4 | GO:0005657 | replication fork(GO:0005657) |
| 0.9 | 0.9 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.9 | 1.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.9 | 523.6 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.9 | 503.7 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
| 0.9 | 0.9 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.9 | 0.9 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.9 | 14.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.9 | 2117.1 | GO:0005737 | cytoplasm(GO:0005737) |
| 0.9 | 0.9 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.8 | 0.8 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.8 | 711.0 | GO:0005576 | extracellular region(GO:0005576) |
| 0.8 | 1.6 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.8 | 793.6 | GO:0043231 | intracellular membrane-bounded organelle(GO:0043231) |
| 0.8 | 73.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.7 | 7.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.7 | 440.8 | GO:0005886 | plasma membrane(GO:0005886) |
| 0.6 | 1.9 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.5 | 80.9 | GO:0005622 | intracellular(GO:0005622) |
| 0.5 | 0.5 | GO:0098805 | whole membrane(GO:0098805) |
| 0.5 | 28.2 | GO:0043234 | protein complex(GO:0043234) |
| 0.4 | 1.8 | GO:0031252 | cell leading edge(GO:0031252) |
| 0.4 | 665.6 | GO:0016020 | membrane(GO:0016020) |
| 0.4 | 0.9 | GO:0030054 | cell junction(GO:0030054) |
| 0.2 | 0.2 | GO:0012505 | endomembrane system(GO:0012505) |
| 0.1 | 0.1 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.2 | GO:0097458 | neuron part(GO:0097458) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 34.2 | 102.6 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 28.6 | 114.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 27.4 | 109.7 | GO:0015265 | urea channel activity(GO:0015265) |
| 26.7 | 106.7 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 24.9 | 99.6 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 23.9 | 71.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 21.8 | 108.9 | GO:0005499 | vitamin D binding(GO:0005499) |
| 18.4 | 128.9 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 18.3 | 55.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 18.0 | 53.9 | GO:0051870 | methotrexate binding(GO:0051870) |
| 17.6 | 52.8 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 17.1 | 51.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 16.8 | 67.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 16.6 | 33.2 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 15.7 | 62.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 15.5 | 46.4 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 14.6 | 14.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 14.3 | 57.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 14.0 | 210.6 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 13.9 | 111.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 13.4 | 53.6 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 12.3 | 37.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 11.7 | 35.2 | GO:0035877 | death effector domain binding(GO:0035877) |
| 11.6 | 58.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 11.1 | 33.3 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 11.1 | 33.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 11.1 | 33.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 11.1 | 44.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 10.5 | 94.7 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 10.1 | 30.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 9.7 | 38.8 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 9.7 | 29.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 9.5 | 38.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 9.4 | 28.2 | GO:0070905 | serine binding(GO:0070905) |
| 9.2 | 36.8 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 9.0 | 27.1 | GO:0019862 | IgA binding(GO:0019862) |
| 8.9 | 26.6 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 8.8 | 26.5 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 8.6 | 77.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 8.4 | 25.3 | GO:0008142 | oxysterol binding(GO:0008142) |
| 8.4 | 41.8 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 8.2 | 32.9 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 8.2 | 40.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 8.1 | 32.2 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 8.1 | 24.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 7.7 | 23.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 7.7 | 23.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 7.7 | 38.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 7.6 | 30.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 7.5 | 15.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 7.4 | 59.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 7.3 | 36.6 | GO:0070061 | fructose binding(GO:0070061) |
| 7.2 | 43.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 7.2 | 14.3 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 7.2 | 7.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 7.0 | 55.9 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 6.8 | 82.0 | GO:0044606 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
| 6.8 | 27.3 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 6.8 | 20.4 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 6.7 | 54.0 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 6.7 | 26.8 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 6.6 | 33.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 6.5 | 6.5 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 6.5 | 26.0 | GO:0045340 | mercury ion binding(GO:0045340) |
| 6.5 | 32.4 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 6.4 | 63.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 6.4 | 19.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 6.3 | 106.8 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 6.3 | 18.8 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 6.2 | 18.5 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 6.2 | 43.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 6.1 | 42.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 6.0 | 30.1 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 6.0 | 23.8 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 5.9 | 29.6 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 5.9 | 59.0 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 5.9 | 23.6 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 5.9 | 111.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 5.7 | 17.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 5.7 | 17.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 5.7 | 113.1 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 5.6 | 28.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 5.6 | 22.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 5.5 | 33.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 5.5 | 38.3 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 5.4 | 26.8 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 5.3 | 32.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 5.3 | 58.6 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 5.3 | 169.8 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 5.3 | 36.9 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 5.2 | 15.7 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 5.2 | 20.8 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 5.2 | 15.5 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 5.2 | 61.9 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 5.1 | 25.6 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 5.1 | 15.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 5.0 | 40.3 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 5.0 | 15.1 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 5.0 | 15.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 5.0 | 89.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 4.9 | 19.8 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 4.9 | 9.9 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 4.9 | 14.7 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 4.9 | 19.6 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 4.9 | 19.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 4.9 | 24.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 4.8 | 14.4 | GO:0097001 | ceramide binding(GO:0097001) |
| 4.7 | 19.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 4.7 | 28.4 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 4.7 | 14.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 4.7 | 23.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 4.7 | 28.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 4.7 | 23.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 4.6 | 27.8 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 4.6 | 36.8 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 4.6 | 9.2 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 4.6 | 9.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 4.5 | 22.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 4.5 | 13.4 | GO:0034618 | arginine binding(GO:0034618) |
| 4.5 | 66.8 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 4.4 | 53.4 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 4.4 | 43.9 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 4.4 | 26.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 4.4 | 17.4 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 4.3 | 125.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 4.3 | 4.3 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
| 4.3 | 12.9 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 4.3 | 12.9 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 4.3 | 17.0 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 4.2 | 122.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 4.2 | 50.0 | GO:0001848 | complement binding(GO:0001848) |
| 4.2 | 29.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 4.2 | 16.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 4.1 | 20.5 | GO:0016936 | galactoside binding(GO:0016936) |
| 4.1 | 8.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 4.1 | 8.1 | GO:0045182 | translation regulator activity(GO:0045182) |
| 4.0 | 24.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 4.0 | 12.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 4.0 | 24.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 4.0 | 28.2 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
| 4.0 | 28.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 4.0 | 11.9 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 4.0 | 19.9 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 4.0 | 27.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 4.0 | 15.8 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 3.9 | 11.8 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 3.9 | 11.7 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 3.9 | 15.6 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 3.9 | 11.6 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 3.9 | 7.7 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 3.9 | 11.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 3.9 | 15.4 | GO:0050693 | LBD domain binding(GO:0050693) |
| 3.8 | 3.8 | GO:0052827 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
| 3.8 | 424.3 | GO:0003774 | motor activity(GO:0003774) |
| 3.8 | 19.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 3.8 | 129.5 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 3.8 | 15.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 3.8 | 37.9 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 3.8 | 15.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 3.8 | 7.5 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 3.8 | 15.0 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 3.8 | 11.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 3.7 | 3.7 | GO:0032767 | copper chaperone activity(GO:0016531) copper-dependent protein binding(GO:0032767) |
| 3.7 | 14.9 | GO:0030274 | LIM domain binding(GO:0030274) |
| 3.7 | 41.0 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 3.7 | 25.9 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 3.7 | 22.2 | GO:0034863 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 3.7 | 11.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 3.7 | 7.4 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 3.7 | 11.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 3.7 | 14.7 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 3.7 | 25.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 3.6 | 39.6 | GO:0017166 | vinculin binding(GO:0017166) |
| 3.6 | 17.9 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 3.6 | 32.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 3.6 | 39.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 3.6 | 17.8 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 3.5 | 49.7 | GO:0008143 | poly(A) binding(GO:0008143) |
| 3.5 | 3.5 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
| 3.5 | 109.2 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 3.5 | 3.5 | GO:0005119 | smoothened binding(GO:0005119) |
| 3.5 | 45.1 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 3.5 | 10.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 3.4 | 41.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 3.4 | 10.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 3.4 | 10.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 3.4 | 3.4 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
| 3.4 | 6.8 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 3.4 | 61.0 | GO:0003785 | actin monomer binding(GO:0003785) |
| 3.4 | 16.9 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 3.4 | 158.1 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 3.4 | 36.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 3.4 | 10.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 3.3 | 10.0 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 3.3 | 46.8 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 3.3 | 13.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 3.3 | 3.3 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 3.3 | 6.6 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 3.3 | 9.8 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 3.3 | 9.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 3.3 | 3.3 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 3.3 | 9.8 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 3.3 | 26.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 3.3 | 19.5 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 3.2 | 13.0 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 3.2 | 6.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 3.2 | 41.0 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 3.2 | 9.5 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 3.2 | 3.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 3.1 | 25.0 | GO:0070402 | NADPH binding(GO:0070402) |
| 3.1 | 31.3 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 3.1 | 9.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 3.1 | 31.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 3.1 | 87.3 | GO:0015485 | cholesterol binding(GO:0015485) |
| 3.1 | 9.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 3.1 | 49.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 3.1 | 9.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 3.1 | 12.3 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 3.1 | 42.9 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 3.1 | 52.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 3.0 | 9.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 3.0 | 9.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 3.0 | 60.5 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 3.0 | 9.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 3.0 | 6.0 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 3.0 | 185.1 | GO:0002039 | p53 binding(GO:0002039) |
| 3.0 | 8.9 | GO:0043559 | insulin binding(GO:0043559) |
| 3.0 | 8.9 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 3.0 | 59.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 3.0 | 11.8 | GO:0019808 | polyamine binding(GO:0019808) |
| 2.9 | 14.7 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 2.9 | 14.7 | GO:0033265 | choline binding(GO:0033265) |
| 2.9 | 2.9 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 2.9 | 67.5 | GO:0042805 | actinin binding(GO:0042805) |
| 2.9 | 5.8 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 2.9 | 2.9 | GO:1904680 | peptide-transporting ATPase activity(GO:0015440) peptide transmembrane transporter activity(GO:1904680) |
| 2.9 | 89.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 2.9 | 28.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 2.9 | 5.7 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
| 2.9 | 14.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 2.8 | 2.8 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 2.8 | 5.7 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 2.8 | 22.7 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 2.8 | 5.6 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 2.8 | 11.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 2.8 | 5.6 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 2.8 | 8.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 2.8 | 22.3 | GO:0048156 | tau protein binding(GO:0048156) |
| 2.8 | 25.0 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 2.8 | 55.6 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 2.8 | 13.9 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 2.8 | 22.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 2.8 | 60.7 | GO:0045502 | dynein binding(GO:0045502) |
| 2.7 | 8.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 2.7 | 11.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 2.7 | 10.9 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 2.7 | 13.7 | GO:0005113 | patched binding(GO:0005113) |
| 2.7 | 8.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 2.7 | 8.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 2.7 | 21.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 2.7 | 2.7 | GO:0019003 | GDP binding(GO:0019003) |
| 2.7 | 10.8 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 2.7 | 5.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 2.7 | 29.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 2.7 | 10.6 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 2.7 | 5.3 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 2.6 | 7.9 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 2.6 | 47.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 2.6 | 15.7 | GO:0035197 | siRNA binding(GO:0035197) |
| 2.6 | 10.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 2.6 | 18.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 2.6 | 171.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 2.6 | 10.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 2.6 | 7.7 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 2.6 | 12.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 2.6 | 7.7 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 2.5 | 12.7 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 2.5 | 63.6 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 2.5 | 177.5 | GO:0015293 | symporter activity(GO:0015293) |
| 2.5 | 10.1 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 2.5 | 2.5 | GO:0016866 | intramolecular transferase activity(GO:0016866) intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 2.5 | 17.6 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 2.5 | 10.0 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 2.5 | 2.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 2.5 | 19.9 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 2.5 | 22.4 | GO:0070513 | death domain binding(GO:0070513) |
| 2.5 | 7.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 2.5 | 4.9 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 2.5 | 9.9 | GO:0002054 | nucleobase binding(GO:0002054) |
| 2.5 | 9.8 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 2.5 | 4.9 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 2.4 | 24.4 | GO:0005522 | profilin binding(GO:0005522) |
| 2.4 | 12.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 2.4 | 9.7 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 2.4 | 17.0 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 2.4 | 28.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 2.4 | 7.2 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 2.4 | 7.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 2.4 | 102.3 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 2.4 | 47.4 | GO:0019894 | kinesin binding(GO:0019894) |
| 2.4 | 2.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 2.4 | 11.8 | GO:0019841 | retinol binding(GO:0019841) |
| 2.3 | 16.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 2.3 | 9.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 2.3 | 16.4 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 2.3 | 11.6 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 2.3 | 57.9 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 2.3 | 13.8 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 2.3 | 27.6 | GO:0043274 | phospholipase binding(GO:0043274) |
| 2.3 | 59.6 | GO:0070330 | aromatase activity(GO:0070330) |
| 2.3 | 6.9 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 2.3 | 6.9 | GO:0004064 | arylesterase activity(GO:0004064) |
| 2.3 | 20.6 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 2.3 | 4.6 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 2.3 | 2.3 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 2.3 | 168.2 | GO:0051015 | actin filament binding(GO:0051015) |
| 2.3 | 11.4 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 2.3 | 4.5 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 2.3 | 2.3 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 2.3 | 67.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 2.3 | 29.4 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 2.3 | 58.7 | GO:0050699 | WW domain binding(GO:0050699) |
| 2.3 | 6.8 | GO:0008199 | ferric iron binding(GO:0008199) |
| 2.3 | 69.9 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 2.2 | 145.1 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 2.2 | 22.1 | GO:0070403 | NAD+ binding(GO:0070403) |
| 2.2 | 13.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 2.2 | 8.9 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 2.2 | 61.9 | GO:0030145 | manganese ion binding(GO:0030145) |
| 2.2 | 26.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 2.2 | 13.1 | GO:0034046 | poly(G) binding(GO:0034046) |
| 2.2 | 30.6 | GO:0045296 | cadherin binding(GO:0045296) |
| 2.2 | 48.0 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 2.2 | 15.3 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 2.2 | 4.3 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 2.2 | 4.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 2.2 | 2.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 2.2 | 30.1 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 2.1 | 23.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 2.1 | 29.9 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 2.1 | 53.0 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 2.1 | 4.2 | GO:0005534 | galactose binding(GO:0005534) |
| 2.1 | 4.2 | GO:0004096 | catalase activity(GO:0004096) |
| 2.1 | 48.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 2.1 | 8.4 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 2.1 | 12.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 2.1 | 12.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 2.1 | 8.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 2.1 | 8.3 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 2.1 | 4.2 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
| 2.1 | 27.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 2.1 | 8.3 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 2.1 | 87.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 2.1 | 6.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 2.1 | 2.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 2.0 | 2.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 2.0 | 4.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 2.0 | 6.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 2.0 | 8.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 2.0 | 148.4 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 2.0 | 6.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 2.0 | 38.6 | GO:0031489 | myosin V binding(GO:0031489) |
| 2.0 | 12.2 | GO:0048185 | activin binding(GO:0048185) |
| 2.0 | 24.1 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 2.0 | 16.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 2.0 | 16.0 | GO:0030955 | potassium ion binding(GO:0030955) |
| 2.0 | 64.0 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 2.0 | 6.0 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 2.0 | 4.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 2.0 | 15.8 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 2.0 | 23.6 | GO:0015645 | fatty acid ligase activity(GO:0015645) |
| 2.0 | 33.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 2.0 | 2.0 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
| 2.0 | 31.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 2.0 | 9.8 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 2.0 | 5.9 | GO:0046790 | virion binding(GO:0046790) |
| 1.9 | 9.7 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
| 1.9 | 5.8 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 1.9 | 13.6 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 1.9 | 9.7 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 1.9 | 67.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 1.9 | 25.1 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 1.9 | 1.9 | GO:0071253 | connexin binding(GO:0071253) |
| 1.9 | 45.6 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 1.9 | 3.8 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 1.9 | 11.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 1.9 | 35.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 1.9 | 3.7 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 1.9 | 3.7 | GO:0032190 | acrosin binding(GO:0032190) |
| 1.9 | 5.6 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 1.9 | 1.9 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 1.9 | 37.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 1.9 | 11.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 1.8 | 7.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 1.8 | 68.2 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 1.8 | 14.7 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 1.8 | 7.4 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 1.8 | 7.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 1.8 | 23.9 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 1.8 | 20.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 1.8 | 44.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 1.8 | 11.0 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 1.8 | 5.5 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 1.8 | 9.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 1.8 | 74.4 | GO:0005507 | copper ion binding(GO:0005507) |
| 1.8 | 39.8 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 1.8 | 9.0 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 1.8 | 1.8 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 1.8 | 9.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 1.8 | 1.8 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 1.8 | 14.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 1.8 | 41.0 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 1.8 | 3.6 | GO:0043199 | sulfate binding(GO:0043199) |
| 1.8 | 3.6 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 1.8 | 12.5 | GO:0010181 | FMN binding(GO:0010181) |
| 1.8 | 10.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 1.8 | 326.3 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 1.8 | 7.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 1.8 | 1.8 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 1.8 | 5.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 1.8 | 15.8 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 1.8 | 5.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 1.8 | 5.3 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 1.7 | 3.5 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 1.7 | 5.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 1.7 | 13.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 1.7 | 6.9 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 1.7 | 13.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 1.7 | 5.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 1.7 | 15.5 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 1.7 | 3.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 1.7 | 1.7 | GO:0050692 | DBD domain binding(GO:0050692) |
| 1.7 | 10.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 1.7 | 1.7 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 1.7 | 37.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 1.7 | 6.7 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 1.7 | 3.3 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 1.7 | 3.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 1.7 | 15.0 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 1.7 | 3.3 | GO:0016595 | glutamate binding(GO:0016595) |
| 1.7 | 6.6 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 1.7 | 6.6 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 1.6 | 1.6 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 1.6 | 1.6 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 1.6 | 11.5 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 1.6 | 3.3 | GO:0030911 | TPR domain binding(GO:0030911) |
| 1.6 | 4.9 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 1.6 | 4.9 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 1.6 | 3.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 1.6 | 4.9 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 1.6 | 14.7 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 1.6 | 4.9 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 1.6 | 4.9 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 1.6 | 35.6 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 1.6 | 11.3 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 1.6 | 29.0 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 1.6 | 6.4 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 1.6 | 25.7 | GO:0017022 | myosin binding(GO:0017022) |
| 1.6 | 11.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 1.6 | 4.8 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
| 1.6 | 25.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 1.6 | 17.4 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 1.6 | 3.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 1.6 | 12.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 1.6 | 3.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 1.6 | 4.7 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 1.6 | 174.2 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 1.6 | 4.7 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 1.6 | 7.8 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 1.6 | 3.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 1.6 | 4.7 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 1.5 | 15.4 | GO:0016594 | glycine binding(GO:0016594) |
| 1.5 | 4.6 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 1.5 | 4.6 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 1.5 | 19.8 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 1.5 | 3.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 1.5 | 30.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 1.5 | 12.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 1.5 | 33.0 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 1.5 | 4.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 1.5 | 6.0 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 1.5 | 24.0 | GO:0008483 | transaminase activity(GO:0008483) |
| 1.5 | 3.0 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
| 1.5 | 10.5 | GO:0005521 | lamin binding(GO:0005521) |
| 1.5 | 34.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 1.5 | 17.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 1.5 | 3.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 1.5 | 5.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 1.5 | 3.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 1.5 | 56.3 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 1.5 | 165.8 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 1.5 | 5.9 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 1.5 | 11.8 | GO:0005123 | death receptor binding(GO:0005123) |
| 1.5 | 8.8 | GO:0030249 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
| 1.5 | 57.0 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 1.5 | 13.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 1.5 | 110.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 1.5 | 52.2 | GO:0035064 | methylated histone binding(GO:0035064) |
| 1.4 | 2.9 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 1.4 | 5.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 1.4 | 2.9 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 1.4 | 4.3 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 1.4 | 11.5 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 1.4 | 5.8 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 1.4 | 7.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 1.4 | 2.9 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 1.4 | 2.9 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 1.4 | 2.9 | GO:0034452 | dynactin binding(GO:0034452) |
| 1.4 | 24.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 1.4 | 19.9 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 1.4 | 132.2 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 1.4 | 1.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 1.4 | 9.9 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 1.4 | 5.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 1.4 | 11.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 1.4 | 123.3 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
| 1.4 | 15.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 1.4 | 4.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 1.4 | 39.0 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 1.4 | 1.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 1.4 | 1.4 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
| 1.4 | 9.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 1.4 | 2.8 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 1.4 | 1.4 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 1.4 | 6.9 | GO:0030332 | cyclin binding(GO:0030332) |
| 1.4 | 27.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 1.4 | 11.0 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 1.4 | 13.7 | GO:0005217 | intracellular ligand-gated ion channel activity(GO:0005217) |
| 1.4 | 2.7 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 1.4 | 13.7 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 1.4 | 21.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 1.4 | 158.1 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 1.4 | 273.6 | GO:0019904 | protein domain specific binding(GO:0019904) |
| 1.4 | 9.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 1.4 | 10.9 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 1.4 | 12.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 1.4 | 14.9 | GO:0030275 | LRR domain binding(GO:0030275) |
| 1.4 | 5.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 1.3 | 35.1 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
| 1.3 | 5.4 | GO:0042731 | PH domain binding(GO:0042731) |
| 1.3 | 117.0 | GO:0004857 | enzyme inhibitor activity(GO:0004857) |
| 1.3 | 1.3 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
| 1.3 | 18.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 1.3 | 1.3 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 1.3 | 5.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 1.3 | 6.7 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
| 1.3 | 9.3 | GO:0031386 | protein tag(GO:0031386) |
| 1.3 | 8.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 1.3 | 8.0 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 1.3 | 8.0 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 1.3 | 5.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 1.3 | 3.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 1.3 | 10.5 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 1.3 | 10.4 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 1.3 | 27.4 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 1.3 | 1.3 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 1.3 | 9.1 | GO:0001618 | virus receptor activity(GO:0001618) |
| 1.3 | 3.9 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 1.3 | 2.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 1.3 | 2.6 | GO:2001070 | starch binding(GO:2001070) |
| 1.3 | 36.2 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 1.3 | 32.2 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 1.3 | 64.4 | GO:0043492 | ATPase activity, coupled to movement of substances(GO:0043492) |
| 1.3 | 18.0 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 1.3 | 2.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 1.3 | 20.5 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 1.3 | 2.5 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 1.3 | 14.0 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 1.3 | 692.6 | GO:0008270 | zinc ion binding(GO:0008270) |
| 1.3 | 1.3 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 1.3 | 7.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 1.3 | 77.1 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 1.3 | 280.4 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
| 1.3 | 3.8 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 1.3 | 13.8 | GO:0004527 | exonuclease activity(GO:0004527) |
| 1.3 | 10.0 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
| 1.3 | 66.3 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 1.3 | 3.8 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 1.2 | 14.9 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 1.2 | 5.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 1.2 | 2.5 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 1.2 | 6.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 1.2 | 44.2 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 1.2 | 4.9 | GO:0031419 | cobalamin binding(GO:0031419) |
| 1.2 | 7.4 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 1.2 | 3.7 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 1.2 | 6.1 | GO:0090484 | drug transporter activity(GO:0090484) |
| 1.2 | 3.6 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 1.2 | 2.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 1.2 | 6.0 | GO:0015288 | porin activity(GO:0015288) |
| 1.2 | 4.8 | GO:0001047 | core promoter binding(GO:0001047) |
| 1.2 | 16.8 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 1.2 | 27.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 1.2 | 3.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 1.2 | 3.6 | GO:0008430 | selenium binding(GO:0008430) |
| 1.2 | 5.9 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 1.2 | 10.6 | GO:0008061 | chitin binding(GO:0008061) |
| 1.2 | 68.2 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 1.2 | 1.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 1.2 | 4.7 | GO:0051861 | glycolipid binding(GO:0051861) |
| 1.2 | 9.4 | GO:0050661 | NADP binding(GO:0050661) |
| 1.2 | 4.7 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 1.2 | 2.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 1.2 | 3.5 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 1.2 | 14.0 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 1.2 | 2.3 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 1.2 | 2.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 1.2 | 1.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 1.2 | 4.6 | GO:0090079 | translation activator activity(GO:0008494) translation regulator activity, nucleic acid binding(GO:0090079) |
| 1.2 | 3.5 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 1.1 | 6.9 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 1.1 | 2.3 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 1.1 | 9.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 1.1 | 117.9 | GO:0005179 | hormone activity(GO:0005179) |
| 1.1 | 1.1 | GO:0031013 | troponin I binding(GO:0031013) |
| 1.1 | 107.0 | GO:0008134 | transcription factor binding(GO:0008134) |
| 1.1 | 7.8 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 1.1 | 1.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 1.1 | 21.1 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 1.1 | 2.2 | GO:0002046 | opsin binding(GO:0002046) |
| 1.1 | 3.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 1.1 | 1.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 1.1 | 2.2 | GO:0043178 | alcohol binding(GO:0043178) |
| 1.1 | 4.4 | GO:0019843 | rRNA binding(GO:0019843) |
| 1.1 | 8.7 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 1.1 | 6.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 1.1 | 8.7 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 1.1 | 7.6 | GO:0030553 | cGMP binding(GO:0030553) |
| 1.1 | 1.1 | GO:0051379 | epinephrine binding(GO:0051379) |
| 1.1 | 18.3 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 1.1 | 5.4 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 1.1 | 26.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 1.1 | 40.7 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 1.1 | 32.0 | GO:0043022 | ribosome binding(GO:0043022) |
| 1.1 | 6.4 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 1.1 | 58.4 | GO:0019902 | phosphatase binding(GO:0019902) |
| 1.1 | 14.8 | GO:0004497 | monooxygenase activity(GO:0004497) |
| 1.1 | 7.4 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 1.1 | 9.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 1.0 | 27.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 1.0 | 2.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 1.0 | 2.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 1.0 | 8.3 | GO:0030552 | cAMP binding(GO:0030552) |
| 1.0 | 1.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 1.0 | 3.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 1.0 | 3.1 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 1.0 | 11.4 | GO:0051287 | NAD binding(GO:0051287) |
| 1.0 | 670.3 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
| 1.0 | 2.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 1.0 | 1.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 1.0 | 13.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 1.0 | 8.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 1.0 | 1.0 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
| 1.0 | 5.1 | GO:0048037 | cofactor binding(GO:0048037) |
| 1.0 | 20.1 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 1.0 | 1.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 1.0 | 4.0 | GO:0016248 | channel inhibitor activity(GO:0016248) |
| 1.0 | 18.9 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 1.0 | 5.9 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 1.0 | 4.9 | GO:0042562 | hormone binding(GO:0042562) |
| 1.0 | 25.5 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 1.0 | 2.0 | GO:0005506 | iron ion binding(GO:0005506) |
| 1.0 | 2.9 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 1.0 | 1.9 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 1.0 | 2.9 | GO:0030515 | snoRNA binding(GO:0030515) |
| 1.0 | 1.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 1.0 | 183.4 | GO:0005525 | GTP binding(GO:0005525) |
| 0.9 | 10.4 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.9 | 17.0 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
| 0.9 | 1.9 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.9 | 11.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.9 | 0.9 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.9 | 2.8 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.9 | 0.9 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) pyrimidine ribonucleotide binding(GO:0032557) |
| 0.9 | 11.1 | GO:0043738 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.9 | 9.2 | GO:0005537 | mannose binding(GO:0005537) |
| 0.9 | 0.9 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.9 | 23.6 | GO:0020037 | heme binding(GO:0020037) |
| 0.9 | 1.8 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.9 | 2.7 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.9 | 3.6 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.9 | 0.9 | GO:0016298 | lipase activity(GO:0016298) |
| 0.9 | 1.8 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.9 | 1.8 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.9 | 7.1 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.9 | 3.5 | GO:0005048 | signal sequence binding(GO:0005048) |
| 0.9 | 2.7 | GO:0061135 | endopeptidase regulator activity(GO:0061135) |
| 0.9 | 1.8 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.9 | 2.6 | GO:1901677 | phosphate transmembrane transporter activity(GO:1901677) |
| 0.9 | 0.9 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.9 | 28.8 | GO:0022832 | voltage-gated ion channel activity(GO:0005244) voltage-gated channel activity(GO:0022832) |
| 0.9 | 12.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.9 | 15.7 | GO:0034062 | RNA polymerase activity(GO:0034062) |
| 0.9 | 0.9 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.9 | 1.7 | GO:0016208 | AMP binding(GO:0016208) |
| 0.9 | 1.7 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.9 | 26.4 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.8 | 4.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.8 | 77.0 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.8 | 23.6 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.8 | 4.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.8 | 2.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.8 | 100.1 | GO:0000981 | RNA polymerase II transcription factor activity, sequence-specific DNA binding(GO:0000981) |
| 0.8 | 5.9 | GO:0019798 | procollagen-proline dioxygenase activity(GO:0019798) |
| 0.8 | 48.4 | GO:0008201 | heparin binding(GO:0008201) |
| 0.8 | 14.2 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.8 | 2.5 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.8 | 3.3 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.8 | 3.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.8 | 7.4 | GO:0008373 | sialyltransferase activity(GO:0008373) |
| 0.8 | 1.6 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.8 | 128.8 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
| 0.8 | 8.0 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.8 | 4.0 | GO:0048038 | quinone binding(GO:0048038) |
| 0.8 | 0.8 | GO:0016877 | ligase activity, forming carbon-sulfur bonds(GO:0016877) |
| 0.8 | 11.9 | GO:0005518 | collagen binding(GO:0005518) |
| 0.8 | 12.7 | GO:0008144 | drug binding(GO:0008144) |
| 0.8 | 2.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.8 | 7.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.8 | 24.5 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.8 | 49.6 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.8 | 0.8 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.8 | 76.5 | GO:0003779 | actin binding(GO:0003779) |
| 0.8 | 0.8 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.8 | 10.7 | GO:0042393 | histone binding(GO:0042393) |
| 0.8 | 3.1 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.8 | 1.5 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.8 | 19.8 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
| 0.8 | 13.6 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
| 0.8 | 5.3 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.8 | 21.8 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
| 0.7 | 1.5 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.7 | 8.2 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.7 | 2.2 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.7 | 0.7 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.7 | 1.5 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.7 | 0.7 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.7 | 2.9 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.7 | 2.2 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.7 | 0.7 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.7 | 1.5 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.7 | 1.5 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.7 | 10.2 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.7 | 2.9 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.7 | 0.7 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.7 | 10.9 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.7 | 1.4 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.7 | 1.4 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.7 | 12.3 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.7 | 0.7 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.7 | 2.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.7 | 19.1 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.7 | 2.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.7 | 0.7 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.7 | 0.7 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.7 | 2.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.7 | 4.1 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
| 0.7 | 178.0 | GO:0005198 | structural molecule activity(GO:0005198) |
| 0.7 | 2.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.7 | 159.7 | GO:0005509 | calcium ion binding(GO:0005509) |
| 0.7 | 2.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.7 | 23.1 | GO:0016407 | acetyltransferase activity(GO:0016407) |
| 0.7 | 2.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.7 | 10.1 | GO:0016614 | oxidoreductase activity, acting on CH-OH group of donors(GO:0016614) |
| 0.7 | 0.7 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.7 | 1.3 | GO:0035473 | lipase binding(GO:0035473) |
| 0.7 | 28.0 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |
| 0.7 | 5.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.7 | 89.7 | GO:0003723 | RNA binding(GO:0003723) |
| 0.6 | 1.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.6 | 59.5 | GO:0016791 | phosphatase activity(GO:0016791) |
| 0.6 | 2.5 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.6 | 6.9 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.6 | 2.5 | GO:0043176 | amine binding(GO:0043176) |
| 0.6 | 2.5 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.6 | 0.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.6 | 18.7 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.6 | 7.8 | GO:0031267 | small GTPase binding(GO:0031267) |
| 0.6 | 2.4 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
| 0.6 | 0.6 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.6 | 3.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.6 | 1.2 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.6 | 8.7 | GO:0004713 | protein tyrosine kinase activity(GO:0004713) |
| 0.6 | 31.9 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
| 0.6 | 4.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.6 | 0.6 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.6 | 46.6 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
| 0.6 | 22.4 | GO:0008017 | microtubule binding(GO:0008017) |
| 0.6 | 2.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.6 | 1.7 | GO:0016887 | ATPase activity(GO:0016887) |
| 0.6 | 90.7 | GO:0043169 | cation binding(GO:0043169) |
| 0.6 | 6.8 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.6 | 0.6 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
| 0.6 | 1.1 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
| 0.6 | 6.1 | GO:0022840 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
| 0.6 | 3.9 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.6 | 8.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.5 | 7.0 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.5 | 3.2 | GO:0016301 | kinase activity(GO:0016301) |
| 0.5 | 3.8 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
| 0.5 | 2.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.5 | 1.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.5 | 7.9 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.5 | 1.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.5 | 5.2 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.5 | 1.0 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.5 | 18.3 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.5 | 1.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.5 | 0.5 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.5 | 0.5 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.5 | 2.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.5 | 1.5 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.5 | 8.6 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.5 | 1.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.5 | 242.5 | GO:0003677 | DNA binding(GO:0003677) |
| 0.5 | 4.5 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.5 | 2.9 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.5 | 35.2 | GO:0032403 | protein complex binding(GO:0032403) |
| 0.5 | 2.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.5 | 2.4 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
| 0.5 | 0.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.5 | 0.9 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.5 | 73.8 | GO:0016773 | phosphotransferase activity, alcohol group as acceptor(GO:0016773) |
| 0.5 | 4.2 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
| 0.5 | 2.8 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.4 | 2.7 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 0.4 | 0.9 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.4 | 6.2 | GO:0016746 | transferase activity, transferring acyl groups(GO:0016746) |
| 0.4 | 1.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.4 | 0.4 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.4 | 0.4 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
| 0.4 | 593.1 | GO:0005515 | protein binding(GO:0005515) |
| 0.4 | 16.0 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.4 | 1.3 | GO:0036122 | BMP binding(GO:0036122) |
| 0.4 | 2.6 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.4 | 191.6 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
| 0.4 | 0.4 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.4 | 2.1 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.4 | 0.7 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.3 | 0.7 | GO:0003712 | transcription cofactor activity(GO:0003712) |
| 0.3 | 25.2 | GO:1901363 | heterocyclic compound binding(GO:1901363) |
| 0.3 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.3 | 0.3 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.3 | 0.8 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.3 | 0.3 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.3 | 0.8 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.2 | 0.5 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.2 | 1.6 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.2 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.2 | 0.6 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
| 0.2 | 0.2 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
| 0.2 | 0.2 | GO:0016798 | hydrolase activity, acting on glycosyl bonds(GO:0016798) |
| 0.2 | 0.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.2 | 0.3 | GO:0005539 | glycosaminoglycan binding(GO:0005539) |
| 0.2 | 0.3 | GO:0015197 | peptide transporter activity(GO:0015197) |
| 0.1 | 0.1 | GO:0072509 | divalent inorganic cation transmembrane transporter activity(GO:0072509) |
| 0.1 | 103.8 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.1 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 1.4 | GO:0005543 | phospholipid binding(GO:0005543) |
| 0.1 | 0.4 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.1 | 0.1 | GO:0008238 | exopeptidase activity(GO:0008238) |
| 0.1 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.3 | GO:0022834 | ligand-gated ion channel activity(GO:0015276) ligand-gated channel activity(GO:0022834) |
| 0.0 | 0.0 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.0 | 0.0 | GO:0097367 | carbohydrate derivative binding(GO:0097367) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 10.5 | 462.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 7.3 | 189.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 6.0 | 322.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 5.9 | 64.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 4.9 | 93.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 4.6 | 55.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 4.5 | 176.7 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 4.5 | 99.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 4.2 | 8.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 4.2 | 128.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 4.1 | 56.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 4.1 | 44.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 4.0 | 24.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 3.9 | 31.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 3.9 | 85.7 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 3.9 | 11.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 3.8 | 150.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 3.7 | 92.4 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 3.7 | 136.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 3.6 | 86.9 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 3.4 | 65.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 3.4 | 167.8 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 3.3 | 23.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 3.3 | 23.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 3.3 | 146.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 3.2 | 77.9 | PID FGF PATHWAY | FGF signaling pathway |
| 3.0 | 42.3 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 3.0 | 38.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 2.9 | 60.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 2.9 | 48.9 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 2.8 | 39.8 | PID INSULIN PATHWAY | Insulin Pathway |
| 2.8 | 28.4 | PID IFNG PATHWAY | IFN-gamma pathway |
| 2.8 | 82.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 2.8 | 95.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 2.8 | 22.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 2.7 | 75.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 2.6 | 42.4 | PID AURORA A PATHWAY | Aurora A signaling |
| 2.6 | 82.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 2.6 | 23.6 | PID ALK2 PATHWAY | ALK2 signaling events |
| 2.6 | 67.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 2.6 | 12.9 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 2.5 | 22.7 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 2.5 | 2.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 2.4 | 12.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 2.3 | 18.7 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 2.3 | 28.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 2.3 | 34.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 2.3 | 9.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 2.3 | 11.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 2.2 | 6.6 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 2.2 | 10.9 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 2.2 | 30.5 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 2.2 | 49.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 2.1 | 56.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 2.1 | 6.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 2.1 | 20.7 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 2.1 | 6.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 2.0 | 2.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 2.0 | 82.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 2.0 | 4.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 1.9 | 9.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 1.9 | 1.9 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 1.9 | 5.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 1.8 | 9.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 1.8 | 44.0 | PID PLK1 PATHWAY | PLK1 signaling events |
| 1.8 | 25.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 1.8 | 12.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 1.8 | 17.9 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 1.8 | 80.6 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 1.7 | 45.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 1.7 | 62.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| 1.7 | 21.9 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 1.7 | 23.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 1.7 | 52.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 1.6 | 40.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 1.6 | 43.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 1.6 | 11.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 1.6 | 52.9 | PID NOTCH PATHWAY | Notch signaling pathway |
| 1.6 | 22.0 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 1.6 | 34.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 1.5 | 9.1 | PID FOXO PATHWAY | FoxO family signaling |
| 1.5 | 33.5 | PID BCR 5PATHWAY | BCR signaling pathway |
| 1.5 | 7.6 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 1.5 | 1.5 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 1.5 | 7.4 | PID CDC42 PATHWAY | CDC42 signaling events |
| 1.5 | 1.5 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 1.5 | 281.5 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 1.5 | 30.6 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 1.4 | 36.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 1.4 | 11.5 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 1.4 | 28.6 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 1.4 | 17.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 1.4 | 7.0 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 1.4 | 9.8 | PID RHOA PATHWAY | RhoA signaling pathway |
| 1.4 | 1.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 1.4 | 180.8 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 1.4 | 2.7 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 1.4 | 42.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 1.4 | 4.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 1.3 | 1.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 1.3 | 38.7 | PID E2F PATHWAY | E2F transcription factor network |
| 1.3 | 3.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 1.3 | 6.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 1.3 | 1.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 1.3 | 180.7 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 1.2 | 8.7 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 1.2 | 28.7 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 1.2 | 2.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 1.2 | 14.0 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 1.1 | 12.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 1.1 | 6.8 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 1.1 | 10.8 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 1.1 | 11.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 1.1 | 18.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 1.0 | 8.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 1.0 | 7.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 1.0 | 12.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 1.0 | 18.0 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 1.0 | 6.0 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 1.0 | 2.0 | PID SHP2 PATHWAY | SHP2 signaling |
| 1.0 | 13.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 1.0 | 5.8 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.9 | 6.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.9 | 4.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.9 | 7.7 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.8 | 8.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.8 | 10.1 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.8 | 3.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.8 | 4.6 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.8 | 7.6 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.8 | 170.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.7 | 3.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.7 | 1.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.7 | 2.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.7 | 5.7 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.7 | 11.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.7 | 11.8 | PID P73PATHWAY | p73 transcription factor network |
| 0.7 | 6.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.7 | 4.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.7 | 1.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.6 | 2.6 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.6 | 1.9 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.6 | 20.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.6 | 6.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.6 | 6.9 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.6 | 4.9 | PID ATM PATHWAY | ATM pathway |
| 0.6 | 4.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.6 | 5.7 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.6 | 6.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.6 | 3.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.6 | 5.5 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.5 | 2.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.5 | 7.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.5 | 3.7 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.5 | 3.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.5 | 4.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.5 | 0.5 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.5 | 2.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.5 | 3.1 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.5 | 2.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.5 | 0.9 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.4 | 0.9 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.4 | 0.9 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.4 | 1.7 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.4 | 1.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.4 | 0.8 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.4 | 1.5 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.4 | 1.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.4 | 2.5 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.3 | 0.7 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.3 | 2.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.3 | 7.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.3 | 2.9 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.3 | 3.8 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.3 | 3.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.3 | 10.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.3 | 2.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.3 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.3 | 0.3 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.2 | 2.4 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.2 | 0.7 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.2 | 0.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.2 | 0.5 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.2 | 0.4 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.2 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.2 | 1.3 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 0.8 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 0.7 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.1 | 0.8 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 2.3 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 14.1 | 408.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 12.5 | 125.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 9.2 | 73.9 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 8.9 | 160.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 8.1 | 81.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 8.1 | 242.8 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 7.5 | 113.1 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 7.0 | 7.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 6.7 | 113.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 6.7 | 73.3 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 6.6 | 105.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 6.6 | 52.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 5.9 | 65.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 5.9 | 47.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 5.8 | 57.5 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 5.6 | 79.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 5.6 | 124.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 5.5 | 121.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 5.4 | 37.9 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 5.4 | 59.5 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 5.2 | 141.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 5.1 | 10.2 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 4.9 | 53.7 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 4.8 | 38.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 4.7 | 126.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 4.7 | 70.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 4.5 | 13.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 4.5 | 45.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 4.5 | 67.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 4.5 | 49.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 4.5 | 53.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 4.4 | 35.6 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 4.4 | 44.0 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 4.3 | 51.7 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 4.3 | 85.8 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 4.2 | 59.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 4.1 | 12.4 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 4.1 | 4.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 4.0 | 48.4 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 4.0 | 36.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 3.9 | 7.9 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 3.9 | 105.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 3.8 | 42.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 3.8 | 37.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 3.8 | 30.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 3.6 | 90.1 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 3.6 | 60.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 3.4 | 34.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 3.4 | 23.7 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 3.4 | 37.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 3.4 | 53.7 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 3.3 | 103.2 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 3.3 | 330.5 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 3.3 | 58.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 3.2 | 25.5 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 3.2 | 12.7 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 3.2 | 9.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 3.1 | 12.6 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 3.1 | 74.2 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 3.0 | 21.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 3.0 | 57.2 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 3.0 | 212.3 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 3.0 | 35.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 3.0 | 44.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 3.0 | 5.9 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 2.9 | 22.9 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 2.8 | 28.2 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 2.8 | 33.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 2.8 | 154.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 2.7 | 89.9 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 2.7 | 40.7 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 2.7 | 18.9 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 2.7 | 45.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 2.7 | 10.6 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 2.6 | 5.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 2.6 | 62.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 2.6 | 18.1 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 2.6 | 51.2 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 2.6 | 12.8 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 2.5 | 27.9 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 2.5 | 7.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 2.5 | 5.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 2.4 | 17.0 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 2.4 | 23.8 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 2.3 | 20.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 2.3 | 41.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 2.2 | 20.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 2.2 | 210.6 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 2.2 | 94.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 2.2 | 50.4 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 2.1 | 4.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 2.1 | 6.4 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 2.1 | 31.8 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 2.1 | 38.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 2.1 | 42.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 2.1 | 8.4 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 2.1 | 18.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 2.1 | 8.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 2.1 | 47.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 2.0 | 16.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 2.0 | 28.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 2.0 | 15.9 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 1.9 | 11.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 1.9 | 25.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 1.9 | 3.9 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 1.9 | 9.6 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 1.9 | 3.8 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 1.9 | 34.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 1.9 | 18.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 1.9 | 9.4 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 1.9 | 37.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 1.9 | 22.4 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 1.9 | 20.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 1.9 | 18.5 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 1.8 | 22.0 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 1.8 | 109.4 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 1.8 | 16.2 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 1.8 | 1.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 1.8 | 14.2 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 1.8 | 33.4 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 1.8 | 12.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 1.7 | 34.6 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 1.7 | 18.6 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 1.7 | 1.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 1.7 | 15.1 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 1.7 | 43.5 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 1.7 | 216.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 1.7 | 3.3 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 1.6 | 3.3 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 1.6 | 36.1 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 1.6 | 4.9 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 1.6 | 4.9 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 1.6 | 13.0 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 1.6 | 12.9 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 1.6 | 20.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 1.6 | 54.2 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 1.6 | 42.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 1.6 | 31.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 1.6 | 56.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 1.5 | 7.6 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 1.5 | 4.6 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 1.5 | 62.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 1.5 | 10.6 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 1.5 | 16.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 1.5 | 12.1 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 1.5 | 7.5 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 1.5 | 4.5 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 1.5 | 31.3 | REACTOME KINESINS | Genes involved in Kinesins |
| 1.5 | 10.4 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 1.5 | 13.4 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 1.5 | 11.8 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 1.5 | 18.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 1.5 | 11.6 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 1.4 | 78.0 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 1.4 | 7.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 1.4 | 5.7 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 1.4 | 8.4 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
| 1.4 | 74.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 1.4 | 8.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 1.4 | 6.8 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 1.4 | 6.8 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 1.3 | 17.2 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
| 1.3 | 14.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 1.3 | 20.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 1.3 | 10.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 1.3 | 10.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 1.3 | 1.3 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 1.3 | 3.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 1.3 | 26.4 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 1.3 | 12.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 1.3 | 11.3 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 1.3 | 11.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 1.2 | 38.6 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 1.2 | 12.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 1.2 | 42.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 1.2 | 27.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 1.2 | 142.3 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
| 1.2 | 16.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 1.2 | 33.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 1.2 | 29.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 1.2 | 17.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 1.2 | 12.9 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 1.2 | 70.2 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 1.2 | 17.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 1.1 | 4.5 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 1.1 | 2.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 1.1 | 21.2 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 1.1 | 5.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 1.1 | 3.3 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 1.1 | 18.5 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 1.1 | 23.8 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 1.0 | 14.5 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 1.0 | 14.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 1.0 | 5.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 1.0 | 7.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 1.0 | 3.1 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 1.0 | 27.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 1.0 | 12.2 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 1.0 | 13.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 1.0 | 13.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 1.0 | 16.9 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 1.0 | 1.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 1.0 | 21.7 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 1.0 | 21.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 1.0 | 11.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 1.0 | 3.8 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 1.0 | 4.8 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.9 | 20.9 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
| 0.9 | 11.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.9 | 5.7 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.9 | 6.6 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.9 | 9.3 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.9 | 22.3 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.9 | 202.2 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.9 | 9.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.9 | 2.7 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.9 | 5.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.9 | 0.9 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.9 | 5.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.9 | 42.3 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.9 | 3.5 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.9 | 3.4 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.9 | 1.7 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.9 | 1.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.8 | 18.7 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.8 | 0.8 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.8 | 9.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.8 | 3.4 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.8 | 8.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.8 | 35.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.8 | 4.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.8 | 4.0 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.8 | 9.6 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.8 | 1.6 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.8 | 7.9 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.8 | 3.2 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.8 | 1.6 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.7 | 3.0 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.7 | 1.5 | REACTOME DOWNSTREAM SIGNALING OF ACTIVATED FGFR | Genes involved in Downstream signaling of activated FGFR |
| 0.7 | 2.9 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.7 | 2.9 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.7 | 3.6 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.7 | 4.2 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.7 | 10.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.7 | 3.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.7 | 1.4 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.7 | 9.6 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.7 | 4.7 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.7 | 1.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.7 | 8.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.7 | 3.3 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.6 | 1.3 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.6 | 10.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.6 | 14.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.6 | 0.6 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.6 | 5.6 | REACTOME METABOLISM OF RNA | Genes involved in Metabolism of RNA |
| 0.6 | 6.8 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.6 | 4.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.6 | 6.8 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.6 | 11.0 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.6 | 7.3 | REACTOME GPCR LIGAND BINDING | Genes involved in GPCR ligand binding |
| 0.6 | 8.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.6 | 1.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.6 | 1.7 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.6 | 22.7 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.5 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.5 | 2.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.5 | 12.2 | REACTOME SLC MEDIATED TRANSMEMBRANE TRANSPORT | Genes involved in SLC-mediated transmembrane transport |
| 0.5 | 4.9 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.5 | 1.0 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.5 | 4.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.5 | 5.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.5 | 1.4 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.4 | 0.9 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.4 | 4.7 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |
| 0.4 | 4.2 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.4 | 3.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.4 | 2.3 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
| 0.4 | 3.8 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.4 | 13.2 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
| 0.4 | 3.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.4 | 1.8 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.3 | 1.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.3 | 23.1 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.3 | 1.5 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.3 | 16.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.3 | 0.3 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.3 | 1.0 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 0.5 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.2 | 0.4 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.2 | 1.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.2 | 1.2 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.2 | 0.9 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
| 0.2 | 2.4 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.2 | 0.9 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
| 0.2 | 1.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 0.1 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
| 0.1 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 0.4 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
| 0.1 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.0 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |