| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Tbx19
|
ENSMUSG00000026572.5 | Tbx19 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Tbx19 | mm10_chr1_164796613_164796764 | -0.68 | 1.0e-08 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr1_160409781_160409971 | 10.10 |
Rabgap1l |
RAB GTPase activating protein 1-like |
31991 |
0.16 |
| chr6_146220158_146220350 | 4.11 |
Itpr2 |
inositol 1,4,5-triphosphate receptor 2 |
7289 |
0.26 |
| chr4_75213011_75213603 | 3.76 |
Dmac1 |
distal membrane arm assembly complex 1 |
64998 |
0.1 |
| chr5_27873604_27873982 | 3.59 |
Gm5551 |
predicted gene 5551 |
13344 |
0.15 |
| chr13_76017514_76017682 | 3.34 |
Rfesd |
Rieske (Fe-S) domain containing |
870 |
0.47 |
| chr4_93481257_93481600 | 3.24 |
Gm23443 |
predicted gene, 23443 |
63849 |
0.13 |
| chr5_5134242_5134421 | 3.11 |
Gm43623 |
predicted gene 43623 |
5776 |
0.2 |
| chr14_97395839_97396042 | 2.95 |
Gm23276 |
predicted gene, 23276 |
59308 |
0.16 |
| chr9_5526127_5526279 | 2.93 |
Casp12 |
caspase 12 |
180699 |
0.03 |
| chr14_122323757_122324119 | 2.86 |
Gm25464 |
predicted gene, 25464 |
64222 |
0.09 |
| chr3_51230204_51230396 | 2.79 |
Gm38357 |
predicted gene, 38357 |
1617 |
0.3 |
| chr9_95542600_95542778 | 2.72 |
Gm32281 |
predicted gene, 32281 |
11808 |
0.13 |
| chr1_58739583_58739773 | 2.67 |
Cflar |
CASP8 and FADD-like apoptosis regulator |
9126 |
0.14 |
| chr18_77819086_77819244 | 2.60 |
F830208F22Rik |
RIKEN cDNA F830208F22 gene |
22422 |
0.14 |
| chr2_180889406_180890514 | 2.56 |
Gm14342 |
predicted gene 14342 |
300 |
0.8 |
| chr10_108710601_108710798 | 2.50 |
Gm5136 |
predicted gene 5136 |
10539 |
0.26 |
| chr16_49840220_49840396 | 2.49 |
Cd47 |
CD47 antigen (Rh-related antigen, integrin-associated signal transducer) |
15058 |
0.25 |
| chr1_9541341_9541515 | 2.46 |
Rrs1 |
ribosome biogenesis regulator 1 |
3980 |
0.16 |
| chr6_10969635_10970167 | 2.45 |
AA545190 |
EST AA545190 |
4477 |
0.3 |
| chr2_22029338_22029851 | 2.44 |
Gm13337 |
predicted gene 13337 |
38232 |
0.22 |
| chr17_61606845_61606996 | 2.38 |
Gm4518 |
predicted gene 4518 |
174712 |
0.03 |
| chr9_78105526_78105687 | 2.37 |
Fbxo9 |
f-box protein 9 |
2981 |
0.16 |
| chr3_60546035_60546186 | 2.34 |
Gm37589 |
predicted gene, 37589 |
10359 |
0.21 |
| chr2_90870868_90871019 | 2.33 |
Mtch2 |
mitochondrial carrier 2 |
7484 |
0.11 |
| chr2_105284895_105285179 | 2.28 |
Them7 |
thioesterase superfamily member 7 |
60695 |
0.12 |
| chr13_107577239_107577601 | 2.26 |
Gm32004 |
predicted gene, 32004 |
12089 |
0.22 |
| chr14_75749184_75749337 | 2.26 |
Gm24876 |
predicted gene, 24876 |
3320 |
0.2 |
| chr9_102235369_102235971 | 2.25 |
Gm37260 |
predicted gene, 37260 |
38066 |
0.14 |
| chr10_47263117_47263268 | 2.24 |
Gm19137 |
predicted gene, 19137 |
47383 |
0.17 |
| chr17_81031924_81032142 | 2.23 |
Thumpd2 |
THUMP domain containing 2 |
33034 |
0.2 |
| chr6_56905110_56905280 | 2.21 |
Gm3793 |
predicted gene 3793 |
1387 |
0.31 |
| chr16_75904152_75904303 | 2.19 |
Samsn1 |
SAM domain, SH3 domain and nuclear localization signals, 1 |
5052 |
0.28 |
| chr3_152749933_152750118 | 2.16 |
Pigk |
phosphatidylinositol glycan anchor biosynthesis, class K |
11763 |
0.2 |
| chr10_59800856_59801208 | 2.16 |
Gm17059 |
predicted gene 17059 |
778 |
0.56 |
| chr2_174450714_174450865 | 2.13 |
Tubb1 |
tubulin, beta 1 class VI |
94 |
0.94 |
| chr6_41703076_41703251 | 2.13 |
Kel |
Kell blood group |
1176 |
0.36 |
| chr12_29527021_29527799 | 2.12 |
Myt1l |
myelin transcription factor 1-like |
974 |
0.61 |
| chr13_67525535_67526312 | 2.07 |
Zfp87 |
zinc finger protein 87 |
198 |
0.51 |
| chr14_17556598_17556749 | 2.07 |
Thrb |
thyroid hormone receptor beta |
103588 |
0.08 |
| chr13_81628689_81629170 | 2.07 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
4210 |
0.23 |
| chr1_13574156_13574379 | 2.06 |
Tram1 |
translocating chain-associating membrane protein 1 |
5531 |
0.24 |
| chr8_22390855_22391028 | 2.03 |
Slc25a15 |
solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 |
7603 |
0.11 |
| chr2_77506335_77506678 | 2.03 |
Zfp385b |
zinc finger protein 385B |
13029 |
0.24 |
| chr15_36640888_36641046 | 2.01 |
Gm6704 |
predicted gene 6704 |
11098 |
0.13 |
| chr2_145299951_145300122 | 1.99 |
Gm14093 |
predicted gene 14093 |
37612 |
0.17 |
| chr3_42895880_42896104 | 1.99 |
Gm38044 |
predicted gene, 38044 |
310393 |
0.01 |
| chr18_30197602_30197916 | 1.99 |
Gm49980 |
predicted gene, 49980 |
69490 |
0.12 |
| chr3_153794768_153794969 | 1.98 |
5730460C07Rik |
RIKEN cDNA 5730460C07 gene |
2781 |
0.17 |
| chr6_5154894_5155087 | 1.97 |
Pon1 |
paraoxonase 1 |
38773 |
0.14 |
| chr2_6331309_6331868 | 1.97 |
AL845275.1 |
novel protein |
8508 |
0.19 |
| chr6_58642798_58642958 | 1.96 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
2296 |
0.35 |
| chr6_118758618_118758929 | 1.95 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
799 |
0.74 |
| chr8_77294707_77294858 | 1.93 |
4933421D24Rik |
RIKEN cDNA 4933421D24 gene |
10751 |
0.18 |
| chr9_103504692_103504887 | 1.93 |
Tmem108 |
transmembrane protein 108 |
11178 |
0.11 |
| chr11_107965416_107965870 | 1.92 |
Prkca |
protein kinase C, alpha |
13996 |
0.15 |
| chr6_120579566_120580923 | 1.91 |
Gm44124 |
predicted gene, 44124 |
68 |
0.96 |
| chr5_103737592_103737761 | 1.91 |
Aff1 |
AF4/FMR2 family, member 1 |
16486 |
0.19 |
| chr6_60934969_60935379 | 1.89 |
Mmrn1 |
multimerin 1 |
9302 |
0.22 |
| chr5_83623080_83623231 | 1.89 |
Gm25765 |
predicted gene, 25765 |
25799 |
0.22 |
| chr10_38357833_38358251 | 1.89 |
Gm48197 |
predicted gene, 48197 |
44196 |
0.17 |
| chr9_12690275_12690474 | 1.89 |
Gm25365 |
predicted gene, 25365 |
89791 |
0.09 |
| chr12_12877548_12878341 | 1.88 |
Gm48187 |
predicted gene, 48187 |
12374 |
0.14 |
| chr8_99631118_99631288 | 1.86 |
Gm8688 |
predicted gene 8688 |
32816 |
0.23 |
| chr11_79069807_79070128 | 1.85 |
Ksr1 |
kinase suppressor of ras 1 |
4519 |
0.24 |
| chr16_56719342_56719540 | 1.84 |
Tfg |
Trk-fused gene |
1991 |
0.37 |
| chr12_87122330_87122504 | 1.84 |
Pomt2 |
protein-O-mannosyltransferase 2 |
2445 |
0.17 |
| chr13_84638647_84638885 | 1.84 |
Gm26913 |
predicted gene, 26913 |
52175 |
0.18 |
| chr7_97210418_97210570 | 1.82 |
Usp35 |
ubiquitin specific peptidase 35 |
104531 |
0.06 |
| chr16_58661948_58662241 | 1.82 |
Gm49701 |
predicted gene, 49701 |
6850 |
0.13 |
| chr6_32796194_32796358 | 1.81 |
Chchd3 |
coiled-coil-helix-coiled-coil-helix domain containing 3 |
7716 |
0.27 |
| chr2_8628513_8628745 | 1.81 |
Gm13255 |
predicted gene 13255 |
5308 |
0.36 |
| chr3_134490072_134490247 | 1.80 |
4930539C22Rik |
RIKEN cDNA 4930539C22 gene |
66524 |
0.12 |
| chr7_63958631_63958886 | 1.79 |
Gm45052 |
predicted gene 45052 |
3482 |
0.17 |
| chr11_114335861_114336155 | 1.79 |
Gm11692 |
predicted gene 11692 |
21121 |
0.21 |
| chr6_86077601_86077785 | 1.79 |
Add2 |
adducin 2 (beta) |
364 |
0.81 |
| chr3_66326110_66326323 | 1.79 |
Veph1 |
ventricular zone expressed PH domain-containing 1 |
29379 |
0.18 |
| chr13_21418936_21419108 | 1.78 |
Gm50481 |
predicted gene, 50481 |
6971 |
0.07 |
| chr10_41205578_41205924 | 1.77 |
Gm25526 |
predicted gene, 25526 |
10294 |
0.2 |
| chr13_12544248_12544520 | 1.77 |
Gm30239 |
predicted gene, 30239 |
984 |
0.46 |
| chr13_29371351_29371690 | 1.77 |
Cdkal1 |
CDK5 regulatory subunit associated protein 1-like 1 |
103087 |
0.08 |
| chr13_83984413_83984945 | 1.77 |
Gm4241 |
predicted gene 4241 |
3312 |
0.25 |
| chr2_149768940_149769091 | 1.77 |
Gm14130 |
predicted gene 14130 |
25840 |
0.17 |
| chr1_41605098_41605443 | 1.76 |
Gm28634 |
predicted gene 28634 |
75727 |
0.12 |
| chr3_134490270_134490421 | 1.75 |
4930539C22Rik |
RIKEN cDNA 4930539C22 gene |
66710 |
0.11 |
| chr11_87729251_87729412 | 1.74 |
Rnf43 |
ring finger protein 43 |
43 |
0.95 |
| chr5_77806307_77806485 | 1.74 |
Gm42673 |
predicted gene 42673 |
103064 |
0.07 |
| chr10_52877516_52878175 | 1.73 |
Gm25664 |
predicted gene, 25664 |
27793 |
0.18 |
| chr15_73606895_73607071 | 1.73 |
Slc45a4 |
solute carrier family 45, member 4 |
1516 |
0.39 |
| chr11_32158171_32158538 | 1.73 |
Gm12109 |
predicted gene 12109 |
26651 |
0.12 |
| chr3_26835054_26835226 | 1.72 |
Gm37659 |
predicted gene, 37659 |
177624 |
0.03 |
| chr13_79698330_79698512 | 1.72 |
Gm48471 |
predicted gene, 48471 |
139656 |
0.05 |
| chr2_43862548_43862699 | 1.71 |
Arhgap15 |
Rho GTPase activating protein 15 |
113753 |
0.07 |
| chr5_22262595_22262780 | 1.70 |
Gm16113 |
predicted gene 16113 |
18895 |
0.17 |
| chr16_58525942_58526108 | 1.70 |
St3gal6 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 6 |
1782 |
0.34 |
| chr3_132917467_132917619 | 1.69 |
Npnt |
nephronectin |
11184 |
0.16 |
| chr2_10080725_10081192 | 1.68 |
Kin |
Kin17 DNA and RNA binding protein |
334 |
0.55 |
| chr2_15121171_15121404 | 1.67 |
Gm13313 |
predicted gene 13313 |
6313 |
0.21 |
| chr8_6604352_6604691 | 1.67 |
Gm44844 |
predicted gene 44844 |
166777 |
0.04 |
| chr17_50031938_50032350 | 1.67 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
59317 |
0.1 |
| chr2_5700991_5701268 | 1.66 |
Camk1d |
calcium/calmodulin-dependent protein kinase ID |
13374 |
0.24 |
| chr13_3537575_3537894 | 1.66 |
Gdi2 |
guanosine diphosphate (GDP) dissociation inhibitor 2 |
329 |
0.86 |
| chr9_113858274_113858431 | 1.66 |
Clasp2 |
CLIP associating protein 2 |
45752 |
0.14 |
| chr11_20987831_20988009 | 1.66 |
Gm23681 |
predicted gene, 23681 |
50219 |
0.13 |
| chr14_34718229_34718383 | 1.65 |
Wapl |
WAPL cohesin release factor |
7684 |
0.15 |
| chr1_23834961_23835181 | 1.64 |
Smap1 |
small ArfGAP 1 |
12706 |
0.26 |
| chr4_101657062_101657258 | 1.64 |
Leprot |
leptin receptor overlapping transcript |
9367 |
0.23 |
| chr16_35098238_35098389 | 1.63 |
Hacd2 |
3-hydroxyacyl-CoA dehydratase 2 |
49698 |
0.12 |
| chr19_32272552_32272859 | 1.63 |
Sgms1 |
sphingomyelin synthase 1 |
4221 |
0.28 |
| chr15_34824497_34824736 | 1.62 |
Gm48932 |
predicted gene, 48932 |
1813 |
0.39 |
| chr11_12231499_12232054 | 1.62 |
Gm12002 |
predicted gene 12002 |
82738 |
0.09 |
| chr6_28754227_28754378 | 1.62 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
10388 |
0.22 |
| chr19_40769316_40769607 | 1.62 |
Cc2d2b |
coiled-coil and C2 domain containing 2B |
4909 |
0.21 |
| chr4_70482030_70482181 | 1.62 |
Megf9 |
multiple EGF-like-domains 9 |
52823 |
0.16 |
| chr5_8893257_8893830 | 1.61 |
Abcb4 |
ATP-binding cassette, sub-family B (MDR/TAP), member 4 |
174 |
0.94 |
| chr1_82374350_82374501 | 1.61 |
Gm19552 |
predicted gene, 19552 |
22208 |
0.14 |
| chr16_94698779_94699042 | 1.61 |
Gm41504 |
predicted gene, 41504 |
14993 |
0.17 |
| chr12_105016395_105016591 | 1.60 |
Gm47648 |
predicted gene, 47648 |
4866 |
0.11 |
| chr9_60876635_60876806 | 1.60 |
Uaca |
uveal autoantigen with coiled-coil domains and ankyrin repeats |
10575 |
0.19 |
| chr2_118963721_118963890 | 1.60 |
Gm14089 |
predicted gene 14089 |
33263 |
0.1 |
| chr16_41729236_41729556 | 1.59 |
Lsamp |
limbic system-associated membrane protein |
195977 |
0.03 |
| chr2_123364225_123364551 | 1.59 |
Gm13988 |
predicted gene 13988 |
90464 |
0.1 |
| chrX_10010308_10010474 | 1.59 |
Gm5754 |
predicted gene 5754 |
1397 |
0.54 |
| chr9_53705535_53706804 | 1.59 |
Rab39 |
RAB39, member RAS oncogene family |
63 |
0.96 |
| chr5_50128978_50129261 | 1.59 |
4930448I18Rik |
RIKEN cDNA 4930448I18 gene |
22214 |
0.2 |
| chr16_72088914_72089089 | 1.59 |
8030451O07Rik |
RIKEN cDNA 8030451O07 gene |
145301 |
0.04 |
| chr19_60710175_60710335 | 1.58 |
Nanos1 |
nanos C2HC-type zinc finger 1 |
45732 |
0.1 |
| chr6_22834709_22835019 | 1.58 |
Gm43629 |
predicted gene 43629 |
29535 |
0.14 |
| chr6_102900468_102900719 | 1.58 |
Gm44429 |
predicted gene, 44429 |
36945 |
0.18 |
| chr11_33772584_33772816 | 1.58 |
Gm12120 |
predicted gene 12120 |
67150 |
0.1 |
| chr9_94610676_94610827 | 1.57 |
Gm39404 |
predicted gene, 39404 |
18555 |
0.17 |
| chr3_149385507_149385665 | 1.57 |
Gm26468 |
predicted gene, 26468 |
44578 |
0.15 |
| chr3_69054847_69055016 | 1.57 |
Trim59 |
tripartite motif-containing 59 |
10176 |
0.12 |
| chr6_108454125_108454276 | 1.56 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
4503 |
0.21 |
| chr5_103741831_103742104 | 1.55 |
Aff1 |
AF4/FMR2 family, member 1 |
12195 |
0.2 |
| chr13_83382943_83383094 | 1.55 |
Mef2c |
myocyte enhancer factor 2C |
121016 |
0.06 |
| chr11_26594630_26594781 | 1.55 |
Vrk2 |
vaccinia related kinase 2 |
706 |
0.63 |
| chr8_117855235_117855386 | 1.55 |
Gm10617 |
predicted gene 10617 |
53248 |
0.12 |
| chr5_49150518_49150704 | 1.54 |
Gm42770 |
predicted gene 42770 |
21870 |
0.13 |
| chr9_102193238_102193748 | 1.54 |
Gm37945 |
predicted gene, 37945 |
20755 |
0.17 |
| chr8_126176385_126176536 | 1.54 |
Slc35f3 |
solute carrier family 35, member F3 |
37078 |
0.2 |
| chr16_93365247_93365596 | 1.54 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
31 |
0.97 |
| chr8_83623647_83623831 | 1.54 |
Dnajb1 |
DnaJ heat shock protein family (Hsp40) member B1 |
15186 |
0.09 |
| chr11_64931191_64931357 | 1.53 |
Elac2 |
elaC ribonuclease Z 2 |
47764 |
0.15 |
| chr12_31966543_31966864 | 1.53 |
Hbp1 |
high mobility group box transcription factor 1 |
16168 |
0.19 |
| chr4_44519102_44519253 | 1.53 |
Mir5120 |
microRNA 5120 |
88391 |
0.07 |
| chr14_118657372_118657526 | 1.52 |
Abcc4 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 4 |
19482 |
0.18 |
| chr2_57523169_57523407 | 1.52 |
Gm13531 |
predicted gene 13531 |
97579 |
0.07 |
| chr14_24578363_24578849 | 1.52 |
4930542C16Rik |
RIKEN cDNA 4930542C16 gene |
38698 |
0.14 |
| chr5_10417082_10417233 | 1.52 |
Gm17091 |
predicted gene 17091 |
120128 |
0.05 |
| chr14_16200927_16201541 | 1.51 |
Rpl31-ps3 |
ribosomal protein L31, pseudogene 3 |
23789 |
0.13 |
| chr13_23596067_23596263 | 1.51 |
H4c4 |
H4 clustered histone 4 |
14567 |
0.04 |
| chr14_17558474_17558625 | 1.50 |
Thrb |
thyroid hormone receptor beta |
101712 |
0.08 |
| chr10_115818034_115818185 | 1.50 |
Tspan8 |
tetraspanin 8 |
825 |
0.72 |
| chr9_14354961_14355127 | 1.50 |
Gm47326 |
predicted gene, 47326 |
19432 |
0.11 |
| chr8_86712768_86712970 | 1.50 |
Gm10638 |
predicted gene 10638 |
32584 |
0.12 |
| chr15_66559165_66559336 | 1.49 |
Tmem71 |
transmembrane protein 71 |
1853 |
0.37 |
| chr1_128016065_128016406 | 1.49 |
Zranb3 |
zinc finger, RAN-binding domain containing 3 |
2458 |
0.22 |
| chr6_135166144_135166455 | 1.49 |
Hebp1 |
heme binding protein 1 |
1836 |
0.21 |
| chr3_137943749_137943976 | 1.49 |
Dapp1 |
dual adaptor for phosphotyrosine and 3-phosphoinositides 1 |
10851 |
0.1 |
| chr2_32116110_32116272 | 1.48 |
Plpp7 |
phospholipid phosphatase 7 (inactive) |
20036 |
0.1 |
| chr5_90987721_90988058 | 1.48 |
Epgn |
epithelial mitogen |
39575 |
0.11 |
| chr12_17425646_17425797 | 1.48 |
Gm36752 |
predicted gene, 36752 |
10897 |
0.19 |
| chr11_44469603_44469912 | 1.46 |
Ublcp1 |
ubiquitin-like domain containing CTD phosphatase 1 |
741 |
0.4 |
| chr7_120969343_120969499 | 1.46 |
Cdr2 |
cerebellar degeneration-related 2 |
12369 |
0.1 |
| chr9_108047898_108048075 | 1.46 |
Gmppb |
GDP-mannose pyrophosphorylase B |
1256 |
0.18 |
| chr1_179844917_179845212 | 1.45 |
Ahctf1 |
AT hook containing transcription factor 1 |
41384 |
0.14 |
| chr15_66826569_66826794 | 1.45 |
Sla |
src-like adaptor |
4965 |
0.22 |
| chr6_6871537_6871723 | 1.44 |
Dlx6os1 |
distal-less homeobox 6, opposite strand 1 |
38 |
0.96 |
| chr5_100638641_100638903 | 1.44 |
Coq2 |
coenzyme Q2 4-hydroxybenzoate polyprenyltransferase |
25647 |
0.12 |
| chr12_33311111_33311262 | 1.44 |
Atxn7l1 |
ataxin 7-like 1 |
3091 |
0.28 |
| chr4_41470461_41470625 | 1.43 |
Nudt2 |
nudix (nucleoside diphosphate linked moiety X)-type motif 2 |
5392 |
0.12 |
| chr9_95784959_95785110 | 1.43 |
Pls1 |
plastin 1 (I-isoform) |
30372 |
0.13 |
| chr8_90391775_90391981 | 1.43 |
Tox3 |
TOX high mobility group box family member 3 |
43535 |
0.2 |
| chr15_9114613_9115328 | 1.42 |
Nadk2 |
NAD kinase 2, mitochondrial |
11982 |
0.18 |
| chr11_26481973_26482124 | 1.42 |
Fancl |
Fanconi anemia, complementation group L |
13713 |
0.23 |
| chr5_78622077_78622228 | 1.42 |
Gm43232 |
predicted gene 43232 |
81624 |
0.11 |
| chr7_51815722_51815935 | 1.41 |
Gm45001 |
predicted gene 45001 |
34476 |
0.12 |
| chr3_97610137_97610322 | 1.41 |
Chd1l |
chromodomain helicase DNA binding protein 1-like |
26 |
0.81 |
| chr12_102058274_102058594 | 1.41 |
Slc24a4 |
solute carrier family 24 (sodium/potassium/calcium exchanger), member 4 |
70299 |
0.08 |
| chr15_98108351_98109101 | 1.41 |
Pfkm |
phosphofructokinase, muscle |
260 |
0.87 |
| chr12_49381565_49382180 | 1.41 |
Gm34304 |
predicted gene, 34304 |
13 |
0.93 |
| chr8_105305345_105306455 | 1.40 |
Elmo3 |
engulfment and cell motility 3 |
257 |
0.72 |
| chr6_12336720_12336871 | 1.40 |
Thsd7a |
thrombospondin, type I, domain containing 7A |
12102 |
0.3 |
| chr3_88832410_88832792 | 1.40 |
1500004A13Rik |
RIKEN cDNA 1500004A13 gene |
54 |
0.95 |
| chr2_133688238_133688389 | 1.39 |
Gm25258 |
predicted gene, 25258 |
103892 |
0.07 |
| chr8_71728606_71728807 | 1.39 |
Fcho1 |
FCH domain only 1 |
2990 |
0.13 |
| chr7_46422711_46423348 | 1.39 |
Kcnc1 |
potassium voltage gated channel, Shaw-related subfamily, member 1 |
349 |
0.86 |
| chr13_101551869_101552068 | 1.39 |
Gm41043 |
predicted gene, 41043 |
3816 |
0.2 |
| chr14_75365484_75365635 | 1.39 |
Zc3h13 |
zinc finger CCCH type containing 13 |
27487 |
0.16 |
| chr14_8223629_8223803 | 1.38 |
Kctd6 |
potassium channel tetramerisation domain containing 6 |
9214 |
0.18 |
| chr2_166701479_166701697 | 1.38 |
Prex1 |
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
2006 |
0.35 |
| chr3_26851001_26851285 | 1.38 |
Gm37659 |
predicted gene, 37659 |
161621 |
0.03 |
| chr16_8686443_8686800 | 1.38 |
Gm5767 |
predicted gene 5767 |
3791 |
0.15 |
| chr2_22774246_22774443 | 1.37 |
Apbb1ip |
amyloid beta (A4) precursor protein-binding, family B, member 1 interacting protein |
46 |
0.97 |
| chr1_176949345_176949641 | 1.37 |
Gm15423 |
predicted gene 15423 |
16782 |
0.13 |
| chr17_83684505_83684810 | 1.37 |
Mta3 |
metastasis associated 3 |
21506 |
0.21 |
| chr6_77847776_77847938 | 1.36 |
Gm44437 |
predicted gene, 44437 |
98075 |
0.07 |
| chr11_79054559_79054722 | 1.36 |
Ksr1 |
kinase suppressor of ras 1 |
2987 |
0.27 |
| chr4_122835628_122835863 | 1.35 |
Ppt1 |
palmitoyl-protein thioesterase 1 |
497 |
0.78 |
| chr7_19563668_19563906 | 1.35 |
Ppp1r37 |
protein phosphatase 1, regulatory subunit 37 |
711 |
0.46 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.5 | 1.6 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.4 | 1.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.4 | 1.8 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.4 | 1.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.3 | 1.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.3 | 0.9 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.3 | 1.2 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.3 | 1.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.3 | 1.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.3 | 1.2 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.3 | 1.4 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.3 | 0.8 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
| 0.3 | 1.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.2 | 1.0 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.2 | 1.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.2 | 0.9 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.2 | 0.5 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 0.7 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 0.4 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.2 | 0.7 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 | 0.8 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.2 | 0.6 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.2 | 0.6 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.2 | 0.6 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 0.8 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 1.0 | GO:0046618 | drug export(GO:0046618) |
| 0.2 | 0.6 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.2 | 0.6 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.2 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.2 | 0.9 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.2 | 0.7 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.2 | 0.5 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.2 | 0.5 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.2 | 0.7 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.2 | 0.5 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.2 | 0.5 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.2 | 0.5 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
| 0.2 | 0.7 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.2 | 0.6 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.2 | 0.6 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.2 | 0.8 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.7 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.7 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.6 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.1 | 0.1 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 1.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.9 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.7 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 0.4 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.3 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 | 0.4 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.1 | 0.7 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.4 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 0.5 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.3 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.1 | 0.1 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
| 0.1 | 0.4 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.4 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 0.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 | 2.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 1.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.1 | 0.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.4 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.2 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.1 | 1.6 | GO:0030449 | regulation of complement activation(GO:0030449) |
| 0.1 | 0.7 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 1.0 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 0.9 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.6 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.5 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.1 | 1.0 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.9 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.5 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.8 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.1 | 0.5 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 | 0.1 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.4 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.3 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.1 | 0.6 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.5 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.4 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.3 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.1 | 0.6 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.3 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 0.3 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.5 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 | 0.2 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.1 | 1.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.1 | 0.3 | GO:0033026 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.1 | 0.6 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.3 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.1 | 0.7 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.6 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.6 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.1 | 0.8 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 | 0.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.2 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.1 | 0.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 2.3 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.1 | 0.4 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.1 | 0.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.3 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 0.5 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 0.1 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
| 0.1 | 0.4 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.1 | 0.6 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.4 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.1 | 0.4 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.3 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 0.4 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 | 0.3 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.3 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.4 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.1 | 1.3 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.3 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.4 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.1 | 0.5 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.7 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.1 | 0.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.5 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.1 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 1.0 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 1.5 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.4 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.4 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.2 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.1 | 0.2 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 0.3 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.1 | 0.5 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.2 | GO:0006227 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.6 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
| 0.1 | 0.6 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 1.3 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 1.2 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.1 | 0.9 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.3 | GO:0006056 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.1 | 0.4 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.3 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.1 | 1.6 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 1.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.2 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.1 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.4 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.1 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.1 | 0.2 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.7 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 1.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.6 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.4 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.7 | GO:0007614 | short-term memory(GO:0007614) |
| 0.1 | 0.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.2 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.1 | 0.2 | GO:1902837 | amino acid import into cell(GO:1902837) |
| 0.1 | 0.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 0.1 | GO:0050655 | dermatan sulfate metabolic process(GO:0030205) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.1 | 0.4 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.1 | 0.2 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.9 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.3 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.4 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.3 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 1.0 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.2 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 0.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 1.1 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.1 | 0.3 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.1 | 0.5 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.1 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.1 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
| 0.1 | 0.3 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 | 0.3 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.7 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.1 | 0.6 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.1 | 0.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.4 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.1 | 0.2 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.2 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.0 | 0.0 | GO:0003130 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 0.0 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.0 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.0 | 0.0 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.0 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.0 | 0.2 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) single-organism membrane invagination(GO:1902534) |
| 0.0 | 0.3 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
| 0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.0 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.6 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.0 | 0.4 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.2 | GO:2000774 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.0 | 0.1 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.0 | 0.5 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
| 0.0 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.0 | 0.0 | GO:1903367 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
| 0.0 | 0.1 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) |
| 0.0 | 0.2 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.4 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.1 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.0 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.0 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
| 0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.2 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.0 | 0.0 | GO:1901256 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
| 0.0 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.3 | GO:0003352 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.1 | GO:0071218 | response to misfolded protein(GO:0051788) cellular response to misfolded protein(GO:0071218) |
| 0.0 | 0.1 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.0 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 1.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.3 | GO:0060717 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
| 0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.7 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.2 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.5 | GO:0043574 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.3 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.2 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.3 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 1.2 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.0 | 0.3 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
| 0.0 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.2 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
| 0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 1.0 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.0 | 0.1 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.0 | 0.8 | GO:0007099 | centriole replication(GO:0007099) |
| 0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.0 | 0.3 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.6 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.0 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.0 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.0 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.0 | 0.1 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.2 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.0 | 0.4 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.2 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.0 | 0.2 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.4 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.2 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.5 | GO:0048753 | pigment granule organization(GO:0048753) |
| 0.0 | 0.0 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.4 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.0 | 0.0 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.4 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.0 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
| 0.0 | 0.4 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.3 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.1 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.2 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.1 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
| 0.0 | 0.1 | GO:0032513 | regulation of protein phosphatase type 2B activity(GO:0032512) negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.0 | 1.7 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.1 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.0 | 0.3 | GO:1900004 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.3 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.3 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.0 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.1 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.4 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.0 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.4 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.0 | 0.1 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.0 | 0.5 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.0 | 0.6 | GO:0030431 | sleep(GO:0030431) |
| 0.0 | 1.4 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 0.2 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 | 0.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.3 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.2 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 | 0.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.1 | GO:0010042 | response to manganese ion(GO:0010042) |
| 0.0 | 0.7 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.3 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.0 | 0.3 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.1 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.0 | 0.2 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.2 | GO:0032402 | establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) |
| 0.0 | 0.2 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.2 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.0 | 0.2 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
| 0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.0 | GO:0072309 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.5 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.0 | 0.2 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.1 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
| 0.0 | 0.1 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.0 | 0.2 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.0 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
| 0.0 | 0.0 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.1 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.0 | 0.2 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.0 | 0.1 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.9 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.4 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.0 | 0.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.0 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.0 | 0.1 | GO:0032049 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.2 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.0 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.0 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
| 0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 | 0.1 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.0 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.0 | 0.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.3 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 1.9 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.6 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.6 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.0 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.2 | GO:0002931 | response to ischemia(GO:0002931) |
| 0.0 | 0.4 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
| 0.0 | 0.2 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
| 0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.0 | 0.0 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.2 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 | 0.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 0.1 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 | 0.1 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.0 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.8 | GO:0001541 | ovarian follicle development(GO:0001541) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.0 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 | 0.1 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 0.2 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
| 0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.0 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.2 | GO:0042026 | protein refolding(GO:0042026) |
| 0.0 | 0.2 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
| 0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.0 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.3 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.4 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.3 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.2 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 | 0.2 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.3 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.0 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.1 | GO:0009651 | response to salt stress(GO:0009651) |
| 0.0 | 0.4 | GO:0051966 | regulation of synaptic transmission, glutamatergic(GO:0051966) |
| 0.0 | 0.0 | GO:2000319 | regulation of T-helper 17 cell differentiation(GO:2000319) positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.2 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.7 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.1 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.3 | GO:0010737 | protein kinase A signaling(GO:0010737) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.0 | 0.0 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.4 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.0 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 | 0.0 | GO:0045423 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.0 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.0 | GO:0035826 | rubidium ion transport(GO:0035826) |
| 0.0 | 0.0 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.0 | 0.0 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.0 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.0 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.3 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
| 0.0 | 0.0 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
| 0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
| 0.0 | 0.4 | GO:0008206 | bile acid metabolic process(GO:0008206) |
| 0.0 | 0.0 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 1.9 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.7 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.1 | GO:1900040 | regulation of interleukin-2 secretion(GO:1900040) |
| 0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.0 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.1 | GO:0098926 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 0.0 | GO:0048840 | otolith development(GO:0048840) |
| 0.0 | 0.0 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.0 | 0.1 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 | 0.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.0 | 0.1 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.2 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.1 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.0 | 0.0 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 0.0 | 0.1 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.0 | 0.1 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.0 | 0.0 | GO:0033083 | regulation of immature T cell proliferation(GO:0033083) |
| 0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.0 | 0.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 0.2 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
| 0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.0 | 0.2 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.0 | 0.0 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.0 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 | 0.0 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.3 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.0 | 0.0 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.0 | 0.9 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.4 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.0 | 0.1 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 0.2 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.0 | GO:0045404 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.0 | 0.0 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.0 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 0.0 | 0.0 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.0 | 0.2 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.1 | GO:0097012 | response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.2 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.0 | 0.2 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.0 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.0 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.2 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.0 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.3 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.1 | GO:0046148 | pigment biosynthetic process(GO:0046148) |
| 0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.0 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.0 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.0 | 0.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.2 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 0.0 | 0.0 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.0 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 0.1 | GO:0043687 | post-translational protein modification(GO:0043687) |
| 0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.4 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.0 | 0.1 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
| 0.0 | 0.0 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.0 | 0.0 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.0 | 0.0 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.0 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.0 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.0 | 0.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.0 | 0.4 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.0 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.0 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.0 | GO:0006882 | cellular zinc ion homeostasis(GO:0006882) |
| 0.0 | 0.0 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.0 | 0.0 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.1 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
| 0.0 | 0.0 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.0 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.1 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.1 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.0 | 0.1 | GO:0006241 | CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) pyrimidine ribonucleotide biosynthetic process(GO:0009220) CTP metabolic process(GO:0046036) pyrimidine ribonucleoside biosynthetic process(GO:0046132) |
| 0.0 | 0.0 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.0 | 0.0 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.1 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
| 0.0 | 0.0 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.0 | 0.8 | GO:0006457 | protein folding(GO:0006457) |
| 0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.2 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 | 0.0 | GO:0016068 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.0 | GO:0070197 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.5 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.0 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.0 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.0 | 0.0 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.0 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.3 | 1.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.3 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
| 0.3 | 1.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.2 | 1.0 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.2 | 1.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 1.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 0.7 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.2 | 0.7 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.2 | 1.8 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 0.9 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.2 | 0.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.2 | 1.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.2 | 0.6 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.2 | 0.8 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 1.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.1 | 0.7 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 1.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 0.7 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.5 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 1.6 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.9 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 0.6 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.1 | 1.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 1.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 0.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.1 | 0.4 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 1.7 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 0.7 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 1.9 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.5 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.3 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.4 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 0.7 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 1.0 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.3 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.1 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 0.3 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.7 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.6 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 0.9 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.2 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.4 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.1 | 0.3 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.1 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 1.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 2.3 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 1.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.5 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.6 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 0.6 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.7 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.4 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.4 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.9 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.6 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.3 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 2.1 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.0 | GO:1903349 | extrinsic component of omegasome membrane(GO:0097629) omegasome membrane(GO:1903349) |
| 0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.3 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.3 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.0 | 0.8 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.6 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 2.1 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.1 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.0 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.6 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 2.1 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
| 0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.0 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.2 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 1.6 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.1 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 1.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.9 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.8 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.8 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.0 | 0.0 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 1.7 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.5 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 0.0 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.3 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.0 | 0.7 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.3 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 1.0 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.2 | GO:0030135 | coated vesicle(GO:0030135) |
| 0.0 | 0.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.6 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 0.2 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.0 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.0 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 1.0 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.9 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.2 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.0 | 0.0 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.5 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.6 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.0 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.0 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.0 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.0 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.7 | 2.0 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.4 | 2.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.4 | 1.3 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.4 | 1.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.4 | 1.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.3 | 0.9 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.3 | 0.3 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.2 | 0.7 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.2 | 0.5 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.2 | 1.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.2 | 0.7 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 0.9 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.2 | 0.8 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.2 | 1.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 1.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 0.7 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.2 | 2.7 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.2 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.2 | 0.5 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.2 | 0.5 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.2 | 1.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.2 | 0.7 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.2 | 0.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.2 | 0.8 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.2 | 0.8 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.4 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.1 | 1.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 0.5 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.7 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 0.9 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.6 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.1 | 0.6 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 1.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 1.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.6 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.8 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.1 | 0.2 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.1 | 0.9 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.1 | 1.0 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.8 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.1 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.7 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 0.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.5 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.1 | 0.3 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.1 | 0.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 1.5 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.5 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.1 | 0.3 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.5 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.1 | 0.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.1 | 0.9 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| 0.1 | 0.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.4 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 0.7 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.1 | 0.6 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.1 | 0.3 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 0.3 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.1 | 0.6 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.4 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.8 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.1 | 0.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.4 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.3 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.4 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 0.5 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.3 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.1 | 1.0 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.5 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.3 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.2 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.9 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.7 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.1 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.2 | GO:0019002 | GMP binding(GO:0019002) |
| 0.1 | 2.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.8 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.1 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.1 | 0.2 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.5 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 0.8 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 1.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.1 | 0.5 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 0.2 | GO:0043176 | amine binding(GO:0043176) |
| 0.1 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 0.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 0.2 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.1 | 0.5 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 0.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.8 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.1 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.3 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 1.3 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.0 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
| 0.0 | 0.3 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.4 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.0 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.5 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.2 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 1.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.6 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.4 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 1.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.6 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 0.0 | 1.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.8 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.5 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.6 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 1.2 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.6 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.5 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 1.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.2 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.6 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.3 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.0 | 0.4 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.4 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.5 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.7 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.3 | GO:0034576 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.0 | 0.6 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.8 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 0.2 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.2 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.0 | 0.3 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.5 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 1.2 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.2 | GO:0060229 | lipase activator activity(GO:0060229) |
| 0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.0 | 0.1 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.0 | 0.6 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.2 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.5 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.8 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.8 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.2 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.0 | 0.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.2 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 1.1 | GO:0005496 | steroid binding(GO:0005496) |
| 0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.8 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 0.2 | GO:0034522 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.0 | 0.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
| 0.0 | 0.0 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.0 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.2 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.4 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.4 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.2 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.8 | GO:0043765 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
| 0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.9 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.0 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.7 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.0 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.0 | 0.3 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.2 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.0 | 1.2 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.1 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.0 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 2.5 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 1.4 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.4 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.2 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.2 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.0 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.1 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.1 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 2.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.3 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.7 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.7 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.0 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.1 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.0 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 1.0 | GO:0020037 | heme binding(GO:0020037) |
| 0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.0 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.0 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.0 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.4 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.0 | 0.2 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.0 | 0.0 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 1.4 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.1 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 1.1 | GO:0004386 | helicase activity(GO:0004386) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 0.1 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 1.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 1.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 1.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 1.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 3.1 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.1 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 0.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 2.2 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.9 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.7 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 1.2 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.4 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 2.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.7 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.6 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 1.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.2 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.5 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.3 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.0 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.2 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.1 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.1 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.8 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.2 | 3.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 1.4 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.2 | 1.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 1.2 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 1.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 0.9 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 1.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 1.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 0.9 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 1.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 1.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 1.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 1.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.3 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 0.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 1.7 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 1.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.1 | 0.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 0.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 0.6 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 1.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 2.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 0.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 0.6 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 1.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 2.1 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.7 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.5 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 1.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 1.8 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 1.3 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.6 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.4 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.4 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.2 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.2 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.0 | 0.2 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.0 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.0 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.5 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.3 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.2 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
| 0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.2 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.5 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 1.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.4 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.1 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.3 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.7 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.3 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.6 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.3 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.0 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 0.0 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.0 | 0.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |