| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Irf3
|
ENSMUSG00000003184.8 | Irf3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Irf3 | chr7_44997793_44998029 | 38 | 0.786164 | 0.65 | 9.3e-08 | Click! |
| Irf3 | chr7_44999860_45000011 | 232 | 0.745342 | 0.10 | 4.8e-01 | Click! |
| Irf3 | chr7_45000798_45000949 | 125 | 0.865469 | 0.02 | 9.0e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr11_4543069_4543227 | 20.34 |
Mtmr3 |
myotubularin related protein 3 |
3120 |
0.23 |
| chr16_58661948_58662241 | 19.17 |
Gm49701 |
predicted gene, 49701 |
6850 |
0.13 |
| chr5_36726254_36726643 | 18.73 |
Gm43701 |
predicted gene 43701 |
22170 |
0.11 |
| chr1_180261995_180262146 | 16.21 |
Psen2 |
presenilin 2 |
1368 |
0.35 |
| chrX_101428817_101430172 | 15.85 |
Nono |
non-POU-domain-containing, octamer binding protein |
61 |
0.96 |
| chr11_86581327_86581590 | 15.68 |
Mir21a |
microRNA 21a |
2700 |
0.21 |
| chr3_105808565_105808856 | 15.05 |
Gm5547 |
predicted gene 5547 |
6830 |
0.11 |
| chr11_86581594_86581768 | 15.00 |
Mir21a |
microRNA 21a |
2477 |
0.22 |
| chr13_59820217_59820403 | 14.83 |
Tut7 |
terminal uridylyl transferase 7 |
2278 |
0.17 |
| chr15_77922797_77923125 | 14.29 |
Txn2 |
thioredoxin 2 |
4774 |
0.17 |
| chr6_127245874_127246080 | 14.19 |
Gm43635 |
predicted gene 43635 |
8667 |
0.13 |
| chr11_58214634_58215080 | 14.12 |
Irgm2 |
immunity-related GTPase family M member 2 |
151 |
0.92 |
| chr8_46546459_46546652 | 13.61 |
Cenpu |
centromere protein U |
5473 |
0.17 |
| chr11_95339762_95339938 | 13.16 |
Fam117a |
family with sequence similarity 117, member A |
81 |
0.95 |
| chr17_36020770_36020975 | 12.96 |
H2-T24 |
histocompatibility 2, T region locus 24 |
312 |
0.69 |
| chr9_32906251_32906426 | 12.57 |
Gm27162 |
predicted gene 27162 |
22628 |
0.19 |
| chr6_38900912_38901211 | 12.51 |
Tbxas1 |
thromboxane A synthase 1, platelet |
17919 |
0.19 |
| chr17_36121540_36121726 | 12.39 |
Gm19684 |
predicted gene, 19684 |
45 |
0.63 |
| chr9_107975396_107975585 | 12.21 |
Uba7 |
ubiquitin-like modifier activating enzyme 7 |
15 |
0.92 |
| chr17_36023721_36023895 | 11.44 |
H2-T24 |
histocompatibility 2, T region locus 24 |
3248 |
0.08 |
| chr4_150784726_150784890 | 11.22 |
Gm13049 |
predicted gene 13049 |
40925 |
0.13 |
| chr11_58199487_58199685 | 11.08 |
Igtp |
interferon gamma induced GTPase |
0 |
0.5 |
| chr14_55577823_55578992 | 10.53 |
Psme1 |
proteasome (prosome, macropain) activator subunit 1 (PA28 alpha) |
2 |
0.91 |
| chr2_167697961_167698142 | 10.43 |
A530013C23Rik |
RIKEN cDNA A530013C23 gene |
6870 |
0.12 |
| chr9_35175147_35176476 | 10.25 |
Dcps |
decapping enzyme, scavenger |
182 |
0.9 |
| chr14_25686636_25686805 | 10.18 |
Ppif |
peptidylprolyl isomerase F (cyclophilin F) |
7434 |
0.14 |
| chr15_74989440_74989591 | 10.15 |
Gm37042 |
predicted gene, 37042 |
765 |
0.35 |
| chr10_80948620_80948940 | 9.94 |
Gm3828 |
predicted gene 3828 |
5930 |
0.1 |
| chr5_103760139_103760316 | 9.93 |
Aff1 |
AF4/FMR2 family, member 1 |
5654 |
0.23 |
| chr11_119392977_119393557 | 9.78 |
Rnf213 |
ring finger protein 213 |
167 |
0.93 |
| chr9_123845102_123845518 | 9.27 |
Fyco1 |
FYVE and coiled-coil domain containing 1 |
704 |
0.59 |
| chr3_127893994_127894286 | 9.08 |
Fam241a |
family with sequence similarity 241, member A |
2148 |
0.22 |
| chr17_33919383_33920010 | 9.05 |
Tapbp |
TAP binding protein |
59 |
0.83 |
| chr10_95297705_95298060 | 8.99 |
Gm48880 |
predicted gene, 48880 |
16971 |
0.14 |
| chr17_36042796_36043034 | 8.85 |
Gm6034 |
predicted gene 6034 |
46 |
0.63 |
| chr4_136187071_136187247 | 8.74 |
E2f2 |
E2F transcription factor 2 |
6376 |
0.15 |
| chr12_26460219_26460410 | 8.47 |
Rsad2 |
radical S-adenosyl methionine domain containing 2 |
3862 |
0.17 |
| chr18_84906326_84906549 | 8.33 |
Fbxo15 |
F-box protein 15 |
28345 |
0.13 |
| chr8_25609113_25609264 | 8.27 |
Gm23184 |
predicted gene, 23184 |
1370 |
0.25 |
| chr6_38338044_38338499 | 8.20 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
16002 |
0.12 |
| chr15_77397415_77397965 | 8.18 |
Apol7a |
apolipoprotein L 7a |
756 |
0.47 |
| chr8_116581419_116581617 | 8.18 |
Dynlrb2 |
dynein light chain roadblock-type 2 |
76503 |
0.1 |
| chr19_6046015_6046240 | 8.06 |
Syvn1 |
synovial apoptosis inhibitor 1, synoviolin |
449 |
0.48 |
| chr15_36648029_36648244 | 8.02 |
Gm6704 |
predicted gene 6704 |
18267 |
0.12 |
| chr5_114897341_114897492 | 7.91 |
Oasl2 |
2'-5' oligoadenylate synthetase-like 2 |
116 |
0.92 |
| chr4_154928100_154928296 | 7.84 |
Tnfrsf14 |
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
4 |
0.96 |
| chr8_122306282_122306514 | 7.78 |
Zfpm1 |
zinc finger protein, multitype 1 |
922 |
0.5 |
| chr2_162930645_162930796 | 7.74 |
Srsf6 |
serine and arginine-rich splicing factor 6 |
808 |
0.51 |
| chr12_84969806_84969957 | 7.72 |
Arel1 |
apoptosis resistant E3 ubiquitin protein ligase 1 |
943 |
0.35 |
| chr6_38533231_38533979 | 7.58 |
Fmc1 |
formation of mitochondrial complex V assembly factor 1 |
103 |
0.96 |
| chr16_18428507_18428684 | 7.43 |
Txnrd2 |
thioredoxin reductase 2 |
102 |
0.93 |
| chr1_153770335_153770651 | 7.37 |
Rnasel |
ribonuclease L (2', 5'-oligoisoadenylate synthetase-dependent) |
14509 |
0.1 |
| chr5_92353466_92353617 | 7.35 |
Cxcl10 |
chemokine (C-X-C motif) ligand 10 |
4652 |
0.11 |
| chr15_76243373_76243550 | 7.34 |
Parp10 |
poly (ADP-ribose) polymerase family, member 10 |
20 |
0.93 |
| chr2_84798993_84799537 | 7.16 |
Ube2l6 |
ubiquitin-conjugating enzyme E2L 6 |
431 |
0.71 |
| chr12_78980719_78981012 | 6.99 |
Tmem229b |
transmembrane protein 229B |
87 |
0.97 |
| chr4_86902253_86902422 | 6.93 |
Acer2 |
alkaline ceramidase 2 |
27923 |
0.18 |
| chr6_67170285_67170790 | 6.88 |
A430010J10Rik |
RIKEN cDNA A430010J10 gene |
5334 |
0.17 |
| chr5_137306965_137308105 | 6.85 |
Srrt |
serrate RNA effector molecule homolog (Arabidopsis) |
62 |
0.92 |
| chr2_85047884_85048082 | 6.79 |
Tnks1bp1 |
tankyrase 1 binding protein 1 |
39 |
0.96 |
| chr12_111515021_111515172 | 6.76 |
Gm40578 |
predicted gene, 40578 |
14256 |
0.1 |
| chr7_78913903_78914305 | 6.73 |
Isg20 |
interferon-stimulated protein |
123 |
0.94 |
| chr5_120812476_120812687 | 6.73 |
Oas1b |
2'-5' oligoadenylate synthetase 1B |
54 |
0.5 |
| chr11_100704167_100704329 | 6.68 |
Dhx58 |
DEXH (Asp-Glu-X-His) box polypeptide 58 |
5 |
0.95 |
| chr6_143751347_143751526 | 6.67 |
1700060C16Rik |
RIKEN cDNA 1700060C16 gene |
100148 |
0.08 |
| chr1_67092586_67092737 | 6.66 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
30365 |
0.17 |
| chr14_60171561_60171774 | 6.66 |
Atp8a2 |
ATPase, aminophospholipid transporter-like, class I, type 8A, member 2 |
5872 |
0.15 |
| chr10_81496759_81496938 | 6.64 |
Ncln |
nicalin |
456 |
0.57 |
| chr11_74622356_74622521 | 6.60 |
Ccdc92b |
coiled-coil domain containing 92B |
2833 |
0.22 |
| chr7_126607127_126607307 | 6.46 |
Il27 |
interleukin 27 |
12276 |
0.07 |
| chr2_170153397_170153978 | 6.38 |
Zfp217 |
zinc finger protein 217 |
5584 |
0.31 |
| chr7_104244275_104244625 | 6.30 |
Trim34a |
tripartite motif-containing 34A |
7 |
0.94 |
| chr16_10732413_10732740 | 6.10 |
Gm15558 |
predicted gene 15558 |
49037 |
0.07 |
| chr5_105110188_105110546 | 6.08 |
Gbp9 |
guanylate-binding protein 9 |
90 |
0.97 |
| chr19_45208051_45208464 | 6.04 |
Lbx1 |
ladybird homeobox 1 |
27555 |
0.14 |
| chr1_195092219_195092480 | 6.04 |
Cd46 |
CD46 antigen, complement regulatory protein |
100 |
0.95 |
| chr2_26089089_26089249 | 6.00 |
Nacc2 |
nucleus accumbens associated 2, BEN and BTB (POZ) domain containing |
1206 |
0.38 |
| chr11_57962679_57963326 | 5.93 |
Gm12249 |
predicted gene 12249 |
10132 |
0.15 |
| chr7_46830743_46831064 | 5.92 |
Gm45308 |
predicted gene 45308 |
1561 |
0.21 |
| chr18_32559402_32560290 | 5.79 |
Gypc |
glycophorin C |
134 |
0.97 |
| chr10_121586932_121587331 | 5.78 |
Tbk1 |
TANK-binding kinase 1 |
344 |
0.83 |
| chr2_6444750_6445068 | 5.74 |
Gm13388 |
predicted gene 13388 |
8876 |
0.17 |
| chr6_122394205_122394556 | 5.72 |
1700063H04Rik |
RIKEN cDNA 1700063H04 gene |
3001 |
0.17 |
| chr5_137115775_137116361 | 5.70 |
Trim56 |
tripartite motif-containing 56 |
139 |
0.93 |
| chr7_116285322_116285500 | 5.61 |
Gm44867 |
predicted gene 44867 |
2526 |
0.23 |
| chr11_72301460_72301663 | 5.52 |
Xaf1 |
XIAP associated factor 1 |
68 |
0.95 |
| chr1_79752855_79753006 | 5.51 |
Wdfy1 |
WD repeat and FYVE domain containing 1 |
8791 |
0.17 |
| chr2_155541250_155541401 | 5.48 |
Mipep-ps |
mitochondrial intermediate peptidase, pseudogene |
1322 |
0.24 |
| chr14_20478827_20479017 | 5.47 |
Anxa7 |
annexin A7 |
986 |
0.42 |
| chr5_63823714_63823894 | 5.45 |
0610040J01Rik |
RIKEN cDNA 0610040J01 gene |
11284 |
0.2 |
| chr3_127123331_127123826 | 5.43 |
Ank2 |
ankyrin 2, brain |
1284 |
0.39 |
| chr19_41345544_41345700 | 5.38 |
Pik3ap1 |
phosphoinositide-3-kinase adaptor protein 1 |
39474 |
0.17 |
| chr9_114752784_114753499 | 5.33 |
Cmtm6 |
CKLF-like MARVEL transmembrane domain containing 6 |
21968 |
0.13 |
| chr6_38353782_38354731 | 5.29 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
17 |
0.97 |
| chr13_42051896_42052956 | 5.21 |
Hivep1 |
human immunodeficiency virus type I enhancer binding protein 1 |
22 |
0.98 |
| chr17_46889460_46890097 | 5.20 |
Tbcc |
tubulin-specific chaperone C |
906 |
0.51 |
| chr16_35938456_35939088 | 5.18 |
Parp9 |
poly (ADP-ribose) polymerase family, member 9 |
239 |
0.62 |
| chr5_29893936_29894092 | 5.16 |
Gm42450 |
predicted gene 42450 |
2050 |
0.31 |
| chr2_24385099_24385869 | 5.15 |
Psd4 |
pleckstrin and Sec7 domain containing 4 |
131 |
0.95 |
| chr9_58249475_58249881 | 5.15 |
Pml |
promyelocytic leukemia |
13 |
0.96 |
| chr15_74930453_74930628 | 5.13 |
Gm39556 |
predicted gene, 39556 |
1103 |
0.31 |
| chr7_102565432_102565621 | 5.07 |
Trim21 |
tripartite motif-containing 21 |
40 |
0.93 |
| chr6_34863037_34863250 | 5.06 |
Tmem140 |
transmembrane protein 140 |
3 |
0.96 |
| chr15_102296754_102296921 | 5.02 |
Espl1 |
extra spindle pole bodies 1, separase |
532 |
0.42 |
| chr11_100402292_100402625 | 4.98 |
Gm12348 |
predicted gene 12348 |
950 |
0.31 |
| chr5_20945137_20945297 | 4.97 |
Rsbn1l |
round spermatid basic protein 1-like |
287 |
0.89 |
| chr16_30959800_30959970 | 4.96 |
Gm15742 |
predicted gene 15742 |
13633 |
0.17 |
| chr10_121580489_121580640 | 4.93 |
Tbk1 |
TANK-binding kinase 1 |
6177 |
0.15 |
| chr9_109054683_109055091 | 4.84 |
Shisa5 |
shisa family member 5 |
24 |
0.95 |
| chr11_119394402_119394553 | 4.81 |
Rnf213 |
ring finger protein 213 |
1377 |
0.33 |
| chr6_31642445_31643002 | 4.80 |
Gm43154 |
predicted gene 43154 |
8318 |
0.19 |
| chr1_31096747_31096898 | 4.73 |
4931428L18Rik |
RIKEN cDNA 4931428L18 gene |
368 |
0.84 |
| chr14_21853898_21854077 | 4.71 |
Comtd1 |
catechol-O-methyltransferase domain containing 1 |
5010 |
0.14 |
| chr6_38342333_38342771 | 4.68 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
11721 |
0.13 |
| chr7_75612084_75612766 | 4.66 |
Akap13 |
A kinase (PRKA) anchor protein 13 |
141 |
0.96 |
| chr4_140679856_140680032 | 4.59 |
Gm13025 |
predicted gene 13025 |
191 |
0.91 |
| chr7_118129449_118130261 | 4.53 |
Arl6ip1 |
ADP-ribosylation factor-like 6 interacting protein 1 |
193 |
0.93 |
| chr14_37163999_37164150 | 4.51 |
Gm18834 |
predicted gene, 18834 |
18991 |
0.15 |
| chr5_100656535_100656686 | 4.48 |
Coq2 |
coenzyme Q2 4-hydroxybenzoate polyprenyltransferase |
7809 |
0.15 |
| chr16_90988770_90988947 | 4.44 |
Gm15965 |
predicted gene 15965 |
4951 |
0.12 |
| chr11_65777037_65777188 | 4.40 |
Map2k4 |
mitogen-activated protein kinase kinase 4 |
11173 |
0.21 |
| chr12_98746733_98746999 | 4.34 |
Zc3h14 |
zinc finger CCCH type containing 14 |
98 |
0.95 |
| chr11_22871975_22872126 | 4.34 |
Gm24917 |
predicted gene, 24917 |
3149 |
0.16 |
| chr7_24380530_24380681 | 4.31 |
Kcnn4 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4 |
1565 |
0.21 |
| chr19_55865164_55865315 | 4.25 |
Ppnr |
per-pentamer repeat gene |
23567 |
0.21 |
| chr17_87638274_87638425 | 4.24 |
Epcam |
epithelial cell adhesion molecule |
1667 |
0.38 |
| chr5_135168094_135168944 | 4.19 |
Bcl7b |
B cell CLL/lymphoma 7B |
74 |
0.95 |
| chr11_53423074_53423393 | 4.17 |
Leap2 |
liver-expressed antimicrobial peptide 2 |
63 |
0.93 |
| chr4_86690175_86690553 | 4.17 |
Plin2 |
perilipin 2 |
20304 |
0.17 |
| chr11_48871235_48871826 | 4.17 |
Irgm1 |
immunity-related GTPase family M member 1 |
110 |
0.93 |
| chr6_39381267_39381418 | 4.14 |
Rab19 |
RAB19, member RAS oncogene family |
167 |
0.93 |
| chr14_52103963_52104507 | 4.10 |
Hnrnpc |
heterogeneous nuclear ribonucleoprotein C |
207 |
0.88 |
| chr8_46844739_46844892 | 4.09 |
Gm45481 |
predicted gene 45481 |
10903 |
0.18 |
| chr2_167061965_167062856 | 4.07 |
Znfx1 |
zinc finger, NFX1-type containing 1 |
229 |
0.66 |
| chr13_77548432_77549057 | 4.07 |
Gm9634 |
predicted gene 9634 |
5629 |
0.31 |
| chr7_118756592_118756841 | 4.06 |
Vps35l |
VPS35 endosomal protein sorting factor like |
4053 |
0.14 |
| chr7_132811860_132812052 | 4.04 |
Fam53b |
family with sequence similarity 53, member B |
1139 |
0.45 |
| chr3_104817474_104818824 | 4.00 |
Mov10 |
Mov10 RISC complex RNA helicase |
33 |
0.95 |
| chr17_34204420_34204645 | 3.96 |
Tap2 |
transporter 2, ATP-binding cassette, sub-family B (MDR/TAP) |
35 |
0.87 |
| chr5_105598967_105599118 | 3.95 |
C230066G23Rik |
RIKEN cDNA C230066G23 gene |
18602 |
0.19 |
| chr5_134966335_134966938 | 3.93 |
Cldn3 |
claudin 3 |
19578 |
0.07 |
| chr7_123397485_123397636 | 3.92 |
Lcmt1 |
leucine carboxyl methyltransferase 1 |
10620 |
0.17 |
| chr17_83747854_83748005 | 3.90 |
Mta3 |
metastasis associated 3 |
7705 |
0.24 |
| chr6_94743069_94743231 | 3.89 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
42992 |
0.13 |
| chr2_90894414_90894603 | 3.80 |
Gm32514 |
predicted gene, 32514 |
1310 |
0.26 |
| chr15_79062847_79063320 | 3.80 |
Ankrd54 |
ankyrin repeat domain 54 |
190 |
0.84 |
| chr19_18692041_18692250 | 3.78 |
Carnmt1 |
carnosine N-methyltransferase 1 |
20816 |
0.13 |
| chr17_34198241_34198411 | 3.77 |
Psmb8 |
proteasome (prosome, macropain) subunit, beta type 8 (large multifunctional peptidase 7) |
44 |
0.92 |
| chr19_4503888_4504039 | 3.72 |
2010003K11Rik |
RIKEN cDNA 2010003K11 gene |
5380 |
0.14 |
| chr11_53859007_53859393 | 3.70 |
Gm12216 |
predicted gene 12216 |
29 |
0.96 |
| chr13_58158180_58158751 | 3.67 |
Idnk |
idnK gluconokinase homolog (E. coli) |
782 |
0.36 |
| chr4_145246773_145246990 | 3.60 |
Tnfrsf1b |
tumor necrosis factor receptor superfamily, member 1b |
11 |
0.98 |
| chr1_61374362_61374513 | 3.59 |
9530026F06Rik |
RIKEN cDNA 9530026F06 gene |
3995 |
0.24 |
| chr1_161748259_161748419 | 3.59 |
Gm5049 |
predicted gene 5049 |
2283 |
0.24 |
| chr16_14308796_14308970 | 3.59 |
Gm15868 |
predicted gene 15868 |
2958 |
0.2 |
| chr8_34158314_34158519 | 3.59 |
Saraf |
store-operated calcium entry-associated regulatory factor |
65 |
0.95 |
| chr1_105971738_105972167 | 3.58 |
Gm18801 |
predicted gene, 18801 |
15642 |
0.14 |
| chr4_154297804_154298100 | 3.57 |
Arhgef16 |
Rho guanine nucleotide exchange factor (GEF) 16 |
1940 |
0.29 |
| chr4_57130427_57130578 | 3.57 |
Epb41l4b |
erythrocyte membrane protein band 4.1 like 4b |
7690 |
0.23 |
| chr7_29030418_29030583 | 3.57 |
Gm38979 |
predicted gene, 38979 |
1477 |
0.24 |
| chr6_39264655_39265049 | 3.56 |
Gm26008 |
predicted gene, 26008 |
1090 |
0.47 |
| chr8_84974849_84975028 | 3.56 |
AC163703.1 |
|
1604 |
0.14 |
| chr5_129500699_129500850 | 3.55 |
Gm40332 |
predicted gene, 40332 |
227 |
0.71 |
| chr3_60408983_60409147 | 3.53 |
Mbnl1 |
muscleblind like splicing factor 1 |
63765 |
0.12 |
| chr13_112073928_112074288 | 3.53 |
Gm31104 |
predicted gene, 31104 |
64008 |
0.09 |
| chr9_20868539_20869028 | 3.50 |
Shfl |
shiftless antiviral inhibitor of ribosomal frameshifting |
103 |
0.92 |
| chr14_76673707_76673858 | 3.48 |
1700108F19Rik |
RIKEN cDNA 1700108F19 gene |
819 |
0.66 |
| chr4_56892851_56893002 | 3.47 |
Mir32 |
microRNA 32 |
2372 |
0.2 |
| chr11_21994299_21994805 | 3.43 |
Otx1 |
orthodenticle homeobox 1 |
7063 |
0.25 |
| chr4_156200724_156201012 | 3.41 |
Isg15 |
ISG15 ubiquitin-like modifier |
72 |
0.93 |
| chr5_121469594_121469759 | 3.41 |
Gm15546 |
predicted gene 15546 |
2712 |
0.13 |
| chr8_46611647_46611798 | 3.40 |
Primpol |
primase and polymerase (DNA-directed) |
1293 |
0.37 |
| chr18_5603185_5603788 | 3.38 |
Zeb1 |
zinc finger E-box binding homeobox 1 |
258 |
0.88 |
| chr15_39113027_39113251 | 3.37 |
Dcaf13 |
DDB1 and CUL4 associated factor 13 |
274 |
0.62 |
| chr4_136213729_136213912 | 3.36 |
Asap3 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 3 |
7455 |
0.15 |
| chr9_62343227_62343790 | 3.34 |
Anp32a |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member A |
555 |
0.78 |
| chr1_190832275_190832426 | 3.33 |
Rps6kc1 |
ribosomal protein S6 kinase polypeptide 1 |
1686 |
0.44 |
| chr11_59184195_59184346 | 3.33 |
Guk1 |
guanylate kinase 1 |
584 |
0.48 |
| chr11_94589805_94589967 | 3.30 |
Acsf2 |
acyl-CoA synthetase family member 2 |
11883 |
0.11 |
| chr6_128362791_128363670 | 3.29 |
Foxm1 |
forkhead box M1 |
263 |
0.49 |
| chr3_131266526_131266677 | 3.28 |
Hadh |
hydroxyacyl-Coenzyme A dehydrogenase |
5423 |
0.17 |
| chr10_95623626_95623777 | 3.27 |
Gm33336 |
predicted gene, 33336 |
8538 |
0.13 |
| chr11_55113548_55113800 | 3.21 |
Atp5pb-ps |
ATP synthase peripheral stalk-membrane subunit b, pseudogene |
5121 |
0.13 |
| chr13_46735814_46736188 | 3.20 |
Nup153 |
nucleoporin 153 |
8061 |
0.17 |
| chr6_39117795_39118421 | 3.17 |
Parp12 |
poly (ADP-ribose) polymerase family, member 12 |
241 |
0.62 |
| chr9_106367425_106368835 | 3.16 |
Dusp7 |
dual specificity phosphatase 7 |
502 |
0.7 |
| chr2_32115882_32116037 | 3.12 |
Plpp7 |
phospholipid phosphatase 7 (inactive) |
19804 |
0.1 |
| chr5_140034121_140034770 | 3.12 |
Gm43702 |
predicted gene 43702 |
2269 |
0.28 |
| chr2_25546540_25546764 | 3.11 |
Traf2 |
TNF receptor-associated factor 2 |
258 |
0.77 |
| chrX_94212852_94213030 | 3.10 |
Eif2s3x |
eukaryotic translation initiation factor 2, subunit 3, structural gene X-linked |
79 |
0.97 |
| chr6_142752495_142752646 | 3.09 |
Cmas |
cytidine monophospho-N-acetylneuraminic acid synthetase |
4116 |
0.23 |
| chr6_86547859_86548409 | 3.07 |
1600020E01Rik |
RIKEN cDNA 1600020E01 gene |
153 |
0.91 |
| chr2_163710865_163711016 | 3.06 |
Pkig |
protein kinase inhibitor, gamma |
16902 |
0.13 |
| chr17_26511994_26512145 | 3.04 |
Dusp1 |
dual specificity phosphatase 1 |
3550 |
0.13 |
| chr5_132466431_132466777 | 3.01 |
Auts2 |
autism susceptibility candidate 2 |
17244 |
0.12 |
| chr16_91056144_91056326 | 2.97 |
4931406G06Rik |
RIKEN cDNA 4931406G06 gene |
11579 |
0.1 |
| chr11_109362305_109363665 | 2.94 |
Gna13 |
guanine nucleotide binding protein, alpha 13 |
154 |
0.59 |
| chr14_32861100_32861956 | 2.93 |
Vstm4 |
V-set and transmembrane domain containing 4 |
4772 |
0.2 |
| chr2_38998173_38998600 | 2.92 |
Wdr38 |
WD repeat domain 38 |
54 |
0.59 |
| chr10_127676686_127677194 | 2.91 |
Nemp1 |
nuclear envelope integral membrane protein 1 |
124 |
0.61 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.9 | 15.6 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 3.9 | 19.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 2.3 | 6.9 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 2.1 | 6.4 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 1.9 | 5.8 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 1.7 | 6.7 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 1.6 | 4.7 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 1.5 | 10.8 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 1.5 | 7.7 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 1.5 | 4.6 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 1.5 | 7.6 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 1.5 | 5.9 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 1.4 | 4.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 1.3 | 4.0 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 1.3 | 12.6 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 1.2 | 3.7 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 1.1 | 6.8 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 1.0 | 3.8 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.9 | 8.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.9 | 1.7 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 0.8 | 5.0 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.8 | 5.7 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.8 | 2.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.8 | 5.5 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.7 | 1.4 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.7 | 6.3 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.7 | 2.7 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
| 0.7 | 2.7 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.6 | 2.5 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.6 | 18.4 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.6 | 2.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.6 | 16.0 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.6 | 2.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.5 | 2.1 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
| 0.5 | 1.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.5 | 1.0 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.5 | 1.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.5 | 4.1 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.5 | 1.5 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.5 | 2.4 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.5 | 6.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.5 | 1.4 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.5 | 1.4 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.4 | 1.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.4 | 3.4 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.4 | 2.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.4 | 3.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.4 | 1.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.4 | 2.8 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.4 | 1.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.4 | 2.7 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.4 | 1.5 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.4 | 1.5 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.4 | 1.1 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
| 0.4 | 3.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.4 | 1.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.4 | 1.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.4 | 1.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.3 | 10.5 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.3 | 1.7 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.3 | 2.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.3 | 1.3 | GO:1904672 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 0.3 | 2.3 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.3 | 7.2 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.3 | 2.5 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.3 | 4.7 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.3 | 2.8 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.3 | 0.9 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.3 | 3.9 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.3 | 0.6 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.3 | 0.9 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.3 | 3.5 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.3 | 1.2 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.3 | 0.9 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.3 | 6.6 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.3 | 1.4 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 | 2.5 | GO:0032966 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.3 | 1.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.3 | 0.5 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.3 | 2.4 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.3 | 4.0 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.3 | 0.8 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.3 | 0.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 1.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.2 | 1.2 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.2 | 0.5 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.2 | 4.5 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.2 | 0.9 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.2 | 1.2 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.2 | 0.5 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.2 | 1.6 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.2 | 1.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 0.7 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.2 | 0.5 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.2 | 0.7 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 1.3 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.2 | 2.4 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.2 | 0.6 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 1.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.2 | 2.0 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.2 | 2.5 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.2 | 1.5 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.2 | 1.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 | 0.6 | GO:0030578 | PML body organization(GO:0030578) |
| 0.2 | 0.6 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.2 | 0.8 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.2 | 2.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 0.9 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 1.1 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.2 | 0.4 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.2 | 2.5 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.2 | 0.7 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.2 | 2.1 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.2 | 5.3 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.2 | 1.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 | 0.9 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.2 | 0.7 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 1.9 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.2 | 0.3 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.2 | 0.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.2 | 1.3 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.2 | 0.7 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.2 | 0.5 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.2 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.2 | 0.2 | GO:0001796 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.2 | 0.3 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
| 0.2 | 0.8 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.2 | 0.6 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 | 0.5 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.1 | 0.4 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.1 | 0.6 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.1 | 4.0 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.1 | 0.8 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.1 | 0.1 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.1 | 0.3 | GO:0033206 | meiotic chromosome movement towards spindle pole(GO:0016344) meiotic cytokinesis(GO:0033206) |
| 0.1 | 0.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 0.8 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.5 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 0.4 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.1 | 4.2 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.1 | 0.3 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.1 | 0.9 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.4 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.1 | 0.4 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.1 | 0.4 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.4 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.2 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 | 0.4 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 1.3 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.1 | 0.5 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.9 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.4 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 1.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 0.1 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 0.7 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.3 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.7 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.1 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.1 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.5 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 | 1.9 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
| 0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.3 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.3 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.2 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 | 0.5 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 1.0 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.1 | 0.7 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.7 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
| 0.1 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.8 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 1.6 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.2 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.1 | 0.3 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.1 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.3 | GO:0071357 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 | 0.1 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 | 1.1 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.1 | 0.4 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.1 | 0.6 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.6 | GO:0051177 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.1 | 0.3 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 0.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.9 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.5 | GO:0045625 | regulation of T-helper 1 cell differentiation(GO:0045625) |
| 0.1 | 0.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.1 | 0.6 | GO:0010388 | cullin deneddylation(GO:0010388) |
| 0.1 | 0.6 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 | 0.5 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.1 | 0.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.7 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.8 | GO:0021932 | hindbrain radial glia guided cell migration(GO:0021932) |
| 0.1 | 0.1 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.8 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.1 | 0.7 | GO:0097286 | iron ion import(GO:0097286) |
| 0.1 | 0.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 0.5 | GO:0048242 | epinephrine secretion(GO:0048242) |
| 0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 1.0 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 0.3 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.1 | 0.4 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 | 0.3 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.3 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.1 | 0.4 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 1.4 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
| 0.1 | 0.7 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.1 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.6 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.1 | 0.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.1 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.1 | 0.5 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.1 | 0.9 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 0.4 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.1 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.1 | 0.1 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.1 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.1 | 0.9 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
| 0.1 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.6 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 | 0.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.1 | 0.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 9.1 | GO:0051607 | defense response to virus(GO:0051607) |
| 0.1 | 1.2 | GO:0072678 | T cell migration(GO:0072678) |
| 0.1 | 0.1 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.1 | 0.2 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.1 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
| 0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.3 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.1 | 0.2 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 0.6 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 | 1.4 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.1 | 0.3 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.5 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.7 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.1 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.0 | 0.0 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 1.9 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
| 0.0 | 0.1 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
| 0.0 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.5 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 1.4 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
| 0.0 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.2 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.6 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
| 0.0 | 0.2 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0044838 | cell quiescence(GO:0044838) |
| 0.0 | 0.7 | GO:0045047 | protein targeting to ER(GO:0045047) establishment of protein localization to endoplasmic reticulum(GO:0072599) |
| 0.0 | 1.7 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.0 | 0.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 1.0 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
| 0.0 | 0.3 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.2 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.0 | 0.1 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.0 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.3 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.0 | 1.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.0 | 0.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.0 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
| 0.0 | 2.2 | GO:0019882 | antigen processing and presentation(GO:0019882) |
| 0.0 | 0.5 | GO:0048535 | lymph node development(GO:0048535) |
| 0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.1 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.0 | 0.9 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
| 0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.0 | 0.1 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.0 | 0.0 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.0 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.0 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
| 0.0 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.0 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.5 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 1.0 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 1.0 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.2 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.9 | GO:2001243 | negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
| 0.0 | 0.2 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.0 | 0.4 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.3 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.4 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.1 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.0 | 0.0 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.2 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) specification of axis polarity(GO:0065001) |
| 0.0 | 0.0 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.0 | 0.0 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
| 0.0 | 0.2 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.0 | 0.2 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) negative regulation of cyclase activity(GO:0031280) |
| 0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.0 | 0.5 | GO:0014823 | response to activity(GO:0014823) |
| 0.0 | 0.1 | GO:0071305 | cellular response to vitamin D(GO:0071305) |
| 0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.6 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.1 | GO:0035610 | protein deglutamylation(GO:0035608) protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.3 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.1 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.9 | GO:0014068 | positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.0 | 0.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.4 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.1 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.0 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.5 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.2 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.1 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.1 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.0 | 0.0 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.0 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.0 | 0.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.0 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
| 0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 1.0 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.0 | 0.3 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 | 0.1 | GO:1902186 | regulation of viral release from host cell(GO:1902186) |
| 0.0 | 0.3 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.2 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.0 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.5 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.9 | GO:0003014 | renal system process(GO:0003014) |
| 0.0 | 0.0 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.0 | 0.0 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
| 0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.7 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
| 0.0 | 0.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.2 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.8 | GO:0051492 | regulation of stress fiber assembly(GO:0051492) |
| 0.0 | 0.0 | GO:0002753 | cytoplasmic pattern recognition receptor signaling pathway(GO:0002753) |
| 0.0 | 0.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0033280 | response to vitamin D(GO:0033280) |
| 0.0 | 0.1 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
| 0.0 | 0.2 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.0 | 0.1 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.0 | 0.0 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.5 | GO:0007569 | cell aging(GO:0007569) |
| 0.0 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.0 | 0.0 | GO:0044531 | induction of programmed cell death(GO:0012502) modulation of programmed cell death in other organism(GO:0044531) modulation of apoptotic process in other organism(GO:0044532) positive regulation of apoptotic process in other organism(GO:0044533) modulation by symbiont of host programmed cell death(GO:0052040) positive regulation by symbiont of host programmed cell death(GO:0052042) modulation by symbiont of host apoptotic process(GO:0052150) positive regulation by symbiont of host apoptotic process(GO:0052151) modulation of programmed cell death in other organism involved in symbiotic interaction(GO:0052248) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) modulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052433) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.4 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.0 | 2.3 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.1 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.2 | GO:0050802 | circadian sleep/wake cycle, sleep(GO:0050802) |
| 0.0 | 0.0 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.0 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.0 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.0 | 0.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.0 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.0 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.0 | 0.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.2 | GO:0032094 | response to food(GO:0032094) |
| 0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.4 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.0 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.0 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.7 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 | 0.1 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.0 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
| 0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.0 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.0 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.0 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.1 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.0 | GO:0060371 | response to pyrethroid(GO:0046684) regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.0 | 0.2 | GO:0051923 | sulfation(GO:0051923) |
| 0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.0 | 0.4 | GO:0007041 | lysosomal transport(GO:0007041) |
| 0.0 | 0.0 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.0 | 0.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.0 | 0.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.0 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.0 | 0.0 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.0 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.0 | GO:0002830 | positive regulation of type 2 immune response(GO:0002830) |
| 0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.2 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.0 | 0.5 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.3 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.0 | 0.2 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.0 | 0.0 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.0 | GO:0061526 | acetylcholine secretion(GO:0061526) |
| 0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.0 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.0 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.1 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.0 | GO:0061081 | positive regulation of macrophage cytokine production(GO:0060907) positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
| 0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.0 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.0 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.0 | 0.0 | GO:0045583 | cytotoxic T cell differentiation(GO:0045065) regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.0 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.1 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.0 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.0 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.0 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.0 | 0.0 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.0 | 0.0 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.1 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.2 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
| 0.0 | 0.0 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.0 | 0.1 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.0 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.1 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.0 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.1 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.9 | 11.7 | GO:0042825 | TAP complex(GO:0042825) |
| 2.2 | 15.3 | GO:0042382 | paraspeckles(GO:0042382) |
| 2.0 | 18.1 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 1.4 | 5.7 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 1.1 | 4.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 1.0 | 3.8 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.9 | 4.7 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.9 | 4.7 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.8 | 2.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.6 | 1.8 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.6 | 2.3 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.6 | 1.7 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.6 | 2.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.5 | 6.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.4 | 9.8 | GO:0022624 | proteasome accessory complex(GO:0022624) |
| 0.4 | 1.2 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.3 | 1.7 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.3 | 0.6 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 1.6 | GO:0005638 | lamin filament(GO:0005638) |
| 0.3 | 4.7 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.3 | 0.8 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.3 | 1.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 3.5 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 6.7 | GO:0005776 | autophagosome(GO:0005776) |
| 0.2 | 0.6 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.2 | 1.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.2 | 3.7 | GO:0045120 | pronucleus(GO:0045120) |
| 0.2 | 1.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.2 | 1.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.2 | 2.1 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.2 | 0.5 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.2 | 2.6 | GO:0031430 | M band(GO:0031430) |
| 0.2 | 2.3 | GO:0046930 | pore complex(GO:0046930) |
| 0.1 | 5.3 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 4.4 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.1 | 0.6 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 9.1 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.8 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 10.7 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
| 0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 2.3 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.4 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.1 | 1.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 1.4 | GO:0038201 | TOR complex(GO:0038201) |
| 0.1 | 1.0 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 1.0 | GO:0042612 | MHC protein complex(GO:0042611) MHC class I protein complex(GO:0042612) |
| 0.1 | 3.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.8 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.1 | 2.0 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 2.2 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.4 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 1.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 1.3 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 3.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 4.1 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 1.9 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 2.8 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.7 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 4.3 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.6 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 0.3 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.8 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 2.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 2.2 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.1 | 0.2 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 6.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 0.6 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 0.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.5 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.4 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 1.5 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 1.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 1.9 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 1.1 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 2.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.1 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.0 | 1.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.7 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 1.8 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
| 0.0 | 1.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.9 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 4.3 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 1.1 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 8.3 | GO:0005635 | nuclear envelope(GO:0005635) |
| 0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.4 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 1.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.5 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.3 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 0.3 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.3 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
| 0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 1.2 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.7 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.0 | 2.5 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 1.8 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.2 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.7 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 2.8 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 2.9 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.0 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.1 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.0 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.1 | GO:0033202 | DNA helicase complex(GO:0033202) |
| 0.0 | 1.2 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.2 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.1 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.0 | 0.5 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.1 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.0 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 1.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.2 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.2 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 10.3 | GO:0005829 | cytosol(GO:0005829) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.9 | 11.7 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 2.8 | 11.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 2.3 | 9.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 2.1 | 6.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 1.8 | 10.6 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 1.7 | 5.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 1.4 | 6.9 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 1.4 | 6.8 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.8 | 8.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.8 | 2.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.7 | 5.0 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.6 | 4.5 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.6 | 11.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.6 | 5.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.6 | 1.7 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.6 | 5.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.6 | 11.3 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.6 | 3.9 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.5 | 3.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.5 | 1.4 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.5 | 0.9 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.4 | 1.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.4 | 2.4 | GO:0043910 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
| 0.4 | 1.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.4 | 1.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.4 | 1.5 | GO:0052717 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.4 | 1.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.4 | 3.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.4 | 6.0 | GO:0001848 | complement binding(GO:0001848) |
| 0.3 | 2.4 | GO:0046790 | virion binding(GO:0046790) |
| 0.3 | 2.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.3 | 10.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.3 | 4.9 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.3 | 1.8 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.3 | 2.6 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.3 | 1.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.3 | 0.8 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.3 | 2.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.3 | 1.8 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.3 | 2.6 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.3 | 0.8 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.3 | 1.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 0.7 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.2 | 2.7 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.2 | 1.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.2 | 2.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.2 | 1.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.2 | 0.4 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 0.9 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.2 | 4.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.2 | 1.5 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.2 | 1.5 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.2 | 1.5 | GO:0043495 | protein anchor(GO:0043495) |
| 0.2 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 1.0 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.2 | 0.6 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 0.8 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.2 | 11.5 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.2 | 3.9 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.2 | 0.6 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.2 | 1.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.2 | 5.7 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.2 | 0.4 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.2 | 31.4 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.2 | 0.5 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.2 | 0.5 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.2 | 0.7 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.2 | 0.5 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.2 | 4.5 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.2 | 0.8 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.2 | 0.6 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.2 | 0.8 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.6 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 2.9 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 2.0 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.9 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.5 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 2.5 | GO:0004407 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
| 0.1 | 3.1 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.9 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 0.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 1.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.7 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 1.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.1 | 0.1 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
| 0.1 | 1.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.1 | 1.0 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 0.5 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.8 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 0.3 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 1.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.6 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.1 | 1.0 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.5 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.5 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 20.4 | GO:0043774 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
| 0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 0.6 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.5 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 1.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 2.8 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.9 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.1 | 0.1 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.1 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.1 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.5 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.3 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.7 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 4.6 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 0.2 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 2.2 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 1.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.1 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 0.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.6 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 1.0 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 1.0 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 3.0 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 1.1 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 3.3 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.3 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 1.0 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.1 | 0.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.3 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.1 | 2.6 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
| 0.1 | 0.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 1.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.3 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 0.2 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 3.8 | GO:0061659 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
| 0.1 | 0.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.1 | 0.6 | GO:0052859 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
| 0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.2 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.5 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 1.5 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.5 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 6.7 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.2 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 1.6 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.8 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.3 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.2 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.3 | GO:0034823 | acyl-CoA ligase activity(GO:0003996) succinate-CoA ligase activity(GO:0004774) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.7 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 1.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.9 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.0 | 2.5 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.0 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.3 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 2.7 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.5 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.6 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.6 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.0 | 0.1 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.0 | 1.6 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.0 | GO:0030352 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
| 0.0 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 3.3 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
| 0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.3 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.2 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.4 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.8 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.4 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.4 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
| 0.0 | 0.1 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.8 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.0 | 0.1 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 0.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.0 | 2.2 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.0 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.1 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.0 | 1.2 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
| 0.0 | 0.8 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.0 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.0 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.2 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.1 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.1 | GO:0043864 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.3 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.9 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.9 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.2 | GO:0047617 | palmitoyl-CoA hydrolase activity(GO:0016290) acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.0 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
| 0.0 | 0.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.4 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 1.1 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |
| 0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 1.2 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.0 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.0 | 0.0 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.1 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.0 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 2.8 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.0 | 0.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.0 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.0 | 0.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.7 | GO:0050660 | flavin adenine dinucleotide binding(GO:0050660) |
| 0.0 | 8.5 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
| 0.0 | 0.0 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.0 | 0.0 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
| 0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.0 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.0 | GO:0002054 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
| 0.0 | 0.0 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.1 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 1.1 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
| 0.0 | 0.0 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 15.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.3 | 8.3 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.2 | 5.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.2 | 1.6 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.2 | 5.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 3.5 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.2 | 1.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 1.6 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 2.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 6.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 4.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 3.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 0.7 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 3.3 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 1.1 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.8 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 6.1 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.1 | 2.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 3.0 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 1.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 2.4 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 0.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 2.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 2.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.1 | 2.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 2.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 1.1 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.1 | 0.7 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 2.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.5 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.8 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 2.8 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 1.2 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 1.0 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.3 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.2 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 1.1 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.4 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.3 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.1 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 25.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.8 | 9.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.6 | 5.9 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.6 | 5.6 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.5 | 2.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.4 | 7.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.4 | 3.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.4 | 20.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.4 | 6.4 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.3 | 14.9 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.3 | 1.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.2 | 3.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.2 | 4.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.2 | 1.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.2 | 6.0 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.2 | 4.9 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.2 | 2.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.2 | 2.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.2 | 7.9 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.2 | 0.9 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.2 | 1.6 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.2 | 2.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 5.4 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.2 | 1.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 1.1 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 2.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 1.2 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 0.6 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 1.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.8 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.1 | 2.4 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.1 | 2.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.0 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 4.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 0.9 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.1 | 2.6 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.3 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.1 | 0.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 5.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.1 | 2.8 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 3.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 0.6 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 1.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 1.4 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 7.6 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 1.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 4.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 0.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 1.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 0.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 0.2 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.5 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 1.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.9 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.1 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.6 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.0 | 0.5 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 1.0 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 1.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.0 | 0.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 1.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.7 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 1.1 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.8 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.4 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.8 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.2 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 2.0 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.4 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.4 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.0 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 0.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.1 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.9 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.3 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.2 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.1 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |