| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Lhx3
|
ENSMUSG00000026934.9 | Lhx3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Lhx3 | chr2_26208223_26208421 | 33 | 0.951301 | 0.57 | 5.1e-06 | Click! |
| Lhx3 | chr2_26198625_26198780 | 4164 | 0.131998 | -0.08 | 5.5e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr15_79690079_79691459 | 37.71 |
Gtpbp1 |
GTP binding protein 1 |
76 |
0.92 |
| chr13_43480925_43481874 | 21.69 |
Ranbp9 |
RAN binding protein 9 |
117 |
0.95 |
| chr4_116720426_116721428 | 17.79 |
Tesk2 |
testis-specific kinase 2 |
21 |
0.96 |
| chr2_78718517_78718735 | 17.75 |
Gm14463 |
predicted gene 14463 |
61197 |
0.13 |
| chr8_94898997_94899206 | 17.67 |
Ccdc102a |
coiled-coil domain containing 102A |
18420 |
0.1 |
| chr3_82809967_82810130 | 17.19 |
Gm43348 |
predicted gene 43348 |
2186 |
0.32 |
| chr13_47111196_47111529 | 17.04 |
1700026N04Rik |
RIKEN cDNA 1700026N04 gene |
4943 |
0.13 |
| chr7_103865311_103865713 | 16.74 |
Hbb-y |
hemoglobin Y, beta-like embryonic chain |
12296 |
0.06 |
| chr2_119566179_119566455 | 16.40 |
Chp1 |
calcineurin-like EF hand protein 1 |
288 |
0.85 |
| chr19_43767999_43768210 | 15.01 |
Cutc |
cutC copper transporter |
3231 |
0.18 |
| chr15_98608664_98610204 | 14.79 |
Adcy6 |
adenylate cyclase 6 |
598 |
0.55 |
| chr6_138424907_138425582 | 14.77 |
Lmo3 |
LIM domain only 3 |
629 |
0.69 |
| chr1_21660699_21661216 | 13.83 |
Gm7658 |
predicted gene 7658 |
147901 |
0.04 |
| chr1_184290010_184290162 | 13.63 |
Gm37223 |
predicted gene, 37223 |
68243 |
0.11 |
| chr4_117136303_117136464 | 13.63 |
Plk3 |
polo like kinase 3 |
2420 |
0.1 |
| chr10_116908685_116908852 | 12.83 |
Rab3ip |
RAB3A interacting protein |
11165 |
0.14 |
| chr18_56871340_56871513 | 12.50 |
Gm18087 |
predicted gene, 18087 |
44662 |
0.14 |
| chr1_24612739_24612914 | 12.38 |
Gm10222 |
predicted gene 10222 |
126 |
0.59 |
| chr7_126975552_126976438 | 12.29 |
Cdiptos |
CDIP transferase, opposite strand |
57 |
0.51 |
| chr7_133988507_133988680 | 12.05 |
Adam12 |
a disintegrin and metallopeptidase domain 12 (meltrin alpha) |
27328 |
0.2 |
| chr1_177475904_177476057 | 12.04 |
Gm37306 |
predicted gene, 37306 |
8602 |
0.17 |
| chr16_25293836_25294037 | 11.95 |
Tprg |
transformation related protein 63 regulated |
7115 |
0.32 |
| chr5_66337123_66338408 | 11.39 |
Apbb2 |
amyloid beta (A4) precursor protein-binding, family B, member 2 |
83 |
0.96 |
| chr7_40842646_40842992 | 11.23 |
Gm45008 |
predicted gene 45008 |
21709 |
0.13 |
| chr8_128688109_128688260 | 11.03 |
Itgb1 |
integrin beta 1 (fibronectin receptor beta) |
2314 |
0.29 |
| chr13_37859595_37859751 | 10.98 |
Rreb1 |
ras responsive element binding protein 1 |
1739 |
0.39 |
| chr8_126497512_126498658 | 10.98 |
Gm6091 |
predicted pseudogene 6091 |
21673 |
0.18 |
| chr3_121201082_121201399 | 10.82 |
Gm5710 |
predicted gene 5710 |
20143 |
0.13 |
| chr4_127020948_127021345 | 10.64 |
Sfpq |
splicing factor proline/glutamine rich (polypyrimidine tract binding protein associated) |
178 |
0.91 |
| chr17_47914586_47915244 | 10.36 |
Gm15556 |
predicted gene 15556 |
7463 |
0.14 |
| chr19_61057665_61057910 | 10.24 |
Gm22520 |
predicted gene, 22520 |
44242 |
0.12 |
| chr16_45572344_45572649 | 10.08 |
Slc9c1 |
solute carrier family 9, subfamily C (Na+-transporting carboxylic acid decarboxylase), member 1 |
32825 |
0.11 |
| chr6_120605559_120605721 | 10.08 |
Gm44124 |
predicted gene, 44124 |
25464 |
0.13 |
| chr5_145464693_145465010 | 10.05 |
Cyp3a16 |
cytochrome P450, family 3, subfamily a, polypeptide 16 |
4872 |
0.19 |
| chr3_52938291_52938546 | 10.01 |
Gm20750 |
predicted gene, 20750 |
10752 |
0.18 |
| chr8_126736428_126737199 | 9.75 |
Gm45805 |
predicted gene 45805 |
21521 |
0.23 |
| chr19_38038262_38038413 | 9.62 |
Myof |
myoferlin |
5014 |
0.16 |
| chr9_88483752_88484150 | 9.57 |
Syncrip |
synaptotagmin binding, cytoplasmic RNA interacting protein |
1377 |
0.28 |
| chr17_56036249_56036917 | 9.42 |
Sh3gl1 |
SH3-domain GRB2-like 1 |
7 |
0.94 |
| chr1_133251734_133252115 | 9.35 |
Gm19461 |
predicted gene, 19461 |
2368 |
0.24 |
| chr8_120724834_120725149 | 9.27 |
Gm18709 |
predicted gene, 18709 |
2272 |
0.22 |
| chr4_129416522_129416820 | 9.14 |
Zbtb8b |
zinc finger and BTB domain containing 8b |
15858 |
0.1 |
| chr12_84284873_84285073 | 9.12 |
Ptgr2 |
prostaglandin reductase 2 |
259 |
0.87 |
| chr5_115436438_115437458 | 9.09 |
4930430O22Rik |
RIKEN cDNA 4930430O22 gene |
304 |
0.74 |
| chr13_22020931_22021318 | 9.08 |
Gm11290 |
predicted gene 11290 |
3618 |
0.06 |
| chr2_3424274_3424638 | 9.06 |
Dclre1c |
DNA cross-link repair 1C |
254 |
0.86 |
| chr9_65196833_65197269 | 9.06 |
Gm25313 |
predicted gene, 25313 |
364 |
0.76 |
| chr5_125291456_125291674 | 9.05 |
Scarb1 |
scavenger receptor class B, member 1 |
2544 |
0.24 |
| chr12_91383684_91384259 | 9.01 |
Cep128 |
centrosomal protein 128 |
382 |
0.63 |
| chr18_3005171_3005609 | 9.00 |
Gm50072 |
predicted gene, 50072 |
10518 |
0.21 |
| chr10_4239811_4240108 | 8.91 |
Akap12 |
A kinase (PRKA) anchor protein (gravin) 12 |
26421 |
0.16 |
| chr9_90242297_90242465 | 8.79 |
Tbc1d2b |
TBC1 domain family, member 2B |
13546 |
0.16 |
| chr8_111312693_111312982 | 8.77 |
Mlkl |
mixed lineage kinase domain-like |
3282 |
0.18 |
| chr7_44472278_44472749 | 8.74 |
5430431A17Rik |
RIKEN cDNA 5430431A17 gene |
1025 |
0.24 |
| chr11_45855763_45856440 | 8.68 |
Clint1 |
clathrin interactor 1 |
4137 |
0.18 |
| chr2_170158021_170158172 | 8.62 |
Zfp217 |
zinc finger protein 217 |
9993 |
0.28 |
| chr19_14596815_14596966 | 8.42 |
Tle4 |
transducin-like enhancer of split 4 |
1161 |
0.62 |
| chr8_25620112_25620378 | 8.38 |
Gm23184 |
predicted gene, 23184 |
9687 |
0.09 |
| chr7_100559420_100559571 | 8.38 |
Mrpl48 |
mitochondrial ribosomal protein L48 |
11875 |
0.09 |
| chr11_113798252_113798403 | 8.30 |
Sdk2 |
sidekick cell adhesion molecule 2 |
12096 |
0.18 |
| chr14_48580344_48580672 | 8.27 |
Gm49120 |
predicted gene, 49120 |
10091 |
0.12 |
| chr4_150685197_150685518 | 8.25 |
Gm16079 |
predicted gene 16079 |
6565 |
0.21 |
| chr10_61124528_61124679 | 8.25 |
Gm44308 |
predicted gene, 44308 |
632 |
0.66 |
| chr15_82794220_82794587 | 8.24 |
Cyp2d26 |
cytochrome P450, family 2, subfamily d, polypeptide 26 |
109 |
0.93 |
| chr2_167713774_167713925 | 8.23 |
A530013C23Rik |
RIKEN cDNA A530013C23 gene |
22668 |
0.1 |
| chr2_18671841_18672581 | 8.14 |
Commd3 |
COMM domain containing 3 |
173 |
0.93 |
| chr9_50501327_50501514 | 8.07 |
Plet1os |
placenta expressed transcript 1, opposite strand |
3385 |
0.16 |
| chr7_103810908_103811069 | 8.06 |
Hbb-bt |
hemoglobin, beta adult t chain |
3008 |
0.09 |
| chr11_117407452_117407833 | 8.04 |
Gm11729 |
predicted gene 11729 |
6747 |
0.15 |
| chr18_55095859_55096019 | 8.02 |
AC163347.1 |
novel transcript |
421 |
0.83 |
| chr5_146234394_146234658 | 8.00 |
Cdk8 |
cyclin-dependent kinase 8 |
3141 |
0.15 |
| chr7_4741225_4741629 | 7.98 |
Kmt5c |
lysine methyltransferase 5C |
208 |
0.83 |
| chr11_4095576_4095728 | 7.96 |
Mtfp1 |
mitochondrial fission process 1 |
207 |
0.87 |
| chr8_91381604_91381966 | 7.96 |
Fto |
fat mass and obesity associated |
8770 |
0.16 |
| chr16_22857240_22857498 | 7.95 |
Tbccd1 |
TBCC domain containing 1 |
171 |
0.78 |
| chr9_70935136_70935406 | 7.90 |
Lipc |
lipase, hepatic |
463 |
0.83 |
| chr3_55075221_55075624 | 7.89 |
Gm43555 |
predicted gene 43555 |
17766 |
0.13 |
| chr16_58519486_58519656 | 7.86 |
St3gal6 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 6 |
3773 |
0.22 |
| chr7_115830920_115831237 | 7.85 |
Sox6 |
SRY (sex determining region Y)-box 6 |
6368 |
0.31 |
| chr1_84960126_84960364 | 7.83 |
AC167036.1 |
novel protein |
1263 |
0.35 |
| chr13_94037415_94037843 | 7.82 |
Cycs-ps3 |
cytochrome c, pseudogene 3 |
16214 |
0.17 |
| chr10_111936919_111937157 | 7.78 |
Krr1 |
KRR1, small subunit (SSU) processome component, homolog (yeast) |
35626 |
0.12 |
| chr12_84202809_84202960 | 7.74 |
Gm31513 |
predicted gene, 31513 |
6915 |
0.11 |
| chr7_109191268_109192295 | 7.70 |
Lmo1 |
LIM domain only 1 |
16574 |
0.17 |
| chr7_90062841_90063193 | 7.61 |
Gm44861 |
predicted gene 44861 |
20320 |
0.11 |
| chr10_93886358_93886509 | 7.60 |
Metap2 |
methionine aminopeptidase 2 |
1053 |
0.42 |
| chr7_45103031_45103408 | 7.53 |
Fcgrt |
Fc receptor, IgG, alpha chain transporter |
133 |
0.83 |
| chr4_132129197_132129583 | 7.48 |
Oprd1 |
opioid receptor, delta 1 |
15096 |
0.1 |
| chr3_115660838_115661123 | 7.46 |
S1pr1 |
sphingosine-1-phosphate receptor 1 |
54092 |
0.13 |
| chr13_91890302_91890496 | 7.30 |
Ckmt2 |
creatine kinase, mitochondrial 2 |
13514 |
0.2 |
| chr5_139681780_139682442 | 7.27 |
Gm42424 |
predicted gene 42424 |
19536 |
0.16 |
| chr10_61027371_61027522 | 7.27 |
Gm20611 |
predicted gene 20611 |
3857 |
0.17 |
| chr1_40229820_40230069 | 7.27 |
Il1r1 |
interleukin 1 receptor, type I |
4864 |
0.22 |
| chr6_7845514_7845676 | 7.26 |
C1galt1 |
core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase, 1 |
753 |
0.57 |
| chr19_5845343_5846183 | 7.22 |
Frmd8os |
FERM domain containing 8, opposite strand |
140 |
0.66 |
| chr9_113833592_113833892 | 7.19 |
Clasp2 |
CLIP associating protein 2 |
21142 |
0.2 |
| chr10_80141211_80141682 | 7.16 |
Atp5d |
ATP synthase, H+ transporting, mitochondrial F1 complex, delta subunit |
11 |
0.89 |
| chr5_27708254_27708552 | 7.15 |
Paxip1 |
PAX interacting (with transcription-activation domain) protein 1 |
42892 |
0.16 |
| chr9_116872914_116873407 | 7.07 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
50341 |
0.18 |
| chr13_63039019_63039172 | 6.97 |
Aopep |
aminopeptidase O |
23602 |
0.15 |
| chr15_58950775_58950926 | 6.95 |
Mtss1 |
MTSS I-BAR domain containing 1 |
2730 |
0.2 |
| chr2_181487275_181488108 | 6.93 |
Abhd16b |
abhydrolase domain containing 16B |
5515 |
0.11 |
| chr2_22587496_22588353 | 6.91 |
Gm13341 |
predicted gene 13341 |
38 |
0.95 |
| chr13_43231981_43232458 | 6.82 |
Tbc1d7 |
TBC1 domain family, member 7 |
60718 |
0.11 |
| chr1_36670453_36670635 | 6.75 |
Gm24133 |
predicted gene, 24133 |
6579 |
0.12 |
| chr8_122329580_122330425 | 6.70 |
Zfpm1 |
zinc finger protein, multitype 1 |
3696 |
0.15 |
| chr18_39828001_39828152 | 6.66 |
Pabpc2 |
poly(A) binding protein, cytoplasmic 2 |
54579 |
0.14 |
| chr5_121842326_121842480 | 6.65 |
Sh2b3 |
SH2B adaptor protein 3 |
4757 |
0.11 |
| chr13_23533504_23534327 | 6.62 |
H2ac10 |
H2A clustered histone 10 |
9 |
0.78 |
| chr6_90561220_90561762 | 6.61 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
6215 |
0.15 |
| chr8_31525172_31525323 | 6.61 |
Gm45303 |
predicted gene 45303 |
33271 |
0.2 |
| chr17_45699506_45699657 | 6.53 |
Mrpl14 |
mitochondrial ribosomal protein L14 |
4165 |
0.14 |
| chr7_115844299_115844450 | 6.52 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1731 |
0.5 |
| chr14_21096598_21096812 | 6.51 |
Adk |
adenosine kinase |
20553 |
0.2 |
| chr13_97768202_97768353 | 6.49 |
Rps18-ps6 |
ribosomal protein S18, pseudogene 6 |
7645 |
0.15 |
| chr18_61960597_61960886 | 6.45 |
Sh3tc2 |
SH3 domain and tetratricopeptide repeats 2 |
7657 |
0.21 |
| chr4_48315342_48315493 | 6.35 |
Gm12435 |
predicted gene 12435 |
29813 |
0.16 |
| chr8_41015734_41016166 | 6.33 |
Mtus1 |
mitochondrial tumor suppressor 1 |
370 |
0.8 |
| chr17_47909349_47909983 | 6.27 |
Gm15556 |
predicted gene 15556 |
12712 |
0.13 |
| chr9_79875961_79876154 | 6.23 |
Gm3211 |
predicted gene 3211 |
37143 |
0.12 |
| chr14_115745987_115746350 | 6.17 |
Gm20713 |
predicted gene 20713 |
125110 |
0.06 |
| chr11_98339036_98339432 | 6.14 |
Ppp1r1b |
protein phosphatase 1, regulatory inhibitor subunit 1B |
9170 |
0.09 |
| chr1_190041966_190042117 | 6.11 |
Smyd2 |
SET and MYND domain containing 2 |
119678 |
0.05 |
| chr1_135789932_135790083 | 6.05 |
Tnni1 |
troponin I, skeletal, slow 1 |
6942 |
0.15 |
| chr8_33905789_33906327 | 5.94 |
Rbpms |
RNA binding protein gene with multiple splicing |
14294 |
0.16 |
| chr1_168275797_168276114 | 5.93 |
Gm37524 |
predicted gene, 37524 |
61716 |
0.13 |
| chr2_125122926_125123420 | 5.92 |
Myef2 |
myelin basic protein expression factor 2, repressor |
241 |
0.89 |
| chr8_68606713_68606995 | 5.90 |
Gm15654 |
predicted gene 15654 |
13284 |
0.25 |
| chr9_115403468_115403626 | 5.89 |
Gm9487 |
predicted gene 9487 |
1602 |
0.28 |
| chr4_35165678_35165829 | 5.83 |
Mob3b |
MOB kinase activator 3B |
8269 |
0.17 |
| chr8_33987076_33987405 | 5.83 |
Gm45817 |
predicted gene 45817 |
40 |
0.96 |
| chr11_103141600_103141768 | 5.83 |
Hexim2 |
hexamethylene bis-acetamide inducible 2 |
7819 |
0.12 |
| chr19_55194224_55194541 | 5.82 |
Mir6715 |
microRNA 6715 |
1704 |
0.31 |
| chr1_24615430_24615609 | 5.78 |
Gm28661 |
predicted gene 28661 |
46 |
0.86 |
| chr11_75402326_75402486 | 5.74 |
Smyd4 |
SET and MYND domain containing 4 |
2797 |
0.14 |
| chr4_154359614_154359823 | 5.73 |
Prdm16 |
PR domain containing 16 |
11261 |
0.18 |
| chr1_64087943_64089121 | 5.73 |
Gm13748 |
predicted gene 13748 |
9878 |
0.19 |
| chr11_31830043_31830943 | 5.73 |
Gm12107 |
predicted gene 12107 |
2167 |
0.31 |
| chr1_136911165_136911329 | 5.72 |
Nr5a2 |
nuclear receptor subfamily 5, group A, member 2 |
29336 |
0.18 |
| chr6_138351080_138351249 | 5.70 |
Lmo3 |
LIM domain only 3 |
70288 |
0.11 |
| chr7_114203690_114203856 | 5.70 |
Gm45454 |
predicted gene 45454 |
5315 |
0.22 |
| chr8_125782363_125782518 | 5.68 |
Pcnx2 |
pecanex homolog 2 |
8312 |
0.24 |
| chrX_160426520_160426808 | 5.67 |
Adgrg2 |
adhesion G protein-coupled receptor G2 |
628 |
0.76 |
| chr1_179054720_179054871 | 5.66 |
Smyd3 |
SET and MYND domain containing 3 |
65450 |
0.14 |
| chr2_66780909_66781127 | 5.65 |
Scn7a |
sodium channel, voltage-gated, type VII, alpha |
3896 |
0.32 |
| chr5_121889411_121889760 | 5.64 |
Cux2 |
cut-like homeobox 2 |
5796 |
0.15 |
| chr7_19744712_19745296 | 5.62 |
Nectin2 |
nectin cell adhesion molecule 2 |
4529 |
0.08 |
| chr10_60350903_60351210 | 5.61 |
Vsir |
V-set immunoregulatory receptor |
1733 |
0.37 |
| chr10_115263315_115263511 | 5.60 |
Gm8942 |
predicted gene 8942 |
6565 |
0.17 |
| chr12_76271526_76271782 | 5.60 |
Gm47526 |
predicted gene, 47526 |
6062 |
0.12 |
| chr19_9033450_9033636 | 5.56 |
Ahnak |
AHNAK nucleoprotein (desmoyokin) |
33883 |
0.09 |
| chr7_16604283_16604434 | 5.55 |
Gm29443 |
predicted gene 29443 |
9466 |
0.09 |
| chr7_56043995_56044191 | 5.53 |
Gm34121 |
predicted gene, 34121 |
5846 |
0.12 |
| chr8_66363123_66363725 | 5.52 |
Marchf1 |
membrane associated ring-CH-type finger 1 |
22870 |
0.19 |
| chr8_94182597_94182850 | 5.52 |
Gm39228 |
predicted gene, 39228 |
566 |
0.58 |
| chr2_160619427_160619728 | 5.51 |
Gm14221 |
predicted gene 14221 |
394 |
0.83 |
| chr10_69253249_69253618 | 5.48 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
12204 |
0.19 |
| chr1_190220518_190220669 | 5.43 |
Prox1 |
prospero homeobox 1 |
49879 |
0.13 |
| chr19_40369576_40369846 | 5.40 |
Sorbs1 |
sorbin and SH3 domain containing 1 |
4537 |
0.25 |
| chr13_24551558_24551922 | 5.35 |
Ripor2 |
RHO family interacting cell polarization regulator 2 |
30449 |
0.15 |
| chr1_12409934_12410455 | 5.29 |
Mir6341 |
microRNA 6341 |
15792 |
0.23 |
| chr19_53247701_53247859 | 5.29 |
1700001K23Rik |
RIKEN cDNA 1700001K23 gene |
7410 |
0.16 |
| chr17_32787686_32788072 | 5.28 |
Zfp871 |
zinc finger protein 871 |
332 |
0.55 |
| chr1_126391091_126391421 | 5.27 |
Nckap5 |
NCK-associated protein 5 |
57200 |
0.15 |
| chr13_62952253_62952404 | 5.26 |
Gm48812 |
predicted gene, 48812 |
2886 |
0.22 |
| chr5_90510093_90510743 | 5.20 |
Afp |
alpha fetoprotein |
2987 |
0.17 |
| chr17_48418119_48418309 | 5.19 |
Gm49893 |
predicted gene, 49893 |
934 |
0.42 |
| chr6_34316914_34317089 | 5.18 |
Akr1b3 |
aldo-keto reductase family 1, member B3 (aldose reductase) |
429 |
0.8 |
| chr13_103974317_103974468 | 5.18 |
Gm47851 |
predicted gene, 47851 |
3938 |
0.22 |
| chr9_122074963_122075114 | 5.17 |
Gm39465 |
predicted gene, 39465 |
23575 |
0.1 |
| chr1_129250830_129250985 | 5.17 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
22395 |
0.22 |
| chr16_24399802_24399974 | 5.13 |
Lpp |
LIM domain containing preferred translocation partner in lipoma |
6150 |
0.17 |
| chr11_3139811_3140326 | 5.13 |
Gm11399 |
predicted gene 11399 |
1980 |
0.21 |
| chr13_14040175_14040467 | 5.13 |
Tbce |
tubulin-specific chaperone E |
683 |
0.47 |
| chr10_59569109_59569260 | 5.10 |
Gm10322 |
predicted gene 10322 |
46879 |
0.13 |
| chr4_125485724_125486136 | 5.09 |
Grik3 |
glutamate receptor, ionotropic, kainate 3 |
4770 |
0.22 |
| chr9_42463451_42463637 | 5.07 |
Tbcel |
tubulin folding cofactor E-like |
2083 |
0.29 |
| chr14_79521168_79521327 | 5.05 |
Elf1 |
E74-like factor 1 |
5549 |
0.18 |
| chr6_5314470_5314621 | 5.00 |
Pon2 |
paraoxonase 2 |
16090 |
0.18 |
| chr9_58658414_58658568 | 4.99 |
Rec114 |
REC114 meiotic recombination protein |
801 |
0.62 |
| chr12_52446576_52446857 | 4.98 |
Gm47431 |
predicted gene, 47431 |
1409 |
0.46 |
| chr8_10936772_10936949 | 4.95 |
Gm45042 |
predicted gene 45042 |
6973 |
0.11 |
| chr8_120537903_120538228 | 4.94 |
1700016A09Rik |
RIKEN cDNA 1700016A09 gene |
339 |
0.53 |
| chr5_107040666_107040817 | 4.93 |
Gm33474 |
predicted gene, 33474 |
8095 |
0.21 |
| chr11_108309813_108310102 | 4.92 |
Apoh |
apolipoprotein H |
33397 |
0.16 |
| chr5_124025302_124025455 | 4.89 |
Vps37b |
vacuolar protein sorting 37B |
6880 |
0.1 |
| chr10_20046153_20046446 | 4.88 |
Map3k5 |
mitogen-activated protein kinase kinase kinase 5 |
53226 |
0.13 |
| chr1_77299319_77299474 | 4.87 |
Epha4 |
Eph receptor A4 |
78211 |
0.11 |
| chr6_25664249_25664412 | 4.86 |
Gpr37 |
G protein-coupled receptor 37 |
25462 |
0.25 |
| chr10_117897075_117897226 | 4.86 |
4933411E08Rik |
RIKEN cDNA 4933411E08 gene |
28309 |
0.12 |
| chr9_96258563_96258909 | 4.83 |
Tfdp2 |
transcription factor Dp 2 |
6 |
0.98 |
| chr4_147430116_147430495 | 4.78 |
Gm13161 |
predicted gene 13161 |
13166 |
0.13 |
| chr10_68089780_68089937 | 4.77 |
Rtkn2 |
rhotekin 2 |
45890 |
0.13 |
| chr2_170155390_170155766 | 4.76 |
Zfp217 |
zinc finger protein 217 |
7475 |
0.29 |
| chr6_108207290_108207451 | 4.72 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
5726 |
0.24 |
| chr19_50490641_50491115 | 4.71 |
Gm26629 |
predicted gene, 26629 |
186528 |
0.03 |
| chr2_27540096_27540493 | 4.68 |
Gm13421 |
predicted gene 13421 |
132 |
0.76 |
| chr7_103870533_103870999 | 4.66 |
Olfr66 |
olfactory receptor 66 |
11475 |
0.06 |
| chr8_72216698_72216849 | 4.65 |
Fam32a |
family with sequence similarity 32, member A |
2957 |
0.12 |
| chr5_115490348_115490558 | 4.63 |
Gm24407 |
predicted gene, 24407 |
199 |
0.8 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.5 | 13.9 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 2.4 | 9.6 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 1.9 | 5.7 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 1.8 | 5.3 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 1.5 | 36.8 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 1.4 | 4.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 1.4 | 5.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 1.2 | 8.5 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 1.2 | 8.4 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 1.2 | 6.0 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 1.1 | 6.7 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 1.0 | 3.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.9 | 4.7 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.9 | 3.8 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.9 | 3.5 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.9 | 3.4 | GO:0060486 | Clara cell differentiation(GO:0060486) |
| 0.8 | 5.0 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.8 | 2.4 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.8 | 1.6 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.8 | 2.3 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.8 | 1.5 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.8 | 2.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.7 | 3.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.7 | 2.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.7 | 2.2 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.7 | 2.7 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.7 | 2.6 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.6 | 2.6 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.6 | 1.9 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.6 | 2.9 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.6 | 2.9 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.6 | 10.3 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.6 | 3.3 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.5 | 2.7 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.5 | 2.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.5 | 1.6 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.5 | 2.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.5 | 1.5 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.5 | 1.5 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.5 | 0.5 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.5 | 1.0 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.5 | 1.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.5 | 2.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.5 | 2.4 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.5 | 4.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.5 | 3.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.5 | 1.4 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.5 | 1.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.4 | 1.3 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.4 | 1.8 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.4 | 1.3 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.4 | 2.6 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.4 | 2.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.4 | 1.7 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.4 | 1.3 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.4 | 1.3 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.4 | 1.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.4 | 4.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.4 | 1.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.4 | 2.4 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.4 | 2.4 | GO:0015871 | choline transport(GO:0015871) |
| 0.4 | 23.9 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
| 0.4 | 1.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.4 | 1.9 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.4 | 1.2 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.4 | 1.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.4 | 1.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.4 | 1.5 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.4 | 0.4 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.4 | 1.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.4 | 1.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.4 | 1.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.4 | 1.4 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.4 | 1.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.3 | 1.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.3 | 0.7 | GO:0045472 | response to ether(GO:0045472) |
| 0.3 | 2.1 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.3 | 3.4 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.3 | 1.0 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.3 | 0.7 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.3 | 2.7 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.3 | 7.8 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.3 | 4.6 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.3 | 1.0 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.3 | 1.7 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.3 | 1.6 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.3 | 1.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.3 | 0.6 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.3 | 2.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.3 | 1.6 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.3 | 0.9 | GO:0030242 | pexophagy(GO:0030242) |
| 0.3 | 1.6 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.3 | 0.9 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.3 | 2.2 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.3 | 1.2 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.3 | 0.6 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.3 | 0.9 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.3 | 0.3 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.3 | 2.7 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.3 | 2.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.3 | 5.0 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.3 | 1.2 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.3 | 14.4 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.3 | 5.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.3 | 1.7 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.3 | 1.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.3 | 0.9 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.3 | 3.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.3 | 1.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.3 | 2.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.3 | 1.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.3 | 1.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.3 | 1.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.3 | 1.4 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.3 | 0.5 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.3 | 0.8 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.3 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.3 | 0.5 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.3 | 1.6 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.3 | 1.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 | 1.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.3 | 0.5 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.3 | 0.8 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.3 | 0.5 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.3 | 0.5 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.3 | 0.8 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.3 | 0.8 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.2 | 0.7 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.2 | 1.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.2 | 4.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.2 | 1.5 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.2 | 1.2 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.2 | 6.9 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.2 | 1.5 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.2 | 6.1 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.2 | 4.2 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.2 | 1.0 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.2 | 1.5 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 0.7 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 | 2.6 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.2 | 1.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.2 | 1.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.2 | 3.0 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.2 | 3.7 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.2 | 1.4 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.2 | 0.7 | GO:0046078 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) dUMP metabolic process(GO:0046078) |
| 0.2 | 1.6 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.2 | 1.1 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
| 0.2 | 0.7 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.2 | 1.6 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 0.2 | 1.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.2 | 1.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.2 | 0.9 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.2 | 0.6 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 0.6 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.2 | 1.5 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.2 | 0.4 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.2 | 0.4 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 0.4 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 | 0.8 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 0.2 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.2 | 0.8 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
| 0.2 | 0.4 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.2 | 0.6 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 | 0.6 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.2 | 0.6 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 | 2.1 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.2 | 2.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.2 | 2.5 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.2 | 0.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.2 | 2.2 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.2 | 0.8 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.2 | 2.8 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.2 | 0.8 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.2 | 0.8 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 1.6 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 | 0.6 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.2 | 2.2 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.2 | 0.4 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.2 | 0.6 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.2 | 4.5 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.2 | 1.6 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 | 0.4 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.2 | 0.8 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 | 2.5 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.2 | 0.7 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.2 | 3.2 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.2 | 1.5 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.2 | 0.7 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 2.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.2 | 0.4 | GO:0021938 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.2 | 0.9 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.2 | 0.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 | 0.5 | GO:0070989 | oxidative demethylation(GO:0070989) |
| 0.2 | 0.4 | GO:0007228 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.2 | 0.4 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.2 | 3.4 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.2 | 1.6 | GO:0043586 | tongue development(GO:0043586) |
| 0.2 | 0.2 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.2 | 0.7 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.2 | 1.9 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.2 | 0.5 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.2 | 0.7 | GO:0048293 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
| 0.2 | 0.7 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.2 | 0.7 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.2 | 0.5 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.2 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 0.3 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.2 | 0.7 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.2 | 1.0 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.2 | 1.0 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.2 | 0.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.2 | 0.2 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.2 | 1.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 | 1.2 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.2 | 0.3 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.2 | 0.2 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.2 | 1.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.2 | 0.2 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) primary alcohol catabolic process(GO:0034310) |
| 0.2 | 1.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 0.5 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 0.3 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.2 | 0.5 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.2 | 2.3 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.2 | 0.6 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.2 | 0.6 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.2 | 0.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 0.8 | GO:0060770 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.4 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.3 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 1.8 | GO:0043489 | RNA stabilization(GO:0043489) |
| 0.1 | 0.1 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 0.9 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.4 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 | 1.3 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.1 | 0.6 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 2.6 | GO:0071398 | cellular response to fatty acid(GO:0071398) |
| 0.1 | 0.4 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.1 | 0.3 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 | 0.1 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.1 | 0.6 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 | 0.3 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.1 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.1 | 1.6 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 7.9 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.1 | 1.0 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 1.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.8 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.1 | 0.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.4 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.1 | 0.8 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.1 | 1.0 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.4 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.3 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.1 | 0.4 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.1 | GO:0060058 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 | 1.2 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.1 | 1.6 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.1 | 0.4 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.1 | 0.4 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.1 | 0.8 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 0.8 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 2.0 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.3 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 | 1.2 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 1.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.7 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.3 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.1 | 0.9 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 0.5 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.1 | 0.4 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.5 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.1 | 0.4 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
| 0.1 | 1.1 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
| 0.1 | 0.6 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.4 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
| 0.1 | 1.0 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 0.4 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 1.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.4 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.5 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.2 | GO:0036492 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
| 0.1 | 1.6 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.1 | 0.4 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 4.6 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.1 | 0.2 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.1 | 0.5 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 | 1.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.5 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 0.4 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 6.9 | GO:0030048 | actin filament-based movement(GO:0030048) |
| 0.1 | 0.1 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.1 | 0.8 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.1 | 0.5 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.3 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.1 | 0.3 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.6 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.1 | 0.2 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 1.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.3 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.1 | 0.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.2 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.3 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.8 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 1.3 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 0.4 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.6 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 0.3 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.1 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 1.2 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 1.0 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.1 | 0.2 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.2 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.1 | 0.2 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.1 | 0.1 | GO:0031946 | regulation of glucocorticoid biosynthetic process(GO:0031946) |
| 0.1 | 0.4 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 | 0.3 | GO:0051657 | maintenance of organelle location(GO:0051657) |
| 0.1 | 0.3 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 4.6 | GO:0048041 | cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
| 0.1 | 0.6 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 | 0.4 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
| 0.1 | 0.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.5 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 3.6 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.1 | 0.5 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
| 0.1 | 0.5 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.1 | 0.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.1 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.1 | 0.8 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.1 | 0.4 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.3 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.2 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.1 | 0.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.2 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.1 | 0.2 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.1 | 0.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.6 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.8 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.1 | 0.3 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 0.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 2.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.1 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.6 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 | 0.4 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.1 | 0.3 | GO:2000664 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) positive regulation of interleukin-5 secretion(GO:2000664) regulation of interleukin-13 secretion(GO:2000665) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.1 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.8 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.4 | GO:0060068 | vagina development(GO:0060068) |
| 0.1 | 0.5 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.2 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 0.6 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.1 | 0.4 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.1 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.7 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 0.8 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 1.2 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.1 | 0.3 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 | 0.4 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.1 | 0.9 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 1.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.1 | GO:0060435 | bronchiole development(GO:0060435) |
| 0.1 | 0.2 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.1 | 0.3 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.1 | 0.3 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.3 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.1 | 0.6 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 0.7 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.1 | 0.3 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.1 | 1.0 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.1 | 0.8 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 | 0.6 | GO:0009650 | UV protection(GO:0009650) |
| 0.1 | 0.6 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.1 | 1.4 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.1 | 3.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.1 | 0.3 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.1 | 0.8 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 0.1 | 0.9 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.1 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.1 | 0.2 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 | 0.7 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.1 | 0.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 3.7 | GO:0007569 | cell aging(GO:0007569) |
| 0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.1 | 0.1 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.1 | 0.3 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.1 | 0.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 0.2 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 1.1 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.1 | 0.2 | GO:0007619 | courtship behavior(GO:0007619) |
| 0.1 | 2.0 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.1 | 0.2 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.1 | 0.4 | GO:0051256 | mitotic spindle elongation(GO:0000022) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 | 0.4 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.2 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.1 | 0.6 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.4 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
| 0.1 | 1.0 | GO:0000303 | response to superoxide(GO:0000303) |
| 0.1 | 0.2 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 1.5 | GO:0048536 | spleen development(GO:0048536) |
| 0.1 | 0.3 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.9 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 | 0.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 0.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.5 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 1.8 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.1 | 0.2 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.1 | 0.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.1 | 0.2 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 4.1 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.1 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.1 | 0.2 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
| 0.1 | 1.0 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
| 0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.4 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.1 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.1 | 0.5 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
| 0.1 | 0.5 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.1 | 0.1 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
| 0.1 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.7 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 1.0 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 0.1 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 2.2 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.1 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.6 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
| 0.1 | 0.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 | 2.3 | GO:0045727 | positive regulation of translation(GO:0045727) |
| 0.1 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.9 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.9 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.1 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 | 0.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 0.2 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.1 | 0.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.9 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.3 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.1 | 1.2 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.1 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.1 | 0.6 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 | 0.5 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.5 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.1 | GO:1901890 | positive regulation of cell junction assembly(GO:1901890) |
| 0.1 | 0.5 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.1 | 0.3 | GO:0051352 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.5 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.1 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.1 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
| 0.1 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.1 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.3 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.8 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 0.9 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 | 0.2 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.1 | 0.5 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.1 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.1 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.5 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.1 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.1 | 0.1 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.1 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 0.6 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.1 | 0.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.1 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.1 | GO:0002576 | platelet degranulation(GO:0002576) |
| 0.1 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 0.8 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.1 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 | 0.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.1 | 0.4 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.1 | 0.1 | GO:0048557 | embryonic digestive tract morphogenesis(GO:0048557) |
| 0.1 | 1.2 | GO:0043297 | apical junction assembly(GO:0043297) |
| 0.1 | 1.1 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.1 | 1.9 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.1 | 0.2 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.1 | 0.9 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.1 | 0.2 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.1 | 4.9 | GO:0019882 | antigen processing and presentation(GO:0019882) |
| 0.1 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.1 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.1 | GO:0060525 | prostate glandular acinus development(GO:0060525) |
| 0.1 | 0.1 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.1 | 0.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.2 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 | 0.5 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 | 0.1 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
| 0.1 | 0.4 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
| 0.1 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.1 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 1.0 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.6 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.2 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.1 | 0.4 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.1 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.1 | 0.3 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.1 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 0.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 | 0.1 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
| 0.1 | 0.3 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
| 0.1 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.4 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 0.9 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.2 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 0.2 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
| 0.1 | 0.1 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.1 | 0.2 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 2.2 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.1 | 0.1 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.4 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.3 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.2 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.1 | 0.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 | 0.2 | GO:0045821 | positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 | 0.2 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 | 0.7 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 0.1 | 0.4 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 1.9 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.1 | 2.1 | GO:0003341 | cilium movement(GO:0003341) |
| 0.1 | 0.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 | 0.1 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) sinoatrial node cell differentiation(GO:0060921) cardiac pacemaker cell development(GO:0060926) sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.1 | 0.3 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.1 | 0.1 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
| 0.1 | 0.6 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.1 | 1.2 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.3 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 | 0.2 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.1 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 | 0.2 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 | 0.1 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 6.0 | GO:0006814 | sodium ion transport(GO:0006814) |
| 0.0 | 5.0 | GO:0051321 | meiotic cell cycle(GO:0051321) |
| 0.0 | 8.8 | GO:0032259 | methylation(GO:0032259) |
| 0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.1 | GO:1903432 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
| 0.0 | 0.3 | GO:0061213 | positive regulation of mesonephros development(GO:0061213) |
| 0.0 | 0.1 | GO:0001781 | neutrophil apoptotic process(GO:0001781) |
| 0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.2 | GO:1902186 | regulation of viral release from host cell(GO:1902186) |
| 0.0 | 0.7 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 1.0 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.0 | 0.1 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 0.0 | 0.2 | GO:0043482 | endosome to melanosome transport(GO:0035646) cellular pigment accumulation(GO:0043482) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.0 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.5 | GO:1902285 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) |
| 0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.6 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.4 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.1 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.7 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.0 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.0 | 1.2 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.4 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.9 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
| 0.0 | 0.2 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.2 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.2 | GO:0050755 | chemokine metabolic process(GO:0050755) |
| 0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.4 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.2 | GO:0014856 | skeletal muscle satellite cell proliferation(GO:0014841) skeletal muscle cell proliferation(GO:0014856) |
| 0.0 | 1.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.0 | GO:0071868 | cellular response to monoamine stimulus(GO:0071868) |
| 0.0 | 0.1 | GO:0051181 | cofactor transport(GO:0051181) |
| 0.0 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.3 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) |
| 0.0 | 0.3 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
| 0.0 | 0.1 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.0 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.7 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.0 | 0.0 | GO:0071605 | monocyte chemotactic protein-1 production(GO:0071605) regulation of monocyte chemotactic protein-1 production(GO:0071637) |
| 0.0 | 1.0 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.0 | 1.2 | GO:0001824 | blastocyst development(GO:0001824) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.5 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.2 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.0 | 0.1 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.0 | 1.0 | GO:0050868 | negative regulation of T cell activation(GO:0050868) |
| 0.0 | 0.0 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.4 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
| 0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.1 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.1 | GO:0015846 | polyamine transport(GO:0015846) |
| 0.0 | 0.2 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.0 | 0.2 | GO:1902402 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
| 0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.3 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
| 0.0 | 0.2 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.0 | GO:1902931 | negative regulation of alcohol biosynthetic process(GO:1902931) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.2 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.0 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.1 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.0 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
| 0.0 | 0.0 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.2 | GO:1903312 | negative regulation of mRNA metabolic process(GO:1903312) |
| 0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.2 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
| 0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.0 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.5 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 | 0.1 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.4 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.0 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.3 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 | 0.1 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 1.0 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.2 | GO:0030878 | thyroid gland development(GO:0030878) |
| 0.0 | 0.9 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.2 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.5 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.0 | 0.0 | GO:0048024 | regulation of mRNA splicing, via spliceosome(GO:0048024) |
| 0.0 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.2 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.5 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.3 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.0 | 0.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.0 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.0 | 0.0 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.2 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
| 0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.0 | 0.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 1.5 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.1 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.0 | 0.1 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
| 0.0 | 0.2 | GO:0070542 | response to fatty acid(GO:0070542) |
| 0.0 | 0.0 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
| 0.0 | 0.5 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.3 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
| 0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0044818 | mitotic G2/M transition checkpoint(GO:0044818) |
| 0.0 | 0.8 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.3 | GO:0009994 | oocyte differentiation(GO:0009994) |
| 0.0 | 0.0 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.0 | 1.4 | GO:0051302 | regulation of cell division(GO:0051302) |
| 0.0 | 0.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.1 | GO:0060674 | placenta blood vessel development(GO:0060674) |
| 0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.0 | 0.0 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.2 | GO:0006754 | ATP biosynthetic process(GO:0006754) |
| 0.0 | 0.4 | GO:0032418 | lysosome localization(GO:0032418) |
| 0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.2 | GO:0032401 | establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) |
| 0.0 | 0.1 | GO:0071514 | genetic imprinting(GO:0071514) |
| 0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.0 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
| 0.0 | 0.0 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.0 | 0.3 | GO:0051180 | vitamin transport(GO:0051180) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.0 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
| 0.0 | 0.2 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.0 | 0.1 | GO:0051972 | regulation of telomerase activity(GO:0051972) |
| 0.0 | 0.3 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.2 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.0 | 0.6 | GO:0001837 | epithelial to mesenchymal transition(GO:0001837) |
| 0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
| 0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.0 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.0 | 0.3 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.7 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 0.3 | GO:0048477 | oogenesis(GO:0048477) |
| 0.0 | 0.5 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.0 | 0.6 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 0.2 | GO:0072678 | T cell migration(GO:0072678) |
| 0.0 | 0.1 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 1.1 | GO:0006475 | internal protein amino acid acetylation(GO:0006475) |
| 0.0 | 2.6 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.0 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.0 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
| 0.0 | 0.0 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.0 | 0.0 | GO:0003097 | renal water transport(GO:0003097) |
| 0.0 | 0.1 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.1 | GO:0046456 | icosanoid biosynthetic process(GO:0046456) fatty acid derivative biosynthetic process(GO:1901570) |
| 0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.0 | GO:0060717 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.0 | 0.0 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.1 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) |
| 0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.0 | 0.2 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.1 | GO:0090197 | chemokine secretion(GO:0090195) regulation of chemokine secretion(GO:0090196) positive regulation of chemokine secretion(GO:0090197) |
| 0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.0 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.0 | 0.0 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.8 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.2 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.0 | 0.1 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 1.2 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 0.4 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
| 0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.0 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.0 | 1.6 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 | 0.2 | GO:0031279 | regulation of cyclase activity(GO:0031279) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.8 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.0 | 0.0 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.0 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.0 | 0.7 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.0 | 0.0 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.0 | 0.0 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.0 | 1.4 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.0 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.0 | 0.1 | GO:0086009 | membrane repolarization(GO:0086009) |
| 0.0 | 0.0 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.0 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.3 | GO:1903845 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 | 0.7 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
| 0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.5 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.0 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.1 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.4 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.0 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
| 0.0 | 0.1 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 | 0.0 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.0 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) |
| 0.0 | 0.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.0 | 0.6 | GO:0045444 | fat cell differentiation(GO:0045444) |
| 0.0 | 0.6 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
| 0.0 | 0.0 | GO:0071554 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 | 0.0 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.1 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.7 | GO:0006413 | translational initiation(GO:0006413) |
| 0.0 | 0.2 | GO:0033561 | regulation of water loss via skin(GO:0033561) |
| 0.0 | 0.2 | GO:0019915 | lipid storage(GO:0019915) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.2 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.1 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.0 | 0.2 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) rRNA 3'-end processing(GO:0031125) |
| 0.0 | 0.6 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.0 | 0.5 | GO:0034612 | response to tumor necrosis factor(GO:0034612) |
| 0.0 | 0.3 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
| 0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.0 | GO:0071622 | regulation of granulocyte chemotaxis(GO:0071622) |
| 0.0 | 0.0 | GO:0042268 | regulation of cytolysis(GO:0042268) negative regulation of cytolysis(GO:0045918) |
| 0.0 | 0.1 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.0 | 0.0 | GO:0050926 | regulation of positive chemotaxis(GO:0050926) |
| 0.0 | 0.1 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.0 | 0.0 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.1 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.0 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.0 | GO:0046640 | regulation of alpha-beta T cell proliferation(GO:0046640) |
| 0.0 | 0.0 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.0 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.0 | 0.0 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 | 0.2 | GO:0030838 | positive regulation of actin filament polymerization(GO:0030838) |
| 0.0 | 0.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 2.1 | GO:0060271 | cilium morphogenesis(GO:0060271) |
| 0.0 | 0.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.0 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
| 0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.1 | GO:0070572 | positive regulation of neuron projection regeneration(GO:0070572) |
| 0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:0098751 | bone cell development(GO:0098751) |
| 0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.0 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.0 | 0.0 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.0 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.0 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.3 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.0 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.0 | 0.0 | GO:0033700 | phospholipid efflux(GO:0033700) |
| 0.0 | 0.0 | GO:0048259 | regulation of receptor-mediated endocytosis(GO:0048259) |
| 0.0 | 0.4 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
| 0.0 | 0.1 | GO:0032720 | negative regulation of tumor necrosis factor production(GO:0032720) |
| 0.0 | 0.2 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.0 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 | 0.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.2 | GO:0071456 | cellular response to hypoxia(GO:0071456) |
| 0.0 | 0.1 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.0 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
| 0.0 | 0.0 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
| 0.0 | 0.1 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.1 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.0 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.0 | GO:0032612 | interleukin-1 production(GO:0032612) |
| 0.0 | 0.3 | GO:0031623 | receptor internalization(GO:0031623) |
| 0.0 | 0.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.1 | GO:0006405 | RNA export from nucleus(GO:0006405) |
| 0.0 | 0.0 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
| 0.0 | 1.1 | GO:0006821 | chloride transport(GO:0006821) |
| 0.0 | 0.1 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
| 0.0 | 0.0 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 | 0.0 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
| 0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.2 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
| 0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0038061 | NIK/NF-kappaB signaling(GO:0038061) |
| 0.0 | 0.0 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.0 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 | 0.2 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.0 | 0.3 | GO:0045638 | negative regulation of myeloid cell differentiation(GO:0045638) |
| 0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.1 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
| 0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.1 | GO:0032094 | response to food(GO:0032094) |
| 0.0 | 0.0 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.0 | 0.0 | GO:0046173 | polyol biosynthetic process(GO:0046173) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.1 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.0 | 0.0 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.4 | GO:0007160 | cell-matrix adhesion(GO:0007160) |
| 0.0 | 0.0 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.0 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
| 0.0 | 0.0 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 0.1 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
| 0.0 | 0.0 | GO:0070168 | negative regulation of biomineral tissue development(GO:0070168) |
| 0.0 | 0.0 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
| 0.0 | 0.3 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.0 | 0.0 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.5 | GO:0006364 | rRNA processing(GO:0006364) |
| 0.0 | 0.0 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.5 | GO:0006909 | phagocytosis(GO:0006909) |
| 0.0 | 0.0 | GO:0035196 | production of miRNAs involved in gene silencing by miRNA(GO:0035196) |
| 0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.1 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 | 0.0 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.1 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 1.1 | GO:0042060 | wound healing(GO:0042060) |
| 0.0 | 0.0 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.0 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.0 | GO:0030823 | regulation of cGMP metabolic process(GO:0030823) |
| 0.0 | 0.2 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
| 0.0 | 0.2 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
| 0.0 | 0.0 | GO:0010586 | miRNA metabolic process(GO:0010586) |
| 0.0 | 0.1 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.0 | 0.1 | GO:1902749 | regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.0 | 0.2 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.0 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.0 | 0.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.0 | 0.0 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.1 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
| 0.0 | 0.1 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.1 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.0 | 0.0 | GO:0048880 | sensory system development(GO:0048880) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
| 0.0 | 0.0 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
| 0.0 | 0.2 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.0 | 12.7 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.0 | 0.0 | GO:0032366 | intracellular sterol transport(GO:0032366) |
| 0.0 | 0.0 | GO:1901739 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 0.0 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.0 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.1 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
| 0.0 | 0.0 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.0 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.0 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.0 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.0 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.2 | GO:0034341 | response to interferon-gamma(GO:0034341) |
| 0.0 | 0.2 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.0 | GO:0046889 | positive regulation of lipid biosynthetic process(GO:0046889) |
| 0.0 | 0.1 | GO:0051452 | intracellular pH reduction(GO:0051452) |
| 0.0 | 0.1 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
| 0.0 | 0.0 | GO:0009120 | deoxyribonucleoside metabolic process(GO:0009120) |
| 0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.0 | 0.0 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.0 | 0.0 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.0 | GO:0046931 | pore complex assembly(GO:0046931) |
| 0.0 | 0.0 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 35.0 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 1.7 | 11.7 | GO:0042382 | paraspeckles(GO:0042382) |
| 1.4 | 4.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 1.4 | 6.8 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 1.1 | 3.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.9 | 6.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.9 | 12.3 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.8 | 5.9 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.7 | 2.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.7 | 2.7 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.7 | 2.0 | GO:0097413 | Lewy body(GO:0097413) |
| 0.6 | 1.7 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.5 | 3.3 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.5 | 1.6 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.5 | 3.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.5 | 6.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.5 | 2.6 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.5 | 1.6 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.5 | 0.9 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.4 | 1.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.4 | 0.4 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.4 | 13.5 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.4 | 2.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.4 | 3.5 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.4 | 1.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.4 | 1.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.4 | 8.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.3 | 0.9 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.3 | 2.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.3 | 2.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.3 | 0.6 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.3 | 0.9 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.3 | 1.4 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.3 | 1.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.3 | 2.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.3 | 1.8 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.3 | 4.6 | GO:0002102 | podosome(GO:0002102) |
| 0.3 | 1.0 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.2 | 2.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.2 | 2.4 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 0.7 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 1.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.2 | 0.2 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.2 | 0.7 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.2 | 0.2 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.2 | 0.9 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.2 | 0.6 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.2 | 0.4 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.2 | 0.7 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.2 | 1.7 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.2 | 2.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.2 | 1.8 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 1.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.2 | 0.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.2 | 2.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.2 | 1.6 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.2 | 1.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.2 | 0.6 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.2 | 1.9 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 1.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.2 | 0.5 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.2 | 2.3 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 1.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 1.5 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.1 | 0.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.9 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.8 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.1 | 27.0 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.1 | 5.2 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 1.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 1.0 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 1.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.1 | 1.3 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 1.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.8 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 1.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 1.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 0.9 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 0.4 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 3.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.5 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 3.3 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.1 | 1.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 3.9 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 1.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 1.6 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 4.6 | GO:0032420 | stereocilium(GO:0032420) |
| 0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 0.2 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.1 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.7 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 0.6 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.1 | 2.3 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.1 | 0.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.8 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 7.9 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 0.4 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 0.8 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
| 0.1 | 1.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 5.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.6 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.4 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.5 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.1 | 0.9 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 34.1 | GO:0005813 | centrosome(GO:0005813) |
| 0.1 | 1.7 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.1 | 0.9 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.1 | 0.5 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 3.6 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
| 0.1 | 2.5 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.8 | GO:1990752 | microtubule end(GO:1990752) |
| 0.1 | 0.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 1.1 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 4.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 3.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 1.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 1.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 0.3 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 26.2 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.1 | 0.8 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 2.2 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 1.5 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 2.0 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.1 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.7 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.6 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.9 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 1.8 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 3.1 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.2 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.1 | 1.5 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 0.5 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 0.4 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.4 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.9 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.8 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.1 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 3.5 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 6.5 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.3 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 0.3 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 2.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 1.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 1.4 | GO:0008305 | integrin complex(GO:0008305) |
| 0.1 | 83.1 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.1 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.2 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.1 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 1.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 0.3 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.1 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.1 | GO:0043601 | nuclear replisome(GO:0043601) |
| 0.1 | 0.6 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
| 0.1 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 1.5 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.1 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 8.2 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 3.1 | GO:0043292 | contractile fiber(GO:0043292) |
| 0.0 | 2.6 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.1 | GO:0044437 | vacuolar membrane(GO:0005774) vacuolar part(GO:0044437) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 2.3 | GO:0099568 | cytoplasmic region(GO:0099568) |
| 0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 16.9 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 1.9 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 3.6 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 2.4 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.1 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 0.0 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 1.1 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.8 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 0.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 4.0 | GO:0005635 | nuclear envelope(GO:0005635) |
| 0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.2 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.0 | 0.2 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.0 | 0.8 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 4.0 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 2.8 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.9 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.6 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 0.6 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.2 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.1 | GO:0019815 | immunoglobulin complex(GO:0019814) B cell receptor complex(GO:0019815) |
| 0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.9 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 4.1 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.0 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.6 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.1 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.0 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 2.1 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 8.4 | GO:0005768 | endosome(GO:0005768) |
| 0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 29.4 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 1.3 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.6 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.2 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 2.5 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 1.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 1.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 2.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.1 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.0 | 0.0 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 11.8 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.7 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.0 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 2.2 | GO:0043235 | receptor complex(GO:0043235) |
| 0.0 | 0.0 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.0 | 0.0 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 18.0 | GO:0070062 | extracellular exosome(GO:0070062) |
| 0.0 | 0.1 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 2.7 | GO:0005912 | adherens junction(GO:0005912) |
| 0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.0 | GO:0048475 | membrane coat(GO:0030117) coated membrane(GO:0048475) |
| 0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.0 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.2 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 0.1 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.1 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.0 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.0 | GO:0005652 | nuclear lamina(GO:0005652) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 9.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 2.1 | 6.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 2.0 | 38.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 1.8 | 8.9 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 1.7 | 6.6 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 1.6 | 1.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 1.4 | 5.7 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 1.4 | 8.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 1.1 | 9.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 1.1 | 5.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 1.1 | 3.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.9 | 2.7 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.9 | 2.6 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.8 | 0.8 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.8 | 2.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.7 | 2.8 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.7 | 22.1 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.7 | 2.0 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.7 | 3.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.6 | 4.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.6 | 4.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.6 | 2.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.6 | 2.8 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.5 | 1.6 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.5 | 1.5 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.5 | 1.5 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.5 | 1.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.5 | 0.5 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.5 | 1.4 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.4 | 3.5 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.4 | 1.8 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.4 | 1.3 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.4 | 1.7 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.4 | 1.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.4 | 2.0 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.4 | 16.6 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.4 | 2.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.4 | 4.6 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.4 | 1.5 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.4 | 1.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.4 | 1.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.4 | 3.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.4 | 1.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.4 | 1.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.4 | 1.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.4 | 10.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.3 | 1.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.3 | 1.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.3 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.3 | 1.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.3 | 0.9 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.3 | 1.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.3 | 1.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.3 | 4.9 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.3 | 0.3 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.3 | 0.9 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.3 | 0.6 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.3 | 0.6 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.3 | 1.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.3 | 0.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.3 | 1.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.3 | 1.7 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.3 | 1.4 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.3 | 1.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.3 | 1.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.3 | 1.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.3 | 2.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.3 | 1.9 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.3 | 1.4 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.3 | 8.9 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.3 | 7.8 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.3 | 2.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.3 | 2.9 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.3 | 1.1 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.3 | 0.8 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.3 | 1.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.3 | 0.3 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
| 0.3 | 3.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.3 | 0.8 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 12.8 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.2 | 0.7 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.2 | 2.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.2 | 0.7 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.2 | 1.9 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.2 | 1.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.2 | 0.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 1.7 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.2 | 0.5 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 6.3 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.2 | 15.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.2 | 0.9 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.2 | 2.2 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 0.2 | 0.7 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.2 | 4.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.2 | 3.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.2 | 1.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 1.9 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.2 | 4.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.2 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 2.5 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 0.6 | GO:0004096 | catalase activity(GO:0004096) |
| 0.2 | 0.6 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.2 | 1.8 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.2 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.2 | 1.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 1.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 2.7 | GO:0034573 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.2 | 6.0 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.2 | 2.7 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.2 | 1.5 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.2 | 0.7 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.2 | 0.6 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.2 | 1.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.2 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 2.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.2 | 1.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.2 | 3.9 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.2 | 8.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.2 | 4.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.2 | 3.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.2 | 2.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.2 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.2 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 1.7 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.2 | 0.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.2 | 0.8 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.2 | 2.6 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.2 | 9.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.2 | 0.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 2.5 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.1 | 0.9 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 3.4 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 1.6 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.6 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.4 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.1 | 3.1 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.7 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 2.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.3 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.1 | 0.8 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 0.9 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.1 | 0.5 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.4 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
| 0.1 | 0.9 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.1 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.4 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 2.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 1.7 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.1 | 0.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.1 | 0.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.9 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.2 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.6 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 2.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 1.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.4 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 0.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.5 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 1.0 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 4.9 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.6 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 5.6 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 1.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 1.6 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 1.0 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.6 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.1 | 0.7 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 3.7 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 3.9 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.1 | 4.2 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.1 | 0.6 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 7.4 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
| 0.1 | 3.2 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.1 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 4.2 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.1 | 0.3 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.3 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 2.1 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 4.7 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.1 | 1.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.3 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.1 | 0.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 0.5 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.3 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.1 | 0.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 4.0 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 1.1 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.1 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
| 0.1 | 1.0 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 0.3 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.3 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 1.7 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.1 | 0.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 0.3 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 0.5 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.5 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.1 | 0.9 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 2.3 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
| 0.1 | 1.8 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.1 | 18.6 | GO:0051020 | GTPase binding(GO:0051020) |
| 0.1 | 0.8 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 0.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 5.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 0.7 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.1 | 2.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.4 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.1 | 1.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.1 | 0.2 | GO:0008412 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 1.2 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
| 0.1 | 3.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 0.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.2 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 1.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.1 | 0.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.7 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 0.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.5 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.1 | 1.1 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 0.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 2.0 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.6 | GO:0019176 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
| 0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.3 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.1 | 0.9 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.1 | 0.4 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.1 | 0.4 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.1 | 9.1 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 2.2 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.2 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.1 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.1 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.5 | GO:0050661 | NADP binding(GO:0050661) |
| 0.1 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.3 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.1 | 0.8 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
| 0.1 | 0.2 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.3 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.1 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.5 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 0.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 1.5 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.2 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.1 | 0.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.2 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.1 | 0.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 0.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 7.7 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
| 0.1 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.1 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.2 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 1.0 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.5 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 4.1 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 0.2 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.1 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.1 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.3 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.1 | 0.6 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.1 | 0.4 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 2.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 2.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 0.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.1 | 0.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.1 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.5 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.8 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.6 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.5 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 2.7 | GO:0016616 | oxidoreductase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0016616) |
| 0.0 | 1.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 1.3 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.0 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.6 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.0 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 1.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 1.4 | GO:0031072 | heat shock protein binding(GO:0031072) |
| 0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.6 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.0 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.3 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 1.1 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.3 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 1.4 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.4 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 31.4 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.0 | 0.2 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.4 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.3 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
| 0.0 | 0.4 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.7 | GO:0045543 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.2 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.2 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 1.4 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.0 | 2.9 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 20.9 | GO:0008270 | zinc ion binding(GO:0008270) |
| 0.0 | 0.4 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.9 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.0 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 1.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.1 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.0 | 5.4 | GO:0003712 | transcription cofactor activity(GO:0003712) |
| 0.0 | 0.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 1.0 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.4 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.3 | GO:0071814 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
| 0.0 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.4 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.2 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 1.3 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.2 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.2 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.2 | GO:0034901 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.0 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.7 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.2 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.0 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.2 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.3 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.9 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.4 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.4 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.4 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.5 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 2.5 | GO:0005550 | pheromone binding(GO:0005550) |
| 0.0 | 0.3 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.0 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 1.1 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.6 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 0.1 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.0 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 1.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.7 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.2 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.5 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.3 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.4 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.0 | 0.2 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.0 | 0.3 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.2 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.0 | 0.4 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 3.9 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.1 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 1.1 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
| 0.0 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.0 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.0 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.0 | 0.1 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.4 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
| 0.0 | 0.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.0 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.5 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.3 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.0 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.4 | GO:0019842 | vitamin binding(GO:0019842) |
| 0.0 | 0.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.1 | GO:0005048 | signal sequence binding(GO:0005048) |
| 0.0 | 0.0 | GO:0046332 | SMAD binding(GO:0046332) |
| 0.0 | 0.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.0 | 0.0 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 1.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0022829 | wide pore channel activity(GO:0022829) |
| 0.0 | 0.0 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.9 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
| 0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.0 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.0 | 0.2 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.6 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.1 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.0 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.0 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.0 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.0 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.0 | GO:0016972 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.0 | 0.0 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.0 | 0.0 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.0 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 12.8 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.0 | 0.0 | GO:0043178 | alcohol binding(GO:0043178) |
| 0.0 | 3.4 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
| 0.0 | 0.0 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.0 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.0 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.0 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.0 | GO:0046977 | TAP binding(GO:0046977) |
| 0.0 | 0.0 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.1 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.3 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 9.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.5 | 0.5 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.4 | 4.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.4 | 5.9 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.4 | 19.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.3 | 10.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.3 | 18.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.3 | 1.0 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.3 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.2 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.2 | 8.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.2 | 3.8 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.2 | 1.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.2 | 3.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.2 | 0.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.2 | 1.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 4.0 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 2.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 2.8 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 2.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 3.5 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 2.6 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 5.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 6.1 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 0.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 1.9 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 2.0 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.8 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 1.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 8.7 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 1.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 1.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 3.0 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 2.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 3.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 0.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 1.5 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 1.9 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 0.4 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 0.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 1.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 0.8 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 2.2 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 0.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 0.3 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.1 | 0.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 0.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 1.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 0.6 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.4 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 1.4 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.1 | 0.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 0.3 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.1 | 1.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 1.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.1 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 1.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 1.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.9 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 2.5 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 1.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 1.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.2 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.2 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.0 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.4 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.1 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.2 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.0 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 9.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.8 | 9.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.5 | 7.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.3 | 1.7 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.3 | 27.9 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.3 | 5.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.3 | 2.9 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.3 | 0.3 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.3 | 3.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.3 | 2.7 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.3 | 1.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.3 | 4.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.3 | 2.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.2 | 2.9 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.2 | 5.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 1.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.2 | 3.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 3.9 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.2 | 2.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 1.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 3.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.2 | 2.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.2 | 1.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.2 | 2.6 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.2 | 12.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.2 | 2.0 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 3.7 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.2 | 2.7 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.2 | 2.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.2 | 4.0 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.2 | 2.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.2 | 4.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.2 | 2.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.2 | 1.8 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.2 | 3.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.9 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 1.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 3.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.1 | 10.4 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.1 | 2.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 0.4 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.1 | 0.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 1.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 0.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 5.6 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 1.0 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 0.2 | REACTOME HEMOSTASIS | Genes involved in Hemostasis |
| 0.1 | 2.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 1.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 7.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 0.8 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 2.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.1 | 7.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.7 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 0.6 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.9 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.8 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.1 | 0.8 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.1 | 2.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.1 | 0.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.5 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 0.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 1.7 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.1 | 0.5 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 0.5 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 0.3 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.1 | 0.2 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.1 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 0.3 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 1.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 1.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 0.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 0.7 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 1.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 13.6 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
| 0.1 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.1 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 0.7 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 3.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 1.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.0 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.1 | 0.9 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 3.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 5.4 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 1.7 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 0.1 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.1 | 0.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.5 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 0.7 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 1.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 2.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 2.1 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 1.9 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.4 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.0 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 4.3 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.0 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.4 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.3 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 1.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.7 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 1.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.0 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 1.3 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 1.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 3.1 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.6 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.6 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.3 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
| 0.0 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.5 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.0 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.2 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.8 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.0 | 0.7 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.0 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
| 0.0 | 0.3 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.4 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.0 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.0 | 0.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.4 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 0.0 | 0.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 1.9 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.7 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
| 0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.1 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.2 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.0 | 0.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 0.1 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |