| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Sp2
|
ENSMUSG00000018678.6 | Sp2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| Sp2 | chr11_96977642_96978462 | 341 | 0.757371 | 0.52 | 4.6e-05 | Click! |
| Sp2 | chr11_96963605_96963878 | 4924 | 0.099001 | 0.47 | 3.2e-04 | Click! |
| Sp2 | chr11_96956472_96956634 | 12112 | 0.082240 | 0.43 | 9.2e-04 | Click! |
| Sp2 | chr11_96956797_96956948 | 11793 | 0.082656 | 0.43 | 1.0e-03 | Click! |
| Sp2 | chr11_96957232_96957395 | 11352 | 0.083239 | 0.43 | 1.0e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_167288765_167288933 | 3.89 |
Mir6347 |
microRNA 6347 |
1276 |
0.29 |
| chr7_25279370_25280622 | 2.70 |
Cic |
capicua transcriptional repressor |
355 |
0.74 |
| chr18_21299601_21300892 | 2.67 |
Garem1 |
GRB2 associated regulator of MAPK1 subtype 1 |
108 |
0.96 |
| chr6_7844118_7845326 | 2.54 |
C1galt1 |
core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase, 1 |
120 |
0.95 |
| chr19_32239325_32239637 | 2.46 |
Sgms1 |
sphingomyelin synthase 1 |
655 |
0.76 |
| chr3_108562098_108562631 | 2.29 |
Tmem167b |
transmembrane protein 167B |
102 |
0.92 |
| chr11_20022835_20022986 | 2.25 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
68340 |
0.1 |
| chr12_69758521_69758986 | 2.04 |
Mir681 |
microRNA 681 |
5191 |
0.14 |
| chr6_128423910_128424151 | 2.03 |
Itfg2 |
integrin alpha FG-GAP repeat containing 2 |
839 |
0.35 |
| chr10_31312849_31313513 | 2.01 |
Hddc2 |
HD domain containing 2 |
202 |
0.92 |
| chr18_35498528_35499200 | 1.94 |
Sil1 |
endoplasmic reticulum chaperone SIL1 homolog (S. cerevisiae) |
2 |
0.71 |
| chr6_90988622_90989360 | 1.89 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
306 |
0.9 |
| chr17_47909349_47909983 | 1.85 |
Gm15556 |
predicted gene 15556 |
12712 |
0.13 |
| chr18_64265897_64266139 | 1.80 |
St8sia3 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 3 |
32 |
0.97 |
| chr2_33582582_33583081 | 1.74 |
Gm38011 |
predicted gene, 38011 |
31567 |
0.14 |
| chr4_137727683_137728235 | 1.74 |
Rap1gap |
Rap1 GTPase-activating protein |
197 |
0.94 |
| chr19_6832373_6832730 | 1.71 |
Mir5046 |
microRNA 5046 |
2607 |
0.15 |
| chr11_109720742_109721454 | 1.71 |
Fam20a |
family with sequence similarity 20, member A |
1158 |
0.48 |
| chr18_20936839_20937401 | 1.67 |
Rnf125 |
ring finger protein 125 |
7505 |
0.22 |
| chr2_84827700_84827907 | 1.63 |
Timm10 |
translocase of inner mitochondrial membrane 10 |
419 |
0.72 |
| chr3_115642021_115642675 | 1.62 |
S1pr1 |
sphingosine-1-phosphate receptor 1 |
72724 |
0.1 |
| chr11_4223413_4223698 | 1.59 |
Castor1 |
cytosolic arginine sensor for mTORC1 subunit 1 |
5330 |
0.1 |
| chr2_165326390_165327162 | 1.58 |
Elmo2 |
engulfment and cell motility 2 |
297 |
0.87 |
| chr5_134467312_134467605 | 1.55 |
Gm16020 |
predicted gene 16020 |
4218 |
0.12 |
| chr15_5244185_5244373 | 1.55 |
Ptger4 |
prostaglandin E receptor 4 (subtype EP4) |
92 |
0.96 |
| chrX_74270090_74270471 | 1.55 |
Rpl10 |
ribosomal protein L10 |
532 |
0.48 |
| chr14_61680824_61681965 | 1.55 |
Gm37472 |
predicted gene, 37472 |
100 |
0.9 |
| chr3_40744698_40745243 | 1.55 |
Hspa4l |
heat shock protein 4 like |
412 |
0.82 |
| chr8_105305345_105306455 | 1.54 |
Elmo3 |
engulfment and cell motility 3 |
257 |
0.72 |
| chr5_5186422_5186573 | 1.50 |
Cdk14 |
cyclin-dependent kinase 14 |
8858 |
0.17 |
| chr9_98297734_98297911 | 1.50 |
Nmnat3 |
nicotinamide nucleotide adenylyltransferase 3 |
1160 |
0.51 |
| chr1_119836783_119837421 | 1.50 |
Ptpn4 |
protein tyrosine phosphatase, non-receptor type 4 |
31 |
0.96 |
| chr7_6860549_6860988 | 1.49 |
Gm44586 |
predicted gene 44586 |
30270 |
0.1 |
| chr13_61803863_61804026 | 1.49 |
Gm23739 |
predicted gene, 23739 |
304 |
0.47 |
| chr7_96951152_96951641 | 1.47 |
C230038L03Rik |
RIKEN cDNA C230038L03 gene |
84 |
0.53 |
| chr13_62467089_62467252 | 1.46 |
Gm22256 |
predicted gene, 22256 |
305 |
0.48 |
| chr4_129463753_129464168 | 1.45 |
Bsdc1 |
BSD domain containing 1 |
582 |
0.57 |
| chr15_77932133_77932295 | 1.45 |
Txn2 |
thioredoxin 2 |
3208 |
0.19 |
| chr7_83884699_83884960 | 1.43 |
Mesd |
mesoderm development LRP chaperone |
363 |
0.55 |
| chr9_107296490_107296947 | 1.42 |
Cish |
cytokine inducible SH2-containing protein |
8 |
0.88 |
| chr2_154790876_154791702 | 1.41 |
Raly |
hnRNP-associated with lethal yellow |
63 |
0.56 |
| chr3_59063502_59063682 | 1.39 |
Gpr171 |
G protein-coupled receptor 171 |
38229 |
0.11 |
| chr5_86064994_86065367 | 1.38 |
Cenpc1 |
centromere protein C1 |
342 |
0.81 |
| chr11_86395859_86396055 | 1.38 |
Gm23667 |
predicted gene, 23667 |
12869 |
0.18 |
| chr14_79331382_79331546 | 1.38 |
Naa16 |
N(alpha)-acetyltransferase 16, NatA auxiliary subunit |
11733 |
0.17 |
| chr15_80097023_80097326 | 1.37 |
Syngr1 |
synaptogyrin 1 |
696 |
0.49 |
| chr8_114117215_114117558 | 1.36 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
16171 |
0.27 |
| chr12_105033804_105033955 | 1.35 |
Glrx5 |
glutaredoxin 5 |
1189 |
0.25 |
| chr11_4094891_4095513 | 1.34 |
Mtfp1 |
mitochondrial fission process 1 |
62 |
0.94 |
| chr8_72492766_72492977 | 1.33 |
Gm17435 |
predicted gene, 17435 |
63 |
0.73 |
| chr17_74527979_74528161 | 1.32 |
Gm31645 |
predicted gene, 31645 |
24 |
0.75 |
| chr3_69042352_69042515 | 1.32 |
Trim59 |
tripartite motif-containing 59 |
2282 |
0.2 |
| chrX_150547265_150547522 | 1.32 |
Alas2 |
aminolevulinic acid synthase 2, erythroid |
18 |
0.52 |
| chr10_45578675_45578859 | 1.30 |
Hace1 |
HECT domain and ankyrin repeat containing, E3 ubiquitin protein ligase 1 |
487 |
0.77 |
| chr15_89177592_89178085 | 1.30 |
Plxnb2 |
plexin B2 |
2950 |
0.12 |
| chrX_162736240_162736751 | 1.30 |
Gm15201 |
predicted gene 15201 |
118 |
0.95 |
| chr1_73046888_73047083 | 1.29 |
1700027A15Rik |
RIKEN cDNA 1700027A15 gene |
22416 |
0.2 |
| chr6_124481595_124482129 | 1.29 |
C1rl |
complement component 1, r subcomponent-like |
11251 |
0.09 |
| chr2_151010553_151010704 | 1.29 |
Ninl |
ninein-like |
1230 |
0.35 |
| chr2_131233834_131234563 | 1.28 |
Mavs |
mitochondrial antiviral signaling protein |
93 |
0.94 |
| chr6_135167678_135168443 | 1.27 |
Hebp1 |
heme binding protein 1 |
75 |
0.95 |
| chr11_110448430_110448605 | 1.27 |
Map2k6 |
mitogen-activated protein kinase kinase 6 |
28860 |
0.23 |
| chr4_108961175_108961348 | 1.27 |
8030443G20Rik |
RIKEN cDNA 8030443G20 gene |
10816 |
0.13 |
| chr1_58353416_58353567 | 1.27 |
Gm37607 |
predicted gene, 37607 |
32643 |
0.11 |
| chr19_45657916_45658214 | 1.26 |
Fbxw4 |
F-box and WD-40 domain protein 4 |
2247 |
0.31 |
| chr6_57703676_57703882 | 1.26 |
Lancl2 |
LanC (bacterial lantibiotic synthetase component C)-like 2 |
692 |
0.59 |
| chr4_106560049_106560214 | 1.25 |
Dhcr24 |
24-dehydrocholesterol reductase |
907 |
0.41 |
| chr1_156420594_156420946 | 1.25 |
Axdnd1 |
axonemal dynein light chain domain containing 1 |
116 |
0.96 |
| chr18_36560129_36560675 | 1.25 |
Ankhd1 |
ankyrin repeat and KH domain containing 1 |
209 |
0.91 |
| chr15_76697423_76698657 | 1.25 |
Gpt |
glutamic pyruvic transaminase, soluble |
22 |
0.93 |
| chr4_133557474_133557769 | 1.24 |
Gm23158 |
predicted gene, 23158 |
1328 |
0.26 |
| chr13_84222146_84222896 | 1.23 |
Tmem161b |
transmembrane protein 161B |
192 |
0.67 |
| chr8_84708740_84709502 | 1.22 |
Nfix |
nuclear factor I/X |
903 |
0.39 |
| chr15_86105433_86105656 | 1.21 |
Gm15722 |
predicted gene 15722 |
15484 |
0.17 |
| chr6_28424073_28424566 | 1.21 |
Gcc1 |
golgi coiled coil 1 |
166 |
0.82 |
| chr3_86799443_86799675 | 1.20 |
Dclk2 |
doublecortin-like kinase 2 |
399 |
0.86 |
| chr6_91116679_91117212 | 1.20 |
Nup210 |
nucleoporin 210 |
116 |
0.95 |
| chr13_119232734_119232969 | 1.20 |
Gm44488 |
predicted gene, 44488 |
36753 |
0.17 |
| chr2_160603252_160603413 | 1.19 |
Gm14221 |
predicted gene 14221 |
16639 |
0.16 |
| chr6_108065537_108065904 | 1.19 |
Setmar |
SET domain without mariner transposase fusion |
658 |
0.78 |
| chr5_137740658_137741144 | 1.19 |
Nyap1 |
neuronal tyrosine-phosphorylated phosphoinositide 3-kinase adaptor 1 |
201 |
0.87 |
| chr11_106613017_106613236 | 1.18 |
Tex2 |
testis expressed gene 2 |
196 |
0.94 |
| chr4_132077386_132077728 | 1.18 |
Epb41 |
erythrocyte membrane protein band 4.1 |
2236 |
0.17 |
| chr11_116077910_116078580 | 1.18 |
Unc13d |
unc-13 homolog D |
284 |
0.82 |
| chr13_5861092_5861858 | 1.18 |
Klf6 |
Kruppel-like factor 6 |
7 |
0.97 |
| chr13_95375254_95375480 | 1.18 |
Aggf1 |
angiogenic factor with G patch and FHA domains 1 |
15 |
0.97 |
| chr12_87147895_87148076 | 1.17 |
Pomt2 |
protein-O-mannosyltransferase 2 |
17 |
0.73 |
| chr13_62558775_62559066 | 1.17 |
Zfp934 |
zinc finger protein 934 |
285 |
0.57 |
| chr7_4743413_4743709 | 1.17 |
Kmt5c |
lysine methyltransferase 5C |
817 |
0.36 |
| chr10_59346660_59346821 | 1.16 |
P4ha1 |
procollagen-proline, 2-oxoglutarate 4-dioxygenase (proline 4-hydroxylase), alpha 1 polypeptide |
23372 |
0.17 |
| chr3_105704756_105705586 | 1.16 |
Inka2 |
inka box actin regulator 2 |
287 |
0.85 |
| chr13_51849011_51849520 | 1.16 |
Gadd45g |
growth arrest and DNA-damage-inducible 45 gamma |
2521 |
0.34 |
| chr11_53794666_53795169 | 1.16 |
Gm12216 |
predicted gene 12216 |
958 |
0.43 |
| chr4_63156837_63157538 | 1.15 |
Ambp |
alpha 1 microglobulin/bikunin precursor |
2388 |
0.26 |
| chrX_73922094_73922327 | 1.15 |
Naa10 |
N(alpha)-acetyltransferase 10, NatA catalytic subunit |
266 |
0.54 |
| chr10_5823394_5824846 | 1.15 |
Mtrf1l |
mitochondrial translational release factor 1-like |
210 |
0.95 |
| chr2_24460802_24461173 | 1.14 |
Pax8 |
paired box 8 |
14110 |
0.13 |
| chr13_62383464_62383625 | 1.13 |
Gm25933 |
predicted gene, 25933 |
307 |
0.47 |
| chr2_37431309_37431486 | 1.13 |
Zbtb6 |
zinc finger and BTB domain containing 6 |
478 |
0.7 |
| chr17_12960636_12961164 | 1.13 |
Acat2 |
acetyl-Coenzyme A acetyltransferase 2 |
153 |
0.89 |
| chr4_118179467_118179867 | 1.11 |
Kdm4a |
lysine (K)-specific demethylase 4A |
13 |
0.97 |
| chr5_3596033_3596490 | 1.11 |
Rbm48 |
RNA binding motif protein 48 |
59 |
0.49 |
| chr4_109475784_109476556 | 1.11 |
Rnf11 |
ring finger protein 11 |
505 |
0.78 |
| chrX_163958587_163958808 | 1.11 |
Zrsr2 |
zinc finger (CCCH type), RNA binding motif and serine/arginine rich 2 |
36 |
0.98 |
| chr14_8244059_8244558 | 1.11 |
Acox2 |
acyl-Coenzyme A oxidase 2, branched chain |
2095 |
0.32 |
| chr16_52031362_52031649 | 1.10 |
Cblb |
Casitas B-lineage lymphoma b |
58 |
0.98 |
| chr1_59174641_59174801 | 1.10 |
Mpp4 |
membrane protein, palmitoylated 4 (MAGUK p55 subfamily member 4) |
11332 |
0.13 |
| chr2_5951282_5952030 | 1.09 |
Upf2 |
UPF2 regulator of nonsense transcripts homolog (yeast) |
187 |
0.94 |
| chr13_114387173_114387324 | 1.09 |
Ndufs4 |
NADH:ubiquinone oxidoreductase core subunit S4 |
801 |
0.64 |
| chr3_127459960_127460112 | 1.09 |
Gm44494 |
predicted gene, 44494 |
21084 |
0.1 |
| chr10_128337504_128337855 | 1.09 |
Cs |
citrate synthase |
55 |
0.92 |
| chr17_32364796_32365156 | 1.09 |
Wiz |
widely-interspaced zinc finger motifs |
513 |
0.66 |
| chr12_80103423_80104027 | 1.08 |
Zfp36l1 |
zinc finger protein 36, C3H type-like 1 |
9269 |
0.12 |
| chr2_125864448_125864599 | 1.08 |
Galk2 |
galactokinase 2 |
1584 |
0.41 |
| chr14_30265845_30266016 | 1.08 |
Gm47570 |
predicted gene, 47570 |
58192 |
0.11 |
| chr6_136856482_136856663 | 1.07 |
Art4 |
ADP-ribosyltransferase 4 |
1161 |
0.29 |
| chr16_10384617_10384821 | 1.06 |
Tekt5 |
tektin 5 |
10729 |
0.15 |
| chr13_74062231_74062742 | 1.06 |
Cep72 |
centrosomal protein 72 |
187 |
0.93 |
| chr18_54422226_54422400 | 1.06 |
Redrum |
Redrum, erythroid developmental long intergenic non-protein coding transcript |
18 |
0.99 |
| chr3_137865547_137865861 | 1.06 |
H2az1 |
H2A.Z variant histone 1 |
576 |
0.51 |
| chr13_111940877_111941182 | 1.06 |
Gm15322 |
predicted gene 15322 |
50437 |
0.1 |
| chr1_133025810_133026048 | 1.05 |
Gm29257 |
predicted gene 29257 |
128 |
0.84 |
| chr1_185362566_185363206 | 1.05 |
4930532G15Rik |
RIKEN cDNA 4930532G15 gene |
21 |
0.66 |
| chr6_113306687_113307009 | 1.05 |
Gm43935 |
predicted gene, 43935 |
174 |
0.61 |
| chr4_136035880_136036031 | 1.05 |
Rpl11 |
ribosomal protein L11 |
7157 |
0.1 |
| chr11_43681649_43682033 | 1.05 |
Pwwp2a |
PWWP domain containing 2A |
157 |
0.95 |
| chr1_183345393_183346126 | 1.04 |
Mia3 |
melanoma inhibitory activity 3 |
245 |
0.89 |
| chr12_79799402_79799702 | 1.04 |
9430078K24Rik |
RIKEN cDNA 9430078K24 gene |
125181 |
0.05 |
| chr1_155351599_155351788 | 1.04 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
32969 |
0.16 |
| chr1_131910209_131910527 | 1.04 |
Nucks1 |
nuclear casein kinase and cyclin-dependent kinase substrate 1 |
166 |
0.91 |
| chr11_5009014_5009183 | 1.04 |
Ap1b1 |
adaptor protein complex AP-1, beta 1 subunit |
376 |
0.8 |
| chr15_90224061_90224393 | 1.03 |
Alg10b |
asparagine-linked glycosylation 10B (alpha-1,2-glucosyltransferase) |
84 |
0.57 |
| chr5_73256580_73257031 | 1.03 |
Fryl |
FRY like transcription coactivator |
186 |
0.9 |
| chr15_81399216_81399860 | 1.03 |
St13 |
suppression of tumorigenicity 13 |
56 |
0.9 |
| chr19_44293374_44294099 | 1.03 |
Scd2 |
stearoyl-Coenzyme A desaturase 2 |
62 |
0.95 |
| chr7_28576380_28576555 | 1.03 |
Pak4 |
p21 (RAC1) activated kinase 4 |
8230 |
0.08 |
| chr7_16296088_16297248 | 1.03 |
Ccdc9 |
coiled-coil domain containing 9 |
9873 |
0.11 |
| chr9_99248394_99248720 | 1.02 |
Cep70 |
centrosomal protein 70 |
2270 |
0.17 |
| chr18_32542062_32542218 | 1.02 |
Gypc |
glycophorin C |
6722 |
0.21 |
| chr6_124738333_124739337 | 1.02 |
Ptpn6 |
protein tyrosine phosphatase, non-receptor type 6 |
121 |
0.85 |
| chr4_95052117_95052656 | 1.01 |
Jun |
jun proto-oncogene |
164 |
0.81 |
| chr11_87748800_87748969 | 1.01 |
Mir142hg |
Mir142 host gene (non-protein coding) |
6693 |
0.09 |
| chrX_155338350_155338776 | 1.01 |
Prdx4 |
peroxiredoxin 4 |
89 |
0.97 |
| chr16_18387405_18388258 | 1.01 |
Arvcf |
armadillo repeat gene deleted in velocardiofacial syndrome |
4752 |
0.11 |
| chr8_111056443_111056615 | 1.01 |
Exosc6 |
exosome component 6 |
190 |
0.89 |
| chr17_8283179_8283893 | 1.01 |
Mpc1 |
mitochondrial pyruvate carrier 1 |
226 |
0.89 |
| chr12_86883989_86885134 | 1.00 |
Irf2bpl |
interferon regulatory factor 2 binding protein-like |
237 |
0.93 |
| chr15_27444875_27445166 | 1.00 |
Gm36899 |
predicted gene, 36899 |
18429 |
0.16 |
| chr19_44563010_44563198 | 1.00 |
Hif1an |
hypoxia-inducible factor 1, alpha subunit inhibitor |
254 |
0.88 |
| chrX_142680720_142682167 | 1.00 |
Tmem164 |
transmembrane protein 164 |
25 |
0.98 |
| chr7_126823412_126823899 | 1.00 |
Fam57b |
family with sequence similarity 57, member B |
352 |
0.65 |
| chr7_65644408_65645427 | 1.00 |
Tarsl2 |
threonyl-tRNA synthetase-like 2 |
19 |
0.98 |
| chr1_13568940_13569143 | 1.00 |
Tram1 |
translocating chain-associating membrane protein 1 |
10757 |
0.22 |
| chr18_67724472_67725101 | 1.00 |
Ptpn2 |
protein tyrosine phosphatase, non-receptor type 2 |
191 |
0.94 |
| chr13_62908646_62908873 | 0.99 |
Fbp1 |
fructose bisphosphatase 1 |
20477 |
0.13 |
| chr2_119350987_119351528 | 0.99 |
Chac1 |
ChaC, cation transport regulator 1 |
28 |
0.97 |
| chr4_143161692_143162506 | 0.99 |
Gm13039 |
predicted gene 13039 |
4504 |
0.16 |
| chr14_69540059_69540582 | 0.99 |
Gm27174 |
predicted gene 27174 |
15012 |
0.09 |
| chr4_62525302_62525880 | 0.99 |
4933430I17Rik |
RIKEN cDNA 4933430I17 gene |
222 |
0.73 |
| chr14_69321815_69322332 | 0.99 |
Gm16677 |
predicted gene, 16677 |
15009 |
0.09 |
| chr12_12428967_12429271 | 0.99 |
4921511I17Rik |
RIKEN cDNA 4921511I17 gene |
36504 |
0.21 |
| chr15_103239260_103239668 | 0.98 |
Cbx5 |
chromobox 5 |
352 |
0.7 |
| chr7_16874715_16875380 | 0.98 |
9330104G04Rik |
RIKEN cDNA 9330104G04 gene |
161 |
0.62 |
| chr12_118301013_118301849 | 0.98 |
Sp4 |
trans-acting transcription factor 4 |
9 |
0.99 |
| chr18_4639699_4639975 | 0.97 |
Jcad |
junctional cadherin 5 associated |
4959 |
0.27 |
| chr6_34907426_34907592 | 0.97 |
Wdr91 |
WD repeat domain 91 |
3054 |
0.17 |
| chr15_36794181_36794614 | 0.97 |
Ywhaz |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, zeta polypeptide |
134 |
0.95 |
| chrX_151800680_151801589 | 0.97 |
Huwe1 |
HECT, UBA and WWE domain containing 1 |
180 |
0.93 |
| chr3_37550247_37550426 | 0.96 |
Gm12564 |
predicted gene 12564 |
6167 |
0.15 |
| chr5_140647773_140649317 | 0.96 |
Ttyh3 |
tweety family member 3 |
452 |
0.77 |
| chr11_102363647_102363997 | 0.96 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
118 |
0.93 |
| chr10_3271098_3271261 | 0.96 |
H60c |
histocompatibility 60c |
3408 |
0.23 |
| chr3_41580743_41581075 | 0.96 |
Jade1 |
jade family PHD finger 1 |
53 |
0.97 |
| chr14_12283812_12284320 | 0.95 |
Gm49355 |
predicted gene, 49355 |
90 |
0.52 |
| chr9_114399783_114399952 | 0.95 |
Glb1 |
galactosidase, beta 1 |
1209 |
0.31 |
| chr6_5297603_5298489 | 0.95 |
Pon2 |
paraoxonase 2 |
284 |
0.91 |
| chrX_108833229_108833456 | 0.95 |
2810403D21Rik |
RIKEN cDNA 2810403D21 gene |
458 |
0.71 |
| chr3_36612816_36613750 | 0.95 |
Bbs7 |
Bardet-Biedl syndrome 7 (human) |
2 |
0.97 |
| chrX_160502321_160502718 | 0.95 |
Phka2 |
phosphorylase kinase alpha 2 |
54 |
0.97 |
| chr11_75172038_75172661 | 0.94 |
1700016P03Rik |
RIKEN cDNA 1700016P03 gene |
211 |
0.79 |
| chr11_120902514_120902732 | 0.94 |
Ccdc57 |
coiled-coil domain containing 57 |
16712 |
0.11 |
| chr19_4719341_4719782 | 0.94 |
Sptbn2 |
spectrin beta, non-erythrocytic 2 |
1518 |
0.25 |
| chr19_10017720_10017964 | 0.93 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
351 |
0.8 |
| chr5_88554364_88554553 | 0.93 |
Utp3 |
UTP3 small subunit processome component |
4 |
0.97 |
| chr11_109550376_109550622 | 0.93 |
Arsg |
arylsulfatase G |
6745 |
0.17 |
| chr15_96638179_96638413 | 0.92 |
Slc38a1 |
solute carrier family 38, member 1 |
3666 |
0.25 |
| chr10_128747405_128748339 | 0.92 |
Pym1 |
PYM homolog 1, exon junction complex associated factor |
17 |
0.94 |
| chr5_109557850_109558797 | 0.92 |
Crlf2 |
cytokine receptor-like factor 2 |
613 |
0.67 |
| chr11_4543369_4543542 | 0.92 |
Mtmr3 |
myotubularin related protein 3 |
2813 |
0.24 |
| chr14_47533459_47534172 | 0.92 |
Fbxo34 |
F-box protein 34 |
7736 |
0.12 |
| chr17_13656448_13657230 | 0.92 |
2700054A10Rik |
RIKEN cDNA 2700054A10 gene |
12052 |
0.15 |
| chr13_51975759_51976556 | 0.92 |
Gm26651 |
predicted gene, 26651 |
2943 |
0.31 |
| chr11_106674335_106675138 | 0.92 |
Pecam1 |
platelet/endothelial cell adhesion molecule 1 |
11410 |
0.17 |
| chr16_58671263_58671414 | 0.91 |
Cpox |
coproporphyrinogen oxidase |
1010 |
0.43 |
| chr19_12794683_12795497 | 0.91 |
Zfp91 |
zinc finger protein 91 |
1036 |
0.3 |
| chr5_92434452_92435336 | 0.91 |
Nup54 |
nucleoporin 54 |
137 |
0.94 |
| chr2_45184417_45184579 | 0.90 |
Gm28643 |
predicted gene 28643 |
27573 |
0.2 |
| chr6_121064309_121064616 | 0.90 |
Gm4651 |
predicted gene 4651 |
2 |
0.98 |
| chr1_157039282_157039824 | 0.89 |
Gm10531 |
predicted gene 10531 |
3994 |
0.21 |
| chr11_80383806_80383984 | 0.89 |
Zfp207 |
zinc finger protein 207 |
498 |
0.77 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0097503 | sialylation(GO:0097503) |
| 0.6 | 0.6 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.6 | 1.7 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
| 0.5 | 1.5 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.5 | 2.8 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.5 | 1.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.4 | 1.3 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.4 | 1.7 | GO:0006848 | pyruvate transport(GO:0006848) |
| 0.4 | 1.7 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.4 | 1.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
| 0.4 | 1.9 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.4 | 1.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.3 | 1.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.3 | 1.0 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.3 | 1.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.3 | 1.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.3 | 1.3 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.3 | 1.0 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.3 | 0.9 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.3 | 2.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.3 | 0.9 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.3 | 0.9 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.3 | 0.9 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.3 | 1.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.3 | 1.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.3 | 1.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.3 | 0.8 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.3 | 1.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.3 | 0.8 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.3 | 0.8 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.3 | 1.3 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.3 | 0.5 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.3 | 2.3 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.2 | 1.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.2 | 1.0 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.2 | 1.0 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.2 | 1.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.2 | 0.7 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.2 | 1.0 | GO:0050904 | diapedesis(GO:0050904) |
| 0.2 | 0.7 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 0.7 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.2 | 0.9 | GO:0042546 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.2 | 1.8 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.2 | 0.7 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.2 | 1.3 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
| 0.2 | 0.9 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 | 0.2 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.2 | 0.6 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.2 | 1.9 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.2 | 0.9 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.2 | 0.8 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.2 | 1.0 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.2 | 0.6 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.2 | 0.8 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.2 | 0.6 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.2 | 0.4 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.2 | 0.6 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.2 | 0.6 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.2 | 0.8 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.2 | 1.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 | 0.8 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 0.8 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.2 | 0.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 0.6 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.2 | 1.1 | GO:1900164 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.2 | 0.6 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.2 | 0.6 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 | 1.5 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.2 | 0.4 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.2 | 0.6 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.2 | 0.4 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.2 | 0.6 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
| 0.2 | 0.2 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.2 | 0.6 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.2 | 0.7 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.2 | 0.5 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.2 | 0.9 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.2 | 1.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.2 | 0.4 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.2 | 1.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.2 | 0.9 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.2 | 0.2 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.2 | 0.5 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.2 | 0.9 | GO:0045006 | DNA deamination(GO:0045006) |
| 0.2 | 0.3 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.2 | 0.8 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.2 | 0.7 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.2 | 0.5 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.2 | 1.5 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.2 | 0.8 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.2 | 1.3 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.2 | 0.3 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.2 | 1.0 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.2 | 0.7 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.2 | 0.5 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 0.5 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.2 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.2 | 0.5 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.2 | 0.5 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.2 | 0.8 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.2 | 1.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
| 0.2 | 0.2 | GO:1902563 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.2 | 0.5 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.2 | 1.2 | GO:0010388 | cullin deneddylation(GO:0010388) |
| 0.2 | 0.9 | GO:0090042 | tubulin deacetylation(GO:0090042) |
| 0.2 | 0.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 0.5 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 | 0.4 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.9 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.4 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.4 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.9 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 | 0.9 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.7 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.6 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 4.8 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 0.3 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 1.0 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 2.9 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.1 | 0.3 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.1 | 0.6 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 0.3 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.1 | 0.4 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 1.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.1 | 0.1 | GO:0034728 | nucleosome organization(GO:0034728) |
| 0.1 | 0.4 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.1 | 0.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 2.1 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 1.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.1 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.1 | 1.6 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.4 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.1 | 0.8 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 | 0.4 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.3 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.9 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.1 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.4 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.5 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.7 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 1.4 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 0.5 | GO:0009838 | abscission(GO:0009838) |
| 0.1 | 0.4 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.1 | 0.3 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.1 | 0.8 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.4 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.5 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.1 | 0.4 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.3 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.5 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.1 | 0.4 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.4 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.1 | 0.6 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.6 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 0.7 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 0.4 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 | 0.1 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.1 | 0.5 | GO:0021590 | cerebellum maturation(GO:0021590) |
| 0.1 | 0.4 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.8 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.1 | 0.5 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.1 | 0.2 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.1 | 1.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.1 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.1 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.5 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 0.6 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 1.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 0.7 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 | 0.3 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 1.3 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
| 0.1 | 1.3 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.1 | 0.3 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.7 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.1 | 0.6 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.1 | 0.3 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.1 | 0.9 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.8 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.1 | 0.3 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.8 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.1 | 0.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.3 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.5 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.5 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.4 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.3 | GO:0097242 | beta-amyloid clearance(GO:0097242) regulation of beta-amyloid clearance(GO:1900221) |
| 0.1 | 0.4 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.1 | 0.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 0.3 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.4 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 0.1 | 0.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 0.5 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 1.1 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.1 | 0.4 | GO:0002445 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.1 | 0.8 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.5 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
| 0.1 | 0.2 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 0.5 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.1 | 0.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.2 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.3 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.6 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.8 | GO:0006983 | ER overload response(GO:0006983) |
| 0.1 | 0.6 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.1 | GO:0046655 | folic acid metabolic process(GO:0046655) |
| 0.1 | 0.7 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.1 | 0.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 1.9 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.1 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 1.1 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 | 0.4 | GO:0097460 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) |
| 0.1 | 0.2 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.1 | 0.2 | GO:0036166 | phenotypic switching(GO:0036166) |
| 0.1 | 0.3 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.4 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.1 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.3 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 0.3 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.6 | GO:0007343 | egg activation(GO:0007343) |
| 0.1 | 1.5 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.5 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.1 | 0.3 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.4 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.4 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.3 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.1 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 1.5 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 1.2 | GO:0033875 | nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:1902218 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 | 0.3 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.4 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.3 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 | 0.3 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.2 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.1 | 0.3 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.1 | 0.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 0.5 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.3 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.1 | 0.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.3 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 1.0 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.1 | 0.8 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 0.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.1 | 0.2 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.1 | 0.7 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.5 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.4 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.1 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.1 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.3 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.7 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.1 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.1 | 0.3 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.1 | 0.4 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.1 | 0.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.5 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.2 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
| 0.1 | 0.3 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.6 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.3 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 1.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.1 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
| 0.1 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.2 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 0.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.7 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.2 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.1 | 1.0 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.3 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.1 | 0.5 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.1 | 0.3 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 1.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 0.4 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
| 0.1 | 0.6 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.1 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.6 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.6 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 | 0.6 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 | 0.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.5 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.2 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.1 | 0.6 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.4 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.1 | 0.1 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.1 | 1.1 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.1 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 | 0.6 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 | 0.1 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.1 | 0.8 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.3 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 0.1 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 0.3 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 2.7 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.1 | 0.3 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.1 | 0.6 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.1 | 0.8 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.4 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.1 | 0.4 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.1 | 0.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.2 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.6 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.1 | 0.1 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 | 0.2 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 | 0.3 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.1 | 0.1 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
| 0.1 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.1 | 2.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) striated muscle atrophy(GO:0014891) |
| 0.1 | 0.1 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.1 | 0.4 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.6 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.3 | GO:0010998 | regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
| 0.1 | 0.2 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 | 1.3 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.1 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.9 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 | 0.2 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 | 0.4 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.1 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.1 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 1.1 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 0.3 | GO:0019359 | nicotinamide nucleotide biosynthetic process(GO:0019359) |
| 0.1 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.4 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.1 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 0.4 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.5 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.1 | 0.2 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.4 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.1 | 0.4 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.1 | 0.3 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 0.1 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.1 | 0.7 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.1 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 1.4 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
| 0.1 | 0.5 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.1 | 0.9 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.2 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 0.2 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.1 | 0.3 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 | 0.6 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.1 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.5 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.1 | 0.2 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.1 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 0.2 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.3 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.1 | 0.4 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.1 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 0.2 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.2 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
| 0.1 | 0.3 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.1 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
| 0.1 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.1 | 0.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.1 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) |
| 0.1 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.1 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.3 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.2 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.2 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.1 | 0.5 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.1 | 0.4 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.1 | 0.1 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
| 0.1 | 0.3 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 0.2 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.1 | 1.1 | GO:1903318 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.1 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.1 | 0.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.1 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 1.9 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.1 | 0.3 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.6 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.1 | GO:0043039 | tRNA aminoacylation(GO:0043039) |
| 0.0 | 0.2 | GO:0009651 | response to salt stress(GO:0009651) |
| 0.0 | 0.1 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.0 | 0.4 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.2 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.3 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) |
| 0.0 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.5 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 1.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.2 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
| 0.0 | 0.0 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 | 0.0 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
| 0.0 | 0.4 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 1.1 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.2 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.0 | 0.2 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.1 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.0 | 0.2 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.4 | GO:0070633 | transepithelial transport(GO:0070633) |
| 0.0 | 0.1 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.3 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.0 | 0.0 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.0 | 0.4 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.0 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.3 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.3 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 1.7 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.5 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.9 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.4 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.5 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.2 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.1 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.0 | 0.0 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
| 0.0 | 0.4 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.2 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.2 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
| 0.0 | 0.2 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.2 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.3 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.0 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.0 | 0.1 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
| 0.0 | 0.0 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.0 | 0.5 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.0 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.0 | 0.8 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.3 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.2 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.0 | 0.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.0 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.0 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.2 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 | 0.0 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.0 | 0.3 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.3 | GO:0046174 | polyol catabolic process(GO:0046174) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.0 | 0.3 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.6 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.1 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.0 | 0.3 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.4 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.3 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.3 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.0 | GO:1990774 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
| 0.0 | 0.0 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 1.6 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.1 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.2 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.0 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
| 0.0 | 0.2 | GO:0006547 | histidine metabolic process(GO:0006547) |
| 0.0 | 0.1 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.0 | 0.1 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) |
| 0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.2 | GO:0070572 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.1 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.0 | 0.0 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.0 | 1.0 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 0.0 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.0 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.0 | 0.1 | GO:0072678 | T cell migration(GO:0072678) |
| 0.0 | 0.4 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.0 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.0 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 2.0 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.2 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.5 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.1 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.0 | 0.1 | GO:0060416 | response to growth hormone(GO:0060416) |
| 0.0 | 0.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.0 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.2 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.3 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.2 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.6 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.0 | 0.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.3 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.3 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.1 | GO:0000019 | regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.3 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.0 | 0.2 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 1.1 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.1 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.2 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.1 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.0 | 1.3 | GO:0006639 | acylglycerol metabolic process(GO:0006639) |
| 0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.3 | GO:0060746 | parental behavior(GO:0060746) |
| 0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.0 | 0.1 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.1 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.0 | 0.3 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.2 | GO:0036093 | germ cell proliferation(GO:0036093) |
| 0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.8 | GO:0032434 | regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032434) |
| 0.0 | 0.4 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 1.4 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.0 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.1 | GO:0060431 | primary lung bud formation(GO:0060431) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.2 | GO:1903363 | negative regulation of cellular protein catabolic process(GO:1903363) |
| 0.0 | 0.0 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.2 | GO:0097035 | regulation of membrane lipid distribution(GO:0097035) |
| 0.0 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.0 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.0 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.0 | GO:0000050 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.0 | 0.3 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.4 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.0 | GO:1903332 | regulation of protein folding(GO:1903332) |
| 0.0 | 0.1 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.0 | 0.0 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 1.0 | GO:0016573 | histone acetylation(GO:0016573) |
| 0.0 | 1.2 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.0 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.0 | 0.5 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.0 | 0.1 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 1.0 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.0 | 0.2 | GO:0051905 | establishment of pigment granule localization(GO:0051905) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.4 | GO:0071806 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.6 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.0 | 0.0 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.1 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.0 | 0.3 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.1 | GO:0043084 | penile erection(GO:0043084) |
| 0.0 | 0.7 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.3 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.0 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 | 0.0 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.0 | 0.1 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.2 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.6 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
| 0.0 | 0.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 | 0.0 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.0 | 0.2 | GO:0007091 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
| 0.0 | 0.1 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.0 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.0 | 0.3 | GO:0007616 | long-term memory(GO:0007616) |
| 0.0 | 0.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.5 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.8 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.0 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.0 | 0.0 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.0 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.1 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.2 | GO:1900003 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.0 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.0 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 0.5 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.0 | 0.0 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.2 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.0 | 0.2 | GO:0051304 | chromosome separation(GO:0051304) |
| 0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
| 0.0 | 0.0 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.0 | 0.1 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.0 | 0.1 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.0 | 0.1 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 | 0.1 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
| 0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.0 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.1 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.2 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.2 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.0 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) |
| 0.0 | 0.1 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.0 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
| 0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 | 0.0 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
| 0.0 | 0.0 | GO:0070474 | regulation of uterine smooth muscle contraction(GO:0070472) positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.0 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.9 | GO:0006909 | phagocytosis(GO:0006909) |
| 0.0 | 0.4 | GO:0051058 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 | 0.0 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.0 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.0 | 0.0 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.0 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.3 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.0 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.3 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.2 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.0 | 0.1 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.0 | 0.0 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.0 | 0.0 | GO:0071616 | thioester biosynthetic process(GO:0035384) acyl-CoA biosynthetic process(GO:0071616) |
| 0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.0 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.3 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.0 | GO:0038066 | p38MAPK cascade(GO:0038066) |
| 0.0 | 0.2 | GO:0061136 | regulation of proteasomal protein catabolic process(GO:0061136) |
| 0.0 | 0.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.6 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.0 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.2 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.0 | 0.4 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.0 | GO:0051917 | regulation of fibrinolysis(GO:0051917) |
| 0.0 | 0.0 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 | 0.7 | GO:0002687 | positive regulation of leukocyte migration(GO:0002687) |
| 0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.1 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.1 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.0 | 0.0 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.5 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 0.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.0 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.0 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.1 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.0 | 0.2 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
| 0.0 | 0.0 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 | 0.0 | GO:0032400 | melanosome localization(GO:0032400) |
| 0.0 | 0.0 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
| 0.0 | 0.1 | GO:0071426 | ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.0 | 0.0 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.0 | 0.1 | GO:0051351 | positive regulation of ligase activity(GO:0051351) |
| 0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.0 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
| 0.0 | 0.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.3 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 | 0.0 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
| 0.0 | 0.1 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.0 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
| 0.0 | 0.2 | GO:0003341 | cilium movement(GO:0003341) |
| 0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.0 | 0.1 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 | 0.1 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.0 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.0 | 0.1 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:0070646 | protein modification by small protein removal(GO:0070646) |
| 0.0 | 0.0 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
| 0.0 | 0.0 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 0.1 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.0 | 0.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.1 | GO:0033013 | tetrapyrrole metabolic process(GO:0033013) |
| 0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.0 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.0 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.0 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.0 | 0.3 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.0 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.3 | 2.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.3 | 1.9 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 1.4 | GO:0089701 | U2AF(GO:0089701) |
| 0.3 | 1.0 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.3 | 0.3 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.3 | 4.3 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.2 | 0.9 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.2 | 0.9 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.2 | 0.9 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.2 | 0.7 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.2 | 1.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.2 | 4.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.2 | 0.6 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 0.8 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.2 | 1.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.2 | 1.5 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.2 | 0.5 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.2 | 0.7 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.2 | 0.9 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 0.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 0.9 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 0.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 0.8 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.2 | 0.5 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 1.7 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 0.6 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.2 | 1.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.2 | 0.8 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.4 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.1 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 1.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 1.6 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 1.0 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 1.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 1.0 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.4 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.8 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.5 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.6 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.7 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.5 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.3 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.1 | 0.5 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.7 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.1 | 0.7 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.1 | 1.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 1.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.3 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.1 | 0.8 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 0.6 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.5 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.4 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 2.1 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.6 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 1.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 1.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 0.9 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.4 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.3 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.1 | 0.9 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.6 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.1 | 0.6 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.6 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 1.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.9 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 1.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.7 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.5 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 1.4 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 0.3 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.1 | 1.5 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 0.4 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 3.3 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.8 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.1 | 3.2 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 1.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 1.9 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.1 | 2.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.3 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.2 | GO:0071010 | prespliceosome(GO:0071010) |
| 0.1 | 0.9 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.1 | 1.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.2 | GO:1990462 | omegasome(GO:1990462) |
| 0.1 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.1 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.8 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 0.8 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 0.5 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 1.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.5 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 0.2 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.9 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.5 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.1 | 2.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.2 | GO:0000805 | X chromosome(GO:0000805) |
| 0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.4 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 0.4 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.1 | 1.0 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 1.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 1.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 2.1 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 3.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.5 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.4 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.8 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 1.8 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.7 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 4.2 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.2 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 1.1 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 1.1 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 5.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.5 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.5 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.6 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.3 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.0 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 1.9 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 1.6 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.9 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 1.4 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.7 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 7.4 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 2.0 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 1.9 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.3 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
| 0.0 | 0.4 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.4 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
| 0.0 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.5 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.0 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.0 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.0 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.4 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.5 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.0 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.0 | 1.6 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.6 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 2.1 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.6 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.2 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.0 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 1.7 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0038201 | TOR complex(GO:0038201) |
| 0.0 | 0.2 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.1 | GO:0042581 | specific granule(GO:0042581) |
| 0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 1.4 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 2.0 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.0 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.0 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.0 | 0.0 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.0 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0030894 | replisome(GO:0030894) |
| 0.0 | 0.4 | GO:0030286 | dynein complex(GO:0030286) |
| 0.0 | 0.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.0 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 0.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.1 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 1.5 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 0.2 | GO:0044452 | nucleolar part(GO:0044452) |
| 0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.0 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.4 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.0 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.5 | 2.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.4 | 1.3 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.4 | 1.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.4 | 1.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 3.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.4 | 1.7 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.4 | 1.6 | GO:0032564 | dATP binding(GO:0032564) |
| 0.4 | 1.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.4 | 0.4 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.4 | 1.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.4 | 0.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.4 | 1.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.4 | 1.8 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.3 | 1.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.3 | 1.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.3 | 1.6 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.3 | 1.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.3 | 0.9 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.3 | 0.9 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.3 | 1.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.3 | 1.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.3 | 0.8 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.3 | 1.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.3 | 0.8 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.3 | 0.8 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.2 | 0.7 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.2 | 1.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.2 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.2 | 0.7 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.2 | 0.9 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.2 | 0.2 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.2 | 0.6 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.2 | 1.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 0.6 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.2 | 0.6 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.2 | 1.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.2 | 1.4 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.2 | 0.6 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 0.6 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.2 | 1.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.2 | 0.8 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.2 | 0.8 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.2 | 1.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.2 | 0.8 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.2 | 0.4 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.2 | 0.6 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.2 | 1.7 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.2 | 0.4 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.2 | 0.7 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.2 | 0.7 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 0.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 0.8 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.2 | 0.7 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 0.2 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.2 | 0.5 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.2 | 0.6 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.2 | 0.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 0.9 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.2 | 0.9 | GO:0043559 | insulin binding(GO:0043559) |
| 0.2 | 0.5 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.2 | 0.5 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.2 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.2 | 0.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.2 | 0.5 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.6 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.7 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 0.7 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.1 | 1.0 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 3.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 1.1 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.4 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.1 | 0.3 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.1 | 0.1 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.1 | 0.4 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 2.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.5 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.1 | 0.4 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.1 | 0.5 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.6 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.1 | 0.4 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 1.7 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 1.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.1 | 0.4 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.1 | 0.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.5 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 0.6 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.3 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.1 | 0.5 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 0.9 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.3 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.5 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.3 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 0.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 1.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.8 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.4 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 0.4 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.1 | 0.3 | GO:0046428 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.1 | 0.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
| 0.1 | 1.4 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 0.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 2.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 0.6 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.5 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.7 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.9 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.4 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 1.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.1 | 0.6 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 2.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 2.9 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.4 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.3 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 1.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.3 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 0.9 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.5 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 1.0 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 1.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.1 | 0.5 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.1 | 0.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.1 | 1.0 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 1.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.1 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.7 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 1.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.1 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 1.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.6 | GO:0034784 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
| 0.1 | 0.8 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 0.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.1 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.1 | 0.2 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 1.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.1 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 0.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.1 | 0.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 0.8 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.4 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 2.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.4 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.6 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.1 | 0.6 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.5 | GO:0016208 | AMP binding(GO:0016208) |
| 0.1 | 0.1 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
| 0.1 | 0.9 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 2.1 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 0.2 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.1 | 1.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 1.0 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 1.4 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.1 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 1.9 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.1 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 2.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 0.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 0.3 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 1.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.5 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.5 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.1 | 0.7 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.6 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 1.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.5 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.2 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
| 0.1 | 0.3 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.1 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.2 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.1 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.4 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.2 | GO:0043830 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.0 | 0.9 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.0 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 2.1 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.6 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 0.2 | GO:1901474 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
| 0.0 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.0 | 0.6 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 1.5 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 2.5 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 1.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 1.0 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.5 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.0 | 0.4 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 1.3 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.0 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.0 | 1.5 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.5 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 8.5 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.4 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 1.6 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.0 | 0.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.1 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.9 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.5 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 1.1 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 1.0 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.3 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 2.9 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
| 0.0 | 0.5 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.5 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.0 | 1.1 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.0 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.8 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 1.5 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 1.9 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.2 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.6 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.2 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 1.4 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.3 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.0 | 0.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.5 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.3 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.0 | 0.6 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.5 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.3 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.5 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.4 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.5 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.6 | GO:0050661 | NADP binding(GO:0050661) |
| 0.0 | 0.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 5.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.9 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.3 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.0 | 0.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
| 0.0 | 0.4 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 1.4 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.1 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.3 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.0 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.0 | 0.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.0 | 0.1 | GO:0060590 | ATPase regulator activity(GO:0060590) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 1.1 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.0 | 0.1 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.0 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.2 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.1 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.1 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.0 | 0.6 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.0 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.5 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.0 | GO:0016801 | hydrolase activity, acting on ether bonds(GO:0016801) ether hydrolase activity(GO:0016803) |
| 0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.2 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
| 0.0 | 0.1 | GO:0034847 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.0 | 0.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.0 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.0 | 0.0 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.0 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.8 | GO:0015405 | primary active transmembrane transporter activity(GO:0015399) P-P-bond-hydrolysis-driven transmembrane transporter activity(GO:0015405) |
| 0.0 | 0.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.0 | 0.9 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.5 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.0 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.5 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 0.0 | 0.0 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.6 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.0 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.2 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.0 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.1 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.1 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.0 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.0 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.0 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.0 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.0 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.0 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.0 | 0.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 0.4 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.2 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.2 | 1.6 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.2 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.2 | 0.5 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.2 | 4.5 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.2 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 0.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 3.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 2.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.7 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 2.5 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.8 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 2.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 2.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 0.9 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 1.6 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 1.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 1.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 0.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 3.1 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 1.9 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.1 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 0.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 0.8 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 2.1 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 0.9 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 0.6 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 1.6 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 1.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.1 | 0.7 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 1.8 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 2.0 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 2.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 2.7 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 0.6 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 1.7 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 1.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.2 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 1.1 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 1.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.7 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.7 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 1.2 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 1.1 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.7 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.3 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.2 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.2 | 3.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.2 | 1.7 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.2 | 2.7 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 1.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 5.0 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.2 | 2.4 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.2 | 2.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 0.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 0.8 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 2.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 0.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 1.0 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 0.4 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.1 | 1.8 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 1.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 2.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 1.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.4 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.1 | 2.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 2.8 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 1.4 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 0.8 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 1.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.0 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 4.4 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 2.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 0.9 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 1.8 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.1 | 1.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 1.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 0.7 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 1.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 0.8 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 0.5 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.1 | 0.6 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 0.4 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 0.8 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 3.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 1.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.0 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 4.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 1.4 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 0.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 1.7 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 0.8 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.1 | 1.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 1.2 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 0.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 0.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 0.5 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.1 | 1.6 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 1.4 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 0.6 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.1 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 0.4 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 0.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 2.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.9 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 1.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 1.0 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.2 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.1 | 4.5 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 0.9 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 0.7 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.1 | 0.6 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 2.2 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.5 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.9 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.5 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 2.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 1.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.5 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.5 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.4 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.0 | 0.2 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.0 | 0.0 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
| 0.0 | 0.3 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.0 | 0.8 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.1 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.4 | REACTOME SIGNALING BY NOTCH | Genes involved in Signaling by NOTCH |
| 0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.3 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.2 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.3 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
| 0.0 | 1.7 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.9 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.1 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 0.0 | 0.0 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
| 0.0 | 0.5 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.1 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.0 | 0.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 2.2 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.1 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.0 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.2 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.0 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 0.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.9 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
| 0.0 | 0.7 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.0 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.3 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.2 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.1 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.0 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
| 0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.1 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.0 | REACTOME TCA CYCLE AND RESPIRATORY ELECTRON TRANSPORT | Genes involved in The citric acid (TCA) cycle and respiratory electron transport |